change UI to UI.WinForms
This commit is contained in:
@@ -1,10 +0,0 @@
|
||||
namespace Pilz.UI.Controls.ConfigurationManager;
|
||||
|
||||
public class ConfigurationEntry(string name, string title, ConfigurationValueListener Listener)
|
||||
{
|
||||
public event EventHandler? OnValueChanged;
|
||||
|
||||
public string Name { get; } = name;
|
||||
public string Title { get; } = title;
|
||||
public ConfigurationValueListener Listener { get; } = Listener;
|
||||
}
|
||||
@@ -1,20 +0,0 @@
|
||||
namespace Pilz.UI.Controls.ConfigurationManager;
|
||||
|
||||
public class ConfigurationManager
|
||||
{
|
||||
private readonly List<ConfigurationPanel> panels = [];
|
||||
|
||||
public void Register(ConfigurationPanel panel)
|
||||
{
|
||||
panels.Add(panel);
|
||||
}
|
||||
|
||||
public IEnumerable<Control> Build()
|
||||
{
|
||||
foreach (var panel in panels)
|
||||
{
|
||||
panel.Build(this);
|
||||
yield return panel;
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,33 +0,0 @@
|
||||
namespace Pilz.UI.Controls.ConfigurationManager;
|
||||
|
||||
public class ConfigurationPanel : TableLayoutPanel
|
||||
{
|
||||
private readonly List<ConfigurationEntry> entries = [];
|
||||
|
||||
public ConfigurationEntry CreateEntry(string name, string title)
|
||||
{
|
||||
return CreateEntry(name, title, null);
|
||||
}
|
||||
|
||||
public ConfigurationEntry CreateEntry(string name, string title, Action? create)
|
||||
{
|
||||
throw new NotImplementedException();
|
||||
//return CreateEntry(new(name, title, ));
|
||||
}
|
||||
|
||||
public ConfigurationEntry CreateEntry(ConfigurationEntry entry)
|
||||
{
|
||||
entries.Add(entry);
|
||||
return entry;
|
||||
}
|
||||
|
||||
internal protected void Build(ConfigurationManager manager)
|
||||
{
|
||||
foreach (var entry in entries)
|
||||
{
|
||||
//var control = ;
|
||||
//entry.Listener.Initialize();
|
||||
// ...
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,15 +0,0 @@
|
||||
namespace Pilz.UI.Controls.ConfigurationManager;
|
||||
|
||||
public abstract class ConfigurationValueListener : IDisposable
|
||||
{
|
||||
public event EventHandler? ValueChanged;
|
||||
|
||||
protected virtual void OnValueChanged(object sender, EventArgs e)
|
||||
{
|
||||
ValueChanged?.Invoke(sender, e);
|
||||
}
|
||||
|
||||
internal protected abstract void Initialize(Control control);
|
||||
|
||||
public abstract void Dispose();
|
||||
}
|
||||
@@ -1,76 +0,0 @@
|
||||
namespace Pilz.UI.Dialogs;
|
||||
|
||||
partial class DialogBase
|
||||
{
|
||||
public delegate void DialogLoadingEventHandler(DialogLoadingEventArgs e);
|
||||
public delegate void DialogClosedEventHandler(DialogClosedEventArgs e);
|
||||
|
||||
public static event DialogLoadingEventHandler? DialogLoading;
|
||||
public static event DialogClosedEventHandler? DialogClosed;
|
||||
|
||||
public static T Show<T>(string title, Icon icon, object? tag = null) where T : FlyoutBase
|
||||
{
|
||||
return Show<T>(null, title, icon, tag);
|
||||
}
|
||||
|
||||
public static T ShowDialog<T>(string title, Icon icon, object? tag = null) where T : FlyoutBase
|
||||
{
|
||||
return ShowDialog<T>(null, title, icon, tag);
|
||||
}
|
||||
|
||||
public static T Show<T>(IWin32Window? parent, string title, Icon icon, object? tag = null) where T : FlyoutBase
|
||||
{
|
||||
return Show(CreatePanelInstance<T>(tag), parent, title, icon);
|
||||
}
|
||||
|
||||
public static T ShowDialog<T>(IWin32Window? parent, string title, Icon icon, object? tag = null) where T : FlyoutBase
|
||||
{
|
||||
return ShowDialog(CreatePanelInstance<T>(tag), parent, title, icon);
|
||||
}
|
||||
|
||||
public static T Show<T>(T dialogPanel, string title, Icon icon) where T : FlyoutBase
|
||||
{
|
||||
return Show(dialogPanel, null, title, icon);
|
||||
}
|
||||
|
||||
public static T ShowDialog<T>(T dialogPanel, string title, Icon icon) where T : FlyoutBase
|
||||
{
|
||||
return ShowDialog(dialogPanel, null, title, icon);
|
||||
}
|
||||
|
||||
public static T Show<T>(T dialogPanel, IWin32Window? parent, string title, Icon icon) where T : FlyoutBase
|
||||
{
|
||||
CreateForm(dialogPanel, parent, title, icon).Show();
|
||||
return dialogPanel;
|
||||
}
|
||||
|
||||
public static T ShowDialog<T>(T dialogPanel, IWin32Window? parent, string title, Icon icon) where T : FlyoutBase
|
||||
{
|
||||
CreateForm(dialogPanel, parent, title, icon).ShowDialog();
|
||||
return dialogPanel;
|
||||
}
|
||||
|
||||
private static T CreatePanelInstance<T>(object? tag) where T : FlyoutBase
|
||||
{
|
||||
T dialogPanel = Activator.CreateInstance<T>();
|
||||
dialogPanel.Tag = tag;
|
||||
return dialogPanel;
|
||||
}
|
||||
|
||||
private static DialogBase CreateForm<T>(T dialogPanel, IWin32Window? parent, string title, Icon icon) where T : FlyoutBase
|
||||
{
|
||||
dialogPanel.Dock = DockStyle.Fill;
|
||||
|
||||
var dialog = new DialogBase(dialogPanel)
|
||||
{
|
||||
Text = title,
|
||||
Icon = icon,
|
||||
StartPosition = parent == null ? FormStartPosition.CenterScreen : FormStartPosition.CenterParent,
|
||||
ClientSize = dialogPanel.Size
|
||||
};
|
||||
|
||||
dialog.Controls.Add(dialogPanel);
|
||||
|
||||
return dialog;
|
||||
}
|
||||
}
|
||||
@@ -1,32 +0,0 @@
|
||||
namespace Pilz.UI.Dialogs;
|
||||
|
||||
public partial class DialogBase : Form
|
||||
{
|
||||
public FlyoutBase? DialogPanel { get; private set; }
|
||||
|
||||
private DialogBase()
|
||||
{
|
||||
Load += DialogBaseForm_Load;
|
||||
FormClosed += DialogBaseForm_FormClosed;
|
||||
}
|
||||
|
||||
public DialogBase(FlyoutBase? dialogPanel) : this()
|
||||
{
|
||||
DialogPanel = dialogPanel;
|
||||
}
|
||||
|
||||
private void DialogBaseForm_Load(object? sender, EventArgs e)
|
||||
{
|
||||
if (DialogPanel is ILoadContent iLoadContent)
|
||||
iLoadContent.LoadContent();
|
||||
else if (DialogPanel is ILoadContentAsync iLoadContentAsync)
|
||||
Task.Run(iLoadContentAsync.LoadContentAsync).Wait();
|
||||
|
||||
DialogLoading?.Invoke(new DialogLoadingEventArgs(this));
|
||||
}
|
||||
|
||||
private void DialogBaseForm_FormClosed(object? sender, FormClosedEventArgs e)
|
||||
{
|
||||
DialogClosed?.Invoke(new DialogClosedEventArgs(this));
|
||||
}
|
||||
}
|
||||
@@ -1,7 +0,0 @@
|
||||
namespace Pilz.UI.Dialogs;
|
||||
|
||||
public class DialogClosedEventArgs(DialogBase dialog) : EventArgs
|
||||
{
|
||||
public DialogBase Parent { get; } = dialog;
|
||||
public FlyoutBase? Content => Parent?.DialogPanel;
|
||||
}
|
||||
@@ -1,7 +0,0 @@
|
||||
namespace Pilz.UI.Dialogs;
|
||||
|
||||
public class DialogLoadingEventArgs(DialogBase dialog) : EventArgs
|
||||
{
|
||||
public DialogBase Parent { get; } = dialog;
|
||||
public FlyoutBase? Content => Parent?.DialogPanel;
|
||||
}
|
||||
@@ -1,222 +0,0 @@
|
||||
using System.ComponentModel;
|
||||
using System.Diagnostics.CodeAnalysis;
|
||||
|
||||
namespace Pilz.UI.Dialogs;
|
||||
|
||||
public partial class FlyoutBase : UserControl
|
||||
{
|
||||
private bool addedControlsToUi;
|
||||
|
||||
protected TableLayoutPanel tableLayoutPanel_TitlePanel;
|
||||
protected Label label_Title;
|
||||
protected TableLayoutPanel tableLayoutPanel_ActionPanel;
|
||||
protected Button button_Cancel;
|
||||
protected Button button_Accept;
|
||||
|
||||
[ReadOnly(true)]
|
||||
public DialogResult Result { get; protected set; }
|
||||
|
||||
[DefaultValue(true)]
|
||||
public bool RegisterDialogAccept { get; set; } = true;
|
||||
|
||||
[DefaultValue(true)]
|
||||
public bool RegisterDialogCancel { get; set; } = true;
|
||||
|
||||
[DefaultValue(true)]
|
||||
public bool ActionPanelVisible
|
||||
{
|
||||
get => tableLayoutPanel_ActionPanel.Visible;
|
||||
set => tableLayoutPanel_ActionPanel.Visible = value;
|
||||
}
|
||||
|
||||
[DefaultValue(true)]
|
||||
public bool CancelButtonVisible
|
||||
{
|
||||
get => button_Cancel.Visible;
|
||||
set => button_Cancel.Visible = value;
|
||||
}
|
||||
|
||||
[DefaultValue(true)]
|
||||
public bool CancelButtonEnable
|
||||
{
|
||||
get => button_Cancel.Enabled;
|
||||
set => button_Cancel.Enabled = value;
|
||||
}
|
||||
|
||||
[DefaultValue(true)]
|
||||
public bool ConfirmButtonEnable
|
||||
{
|
||||
get => button_Accept.Enabled;
|
||||
set => button_Accept.Enabled = value;
|
||||
}
|
||||
|
||||
[Localizable(true)]
|
||||
[DefaultValue("Okay")]
|
||||
public string ConfirmButtonText
|
||||
{
|
||||
get => button_Accept.Text;
|
||||
set => button_Accept.Text = value;
|
||||
}
|
||||
|
||||
[Localizable(true)]
|
||||
[DefaultValue("Cancel")]
|
||||
public string CancelButtonText
|
||||
{
|
||||
get => button_Cancel.Text;
|
||||
set => button_Cancel.Text = value;
|
||||
}
|
||||
|
||||
[Localizable(true)]
|
||||
[DefaultValue("")]
|
||||
public string Title
|
||||
{
|
||||
get => label_Title.Text;
|
||||
set
|
||||
{
|
||||
label_Title.Text = value;
|
||||
SetShowTitlePanel();
|
||||
}
|
||||
}
|
||||
|
||||
public FlyoutBase()
|
||||
{
|
||||
InitializeComponent();
|
||||
ParentChanged += FlyoutBase_ParentChanged;
|
||||
}
|
||||
|
||||
private void InitializeComponent()
|
||||
{
|
||||
// button_Accept
|
||||
button_Accept = new Button
|
||||
{
|
||||
Name = "button_Accept",
|
||||
Size = new Size(75, 23),
|
||||
TabIndex = int.MaxValue - 1,
|
||||
Text = "Accept",
|
||||
UseVisualStyleBackColor = true
|
||||
};
|
||||
button_Accept.Click += Button_Accept_Click;
|
||||
|
||||
// button_Cancel
|
||||
button_Cancel = new Button
|
||||
{
|
||||
Name = "button_Cancel",
|
||||
Size = new Size(75, 23),
|
||||
TabIndex = int.MaxValue,
|
||||
Text = "Cancel",
|
||||
UseVisualStyleBackColor = true
|
||||
};
|
||||
button_Cancel.Click += Button_Cancel_Click;
|
||||
|
||||
// label_Title
|
||||
label_Title = new Label
|
||||
{
|
||||
Name = "label_Title",
|
||||
Dock = DockStyle.Fill,
|
||||
TextAlign = ContentAlignment.MiddleLeft
|
||||
};
|
||||
|
||||
// tableLayoutPanel_TitlePanel
|
||||
tableLayoutPanel_TitlePanel = new TableLayoutPanel
|
||||
{
|
||||
Name = "tableLayoutPanel_TitlePanel",
|
||||
Dock = DockStyle.Top,
|
||||
Size = new Size(ClientSize.Width, 29),
|
||||
Visible = false,
|
||||
ColumnCount = 1,
|
||||
RowCount = 1
|
||||
};
|
||||
tableLayoutPanel_TitlePanel.SuspendLayout();
|
||||
tableLayoutPanel_TitlePanel.ColumnStyles.Add(new ColumnStyle(SizeType.Percent, 50F));
|
||||
tableLayoutPanel_TitlePanel.RowStyles.Add(new RowStyle(SizeType.Percent, 50F));
|
||||
tableLayoutPanel_TitlePanel.Controls.Add(label_Title, 0, 0);
|
||||
|
||||
// tableLayoutPanel_ActionPanel
|
||||
tableLayoutPanel_ActionPanel = new TableLayoutPanel
|
||||
{
|
||||
Name = "tableLayoutPanel_ActionPanel",
|
||||
AutoSize = true,
|
||||
AutoSizeMode = AutoSizeMode.GrowAndShrink,
|
||||
Dock = DockStyle.Bottom,
|
||||
Size = new Size(ClientSize.Width, 29),
|
||||
ColumnCount = 3,
|
||||
RowCount = 1
|
||||
};
|
||||
tableLayoutPanel_ActionPanel.SuspendLayout();
|
||||
tableLayoutPanel_ActionPanel.ColumnStyles.Add(new ColumnStyle(SizeType.Percent, 100F));
|
||||
tableLayoutPanel_ActionPanel.ColumnStyles.Add(new ColumnStyle());
|
||||
tableLayoutPanel_ActionPanel.ColumnStyles.Add(new ColumnStyle());
|
||||
tableLayoutPanel_ActionPanel.RowStyles.Add(new RowStyle());
|
||||
tableLayoutPanel_ActionPanel.Controls.Add(button_Cancel, 2, 0);
|
||||
tableLayoutPanel_ActionPanel.Controls.Add(button_Accept, 1, 0);
|
||||
|
||||
// FlyoutBase
|
||||
AutoScaleDimensions = new SizeF(7F, 15F);
|
||||
AutoScaleMode = AutoScaleMode.Font;
|
||||
Size = new Size(300, 150);
|
||||
|
||||
tableLayoutPanel_TitlePanel.ResumeLayout(false);
|
||||
tableLayoutPanel_ActionPanel.ResumeLayout(false);
|
||||
}
|
||||
|
||||
protected override void OnLoad(EventArgs e)
|
||||
{
|
||||
if (!addedControlsToUi && !DesignMode)
|
||||
{
|
||||
SuspendLayout();
|
||||
Controls.Add(tableLayoutPanel_ActionPanel);
|
||||
tableLayoutPanel_ActionPanel.SendToBack();
|
||||
Controls.Add(tableLayoutPanel_TitlePanel);
|
||||
tableLayoutPanel_TitlePanel.SendToBack();
|
||||
ResumeLayout(false);
|
||||
PerformLayout();
|
||||
addedControlsToUi = true;
|
||||
}
|
||||
base.OnLoad(e);
|
||||
}
|
||||
|
||||
private void FlyoutBase_ParentChanged(object sender, EventArgs e)
|
||||
{
|
||||
var frm = FindForm();
|
||||
if (frm != null)
|
||||
{
|
||||
if (RegisterDialogAccept)
|
||||
frm.AcceptButton = button_Accept;
|
||||
|
||||
if (RegisterDialogCancel)
|
||||
{
|
||||
frm.CancelButton = button_Cancel;
|
||||
button_Cancel.DialogResult = DialogResult.None;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
protected void Close(DialogResult result)
|
||||
{
|
||||
Result = result;
|
||||
|
||||
if (FindForm() is DialogBase dialogForm)
|
||||
dialogForm.Close();
|
||||
}
|
||||
|
||||
protected virtual bool ValidateOK()
|
||||
{
|
||||
return true;
|
||||
}
|
||||
|
||||
protected virtual void SetShowTitlePanel()
|
||||
{
|
||||
tableLayoutPanel_TitlePanel.Visible = !string.IsNullOrWhiteSpace(label_Title.Text);
|
||||
}
|
||||
|
||||
protected virtual void Button_Accept_Click(object sender, EventArgs e)
|
||||
{
|
||||
if (ValidateOK())
|
||||
Close(DialogResult.OK);
|
||||
}
|
||||
|
||||
protected virtual void Button_Cancel_Click(object sender, EventArgs e)
|
||||
{
|
||||
Close(DialogResult.Cancel);
|
||||
}
|
||||
}
|
||||
@@ -1,252 +0,0 @@
|
||||
using System.Drawing;
|
||||
using System.Drawing.Drawing2D;
|
||||
|
||||
namespace Pilz.UI;
|
||||
|
||||
public class DisplayHelp
|
||||
{
|
||||
public static void FillRectangle(Graphics g, Rectangle bounds, Color color1)
|
||||
{
|
||||
FillRectangle(g, bounds, color1, Color.Empty, 90);
|
||||
}
|
||||
|
||||
public static void FillRectangle(Graphics g, Rectangle bounds, Color color1, Color color2)
|
||||
{
|
||||
FillRectangle(g, bounds, color1, color2, 90);
|
||||
}
|
||||
|
||||
public static void FillRectangle(Graphics g, Rectangle r, Color color1, Color color2, int gradientAngle)
|
||||
{
|
||||
if (r.Width == 0 || r.Height == 0)
|
||||
return;
|
||||
|
||||
if (color2.IsEmpty)
|
||||
{
|
||||
if (!color1.IsEmpty)
|
||||
{
|
||||
var sm = g.SmoothingMode;
|
||||
g.SmoothingMode = SmoothingMode.None;
|
||||
|
||||
using var brush = new SolidBrush(color1);
|
||||
g.FillRectangle(brush, r);
|
||||
|
||||
g.SmoothingMode = sm;
|
||||
}
|
||||
}
|
||||
else
|
||||
{
|
||||
using var brush = CreateLinearGradientBrush(r, color1, color2, gradientAngle);
|
||||
g.FillRectangle(brush, r);
|
||||
}
|
||||
}
|
||||
|
||||
public static void FillRectangle(Graphics g, Rectangle r, Color color1, Color color2, int gradientAngle, float[] factors, float[] positions)
|
||||
{
|
||||
if (r.Width == 0 || r.Height == 0)
|
||||
return;
|
||||
|
||||
if (color2.IsEmpty)
|
||||
{
|
||||
if (!color1.IsEmpty)
|
||||
{
|
||||
var sm = g.SmoothingMode;
|
||||
g.SmoothingMode = SmoothingMode.None;
|
||||
|
||||
using var brush = new SolidBrush(color1);
|
||||
g.FillRectangle(brush, r);
|
||||
|
||||
g.SmoothingMode = sm;
|
||||
}
|
||||
}
|
||||
else
|
||||
{
|
||||
using var brush = CreateLinearGradientBrush(r, color1, color2, gradientAngle);
|
||||
var blend = new Blend(factors.Length);
|
||||
blend.Factors = factors;
|
||||
blend.Positions = positions;
|
||||
brush.Blend = blend;
|
||||
g.FillRectangle(brush, r);
|
||||
}
|
||||
}
|
||||
|
||||
public static void FillRoundedRectangle(Graphics g, Rectangle bounds, int cornerSize, Color color1, Color color2, int gradientAngle)
|
||||
{
|
||||
if (color2.IsEmpty)
|
||||
{
|
||||
if (!color1.IsEmpty)
|
||||
{
|
||||
using var brush = new SolidBrush(color1);
|
||||
FillRoundedRectangle(g, brush, bounds, cornerSize);
|
||||
}
|
||||
}
|
||||
else
|
||||
{
|
||||
using var brush = CreateLinearGradientBrush(bounds, color1, color2, gradientAngle);
|
||||
FillRoundedRectangle(g, brush, bounds, cornerSize);
|
||||
}
|
||||
}
|
||||
|
||||
public static void FillRoundedRectangle(Graphics g, Rectangle bounds, int cornerSize, Color color1, Color color2)
|
||||
{
|
||||
FillRoundedRectangle(g, bounds, cornerSize, color1, color2, 90);
|
||||
}
|
||||
|
||||
public static void FillRoundedRectangle(Graphics g, Rectangle bounds, int cornerSize, Color color1)
|
||||
{
|
||||
using var brush = new SolidBrush(color1);
|
||||
FillRoundedRectangle(g, brush, bounds, cornerSize);
|
||||
}
|
||||
|
||||
public static void FillRoundedRectangle(Graphics g, Brush brush, Rectangle bounds, int cornerSize)
|
||||
{
|
||||
if (cornerSize <= 0)
|
||||
{
|
||||
var sm = g.SmoothingMode;
|
||||
g.SmoothingMode = SmoothingMode.None;
|
||||
g.FillRectangle(brush, bounds);
|
||||
g.SmoothingMode = sm;
|
||||
}
|
||||
else
|
||||
{
|
||||
bounds.Width -= 1;
|
||||
bounds.Height -= 1;
|
||||
|
||||
using var path = GetRoundedRectanglePath(bounds, cornerSize);
|
||||
g.FillPath(brush, path);
|
||||
}
|
||||
}
|
||||
|
||||
public static void DrawRectangle(Graphics g, Color color, int x, int y, int width, int height)
|
||||
{
|
||||
using var pen = new Pen(color, 1f);
|
||||
DrawRectangle(g, pen, x, y, width, height);
|
||||
}
|
||||
|
||||
public static void DrawRectangle(Graphics g, Color color, Rectangle r)
|
||||
{
|
||||
DrawRectangle(g, color, r.X, r.Y, r.Width, r.Height);
|
||||
}
|
||||
|
||||
public static void DrawRectangle(Graphics g, Pen pen, int x, int y, int width, int height)
|
||||
{
|
||||
width -= 1;
|
||||
height -= 1;
|
||||
g.DrawRectangle(pen, x, y, width, height);
|
||||
}
|
||||
|
||||
public static void DrawRoundedRectangle(Graphics g, Color color, Rectangle bounds, int cornerSize)
|
||||
{
|
||||
if (color.IsEmpty)
|
||||
return;
|
||||
|
||||
using var pen = new Pen(color);
|
||||
DrawRoundedRectangle(g, pen, bounds.X, bounds.Y, bounds.Width, bounds.Height, cornerSize);
|
||||
}
|
||||
|
||||
public static void DrawRoundedRectangle(Graphics g, Pen pen, int x, int y, int width, int height, int cornerSize)
|
||||
{
|
||||
DrawRoundedRectangle(g, pen, null, x, y, width, height, cornerSize);
|
||||
}
|
||||
|
||||
public static void DrawRoundedRectangle(Graphics g, Pen pen, Brush fill, int x, int y, int width, int height, int cornerSize)
|
||||
{
|
||||
width -= 1;
|
||||
height -= 1;
|
||||
var r = new Rectangle(x, y, width, height);
|
||||
using var path = GetRoundedRectanglePath(r, cornerSize);
|
||||
|
||||
if (fill is not null)
|
||||
g.FillPath(fill, path);
|
||||
|
||||
g.DrawPath(pen, path);
|
||||
}
|
||||
|
||||
public static GraphicsPath GetRoundedRectanglePath(Rectangle r, int cornerSize)
|
||||
{
|
||||
var path = new GraphicsPath();
|
||||
|
||||
if (cornerSize == 0)
|
||||
path.AddRectangle(r);
|
||||
else
|
||||
{
|
||||
AddCornerArc(path, r, cornerSize, eCornerArc.TopLeft);
|
||||
AddCornerArc(path, r, cornerSize, eCornerArc.TopRight);
|
||||
AddCornerArc(path, r, cornerSize, eCornerArc.BottomRight);
|
||||
AddCornerArc(path, r, cornerSize, eCornerArc.BottomLeft);
|
||||
path.CloseAllFigures();
|
||||
}
|
||||
|
||||
return path;
|
||||
}
|
||||
|
||||
public static LinearGradientBrush CreateLinearGradientBrush(Rectangle r, Color color1, Color color2, float gradientAngle)
|
||||
{
|
||||
if (r.Width <= 0)
|
||||
r.Width = 1;
|
||||
if (r.Height <= 0)
|
||||
r.Height = 1;
|
||||
return new LinearGradientBrush(new Rectangle(r.X, r.Y - 1, r.Width, r.Height + 1), color1, color2, gradientAngle);
|
||||
}
|
||||
|
||||
public static void AddCornerArc(GraphicsPath path, Rectangle bounds, int cornerDiameter, eCornerArc corner)
|
||||
{
|
||||
if (cornerDiameter > 0)
|
||||
{
|
||||
var a = GetCornerArc(bounds, cornerDiameter, corner);
|
||||
path.AddArc(a.X, a.Y, a.Width, a.Height, a.StartAngle, a.SweepAngle);
|
||||
}
|
||||
|
||||
else if (corner == eCornerArc.TopLeft)
|
||||
path.AddLine(bounds.X, bounds.Y + 2, bounds.X, bounds.Y);
|
||||
else if (corner == eCornerArc.BottomLeft)
|
||||
path.AddLine(bounds.X + 2, bounds.Bottom, bounds.X, bounds.Bottom);
|
||||
else if (corner == eCornerArc.TopRight)
|
||||
path.AddLine(bounds.Right - 2, bounds.Y, bounds.Right, bounds.Y);
|
||||
else if (corner == eCornerArc.BottomRight)
|
||||
path.AddLine(bounds.Right, bounds.Bottom - 2, bounds.Right, bounds.Bottom);
|
||||
}
|
||||
|
||||
internal static ArcData GetCornerArc(Rectangle bounds, int cornerDiameter, eCornerArc corner)
|
||||
{
|
||||
if (cornerDiameter == 0)
|
||||
cornerDiameter = 1;
|
||||
|
||||
int diameter = cornerDiameter * 2;
|
||||
|
||||
return corner switch
|
||||
{
|
||||
eCornerArc.TopLeft => new ArcData(bounds.X, bounds.Y, diameter, diameter, 180f, 90f),
|
||||
eCornerArc.TopRight => new ArcData(bounds.Right - diameter, bounds.Y, diameter, diameter, 270f, 90f),
|
||||
eCornerArc.BottomLeft => new ArcData(bounds.X, bounds.Bottom - diameter, diameter, diameter, 90f, 90f),
|
||||
_ => new ArcData(bounds.Right - diameter, bounds.Bottom - diameter, diameter, diameter, 0f, 90f),
|
||||
};
|
||||
}
|
||||
|
||||
public enum eCornerArc
|
||||
{
|
||||
TopLeft,
|
||||
TopRight,
|
||||
BottomLeft,
|
||||
BottomRight
|
||||
}
|
||||
|
||||
internal struct ArcData
|
||||
{
|
||||
public int X;
|
||||
public int Y;
|
||||
public int Width;
|
||||
public int Height;
|
||||
public float StartAngle;
|
||||
public float SweepAngle;
|
||||
|
||||
public ArcData(int x, int y, int width, int height, float startAngle, float sweepAngle)
|
||||
{
|
||||
X = x;
|
||||
Y = y;
|
||||
Width = width;
|
||||
Height = height;
|
||||
StartAngle = startAngle;
|
||||
SweepAngle = sweepAngle;
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,232 +0,0 @@
|
||||
Imports System.Drawing
|
||||
Imports System.Drawing.Drawing2D
|
||||
|
||||
Public Class DisplayHelp
|
||||
|
||||
Public Shared Sub FillRectangle(ByVal g As Graphics, ByVal bounds As Rectangle, ByVal color1 As Color)
|
||||
FillRectangle(g, bounds, color1, Color.Empty, 90)
|
||||
End Sub
|
||||
|
||||
Public Shared Sub FillRectangle(ByVal g As Graphics, ByVal bounds As Rectangle, ByVal color1 As Color, ByVal color2 As Color)
|
||||
FillRectangle(g, bounds, color1, color2, 90)
|
||||
End Sub
|
||||
|
||||
Public Shared Sub FillRectangle(ByVal g As Graphics, ByVal r As Rectangle, ByVal color1 As Color, ByVal color2 As Color, ByVal gradientAngle As Integer)
|
||||
If r.Width = 0 OrElse r.Height = 0 Then Return
|
||||
|
||||
If color2.IsEmpty Then
|
||||
|
||||
If Not color1.IsEmpty Then
|
||||
Dim sm As SmoothingMode = g.SmoothingMode
|
||||
g.SmoothingMode = SmoothingMode.None
|
||||
|
||||
Using brush As SolidBrush = New SolidBrush(color1)
|
||||
g.FillRectangle(brush, r)
|
||||
End Using
|
||||
|
||||
g.SmoothingMode = sm
|
||||
End If
|
||||
Else
|
||||
|
||||
Using brush As LinearGradientBrush = CreateLinearGradientBrush(r, color1, color2, gradientAngle)
|
||||
g.FillRectangle(brush, r)
|
||||
End Using
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Public Shared Sub FillRectangle(ByVal g As Graphics, ByVal r As Rectangle, ByVal color1 As Color, ByVal color2 As Color, ByVal gradientAngle As Integer, ByVal factors As Single(), ByVal positions As Single())
|
||||
If r.Width = 0 OrElse r.Height = 0 Then Return
|
||||
|
||||
If color2.IsEmpty Then
|
||||
|
||||
If Not color1.IsEmpty Then
|
||||
Dim sm As SmoothingMode = g.SmoothingMode
|
||||
g.SmoothingMode = SmoothingMode.None
|
||||
|
||||
Using brush As SolidBrush = New SolidBrush(color1)
|
||||
g.FillRectangle(brush, r)
|
||||
End Using
|
||||
|
||||
g.SmoothingMode = sm
|
||||
End If
|
||||
Else
|
||||
|
||||
Using brush As LinearGradientBrush = CreateLinearGradientBrush(r, color1, color2, gradientAngle)
|
||||
Dim blend As Blend = New Blend(factors.Length)
|
||||
blend.Factors = factors
|
||||
blend.Positions = positions
|
||||
brush.Blend = blend
|
||||
g.FillRectangle(brush, r)
|
||||
End Using
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Public Shared Sub FillRoundedRectangle(ByVal g As Graphics, ByVal bounds As Rectangle, ByVal cornerSize As Integer, ByVal color1 As Color, ByVal color2 As Color, ByVal gradientAngle As Integer)
|
||||
If color2.IsEmpty Then
|
||||
|
||||
If Not color1.IsEmpty Then
|
||||
|
||||
Using brush As SolidBrush = New SolidBrush(color1)
|
||||
FillRoundedRectangle(g, brush, bounds, cornerSize)
|
||||
End Using
|
||||
End If
|
||||
Else
|
||||
|
||||
Using brush As LinearGradientBrush = CreateLinearGradientBrush(bounds, color1, color2, gradientAngle)
|
||||
FillRoundedRectangle(g, brush, bounds, cornerSize)
|
||||
End Using
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Public Shared Sub FillRoundedRectangle(ByVal g As Graphics, ByVal bounds As Rectangle, ByVal cornerSize As Integer, ByVal color1 As Color, ByVal color2 As Color)
|
||||
FillRoundedRectangle(g, bounds, cornerSize, color1, color2, 90)
|
||||
End Sub
|
||||
|
||||
Public Shared Sub FillRoundedRectangle(ByVal g As Graphics, ByVal bounds As Rectangle, ByVal cornerSize As Integer, ByVal color1 As Color)
|
||||
Using brush As SolidBrush = New SolidBrush(color1)
|
||||
FillRoundedRectangle(g, brush, bounds, cornerSize)
|
||||
End Using
|
||||
End Sub
|
||||
|
||||
Public Shared Sub FillRoundedRectangle(ByVal g As Graphics, ByVal brush As Brush, ByVal bounds As Rectangle, ByVal cornerSize As Integer)
|
||||
If cornerSize <= 0 Then
|
||||
Dim sm As SmoothingMode = g.SmoothingMode
|
||||
g.SmoothingMode = SmoothingMode.None
|
||||
g.FillRectangle(brush, bounds)
|
||||
g.SmoothingMode = sm
|
||||
Else
|
||||
bounds.Width -= 1
|
||||
bounds.Height -= 1
|
||||
|
||||
Using path As GraphicsPath = GetRoundedRectanglePath(bounds, cornerSize)
|
||||
g.FillPath(brush, path)
|
||||
End Using
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Public Shared Sub DrawRectangle(ByVal g As System.Drawing.Graphics, ByVal color As Color, ByVal x As Integer, ByVal y As Integer, ByVal width As Integer, ByVal height As Integer)
|
||||
Using pen As Pen = New Pen(color, 1)
|
||||
DrawRectangle(g, pen, x, y, width, height)
|
||||
End Using
|
||||
End Sub
|
||||
|
||||
Public Shared Sub DrawRectangle(ByVal g As System.Drawing.Graphics, ByVal color As Color, ByVal r As System.Drawing.Rectangle)
|
||||
DrawRectangle(g, color, r.X, r.Y, r.Width, r.Height)
|
||||
End Sub
|
||||
|
||||
Public Shared Sub DrawRectangle(ByVal g As System.Drawing.Graphics, ByVal pen As System.Drawing.Pen, ByVal x As Integer, ByVal y As Integer, ByVal width As Integer, ByVal height As Integer)
|
||||
width -= 1
|
||||
height -= 1
|
||||
g.DrawRectangle(pen, x, y, width, height)
|
||||
End Sub
|
||||
|
||||
Public Shared Sub DrawRoundedRectangle(ByVal g As System.Drawing.Graphics, ByVal color As Color, ByVal bounds As Rectangle, ByVal cornerSize As Integer)
|
||||
If Not color.IsEmpty Then
|
||||
|
||||
Using pen As Pen = New Pen(color)
|
||||
DrawRoundedRectangle(g, pen, bounds.X, bounds.Y, bounds.Width, bounds.Height, cornerSize)
|
||||
End Using
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Public Shared Sub DrawRoundedRectangle(ByVal g As System.Drawing.Graphics, ByVal pen As System.Drawing.Pen, ByVal x As Integer, ByVal y As Integer, ByVal width As Integer, ByVal height As Integer, ByVal cornerSize As Integer)
|
||||
DrawRoundedRectangle(g, pen, Nothing, x, y, width, height, cornerSize)
|
||||
End Sub
|
||||
|
||||
Public Shared Sub DrawRoundedRectangle(ByVal g As System.Drawing.Graphics, ByVal pen As System.Drawing.Pen, ByVal fill As Brush, ByVal x As Integer, ByVal y As Integer, ByVal width As Integer, ByVal height As Integer, ByVal cornerSize As Integer)
|
||||
width -= 1
|
||||
height -= 1
|
||||
Dim r As Rectangle = New Rectangle(x, y, width, height)
|
||||
|
||||
Using path As GraphicsPath = GetRoundedRectanglePath(r, cornerSize)
|
||||
If fill IsNot Nothing Then g.FillPath(fill, path)
|
||||
g.DrawPath(pen, path)
|
||||
End Using
|
||||
End Sub
|
||||
|
||||
Public Shared Function GetRoundedRectanglePath(ByVal r As Rectangle, ByVal cornerSize As Integer) As GraphicsPath
|
||||
Dim path As GraphicsPath = New GraphicsPath()
|
||||
|
||||
If cornerSize = 0 Then
|
||||
path.AddRectangle(r)
|
||||
Else
|
||||
AddCornerArc(path, r, cornerSize, eCornerArc.TopLeft)
|
||||
AddCornerArc(path, r, cornerSize, eCornerArc.TopRight)
|
||||
AddCornerArc(path, r, cornerSize, eCornerArc.BottomRight)
|
||||
AddCornerArc(path, r, cornerSize, eCornerArc.BottomLeft)
|
||||
path.CloseAllFigures()
|
||||
End If
|
||||
|
||||
Return path
|
||||
End Function
|
||||
|
||||
Public Shared Function CreateLinearGradientBrush(ByVal r As Rectangle, ByVal color1 As Color, ByVal color2 As Color, ByVal gradientAngle As Single) As LinearGradientBrush
|
||||
If r.Width <= 0 Then r.Width = 1
|
||||
If r.Height <= 0 Then r.Height = 1
|
||||
Return New LinearGradientBrush(New Rectangle(r.X, r.Y - 1, r.Width, r.Height + 1), color1, color2, gradientAngle)
|
||||
End Function
|
||||
|
||||
Public Shared Sub AddCornerArc(ByVal path As GraphicsPath, ByVal bounds As Rectangle, ByVal cornerDiameter As Integer, ByVal corner As eCornerArc)
|
||||
If cornerDiameter > 0 Then
|
||||
Dim a As ArcData = GetCornerArc(bounds, cornerDiameter, corner)
|
||||
path.AddArc(a.X, a.Y, a.Width, a.Height, a.StartAngle, a.SweepAngle)
|
||||
Else
|
||||
|
||||
If corner = eCornerArc.TopLeft Then
|
||||
path.AddLine(bounds.X, bounds.Y + 2, bounds.X, bounds.Y)
|
||||
ElseIf corner = eCornerArc.BottomLeft Then
|
||||
path.AddLine(bounds.X + 2, bounds.Bottom, bounds.X, bounds.Bottom)
|
||||
ElseIf corner = eCornerArc.TopRight Then
|
||||
path.AddLine(bounds.Right - 2, bounds.Y, bounds.Right, bounds.Y)
|
||||
ElseIf corner = eCornerArc.BottomRight Then
|
||||
path.AddLine(bounds.Right, bounds.Bottom - 2, bounds.Right, bounds.Bottom)
|
||||
End If
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Friend Shared Function GetCornerArc(ByVal bounds As Rectangle, ByVal cornerDiameter As Integer, ByVal corner As eCornerArc) As ArcData
|
||||
Dim a As ArcData
|
||||
If cornerDiameter = 0 Then cornerDiameter = 1
|
||||
Dim diameter As Integer = cornerDiameter * 2
|
||||
|
||||
Select Case corner
|
||||
Case eCornerArc.TopLeft
|
||||
a = New ArcData(bounds.X, bounds.Y, diameter, diameter, 180, 90)
|
||||
Case eCornerArc.TopRight
|
||||
a = New ArcData(bounds.Right - diameter, bounds.Y, diameter, diameter, 270, 90)
|
||||
Case eCornerArc.BottomLeft
|
||||
a = New ArcData(bounds.X, bounds.Bottom - diameter, diameter, diameter, 90, 90)
|
||||
Case Else
|
||||
a = New ArcData(bounds.Right - diameter, bounds.Bottom - diameter, diameter, diameter, 0, 90)
|
||||
End Select
|
||||
|
||||
Return a
|
||||
End Function
|
||||
|
||||
Public Enum eCornerArc
|
||||
TopLeft
|
||||
TopRight
|
||||
BottomLeft
|
||||
BottomRight
|
||||
End Enum
|
||||
|
||||
|
||||
Friend Structure ArcData
|
||||
Public X As Integer
|
||||
Public Y As Integer
|
||||
Public Width As Integer
|
||||
Public Height As Integer
|
||||
Public StartAngle As Single
|
||||
Public SweepAngle As Single
|
||||
|
||||
Public Sub New(ByVal x As Integer, ByVal y As Integer, ByVal width As Integer, ByVal height As Integer, ByVal startAngle As Single, ByVal sweepAngle As Single)
|
||||
Me.X = x
|
||||
Me.Y = y
|
||||
Me.Width = width
|
||||
Me.Height = height
|
||||
Me.StartAngle = startAngle
|
||||
Me.SweepAngle = sweepAngle
|
||||
End Sub
|
||||
End Structure
|
||||
|
||||
End Class
|
||||
@@ -1,14 +0,0 @@
|
||||
Imports System.Drawing
|
||||
Imports System.Runtime.CompilerServices
|
||||
|
||||
Public Module Extensions
|
||||
|
||||
<Extension>
|
||||
Public Function ToIcon(image As Image)
|
||||
If TypeOf image Is Bitmap Then
|
||||
Return Icon.FromHandle(CType(image, Bitmap).GetHicon)
|
||||
End If
|
||||
Return Nothing
|
||||
End Function
|
||||
|
||||
End Module
|
||||
@@ -1,54 +0,0 @@
|
||||
namespace Pilz.UI.Extensions;
|
||||
|
||||
public static class DialogResultExtensions
|
||||
{
|
||||
public static bool Is(this DialogResult @this, DialogResult result)
|
||||
{
|
||||
return @this == result;
|
||||
}
|
||||
|
||||
public static bool IsNot(this DialogResult @this, DialogResult result)
|
||||
{
|
||||
return @this != result;
|
||||
}
|
||||
|
||||
public static bool Is(this DialogResult @this, params DialogResult[] results)
|
||||
{
|
||||
return results.Any(result => @this == result);
|
||||
}
|
||||
|
||||
public static bool IsNot(this DialogResult @this, params DialogResult[] results)
|
||||
{
|
||||
return results.All(result => @this != result);
|
||||
}
|
||||
|
||||
public static bool IsOk(this DialogResult @this)
|
||||
{
|
||||
return @this == DialogResult.OK;
|
||||
}
|
||||
|
||||
public static bool IsNotOk(this DialogResult @this)
|
||||
{
|
||||
return @this != DialogResult.OK;
|
||||
}
|
||||
|
||||
public static bool IsYes(this DialogResult @this)
|
||||
{
|
||||
return @this == DialogResult.Yes;
|
||||
}
|
||||
|
||||
public static bool IsNotYes(this DialogResult @this)
|
||||
{
|
||||
return @this != DialogResult.Yes;
|
||||
}
|
||||
|
||||
public static bool IsCancel(this DialogResult @this)
|
||||
{
|
||||
return @this == DialogResult.Cancel;
|
||||
}
|
||||
|
||||
public static bool IsNotCancel(this DialogResult @this)
|
||||
{
|
||||
return @this != DialogResult.Cancel;
|
||||
}
|
||||
}
|
||||
@@ -1,12 +0,0 @@
|
||||
using Pilz.UI.Dialogs;
|
||||
using System.Diagnostics.CodeAnalysis;
|
||||
|
||||
namespace Pilz.UI.Extensions;
|
||||
|
||||
public static class FlyoutBaseExtensions
|
||||
{
|
||||
public static bool IsValid(this FlyoutBase? @this)
|
||||
{
|
||||
return @this != null && @this.Result == DialogResult.OK;
|
||||
}
|
||||
}
|
||||
@@ -1,11 +0,0 @@
|
||||
namespace Pilz.UI.Extensions;
|
||||
|
||||
public static class ImageExtensions
|
||||
{
|
||||
public static Icon? ToIcon(this Image image)
|
||||
{
|
||||
if (image is Bitmap bmp)
|
||||
return Icon.FromHandle(bmp.GetHicon());
|
||||
return null;
|
||||
}
|
||||
}
|
||||
@@ -1,19 +0,0 @@
|
||||
using System.Diagnostics;
|
||||
using System.Windows.Forms;
|
||||
|
||||
namespace Pilz.UI;
|
||||
|
||||
public static class HelpfulFunctions
|
||||
{
|
||||
public static void Sleep(int milliseconds)
|
||||
{
|
||||
var stopw = new Stopwatch();
|
||||
|
||||
stopw.Start();
|
||||
|
||||
while (stopw.ElapsedMilliseconds < milliseconds)
|
||||
Application.DoEvents();
|
||||
|
||||
stopw.Stop();
|
||||
}
|
||||
}
|
||||
@@ -1,17 +0,0 @@
|
||||
Imports System.Windows.Forms
|
||||
|
||||
Public Module HelpfulFunctions
|
||||
|
||||
Public Sub Sleep(milliseconds As Integer)
|
||||
Dim stopw As New Stopwatch
|
||||
|
||||
stopw.Start()
|
||||
|
||||
Do While stopw.ElapsedMilliseconds < milliseconds
|
||||
Application.DoEvents()
|
||||
Loop
|
||||
|
||||
stopw.Stop()
|
||||
End Sub
|
||||
|
||||
End Module
|
||||
@@ -1,323 +0,0 @@
|
||||
using System;
|
||||
using System.Collections.Generic;
|
||||
using System.Drawing;
|
||||
using System.Windows.Forms;
|
||||
|
||||
namespace Pilz.UI;
|
||||
|
||||
|
||||
internal class HighlightPanel : Control
|
||||
{
|
||||
|
||||
private Dictionary<Control, eHighlightColor> _Highlights = null;
|
||||
private List<HighlightRegion> _HighlightRegions = new List<HighlightRegion>();
|
||||
|
||||
public HighlightPanel(Dictionary<Control, eHighlightColor> highlights)
|
||||
{
|
||||
_Highlights = highlights;
|
||||
SetStyle(ControlStyles.UserPaint, true);
|
||||
SetStyle(ControlStyles.AllPaintingInWmPaint, true);
|
||||
SetStyle(ControlStyles.Opaque, true);
|
||||
SetStyle(ControlStyles.ResizeRedraw, true);
|
||||
SetStyle(ControlStyles.OptimizedDoubleBuffer, true);
|
||||
SetStyle(ControlStyles.Selectable, false);
|
||||
}
|
||||
|
||||
protected override void OnPaint(PaintEventArgs e)
|
||||
{
|
||||
var g = e.Graphics;
|
||||
g.SmoothingMode = System.Drawing.Drawing2D.SmoothingMode.AntiAlias;
|
||||
|
||||
foreach (HighlightRegion highlightRegion in _HighlightRegions)
|
||||
{
|
||||
Color[] colors = GetHighlightColors(highlightRegion.HighlightColor);
|
||||
var r = highlightRegion.Bounds;
|
||||
var back = highlightRegion.BackColor;
|
||||
r.Inflate(1, 1);
|
||||
DisplayHelp.FillRectangle(g, r, back);
|
||||
r.Inflate(-1, -1);
|
||||
DisplayHelp.FillRoundedRectangle(g, r, 2, colors[0]);
|
||||
r.Inflate(-2, -2);
|
||||
DisplayHelp.DrawRectangle(g, colors[2], r);
|
||||
r.Inflate(1, 1);
|
||||
DisplayHelp.DrawRoundedRectangle(g, colors[1], r, 2);
|
||||
}
|
||||
|
||||
base.OnPaint(e);
|
||||
}
|
||||
|
||||
private Color[] GetHighlightColors(eHighlightColor color)
|
||||
{
|
||||
Color[] colors = new Color[3];
|
||||
|
||||
if (color == eHighlightColor.Blue)
|
||||
{
|
||||
colors[0] = GetColor(172, 0x6A9CD4);
|
||||
colors[1] = GetColor(0x6A9CD4);
|
||||
colors[2] = GetColor(0x5D7EA4);
|
||||
}
|
||||
else if (color == eHighlightColor.Orange)
|
||||
{
|
||||
colors[0] = GetColor(172, 0xFF9C00);
|
||||
colors[1] = GetColor(0xFF9C00);
|
||||
colors[2] = GetColor(0xCC6600);
|
||||
}
|
||||
else if (color == eHighlightColor.Green)
|
||||
{
|
||||
colors[0] = GetColor(172, 0x71B171);
|
||||
colors[1] = GetColor(0x71B171);
|
||||
colors[2] = GetColor(0x339933);
|
||||
}
|
||||
else if (color == eHighlightColor.Custom)
|
||||
{
|
||||
if (_CustomHighlightColors is null || _CustomHighlightColors.Length < 3)
|
||||
{
|
||||
colors[0] = Color.Red;
|
||||
colors[1] = Color.Red;
|
||||
colors[2] = Color.Red;
|
||||
}
|
||||
else
|
||||
{
|
||||
colors[0] = _CustomHighlightColors[0];
|
||||
colors[1] = _CustomHighlightColors[1];
|
||||
colors[2] = _CustomHighlightColors[2];
|
||||
}
|
||||
}
|
||||
else
|
||||
{
|
||||
colors[0] = GetColor(172, 0xC63030);
|
||||
colors[1] = GetColor(0xC63030);
|
||||
colors[2] = GetColor(0x990000);
|
||||
}
|
||||
|
||||
return colors;
|
||||
}
|
||||
|
||||
protected override void OnVisibleChanged(EventArgs e)
|
||||
{
|
||||
if (Visible && !_UpdatingRegion)
|
||||
UpdateRegion();
|
||||
base.OnVisibleChanged(e);
|
||||
}
|
||||
|
||||
protected override void OnHandleCreated(EventArgs e)
|
||||
{
|
||||
if (!_RegionInitialized)
|
||||
UpdateRegion();
|
||||
base.OnHandleCreated(e);
|
||||
}
|
||||
|
||||
private bool _RegionInitialized = false;
|
||||
private bool _UpdatingRegion = false;
|
||||
|
||||
internal void UpdateRegion()
|
||||
{
|
||||
if (_UpdatingRegion || !IsHandleCreated)
|
||||
return;
|
||||
|
||||
try
|
||||
{
|
||||
_UpdatingRegion = true;
|
||||
Region = null;
|
||||
_HighlightRegions.Clear();
|
||||
if (_Highlights is null)
|
||||
return;
|
||||
|
||||
if (_Highlights.Count == 0 && _FocusHighlightControl is null)
|
||||
{
|
||||
Visible = false;
|
||||
return;
|
||||
}
|
||||
|
||||
bool processFocusControl = true;
|
||||
Region region = null;
|
||||
|
||||
foreach (KeyValuePair<Control, eHighlightColor> item in _Highlights)
|
||||
{
|
||||
if (item.Value == eHighlightColor.None || !GetIsVisible(item.Key))
|
||||
continue;
|
||||
if (ReferenceEquals(item.Key, _FocusHighlightControl))
|
||||
processFocusControl = false;
|
||||
var r = GetControlRect(item.Key);
|
||||
if (r.IsEmpty)
|
||||
continue;
|
||||
r.Inflate(2, 2);
|
||||
_HighlightRegions.Add(new HighlightRegion(r, GetBackColor(item.Key.Parent), item.Value));
|
||||
|
||||
if (region is null)
|
||||
region = new Region(r);
|
||||
else
|
||||
{
|
||||
region.Union(r);
|
||||
}
|
||||
|
||||
r.Inflate(-3, -3);
|
||||
region.Exclude(r);
|
||||
}
|
||||
|
||||
if (processFocusControl && _FocusHighlightControl is not null && _FocusHighlightControl.Visible)
|
||||
{
|
||||
var r = GetControlRect(_FocusHighlightControl);
|
||||
|
||||
if (!r.IsEmpty)
|
||||
{
|
||||
r.Inflate(2, 2);
|
||||
_HighlightRegions.Add(new HighlightRegion(r, GetBackColor(_FocusHighlightControl.Parent), _FocusHighlightColor));
|
||||
|
||||
if (region is null)
|
||||
region = new Region(r);
|
||||
else
|
||||
{
|
||||
region.Union(r);
|
||||
}
|
||||
|
||||
r.Inflate(-3, -3);
|
||||
region.Exclude(r);
|
||||
}
|
||||
}
|
||||
|
||||
Region = region;
|
||||
|
||||
if (region is null)
|
||||
Visible = false;
|
||||
else if (!Visible)
|
||||
{
|
||||
Visible = true;
|
||||
BringToFront();
|
||||
}
|
||||
|
||||
Invalidate();
|
||||
}
|
||||
finally
|
||||
{
|
||||
_UpdatingRegion = false;
|
||||
_RegionInitialized = true;
|
||||
}
|
||||
}
|
||||
|
||||
private static Color GetColor(int rgb)
|
||||
{
|
||||
if (rgb == -1)
|
||||
return Color.Empty;
|
||||
else
|
||||
{
|
||||
return Color.FromArgb((rgb & 0xFF0000) >> 16, (rgb & 0xFF00) >> 8, rgb & 0xFF);
|
||||
}
|
||||
}
|
||||
|
||||
private static Color GetColor(int alpha, int rgb)
|
||||
{
|
||||
if (rgb == -1)
|
||||
return Color.Empty;
|
||||
else
|
||||
{
|
||||
return Color.FromArgb(alpha, (rgb & 0xFF0000) >> 16, (rgb & 0xFF00) >> 8, rgb & 0xFF);
|
||||
}
|
||||
}
|
||||
|
||||
private bool GetIsVisible(Control control)
|
||||
{
|
||||
if (!control.Visible)
|
||||
return false;
|
||||
if (control.Parent is null || !control.IsHandleCreated)
|
||||
return control.Visible;
|
||||
var rect = new Pilz.Win32.Native.RECT();
|
||||
Pilz.Win32.Native.User32.GetWindowRect(control.Handle, ref rect);
|
||||
var pp = control.Parent.PointToClient(new Point(rect.Left + 3, rect.Top + 3));
|
||||
var handle = Pilz.Win32.Native.User32.ChildWindowFromPointEx(control.Parent.Handle, new Pilz.Win32.Native.POINT(pp.X, pp.Y), (uint)Pilz.Win32.Native.WindowFromPointFlags.CWP_SKIPINVISIBLE);
|
||||
if (handle == IntPtr.Zero)
|
||||
return control.Visible;
|
||||
var c = Control.FromHandle(handle);
|
||||
|
||||
if (c is not null && !ReferenceEquals(c, control) && !ReferenceEquals(c, this) && !ReferenceEquals(c, control.Parent))
|
||||
return false;
|
||||
|
||||
return control.Visible;
|
||||
}
|
||||
|
||||
private Color GetBackColor(Control control)
|
||||
{
|
||||
var backColor = control.BackColor;
|
||||
|
||||
if (backColor.IsEmpty || backColor == Color.Transparent)
|
||||
backColor = SystemColors.Control;
|
||||
else if (backColor.A < 255)
|
||||
{
|
||||
backColor = Color.FromArgb(255, backColor);
|
||||
}
|
||||
|
||||
return backColor;
|
||||
}
|
||||
|
||||
protected override void OnResize(EventArgs e)
|
||||
{
|
||||
UpdateRegion();
|
||||
base.OnResize(e);
|
||||
}
|
||||
|
||||
private Rectangle GetControlRect(Control c)
|
||||
{
|
||||
if (!c.IsHandleCreated)
|
||||
return Rectangle.Empty;
|
||||
var rect = default(Pilz.Win32.Native.RECT);
|
||||
Pilz.Win32.Native.User32.GetWindowRect(c.Handle, ref rect);
|
||||
var p = this.PointToClient(rect.Location);
|
||||
return new Rectangle(p, rect.Size);
|
||||
}
|
||||
|
||||
private struct HighlightRegion
|
||||
{
|
||||
public Rectangle Bounds;
|
||||
public Color BackColor;
|
||||
public eHighlightColor HighlightColor;
|
||||
|
||||
public HighlightRegion(Rectangle bounds, Color backColor, eHighlightColor highlightColor)
|
||||
{
|
||||
Bounds = bounds;
|
||||
BackColor = backColor;
|
||||
HighlightColor = highlightColor;
|
||||
}
|
||||
}
|
||||
|
||||
private Control _FocusHighlightControl;
|
||||
|
||||
public Control FocusHighlightControl
|
||||
{
|
||||
get
|
||||
{
|
||||
return _FocusHighlightControl;
|
||||
}
|
||||
set
|
||||
{
|
||||
_FocusHighlightControl = value;
|
||||
}
|
||||
}
|
||||
|
||||
private eHighlightColor _FocusHighlightColor = eHighlightColor.Blue;
|
||||
|
||||
public eHighlightColor FocusHighlightColor
|
||||
{
|
||||
get
|
||||
{
|
||||
return _FocusHighlightColor;
|
||||
}
|
||||
set
|
||||
{
|
||||
_FocusHighlightColor = value;
|
||||
}
|
||||
}
|
||||
|
||||
private Color[] _CustomHighlightColors = null;
|
||||
|
||||
public Color[] CustomHighlightColors
|
||||
{
|
||||
get
|
||||
{
|
||||
return _CustomHighlightColors;
|
||||
}
|
||||
set
|
||||
{
|
||||
_CustomHighlightColors = value;
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,261 +0,0 @@
|
||||
Imports System.Drawing
|
||||
Imports System.Windows.Forms
|
||||
|
||||
Imports Pilz.Win32
|
||||
|
||||
Friend Class HighlightPanel
|
||||
Inherits Control
|
||||
|
||||
Private _Highlights As Dictionary(Of Control, eHighlightColor) = Nothing
|
||||
Private _HighlightRegions As List(Of HighlightRegion) = New List(Of HighlightRegion)()
|
||||
|
||||
Public Sub New(ByVal highlights As Dictionary(Of Control, eHighlightColor))
|
||||
_Highlights = highlights
|
||||
Me.SetStyle(ControlStyles.UserPaint, True)
|
||||
Me.SetStyle(ControlStyles.AllPaintingInWmPaint, True)
|
||||
Me.SetStyle(ControlStyles.Opaque, True)
|
||||
Me.SetStyle(ControlStyles.ResizeRedraw, True)
|
||||
Me.SetStyle(ControlStyles.OptimizedDoubleBuffer, True)
|
||||
Me.SetStyle(ControlStyles.Selectable, False)
|
||||
End Sub
|
||||
|
||||
Protected Overrides Sub OnPaint(ByVal e As PaintEventArgs)
|
||||
Dim g As Graphics = e.Graphics
|
||||
g.SmoothingMode = System.Drawing.Drawing2D.SmoothingMode.AntiAlias
|
||||
|
||||
For Each highlightRegion As HighlightRegion In _HighlightRegions
|
||||
Dim colors As Color() = GetHighlightColors(highlightRegion.HighlightColor)
|
||||
Dim r As Rectangle = highlightRegion.Bounds
|
||||
Dim back As Color = highlightRegion.BackColor
|
||||
r.Inflate(1, 1)
|
||||
DisplayHelp.FillRectangle(g, r, back)
|
||||
r.Inflate(-1, -1)
|
||||
DisplayHelp.FillRoundedRectangle(g, r, 2, colors(0))
|
||||
r.Inflate(-2, -2)
|
||||
DisplayHelp.DrawRectangle(g, colors(2), r)
|
||||
r.Inflate(1, 1)
|
||||
DisplayHelp.DrawRoundedRectangle(g, colors(1), r, 2)
|
||||
Next
|
||||
|
||||
MyBase.OnPaint(e)
|
||||
End Sub
|
||||
|
||||
Private Function GetHighlightColors(ByVal color As eHighlightColor) As Color()
|
||||
Dim colors As Color() = New Color(2) {}
|
||||
|
||||
If color = eHighlightColor.Blue Then
|
||||
colors(0) = GetColor(172, &H6A9CD4)
|
||||
colors(1) = GetColor(&H6A9CD4)
|
||||
colors(2) = GetColor(&H5D7EA4)
|
||||
ElseIf color = eHighlightColor.Orange Then
|
||||
colors(0) = GetColor(172, &HFF9C00)
|
||||
colors(1) = GetColor(&HFF9C00)
|
||||
colors(2) = GetColor(&HCC6600)
|
||||
ElseIf color = eHighlightColor.Green Then
|
||||
colors(0) = GetColor(172, &H71B171)
|
||||
colors(1) = GetColor(&H71B171)
|
||||
colors(2) = GetColor(&H339933)
|
||||
ElseIf color = eHighlightColor.Custom Then
|
||||
If _CustomHighlightColors Is Nothing OrElse _CustomHighlightColors.Length < 3 Then
|
||||
colors(0) = System.Drawing.Color.Red
|
||||
colors(1) = System.Drawing.Color.Red
|
||||
colors(2) = System.Drawing.Color.Red
|
||||
Else
|
||||
colors(0) = _CustomHighlightColors(0)
|
||||
colors(1) = _CustomHighlightColors(1)
|
||||
colors(2) = _CustomHighlightColors(2)
|
||||
End If
|
||||
Else
|
||||
colors(0) = GetColor(172, &HC63030)
|
||||
colors(1) = GetColor(&HC63030)
|
||||
colors(2) = GetColor(&H990000)
|
||||
End If
|
||||
|
||||
Return colors
|
||||
End Function
|
||||
|
||||
Protected Overrides Sub OnVisibleChanged(ByVal e As EventArgs)
|
||||
If Me.Visible AndAlso Not _UpdatingRegion Then UpdateRegion()
|
||||
MyBase.OnVisibleChanged(e)
|
||||
End Sub
|
||||
|
||||
Protected Overrides Sub OnHandleCreated(ByVal e As EventArgs)
|
||||
If Not _RegionInitialized Then UpdateRegion()
|
||||
MyBase.OnHandleCreated(e)
|
||||
End Sub
|
||||
|
||||
Private _RegionInitialized As Boolean = False
|
||||
Private _UpdatingRegion As Boolean = False
|
||||
|
||||
Friend Sub UpdateRegion()
|
||||
If _UpdatingRegion OrElse Not Me.IsHandleCreated Then Return
|
||||
|
||||
Try
|
||||
_UpdatingRegion = True
|
||||
Me.Region = Nothing
|
||||
_HighlightRegions.Clear()
|
||||
If _Highlights Is Nothing Then Return
|
||||
|
||||
If _Highlights.Count = 0 AndAlso _FocusHighlightControl Is Nothing Then
|
||||
Me.Visible = False
|
||||
Return
|
||||
End If
|
||||
|
||||
Dim processFocusControl As Boolean = True
|
||||
Dim region As Region = Nothing
|
||||
|
||||
For Each item As KeyValuePair(Of Control, eHighlightColor) In _Highlights
|
||||
If item.Value = eHighlightColor.None OrElse Not GetIsVisible(item.Key) Then Continue For
|
||||
If item.Key Is _FocusHighlightControl Then processFocusControl = False
|
||||
Dim r As Rectangle = GetControlRect(item.Key)
|
||||
If r.IsEmpty Then Continue For
|
||||
r.Inflate(2, 2)
|
||||
_HighlightRegions.Add(New HighlightRegion(r, GetBackColor(item.Key.Parent), item.Value))
|
||||
|
||||
If region Is Nothing Then
|
||||
region = New Region(r)
|
||||
Else
|
||||
region.Union(r)
|
||||
End If
|
||||
|
||||
r.Inflate(-3, -3)
|
||||
region.Exclude(r)
|
||||
Next
|
||||
|
||||
If processFocusControl AndAlso _FocusHighlightControl IsNot Nothing AndAlso _FocusHighlightControl.Visible Then
|
||||
Dim r As Rectangle = GetControlRect(_FocusHighlightControl)
|
||||
|
||||
If Not r.IsEmpty Then
|
||||
r.Inflate(2, 2)
|
||||
_HighlightRegions.Add(New HighlightRegion(r, GetBackColor(_FocusHighlightControl.Parent), _FocusHighlightColor))
|
||||
|
||||
If region Is Nothing Then
|
||||
region = New Region(r)
|
||||
Else
|
||||
region.Union(r)
|
||||
End If
|
||||
|
||||
r.Inflate(-3, -3)
|
||||
region.Exclude(r)
|
||||
End If
|
||||
End If
|
||||
|
||||
Me.Region = region
|
||||
|
||||
If region Is Nothing Then
|
||||
Me.Visible = False
|
||||
ElseIf Not Me.Visible Then
|
||||
Me.Visible = True
|
||||
Me.BringToFront()
|
||||
End If
|
||||
|
||||
Me.Invalidate()
|
||||
Finally
|
||||
_UpdatingRegion = False
|
||||
_RegionInitialized = True
|
||||
End Try
|
||||
End Sub
|
||||
|
||||
Private Shared Function GetColor(rgb As Integer) As Color
|
||||
If rgb = -1 Then
|
||||
Return Color.Empty
|
||||
Else
|
||||
Return Color.FromArgb((rgb And &HFF0000) >> 16, (rgb And &HFF00) >> 8, rgb And &HFF)
|
||||
End If
|
||||
End Function
|
||||
|
||||
Private Shared Function GetColor(alpha As Integer, rgb As Integer) As Color
|
||||
If rgb = -1 Then
|
||||
Return Color.Empty
|
||||
Else
|
||||
Return Color.FromArgb(alpha, (rgb And &HFF0000) >> 16, (rgb And &HFF00) >> 8, rgb And &HFF)
|
||||
End If
|
||||
End Function
|
||||
|
||||
Private Function GetIsVisible(ByVal control As Control) As Boolean
|
||||
If Not control.Visible Then Return False
|
||||
If control.Parent Is Nothing OrElse Not control.IsHandleCreated Then Return control.Visible
|
||||
Dim rect As New Native.RECT
|
||||
Native.User32.GetWindowRect(control.Handle, rect)
|
||||
Dim pp As Point = control.Parent.PointToClient(New Point(rect.Left + 3, rect.Top + 3))
|
||||
Dim handle As IntPtr = Native.User32.ChildWindowFromPointEx(control.Parent.Handle, New Native.POINT(pp.X, pp.Y), CUInt(Native.WindowFromPointFlags.CWP_SKIPINVISIBLE))
|
||||
If handle = IntPtr.Zero Then Return control.Visible
|
||||
Dim c As Control = Control.FromHandle(handle)
|
||||
|
||||
If c IsNot Nothing AndAlso c IsNot control AndAlso c IsNot Me AndAlso c IsNot control.Parent Then
|
||||
Return False
|
||||
End If
|
||||
|
||||
Return control.Visible
|
||||
End Function
|
||||
|
||||
Private Function GetBackColor(ByVal control As Control) As Color
|
||||
Dim backColor As Color = control.BackColor
|
||||
|
||||
If backColor.IsEmpty OrElse backColor = Color.Transparent Then
|
||||
backColor = SystemColors.Control
|
||||
ElseIf backColor.A < 255 Then
|
||||
backColor = Color.FromArgb(255, backColor)
|
||||
End If
|
||||
|
||||
Return backColor
|
||||
End Function
|
||||
|
||||
Protected Overrides Sub OnResize(ByVal e As EventArgs)
|
||||
UpdateRegion()
|
||||
MyBase.OnResize(e)
|
||||
End Sub
|
||||
|
||||
Private Function GetControlRect(ByVal c As Control) As Rectangle
|
||||
If Not c.IsHandleCreated Then Return Rectangle.Empty
|
||||
Dim rect As Native.RECT
|
||||
Native.User32.GetWindowRect(c.Handle, rect)
|
||||
Dim p As Point = Me.PointToClient(rect.Location)
|
||||
Return New Rectangle(p, rect.Size)
|
||||
End Function
|
||||
|
||||
Private Structure HighlightRegion
|
||||
Public Bounds As Rectangle
|
||||
Public BackColor As Color
|
||||
Public HighlightColor As eHighlightColor
|
||||
|
||||
Public Sub New(ByVal bounds As Rectangle, ByVal backColor As Color, ByVal highlightColor As eHighlightColor)
|
||||
Me.Bounds = bounds
|
||||
Me.BackColor = backColor
|
||||
Me.HighlightColor = highlightColor
|
||||
End Sub
|
||||
End Structure
|
||||
|
||||
Private _FocusHighlightControl As Control
|
||||
|
||||
Public Property FocusHighlightControl As Control
|
||||
Get
|
||||
Return _FocusHighlightControl
|
||||
End Get
|
||||
Set(ByVal value As Control)
|
||||
_FocusHighlightControl = value
|
||||
End Set
|
||||
End Property
|
||||
|
||||
Private _FocusHighlightColor As eHighlightColor = eHighlightColor.Blue
|
||||
|
||||
Public Property FocusHighlightColor As eHighlightColor
|
||||
Get
|
||||
Return _FocusHighlightColor
|
||||
End Get
|
||||
Set(ByVal value As eHighlightColor)
|
||||
_FocusHighlightColor = value
|
||||
End Set
|
||||
End Property
|
||||
|
||||
Private _CustomHighlightColors As Color() = Nothing
|
||||
|
||||
Public Property CustomHighlightColors As Color()
|
||||
Get
|
||||
Return _CustomHighlightColors
|
||||
End Get
|
||||
Set(ByVal value As Color())
|
||||
_CustomHighlightColors = value
|
||||
End Set
|
||||
End Property
|
||||
End Class
|
||||
@@ -1,509 +0,0 @@
|
||||
using System;
|
||||
using System.Collections.Generic;
|
||||
using System.ComponentModel;
|
||||
using System.Drawing;
|
||||
// Nicht gemergte Änderung aus Projekt "Pilz.UI (net8.0-windows)"
|
||||
// Vor:
|
||||
// Imports System.Windows.Forms
|
||||
// Imports System.Drawing
|
||||
// Nach:
|
||||
// Imports System.Drawing
|
||||
// Imports System.Windows.Forms
|
||||
using System.Windows.Forms;
|
||||
|
||||
namespace Pilz.UI;
|
||||
|
||||
|
||||
public class Highlighter : Component
|
||||
{
|
||||
|
||||
private Dictionary<Control, eHighlightColor> _Highlights = new Dictionary<Control, eHighlightColor>();
|
||||
private Dictionary<Control, bool> _HighlightOnFocus = new Dictionary<Control, bool>();
|
||||
|
||||
protected override void Dispose(bool disposing)
|
||||
{
|
||||
if (_ContainerControl is not null)
|
||||
{
|
||||
_ContainerControl.SizeChanged -= ContainerControlSizeChanged;
|
||||
_ContainerControl.HandleCreated -= ContainerControlHandleCreated;
|
||||
}
|
||||
|
||||
if (_HighlightPanel is not null && _HighlightPanel.Parent is null && !_HighlightPanel.IsDisposed)
|
||||
{
|
||||
_HighlightPanel.Dispose();
|
||||
_HighlightPanel = null;
|
||||
}
|
||||
else
|
||||
{
|
||||
_HighlightPanel = null;
|
||||
}
|
||||
|
||||
base.Dispose(disposing);
|
||||
}
|
||||
|
||||
[DefaultValue(false)]
|
||||
[Localizable(true)]
|
||||
[Description("Indicates whether control is highlighted when it receives input focus.")]
|
||||
public bool GetHighlightOnFocus(Control c)
|
||||
{
|
||||
if (_HighlightOnFocus.ContainsKey(c))
|
||||
return _HighlightOnFocus[c];
|
||||
|
||||
return false;
|
||||
}
|
||||
|
||||
public void SetHighlightOnFocus(Control c, bool highlight)
|
||||
{
|
||||
if (c is null)
|
||||
throw new NullReferenceException();
|
||||
|
||||
if (_HighlightOnFocus.ContainsKey(c))
|
||||
{
|
||||
|
||||
if (!highlight)
|
||||
RemoveHighlightOnFocus(_HighlightOnFocus, c);
|
||||
|
||||
return;
|
||||
}
|
||||
|
||||
if (highlight)
|
||||
AddHighlightOnFocus(_HighlightOnFocus, c);
|
||||
}
|
||||
|
||||
private void AddHighlightOnFocus(Dictionary<Control, bool> highlightOnFocus, Control c)
|
||||
{
|
||||
c.Enter += ControlHighlightEnter;
|
||||
c.Leave += ControlHighlightLeave;
|
||||
c.VisibleChanged += ControlHighlightVisibleChanged;
|
||||
highlightOnFocus.Add(c, true);
|
||||
}
|
||||
|
||||
private void ControlHighlightVisibleChanged(object sender, EventArgs e)
|
||||
{
|
||||
if (_HighlightPanel is not null && sender.Equals(_HighlightPanel.FocusHighlightControl))
|
||||
UpdateHighlighterRegion();
|
||||
}
|
||||
|
||||
private void ControlHighlightLeave(object sender, EventArgs e)
|
||||
{
|
||||
if (_HighlightPanel is not null)
|
||||
_HighlightPanel.FocusHighlightControl = null;
|
||||
UpdateHighlighterRegion();
|
||||
}
|
||||
|
||||
private void ControlHighlightEnter(object sender, EventArgs e)
|
||||
{
|
||||
if (_HighlightPanel is not null)
|
||||
{
|
||||
if (!_HighlightPanel.Visible)
|
||||
_HighlightPanel.Visible = true;
|
||||
_HighlightPanel.BringToFront();
|
||||
_HighlightPanel.FocusHighlightControl = (Control)sender;
|
||||
}
|
||||
|
||||
UpdateHighlighterRegion();
|
||||
}
|
||||
|
||||
private void RemoveHighlightOnFocus(Dictionary<Control, bool> highlightOnFocus, Control c)
|
||||
{
|
||||
c.Enter -= ControlHighlightEnter;
|
||||
c.Leave -= ControlHighlightLeave;
|
||||
c.VisibleChanged -= ControlHighlightVisibleChanged;
|
||||
highlightOnFocus.Remove(c);
|
||||
}
|
||||
|
||||
[DefaultValue(eHighlightColor.None)]
|
||||
[Localizable(true)]
|
||||
[Description("Indicates the highlight color that is applied to the control.")]
|
||||
public eHighlightColor GetHighlightColor(Control c)
|
||||
{
|
||||
if (_Highlights.ContainsKey(c))
|
||||
return _Highlights[c];
|
||||
|
||||
return eHighlightColor.None;
|
||||
}
|
||||
|
||||
public void SetHighlightColor(Control c, eHighlightColor highlightColor)
|
||||
{
|
||||
if (_Highlights.ContainsKey(c))
|
||||
{
|
||||
|
||||
if (highlightColor == eHighlightColor.None)
|
||||
RemoveHighlight(_Highlights, c);
|
||||
else
|
||||
{
|
||||
var color = _Highlights[c];
|
||||
RemoveHighlight(_Highlights, c);
|
||||
AddHighlight(_Highlights, c, highlightColor);
|
||||
}
|
||||
}
|
||||
else if (highlightColor != eHighlightColor.None)
|
||||
{
|
||||
AddHighlight(_Highlights, c, highlightColor);
|
||||
}
|
||||
}
|
||||
|
||||
private Dictionary<TabControl, int> _TabControl2 = new Dictionary<TabControl, int>();
|
||||
private Dictionary<Panel, int> _ParentPanel = new Dictionary<Panel, int>();
|
||||
|
||||
private void AddHighlight(Dictionary<Control, eHighlightColor> highlights, Control c, eHighlightColor highlightColor)
|
||||
{
|
||||
highlights.Add(c, highlightColor);
|
||||
c.LocationChanged += new EventHandler(ControlLocationChanged);
|
||||
c.SizeChanged += new EventHandler(ControlSizeChanged);
|
||||
c.VisibleChanged += new EventHandler(ControlVisibleChanged);
|
||||
|
||||
if (_HighlightPanel is not null)
|
||||
{
|
||||
if (!_HighlightPanel.Visible)
|
||||
_HighlightPanel.Visible = true;
|
||||
_HighlightPanel.BringToFront();
|
||||
}
|
||||
|
||||
if (c.Parent is null)
|
||||
c.ParentChanged += ControlParentChanged;
|
||||
else
|
||||
{
|
||||
AddTabControlHandlers(c);
|
||||
}
|
||||
|
||||
UpdateHighlighterRegion();
|
||||
}
|
||||
|
||||
private void ControlParentChanged(object sender, EventArgs e)
|
||||
{
|
||||
Control c = (Control)sender;
|
||||
c.ParentChanged -= ControlParentChanged;
|
||||
AddTabControlHandlers(c);
|
||||
}
|
||||
|
||||
private void AddTabControlHandlers(Control c)
|
||||
{
|
||||
TabControl tab2 = GetParentControl(c, typeof(TabControl)) as TabControl;
|
||||
|
||||
if (tab2 is not null)
|
||||
{
|
||||
|
||||
if (_TabControl2.ContainsKey(tab2))
|
||||
_TabControl2[tab2] = _TabControl2[tab2] + 1;
|
||||
else
|
||||
{
|
||||
_TabControl2.Add(tab2, 1);
|
||||
tab2.SelectedIndexChanged += WinFormsTabSelectedIndexChanged;
|
||||
}
|
||||
}
|
||||
else
|
||||
{
|
||||
Panel parentPanel = GetParentControl(c, typeof(Panel)) as Panel;
|
||||
|
||||
if (parentPanel is not null)
|
||||
{
|
||||
|
||||
if (_ParentPanel.ContainsKey(parentPanel))
|
||||
_ParentPanel[parentPanel] = _ParentPanel[parentPanel] + 1;
|
||||
else
|
||||
{
|
||||
_ParentPanel.Add(parentPanel, 1);
|
||||
parentPanel.Resize += ParentPanelResized;
|
||||
parentPanel.LocationChanged += ParentPanelLocationChanged;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
private void ParentPanelLocationChanged(object sender, EventArgs e)
|
||||
{
|
||||
UpdateHighlights();
|
||||
}
|
||||
|
||||
private void ParentPanelResized(object sender, EventArgs e)
|
||||
{
|
||||
UpdateHighlights();
|
||||
}
|
||||
|
||||
private void WinFormsTabSelectedIndexChanged(object sender, EventArgs e)
|
||||
{
|
||||
UpdateHighlighterRegion();
|
||||
}
|
||||
|
||||
private Control GetParentControl(Control c, Type parentType)
|
||||
{
|
||||
var parent = c.Parent;
|
||||
|
||||
while (parent is not null)
|
||||
{
|
||||
if (parentType.IsAssignableFrom(parent.GetType()))
|
||||
return parent;
|
||||
parent = parent.Parent;
|
||||
}
|
||||
|
||||
return null;
|
||||
}
|
||||
|
||||
private void ControlVisibleChanged(object sender, EventArgs e)
|
||||
{
|
||||
UpdateHighlighterRegion();
|
||||
}
|
||||
|
||||
private void ControlSizeChanged(object sender, EventArgs e)
|
||||
{
|
||||
UpdateHighlighterRegion();
|
||||
}
|
||||
|
||||
private void ControlLocationChanged(object sender, EventArgs e)
|
||||
{
|
||||
UpdateHighlighterRegion();
|
||||
}
|
||||
|
||||
private void UpdateHighlighterRegion()
|
||||
{
|
||||
if (_HighlightPanel is not null)
|
||||
_HighlightPanel.UpdateRegion();
|
||||
}
|
||||
|
||||
public void UpdateHighlights()
|
||||
{
|
||||
UpdateHighlighterRegion();
|
||||
}
|
||||
|
||||
private void RemoveHighlight(Dictionary<Control, eHighlightColor> highlights, Control c)
|
||||
{
|
||||
highlights.Remove(c);
|
||||
c.LocationChanged -= new EventHandler(ControlLocationChanged);
|
||||
c.SizeChanged -= new EventHandler(ControlSizeChanged);
|
||||
c.VisibleChanged -= new EventHandler(ControlVisibleChanged);
|
||||
TabControl tab2 = GetParentControl(c, typeof(TabControl)) as TabControl;
|
||||
|
||||
if (tab2 is not null)
|
||||
{
|
||||
|
||||
if (_TabControl2.ContainsKey(tab2))
|
||||
{
|
||||
|
||||
if (_TabControl2[tab2] == 1)
|
||||
{
|
||||
_TabControl2.Remove(tab2);
|
||||
tab2.SelectedIndexChanged -= WinFormsTabSelectedIndexChanged;
|
||||
}
|
||||
else
|
||||
{
|
||||
_TabControl2[tab2] = _TabControl2[tab2] - 1;
|
||||
}
|
||||
}
|
||||
}
|
||||
else
|
||||
{
|
||||
Panel parentPanel = GetParentControl(c, typeof(Panel)) as Panel;
|
||||
|
||||
if (parentPanel is not null)
|
||||
{
|
||||
|
||||
if (_ParentPanel.ContainsKey(parentPanel))
|
||||
{
|
||||
|
||||
if (_ParentPanel[parentPanel] == 1)
|
||||
{
|
||||
_ParentPanel.Remove(parentPanel);
|
||||
parentPanel.LocationChanged -= ParentPanelLocationChanged;
|
||||
parentPanel.SizeChanged -= ParentPanelResized;
|
||||
}
|
||||
else
|
||||
{
|
||||
_ParentPanel[parentPanel] = _ParentPanel[parentPanel] - 1;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
UpdateHighlighterRegion();
|
||||
}
|
||||
|
||||
internal Dictionary<Control, eHighlightColor> Highlights
|
||||
{
|
||||
get
|
||||
{
|
||||
return _Highlights;
|
||||
}
|
||||
}
|
||||
|
||||
private eHighlightColor _FocusHighlightColor = eHighlightColor.Blue;
|
||||
|
||||
[DefaultValue(eHighlightColor.Blue)]
|
||||
[Category("Appearance")]
|
||||
[Description("Indicates the highlight focus color.")]
|
||||
[Localizable(true)]
|
||||
public eHighlightColor FocusHighlightColor
|
||||
{
|
||||
get
|
||||
{
|
||||
return _FocusHighlightColor;
|
||||
}
|
||||
set
|
||||
{
|
||||
_FocusHighlightColor = value;
|
||||
|
||||
if (_HighlightPanel is not null)
|
||||
{
|
||||
_HighlightPanel.FocusHighlightColor = value;
|
||||
UpdateHighlighterRegion();
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
private HighlightPanel _HighlightPanel = null;
|
||||
private Control _ContainerControl = null;
|
||||
|
||||
[Description("Indicates container control highlighter is bound to. Should be set to parent form.")]
|
||||
[Category("Behavior")]
|
||||
public Control ContainerControl
|
||||
{
|
||||
get
|
||||
{
|
||||
return _ContainerControl;
|
||||
}
|
||||
set
|
||||
{
|
||||
|
||||
if (DesignMode)
|
||||
{
|
||||
_ContainerControl = value;
|
||||
return;
|
||||
}
|
||||
|
||||
if (!ReferenceEquals(_ContainerControl, value))
|
||||
{
|
||||
|
||||
if (_ContainerControl is not null)
|
||||
{
|
||||
_ContainerControl.SizeChanged -= ContainerControlSizeChanged;
|
||||
_ContainerControl.HandleCreated -= ContainerControlHandleCreated;
|
||||
if (_HighlightPanel is not null && ReferenceEquals(_HighlightPanel.Parent, _ContainerControl))
|
||||
_ContainerControl.Controls.Remove(_HighlightPanel);
|
||||
}
|
||||
|
||||
_ContainerControl = value;
|
||||
|
||||
if (_ContainerControl is not null)
|
||||
{
|
||||
|
||||
if (_HighlightPanel is null)
|
||||
{
|
||||
_HighlightPanel = new HighlightPanel(_Highlights);
|
||||
_HighlightPanel.FocusHighlightColor = _FocusHighlightColor;
|
||||
_HighlightPanel.Margin = new Padding(0);
|
||||
_HighlightPanel.Padding = new Padding(0);
|
||||
_HighlightPanel.CustomHighlightColors = _CustomHighlightColors;
|
||||
_HighlightPanel.Visible = false;
|
||||
}
|
||||
|
||||
_ContainerControl.SizeChanged += ContainerControlSizeChanged;
|
||||
_ContainerControl.HandleCreated += ContainerControlHandleCreated;
|
||||
_ContainerControl.Controls.Add(_HighlightPanel);
|
||||
UpdateHighlightPanelBounds();
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
private void ContainerControlHandleCreated(object sender, EventArgs e)
|
||||
{
|
||||
if (_Highlights.Count > 0 && _HighlightPanel is not null && !_HighlightPanel.Visible)
|
||||
_HighlightPanel.Visible = true;
|
||||
}
|
||||
|
||||
private void UpdateHighlightPanelBounds()
|
||||
{
|
||||
var bounds = new Rectangle(0, 0, _ContainerControl.ClientRectangle.Width, _ContainerControl.ClientRectangle.Height);
|
||||
|
||||
if (_HighlightPanel is not null)
|
||||
{
|
||||
if (_HighlightPanel.Parent is Form)
|
||||
{
|
||||
Form form = _HighlightPanel.Parent as Form;
|
||||
|
||||
if (form.AutoSize)
|
||||
{
|
||||
bounds.X += form.Padding.Left;
|
||||
bounds.Y += form.Padding.Top;
|
||||
bounds.Width -= form.Padding.Horizontal;
|
||||
bounds.Height -= form.Padding.Vertical;
|
||||
}
|
||||
}
|
||||
|
||||
if (_HighlightPanel.Bounds.Equals(bounds))
|
||||
_HighlightPanel.UpdateRegion();
|
||||
else
|
||||
{
|
||||
_HighlightPanel.Bounds = bounds;
|
||||
}
|
||||
|
||||
_HighlightPanel.BringToFront();
|
||||
}
|
||||
}
|
||||
|
||||
private System.Windows.Forms.Timer _DelayTimer = null;
|
||||
|
||||
private void ContainerControlSizeChanged(object sender, EventArgs e)
|
||||
{
|
||||
Form form = sender as Form;
|
||||
|
||||
if (form is not null)
|
||||
{
|
||||
|
||||
if (_DelayTimer is null)
|
||||
{
|
||||
_DelayTimer = new();
|
||||
_DelayTimer.Interval = 100;
|
||||
_DelayTimer.Tick += new EventHandler(DelayTimerTick);
|
||||
_DelayTimer.Start();
|
||||
}
|
||||
|
||||
return;
|
||||
}
|
||||
|
||||
UpdateHighlightPanelBounds();
|
||||
}
|
||||
|
||||
private void DelayTimerTick(object sender, EventArgs e)
|
||||
{
|
||||
var timer = _DelayTimer;
|
||||
_DelayTimer = null;
|
||||
timer.Tick -= new EventHandler(DelayTimerTick);
|
||||
timer.Stop();
|
||||
timer.Dispose();
|
||||
UpdateHighlightPanelBounds();
|
||||
}
|
||||
|
||||
private Color[] _CustomHighlightColors = null;
|
||||
|
||||
[Category("Appearance")]
|
||||
[Description("Array of colors used to render custom highlight color. Control expects 3 colors in array to be specified which define the highlight border.")]
|
||||
public Color[] CustomHighlightColors
|
||||
{
|
||||
get
|
||||
{
|
||||
return _CustomHighlightColors;
|
||||
}
|
||||
set
|
||||
{
|
||||
_CustomHighlightColors = value;
|
||||
|
||||
if (_HighlightPanel is not null)
|
||||
{
|
||||
_HighlightPanel.CustomHighlightColors = _CustomHighlightColors;
|
||||
_HighlightPanel.Invalidate();
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
public enum eHighlightColor
|
||||
{
|
||||
None,
|
||||
Red,
|
||||
Blue,
|
||||
Green,
|
||||
Orange,
|
||||
Custom
|
||||
}
|
||||
@@ -1,406 +0,0 @@
|
||||
Imports System.ComponentModel
|
||||
Imports System.Drawing
|
||||
|
||||
' Nicht gemergte Änderung aus Projekt "Pilz.UI (net8.0-windows)"
|
||||
' Vor:
|
||||
' Imports System.Windows.Forms
|
||||
' Imports System.Drawing
|
||||
' Nach:
|
||||
' Imports System.Drawing
|
||||
' Imports System.Windows.Forms
|
||||
Imports System.Windows.Forms
|
||||
|
||||
Public Class Highlighter
|
||||
Inherits Component
|
||||
|
||||
Private _Highlights As Dictionary(Of Control, eHighlightColor) = New Dictionary(Of Control, eHighlightColor)()
|
||||
Private _HighlightOnFocus As Dictionary(Of Control, Boolean) = New Dictionary(Of Control, Boolean)()
|
||||
|
||||
Protected Overrides Sub Dispose(ByVal disposing As Boolean)
|
||||
If _ContainerControl IsNot Nothing Then
|
||||
RemoveHandler _ContainerControl.SizeChanged, AddressOf ContainerControlSizeChanged
|
||||
RemoveHandler _ContainerControl.HandleCreated, AddressOf ContainerControlHandleCreated
|
||||
End If
|
||||
|
||||
If _HighlightPanel IsNot Nothing AndAlso _HighlightPanel.Parent Is Nothing AndAlso Not _HighlightPanel.IsDisposed Then
|
||||
_HighlightPanel.Dispose()
|
||||
_HighlightPanel = Nothing
|
||||
Else
|
||||
_HighlightPanel = Nothing
|
||||
End If
|
||||
|
||||
MyBase.Dispose(disposing)
|
||||
End Sub
|
||||
|
||||
<DefaultValue(False), Localizable(True), Description("Indicates whether control is highlighted when it receives input focus.")>
|
||||
Public Function GetHighlightOnFocus(ByVal c As Control) As Boolean
|
||||
If _HighlightOnFocus.ContainsKey(c) Then
|
||||
Return _HighlightOnFocus(c)
|
||||
End If
|
||||
|
||||
Return False
|
||||
End Function
|
||||
|
||||
Public Sub SetHighlightOnFocus(ByVal c As Control, ByVal highlight As Boolean)
|
||||
If c Is Nothing Then Throw New NullReferenceException()
|
||||
|
||||
If _HighlightOnFocus.ContainsKey(c) Then
|
||||
|
||||
If Not highlight Then
|
||||
RemoveHighlightOnFocus(_HighlightOnFocus, c)
|
||||
End If
|
||||
|
||||
Return
|
||||
End If
|
||||
|
||||
If highlight Then AddHighlightOnFocus(_HighlightOnFocus, c)
|
||||
End Sub
|
||||
|
||||
Private Sub AddHighlightOnFocus(ByVal highlightOnFocus As Dictionary(Of Control, Boolean), ByVal c As Control)
|
||||
AddHandler c.Enter, AddressOf ControlHighlightEnter
|
||||
AddHandler c.Leave, AddressOf ControlHighlightLeave
|
||||
AddHandler c.VisibleChanged, AddressOf ControlHighlightVisibleChanged
|
||||
highlightOnFocus.Add(c, True)
|
||||
End Sub
|
||||
|
||||
Private Sub ControlHighlightVisibleChanged(ByVal sender As Object, ByVal e As EventArgs)
|
||||
If _HighlightPanel IsNot Nothing AndAlso _HighlightPanel.FocusHighlightControl = sender Then UpdateHighlighterRegion()
|
||||
End Sub
|
||||
|
||||
Private Sub ControlHighlightLeave(ByVal sender As Object, ByVal e As EventArgs)
|
||||
If _HighlightPanel IsNot Nothing Then _HighlightPanel.FocusHighlightControl = Nothing
|
||||
UpdateHighlighterRegion()
|
||||
End Sub
|
||||
|
||||
Private Sub ControlHighlightEnter(ByVal sender As Object, ByVal e As EventArgs)
|
||||
If _HighlightPanel IsNot Nothing Then
|
||||
If Not _HighlightPanel.Visible Then _HighlightPanel.Visible = True
|
||||
_HighlightPanel.BringToFront()
|
||||
_HighlightPanel.FocusHighlightControl = CType(sender, Control)
|
||||
End If
|
||||
|
||||
UpdateHighlighterRegion()
|
||||
End Sub
|
||||
|
||||
Private Sub RemoveHighlightOnFocus(ByVal highlightOnFocus As Dictionary(Of Control, Boolean), ByVal c As Control)
|
||||
RemoveHandler c.Enter, AddressOf ControlHighlightEnter
|
||||
RemoveHandler c.Leave, AddressOf ControlHighlightLeave
|
||||
RemoveHandler c.VisibleChanged, AddressOf ControlHighlightVisibleChanged
|
||||
highlightOnFocus.Remove(c)
|
||||
End Sub
|
||||
|
||||
<DefaultValue(eHighlightColor.None), Localizable(True), Description("Indicates the highlight color that is applied to the control.")>
|
||||
Public Function GetHighlightColor(ByVal c As Control) As eHighlightColor
|
||||
If _Highlights.ContainsKey(c) Then
|
||||
Return _Highlights(c)
|
||||
End If
|
||||
|
||||
Return eHighlightColor.None
|
||||
End Function
|
||||
|
||||
Public Sub SetHighlightColor(ByVal c As Control, ByVal highlightColor As eHighlightColor)
|
||||
If _Highlights.ContainsKey(c) Then
|
||||
|
||||
If highlightColor = eHighlightColor.None Then
|
||||
RemoveHighlight(_Highlights, c)
|
||||
Else
|
||||
Dim color As eHighlightColor = _Highlights(c)
|
||||
RemoveHighlight(_Highlights, c)
|
||||
AddHighlight(_Highlights, c, highlightColor)
|
||||
End If
|
||||
ElseIf highlightColor <> eHighlightColor.None Then
|
||||
AddHighlight(_Highlights, c, highlightColor)
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Private _TabControl2 As Dictionary(Of System.Windows.Forms.TabControl, Integer) = New Dictionary(Of System.Windows.Forms.TabControl, Integer)()
|
||||
Private _ParentPanel As Dictionary(Of Panel, Integer) = New Dictionary(Of Panel, Integer)()
|
||||
|
||||
Private Sub AddHighlight(ByVal highlights As Dictionary(Of Control, eHighlightColor), ByVal c As Control, ByVal highlightColor As eHighlightColor)
|
||||
highlights.Add(c, highlightColor)
|
||||
AddHandler c.LocationChanged, New EventHandler(AddressOf ControlLocationChanged)
|
||||
AddHandler c.SizeChanged, New EventHandler(AddressOf ControlSizeChanged)
|
||||
AddHandler c.VisibleChanged, New EventHandler(AddressOf ControlVisibleChanged)
|
||||
|
||||
If _HighlightPanel IsNot Nothing Then
|
||||
If Not _HighlightPanel.Visible Then _HighlightPanel.Visible = True
|
||||
_HighlightPanel.BringToFront()
|
||||
End If
|
||||
|
||||
If c.Parent Is Nothing Then
|
||||
AddHandler c.ParentChanged, AddressOf ControlParentChanged
|
||||
Else
|
||||
AddTabControlHandlers(c)
|
||||
End If
|
||||
|
||||
UpdateHighlighterRegion()
|
||||
End Sub
|
||||
|
||||
Private Sub ControlParentChanged(ByVal sender As Object, ByVal e As EventArgs)
|
||||
Dim c As Control = CType(sender, Control)
|
||||
RemoveHandler c.ParentChanged, AddressOf ControlParentChanged
|
||||
AddTabControlHandlers(c)
|
||||
End Sub
|
||||
|
||||
Private Sub AddTabControlHandlers(ByVal c As Control)
|
||||
Dim tab2 As System.Windows.Forms.TabControl = TryCast(GetParentControl(c, GetType(System.Windows.Forms.TabControl)), System.Windows.Forms.TabControl)
|
||||
|
||||
If tab2 IsNot Nothing Then
|
||||
|
||||
If _TabControl2.ContainsKey(tab2) Then
|
||||
_TabControl2(tab2) = _TabControl2(tab2) + 1
|
||||
Else
|
||||
_TabControl2.Add(tab2, 1)
|
||||
AddHandler tab2.SelectedIndexChanged, AddressOf WinFormsTabSelectedIndexChanged
|
||||
End If
|
||||
Else
|
||||
Dim parentPanel As Panel = TryCast(GetParentControl(c, GetType(Panel)), Panel)
|
||||
|
||||
If parentPanel IsNot Nothing Then
|
||||
|
||||
If _ParentPanel.ContainsKey(parentPanel) Then
|
||||
_ParentPanel(parentPanel) = _ParentPanel(parentPanel) + 1
|
||||
Else
|
||||
_ParentPanel.Add(parentPanel, 1)
|
||||
AddHandler parentPanel.Resize, AddressOf ParentPanelResized
|
||||
AddHandler parentPanel.LocationChanged, AddressOf ParentPanelLocationChanged
|
||||
End If
|
||||
End If
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Private Sub ParentPanelLocationChanged(ByVal sender As Object, ByVal e As EventArgs)
|
||||
UpdateHighlights()
|
||||
End Sub
|
||||
|
||||
Private Sub ParentPanelResized(ByVal sender As Object, ByVal e As EventArgs)
|
||||
UpdateHighlights()
|
||||
End Sub
|
||||
|
||||
Private Sub WinFormsTabSelectedIndexChanged(ByVal sender As Object, ByVal e As EventArgs)
|
||||
UpdateHighlighterRegion()
|
||||
End Sub
|
||||
|
||||
Private Function GetParentControl(ByVal c As Control, ByVal parentType As Type) As Control
|
||||
Dim parent As Control = c.Parent
|
||||
|
||||
While parent IsNot Nothing
|
||||
If parentType.IsAssignableFrom(parent.[GetType]()) Then Return parent
|
||||
parent = parent.Parent
|
||||
End While
|
||||
|
||||
Return Nothing
|
||||
End Function
|
||||
|
||||
Private Sub ControlVisibleChanged(ByVal sender As Object, ByVal e As EventArgs)
|
||||
UpdateHighlighterRegion()
|
||||
End Sub
|
||||
|
||||
Private Sub ControlSizeChanged(ByVal sender As Object, ByVal e As EventArgs)
|
||||
UpdateHighlighterRegion()
|
||||
End Sub
|
||||
|
||||
Private Sub ControlLocationChanged(ByVal sender As Object, ByVal e As EventArgs)
|
||||
UpdateHighlighterRegion()
|
||||
End Sub
|
||||
|
||||
Private Sub UpdateHighlighterRegion()
|
||||
If _HighlightPanel IsNot Nothing Then _HighlightPanel.UpdateRegion()
|
||||
End Sub
|
||||
|
||||
Public Sub UpdateHighlights()
|
||||
UpdateHighlighterRegion()
|
||||
End Sub
|
||||
|
||||
Private Sub RemoveHighlight(ByVal highlights As Dictionary(Of Control, eHighlightColor), ByVal c As Control)
|
||||
highlights.Remove(c)
|
||||
RemoveHandler c.LocationChanged, New EventHandler(AddressOf ControlLocationChanged)
|
||||
RemoveHandler c.SizeChanged, New EventHandler(AddressOf ControlSizeChanged)
|
||||
RemoveHandler c.VisibleChanged, New EventHandler(AddressOf ControlVisibleChanged)
|
||||
Dim tab2 As System.Windows.Forms.TabControl = TryCast(GetParentControl(c, GetType(System.Windows.Forms.TabControl)), System.Windows.Forms.TabControl)
|
||||
|
||||
If tab2 IsNot Nothing Then
|
||||
|
||||
If _TabControl2.ContainsKey(tab2) Then
|
||||
|
||||
If _TabControl2(tab2) = 1 Then
|
||||
_TabControl2.Remove(tab2)
|
||||
RemoveHandler tab2.SelectedIndexChanged, AddressOf WinFormsTabSelectedIndexChanged
|
||||
Else
|
||||
_TabControl2(tab2) = _TabControl2(tab2) - 1
|
||||
End If
|
||||
End If
|
||||
Else
|
||||
Dim parentPanel As Panel = TryCast(GetParentControl(c, GetType(Panel)), Panel)
|
||||
|
||||
If parentPanel IsNot Nothing Then
|
||||
|
||||
If _ParentPanel.ContainsKey(parentPanel) Then
|
||||
|
||||
If _ParentPanel(parentPanel) = 1 Then
|
||||
_ParentPanel.Remove(parentPanel)
|
||||
RemoveHandler parentPanel.LocationChanged, AddressOf ParentPanelLocationChanged
|
||||
RemoveHandler parentPanel.SizeChanged, AddressOf ParentPanelResized
|
||||
Else
|
||||
_ParentPanel(parentPanel) = _ParentPanel(parentPanel) - 1
|
||||
End If
|
||||
End If
|
||||
End If
|
||||
End If
|
||||
|
||||
UpdateHighlighterRegion()
|
||||
End Sub
|
||||
|
||||
Friend ReadOnly Property Highlights As Dictionary(Of Control, eHighlightColor)
|
||||
Get
|
||||
Return _Highlights
|
||||
End Get
|
||||
End Property
|
||||
|
||||
Private _FocusHighlightColor As eHighlightColor = eHighlightColor.Blue
|
||||
|
||||
<DefaultValue(eHighlightColor.Blue), Category("Appearance"), Description("Indicates the highlight focus color."), Localizable(True)>
|
||||
Public Property FocusHighlightColor As eHighlightColor
|
||||
Get
|
||||
Return _FocusHighlightColor
|
||||
End Get
|
||||
Set(ByVal value As eHighlightColor)
|
||||
_FocusHighlightColor = value
|
||||
|
||||
If _HighlightPanel IsNot Nothing Then
|
||||
_HighlightPanel.FocusHighlightColor = value
|
||||
UpdateHighlighterRegion()
|
||||
End If
|
||||
End Set
|
||||
End Property
|
||||
|
||||
Private _HighlightPanel As HighlightPanel = Nothing
|
||||
Private _ContainerControl As Control = Nothing
|
||||
|
||||
<Description("Indicates container control highlighter is bound to. Should be set to parent form."), Category("Behavior")>
|
||||
Public Property ContainerControl As Control
|
||||
Get
|
||||
Return _ContainerControl
|
||||
End Get
|
||||
Set(ByVal value As Control)
|
||||
|
||||
If Me.DesignMode Then
|
||||
_ContainerControl = value
|
||||
Return
|
||||
End If
|
||||
|
||||
If _ContainerControl IsNot value Then
|
||||
|
||||
If _ContainerControl IsNot Nothing Then
|
||||
RemoveHandler _ContainerControl.SizeChanged, AddressOf ContainerControlSizeChanged
|
||||
RemoveHandler _ContainerControl.HandleCreated, AddressOf ContainerControlHandleCreated
|
||||
If _HighlightPanel IsNot Nothing AndAlso _HighlightPanel.Parent Is _ContainerControl Then _ContainerControl.Controls.Remove(_HighlightPanel)
|
||||
End If
|
||||
|
||||
_ContainerControl = value
|
||||
|
||||
If _ContainerControl IsNot Nothing Then
|
||||
|
||||
If _HighlightPanel Is Nothing Then
|
||||
_HighlightPanel = New HighlightPanel(_Highlights)
|
||||
_HighlightPanel.FocusHighlightColor = _FocusHighlightColor
|
||||
_HighlightPanel.Margin = New System.Windows.Forms.Padding(0)
|
||||
_HighlightPanel.Padding = New System.Windows.Forms.Padding(0)
|
||||
_HighlightPanel.CustomHighlightColors = _CustomHighlightColors
|
||||
_HighlightPanel.Visible = False
|
||||
End If
|
||||
|
||||
AddHandler _ContainerControl.SizeChanged, AddressOf ContainerControlSizeChanged
|
||||
AddHandler _ContainerControl.HandleCreated, AddressOf ContainerControlHandleCreated
|
||||
_ContainerControl.Controls.Add(_HighlightPanel)
|
||||
UpdateHighlightPanelBounds()
|
||||
End If
|
||||
End If
|
||||
End Set
|
||||
End Property
|
||||
|
||||
Private Sub ContainerControlHandleCreated(ByVal sender As Object, ByVal e As EventArgs)
|
||||
If _Highlights.Count > 0 AndAlso _HighlightPanel IsNot Nothing AndAlso Not _HighlightPanel.Visible Then _HighlightPanel.Visible = True
|
||||
End Sub
|
||||
|
||||
Private Sub UpdateHighlightPanelBounds()
|
||||
Dim bounds As Rectangle = New Rectangle(0, 0, _ContainerControl.ClientRectangle.Width, _ContainerControl.ClientRectangle.Height)
|
||||
|
||||
If _HighlightPanel IsNot Nothing Then
|
||||
If TypeOf _HighlightPanel.Parent Is Form Then
|
||||
Dim form As Form = TryCast(_HighlightPanel.Parent, Form)
|
||||
|
||||
If form.AutoSize Then
|
||||
bounds.X += form.Padding.Left
|
||||
bounds.Y += form.Padding.Top
|
||||
bounds.Width -= form.Padding.Horizontal
|
||||
bounds.Height -= form.Padding.Vertical
|
||||
End If
|
||||
End If
|
||||
|
||||
If _HighlightPanel.Bounds.Equals(bounds) Then
|
||||
_HighlightPanel.UpdateRegion()
|
||||
Else
|
||||
_HighlightPanel.Bounds = bounds
|
||||
End If
|
||||
|
||||
_HighlightPanel.BringToFront()
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Private _DelayTimer As Timer = Nothing
|
||||
|
||||
Private Sub ContainerControlSizeChanged(ByVal sender As Object, ByVal e As EventArgs)
|
||||
Dim form As Form = TryCast(sender, Form)
|
||||
|
||||
If form IsNot Nothing Then
|
||||
|
||||
If _DelayTimer Is Nothing Then
|
||||
_DelayTimer = New Timer()
|
||||
_DelayTimer.Interval = 100
|
||||
AddHandler _DelayTimer.Tick, New EventHandler(AddressOf DelayTimerTick)
|
||||
_DelayTimer.Start()
|
||||
End If
|
||||
|
||||
Return
|
||||
End If
|
||||
|
||||
UpdateHighlightPanelBounds()
|
||||
End Sub
|
||||
|
||||
Private Sub DelayTimerTick(ByVal sender As Object, ByVal e As EventArgs)
|
||||
Dim timer As Timer = _DelayTimer
|
||||
_DelayTimer = Nothing
|
||||
RemoveHandler timer.Tick, New EventHandler(AddressOf DelayTimerTick)
|
||||
timer.[Stop]()
|
||||
timer.Dispose()
|
||||
UpdateHighlightPanelBounds()
|
||||
End Sub
|
||||
|
||||
Private _CustomHighlightColors As Color() = Nothing
|
||||
|
||||
<Category("Appearance"), Description("Array of colors used to render custom highlight color. Control expects 3 colors in array to be specified which define the highlight border.")>
|
||||
Public Property CustomHighlightColors As Color()
|
||||
Get
|
||||
Return _CustomHighlightColors
|
||||
End Get
|
||||
Set(ByVal value As Color())
|
||||
_CustomHighlightColors = value
|
||||
|
||||
If _HighlightPanel IsNot Nothing Then
|
||||
_HighlightPanel.CustomHighlightColors = _CustomHighlightColors
|
||||
_HighlightPanel.Invalidate()
|
||||
End If
|
||||
End Set
|
||||
End Property
|
||||
|
||||
End Class
|
||||
|
||||
Public Enum eHighlightColor
|
||||
None
|
||||
Red
|
||||
Blue
|
||||
Green
|
||||
Orange
|
||||
Custom
|
||||
End Enum
|
||||
@@ -1,6 +0,0 @@
|
||||
namespace Pilz.UI;
|
||||
|
||||
public interface ILoadContent
|
||||
{
|
||||
void LoadContent();
|
||||
}
|
||||
@@ -1,6 +0,0 @@
|
||||
namespace Pilz.UI;
|
||||
|
||||
public interface ILoadContentAsync
|
||||
{
|
||||
Task LoadContentAsync();
|
||||
}
|
||||
@@ -1,18 +0,0 @@
|
||||
using System.Drawing;
|
||||
using System.Drawing.Drawing2D;
|
||||
|
||||
namespace Pilz.UI;
|
||||
|
||||
public class ArrowLineCapProps : LineCapProps
|
||||
{
|
||||
|
||||
public Size Size { get; set; } = new Size(10, 10);
|
||||
public bool IsFilles { get; set; } = true;
|
||||
|
||||
internal override LineCapConfigurationArgs Configure()
|
||||
{
|
||||
var cap = new AdjustableArrowCap(Size.Width, Size.Height, IsFilles);
|
||||
return new LineCapConfigurationArgs(cap);
|
||||
}
|
||||
|
||||
}
|
||||
@@ -1,15 +0,0 @@
|
||||
Imports System.Drawing
|
||||
Imports System.Drawing.Drawing2D
|
||||
|
||||
Public Class ArrowLineCapProps
|
||||
Inherits LineCapProps
|
||||
|
||||
Public Property Size As New Size(10, 10)
|
||||
Public Property IsFilles As Boolean = True
|
||||
|
||||
Friend Overrides Function Configure() As LineCapConfigurationArgs
|
||||
Dim cap As New AdjustableArrowCap(Size.Width, Size.Height, IsFilles)
|
||||
Return New LineCapConfigurationArgs(cap)
|
||||
End Function
|
||||
|
||||
End Class
|
||||
@@ -1,284 +0,0 @@
|
||||
using Pilz.Drawing;
|
||||
using System;
|
||||
using System.Drawing;
|
||||
using System.Drawing.Drawing2D;
|
||||
using System.Windows.Forms;
|
||||
|
||||
namespace Pilz.UI;
|
||||
|
||||
|
||||
/// <summary>
|
||||
/// Contains static methods that are used for the standart PaintingObject Types.
|
||||
/// </summary>
|
||||
public class DefaultDrawMethodes
|
||||
{
|
||||
|
||||
public static void DrawText(PaintingObjectPaintEventArgs e)
|
||||
{
|
||||
var obj = e.PaintingObject;
|
||||
var b = new SolidBrush(obj.TextColor);
|
||||
var p = new PointF();
|
||||
var rect = new Rectangle((int)Math.Round(e.X), (int)Math.Round(e.Y), (int)Math.Round(obj.Width), (int)Math.Round(obj.Height));
|
||||
|
||||
var f = StringFormat.GenericDefault;
|
||||
f.Alignment = obj.HorizontalTextAlignment;
|
||||
f.LineAlignment = obj.VerticalTextAlignment;
|
||||
|
||||
float zoomFactor;
|
||||
if (obj.Parent is null)
|
||||
zoomFactor = 1.0f;
|
||||
else
|
||||
{
|
||||
zoomFactor = obj.Parent.ZoomFactor.Width;
|
||||
}
|
||||
|
||||
e.Graphics.DrawString(obj.Text, new Font(obj.TextFont.FontFamily, obj.TextFont.Size * zoomFactor, obj.TextFont.Style), b, rect, f);
|
||||
}
|
||||
private static object _DrawPicture_newSyncObj = new object();
|
||||
|
||||
public static void DrawPicture(PaintingObjectPaintEventArgs e)
|
||||
{
|
||||
var obj = e.PaintingObject;
|
||||
Image objImg;
|
||||
Size objImgSize;
|
||||
RectangleF result;
|
||||
Bitmap image;
|
||||
SizeF zoomf;
|
||||
bool hasNoParent = e.PaintingObject.Parent is null;
|
||||
object syncObj;
|
||||
|
||||
if (hasNoParent)
|
||||
{
|
||||
zoomf = new SizeF(1f, 1f);
|
||||
syncObj = _DrawPicture_newSyncObj;
|
||||
}
|
||||
else
|
||||
{
|
||||
zoomf = e.PaintingObject.Parent.ZoomFactor;
|
||||
syncObj = e.PaintingObject.Parent;
|
||||
}
|
||||
|
||||
lock (syncObj)
|
||||
{
|
||||
if (obj?.Image is null)
|
||||
return;
|
||||
objImg = obj.Image;
|
||||
objImgSize = objImg.Size;
|
||||
}
|
||||
|
||||
image = (Bitmap)obj.BufferedImage;
|
||||
result = CalculateImageResolution(obj, objImgSize, zoomf);
|
||||
|
||||
if (obj.ImageProperties.Rotate == 90 || obj.ImageProperties.Rotate == 270)
|
||||
result = CalculateImageResolution(obj, new SizeF(objImgSize.Height, objImgSize.Width), zoomf);
|
||||
|
||||
if (image is null)
|
||||
{
|
||||
bool needRescaleImageBecauseRot = false;
|
||||
|
||||
image = DrawToNewImage((Bitmap)objImg, result.Size);
|
||||
|
||||
switch (obj.ImageProperties.Rotate)
|
||||
{
|
||||
case 90:
|
||||
{
|
||||
image.RotateFlip(RotateFlipType.Rotate90FlipNone);
|
||||
needRescaleImageBecauseRot = true;
|
||||
break;
|
||||
}
|
||||
case 180:
|
||||
{
|
||||
image.RotateFlip(RotateFlipType.Rotate180FlipNone);
|
||||
break;
|
||||
}
|
||||
case 270:
|
||||
{
|
||||
image.RotateFlip(RotateFlipType.Rotate270FlipNone);
|
||||
needRescaleImageBecauseRot = true;
|
||||
break;
|
||||
}
|
||||
}
|
||||
if (obj.ImageProperties.FlipX)
|
||||
image.RotateFlip(RotateFlipType.RotateNoneFlipX);
|
||||
if (obj.ImageProperties.FlipY)
|
||||
image.RotateFlip(RotateFlipType.RotateNoneFlipY);
|
||||
|
||||
if (needRescaleImageBecauseRot)
|
||||
{
|
||||
result = CalculateImageResolution(obj, new SizeF(objImgSize.Height, objImgSize.Width), zoomf);
|
||||
image = DrawToNewImage(image, result.Size);
|
||||
}
|
||||
|
||||
obj.BufferedImage = image;
|
||||
}
|
||||
|
||||
if (image is not null)
|
||||
{
|
||||
lock (syncObj)
|
||||
e.Graphics.DrawImageUnscaled(image, new Rectangle(new Point((int)Math.Round(obj.Location.X + result.Location.X - e.Offset.X), (int)Math.Round(obj.Location.Y + result.Location.Y - e.Offset.Y)), result.Size.ToSize()));
|
||||
}
|
||||
}
|
||||
|
||||
private static Bitmap DrawToNewImage(Bitmap image, SizeF newSize)
|
||||
{
|
||||
var bmp = new Bitmap((int)Math.Round(newSize.Width < 0f ? newSize.Width * -1 : newSize.Width), (int)Math.Round(newSize.Height < 0f ? newSize.Height * -1 : newSize.Height));
|
||||
var gimage = Graphics.FromImage(bmp);
|
||||
gimage.SmoothingMode = SmoothingMode.HighQuality;
|
||||
gimage.PixelOffsetMode = PixelOffsetMode.HighQuality;
|
||||
gimage.PageUnit = GraphicsUnit.Pixel;
|
||||
gimage.InterpolationMode = InterpolationMode.HighQualityBicubic;
|
||||
gimage.DrawImage(image, new RectangleF(PointF.Empty, newSize));
|
||||
gimage.Dispose();
|
||||
return bmp;
|
||||
}
|
||||
|
||||
public static void DrawLine(PaintingObjectPaintEventArgs e)
|
||||
{
|
||||
var obj = e.PaintingObject;
|
||||
var p2 = new Pen(obj.OutlineColor, obj.OutlineThicknes) { DashStyle = obj.OutlineDashStyle };
|
||||
|
||||
if (obj.LineEndCap is not null)
|
||||
{
|
||||
var args = obj.LineEndCap.Configure();
|
||||
p2.StartCap = args.LineCap;
|
||||
p2.CustomStartCap = args.CustomLineCap;
|
||||
}
|
||||
|
||||
if (obj.LineStartCap is not null)
|
||||
{
|
||||
var args = obj.LineStartCap.Configure();
|
||||
p2.EndCap = args.LineCap;
|
||||
p2.CustomEndCap = args.CustomLineCap;
|
||||
}
|
||||
|
||||
p2.Alignment = PenAlignment.Center;
|
||||
var no = new PointF(e.X, e.Y);
|
||||
e.Graphics.DrawLine(p2, no, no + obj.Size);
|
||||
}
|
||||
|
||||
private static RectangleF CalculateImageResolution(PaintingObject obj, SizeF imageSize, SizeF zoom)
|
||||
{
|
||||
var result = new RectangleF();
|
||||
var objrect = new RectangleF(obj.Location, obj.Size);
|
||||
var size = new SizeF(imageSize.Width * zoom.Width, imageSize.Height * zoom.Height);
|
||||
var clientRectangle = objrect;
|
||||
float val = clientRectangle.Width / size.Width;
|
||||
|
||||
clientRectangle = objrect;
|
||||
float num = Math.Min(val, clientRectangle.Height / size.Height);
|
||||
|
||||
result.Width = (int)Math.Round(Math.Truncate((double)(size.Width * num)));
|
||||
result.Height = (int)Math.Round(Math.Truncate((double)(size.Height * num)));
|
||||
|
||||
clientRectangle = objrect;
|
||||
result.X = (long)Math.Round(clientRectangle.Width - result.Width) / 2L;
|
||||
|
||||
clientRectangle = objrect;
|
||||
result.Y = (long)Math.Round(clientRectangle.Height - result.Height) / 2L;
|
||||
|
||||
return result;
|
||||
}
|
||||
|
||||
public static void DrawTriangle(PaintingObjectPaintEventArgs e)
|
||||
{
|
||||
var obj = e.PaintingObject;
|
||||
|
||||
var p1 = new Point((int)Math.Round(obj.Size.Width / 2f + e.X), (int)Math.Round(e.Y));
|
||||
var p2 = new Point((int)Math.Round(e.X), (int)Math.Round(e.Y + obj.Size.Height));
|
||||
var p3 = new Point((int)Math.Round(e.X + obj.Size.Width), (int)Math.Round(e.Y + obj.Size.Height));
|
||||
|
||||
if (obj.EnableFill)
|
||||
{
|
||||
var b = new SolidBrush(obj.FillColor);
|
||||
e.Graphics.FillPolygon(b, new[] { p1, p2, p3 });
|
||||
}
|
||||
|
||||
if (obj.EnableOutline)
|
||||
{
|
||||
float lw = obj.OutlineThicknes;
|
||||
var p = new Pen(obj.OutlineColor, obj.OutlineThicknes) { DashStyle = obj.OutlineDashStyle, Alignment = PenAlignment.Inset };
|
||||
e.Graphics.DrawPolygon(p, new[] { p1, p2, p3 });
|
||||
}
|
||||
}
|
||||
|
||||
public static void DrawRectangle(PaintingObjectPaintEventArgs e)
|
||||
{
|
||||
var obj = e.PaintingObject;
|
||||
float hol = obj.OutlineThicknes / 2f;
|
||||
|
||||
if (obj.EnableFill)
|
||||
{
|
||||
var b = new SolidBrush(obj.FillColor);
|
||||
var rect = obj.EnableOutline ? new Rectangle((int)Math.Round(e.X + hol), (int)Math.Round(e.Y + hol), (int)Math.Round(obj.Size.Width - hol * 2f), (int)Math.Round(obj.Size.Height - hol * 2f)) : new Rectangle((int)Math.Round(e.X), (int)Math.Round(e.Y), (int)Math.Round(obj.Size.Width), (int)Math.Round(obj.Size.Height));
|
||||
e.Graphics.FillRectangle(b, rect);
|
||||
}
|
||||
|
||||
if (obj.EnableOutline)
|
||||
{
|
||||
var p = new Pen(obj.OutlineColor, obj.OutlineThicknes) { DashStyle = obj.OutlineDashStyle, Alignment = PenAlignment.Inset };
|
||||
var rect = new Rectangle((int)Math.Round(e.X), (int)Math.Round(e.Y), (int)Math.Round(obj.Size.Width), (int)Math.Round(obj.Size.Height));
|
||||
e.Graphics.DrawRectangle(p, rect);
|
||||
}
|
||||
}
|
||||
|
||||
public static void DrawEllipse(PaintingObjectPaintEventArgs e)
|
||||
{
|
||||
var obj = e.PaintingObject;
|
||||
|
||||
if (obj.EnableFill)
|
||||
{
|
||||
var b = new SolidBrush(obj.FillColor);
|
||||
var rect = new Rectangle((int)Math.Round(e.X), (int)Math.Round(e.Y), (int)Math.Round(obj.Size.Width), (int)Math.Round(obj.Size.Height));
|
||||
e.Graphics.FillEllipse(b, rect);
|
||||
}
|
||||
|
||||
if (obj.EnableOutline)
|
||||
{
|
||||
var p = new Pen(obj.OutlineColor, obj.OutlineThicknes) { DashStyle = obj.OutlineDashStyle, Alignment = PenAlignment.Inset };
|
||||
var rect = new Rectangle((int)Math.Round(e.X), (int)Math.Round(e.Y), (int)Math.Round(obj.Size.Width), (int)Math.Round(obj.Size.Height));
|
||||
e.Graphics.DrawEllipse(p, rect);
|
||||
}
|
||||
}
|
||||
|
||||
public static void DrawSelection(PaintingObjectPaintEventArgs e)
|
||||
{
|
||||
var obj = e.PaintingObject;
|
||||
float lw = 2.5f;
|
||||
float hlw = lw / 2f;
|
||||
float hlwphol = hlw; // + hol
|
||||
float hlwpholm2 = hlwphol * 2f;
|
||||
|
||||
var p = new Pen(Color.CornflowerBlue, lw) { DashStyle = obj.SelectionDashStyle, Alignment = PenAlignment.Outset };
|
||||
var rect = new Rectangle((int)Math.Round(e.X - hlwphol), (int)Math.Round(e.Y - hlwphol), (int)Math.Round(obj.Size.Width + hlwpholm2), (int)Math.Round(obj.Size.Height + hlwpholm2));
|
||||
e.Graphics.DrawRectangle(p, rect);
|
||||
}
|
||||
|
||||
public static void DrawGrid(PaintEventArgs e, PaintingControl pc, PointF offset)
|
||||
{
|
||||
var p = new Pen(pc.GridColor, 0.5f);
|
||||
|
||||
int curX = (int)Math.Round(pc.GridChunkSize.Width * pc.ZoomFactor.Width - offset.X);
|
||||
while (curX < pc.Width)
|
||||
{
|
||||
e.Graphics.DrawLine(p, curX, -offset.Y, curX, pc.Height);
|
||||
curX = (int)Math.Round(curX + pc.GridChunkSize.Width * pc.ZoomFactor.Width);
|
||||
}
|
||||
|
||||
int curY = (int)Math.Round(pc.GridChunkSize.Height * pc.ZoomFactor.Height - offset.Y);
|
||||
while (curY < pc.Height)
|
||||
{
|
||||
e.Graphics.DrawLine(p, -offset.X, curY, pc.Width, curY);
|
||||
curY = (int)Math.Round(curY + pc.GridChunkSize.Height * pc.ZoomFactor.Height);
|
||||
}
|
||||
}
|
||||
|
||||
public static void DrawAreaSelection(PaintEventArgs e, PaintingControl pc, PointF startMousePos, PointF lastMousePos)
|
||||
{
|
||||
var rectToDraw = HelpfulDrawingFunctions.GetRectangle(startMousePos, lastMousePos);
|
||||
var p = new Pen(pc.AreaSelectionColor);
|
||||
p.DashStyle = startMousePos.X >= lastMousePos.X ? DashStyle.DashDot : DashStyle.Solid;
|
||||
p.Width = 3f;
|
||||
e.Graphics.DrawRectangle(p, rectToDraw.X, rectToDraw.Y, rectToDraw.Width, rectToDraw.Height);
|
||||
}
|
||||
|
||||
}
|
||||
@@ -1,249 +0,0 @@
|
||||
Imports System.Drawing
|
||||
Imports System.Drawing.Drawing2D
|
||||
Imports System.Windows.Forms
|
||||
|
||||
Imports Pilz.Drawing
|
||||
|
||||
''' <summary>
|
||||
''' Contains static methods that are used for the standart PaintingObject Types.
|
||||
''' </summary>
|
||||
Public Class DefaultDrawMethodes
|
||||
|
||||
Public Shared Sub DrawText(e As PaintingObjectPaintEventArgs)
|
||||
Dim obj As PaintingObject = e.PaintingObject
|
||||
Dim b As New SolidBrush(obj.TextColor)
|
||||
Dim p As New PointF
|
||||
Dim rect As New Rectangle(e.X, e.Y, obj.Width, obj.Height)
|
||||
|
||||
Dim f As StringFormat = StringFormat.GenericDefault
|
||||
f.Alignment = obj.HorizontalTextAlignment
|
||||
f.LineAlignment = obj.VerticalTextAlignment
|
||||
|
||||
Dim zoomFactor As Single
|
||||
If obj.Parent Is Nothing Then
|
||||
zoomFactor = 1.0!
|
||||
Else
|
||||
zoomFactor = obj.Parent.ZoomFactor.Width
|
||||
End If
|
||||
|
||||
e.Graphics.DrawString(obj.Text, New Font(obj.TextFont.FontFamily, obj.TextFont.Size * zoomFactor, obj.TextFont.Style), b, rect, f)
|
||||
End Sub
|
||||
|
||||
Public Shared Sub DrawPicture(e As PaintingObjectPaintEventArgs)
|
||||
Dim obj As PaintingObject = e.PaintingObject
|
||||
Dim objImg As Image
|
||||
Dim objImgSize As Size
|
||||
Dim result As RectangleF
|
||||
Dim image As Bitmap
|
||||
Dim zoomf As SizeF
|
||||
Dim hasNoParent As Boolean = e.PaintingObject.Parent Is Nothing
|
||||
Dim syncObj As Object
|
||||
|
||||
If hasNoParent Then
|
||||
zoomf = New SizeF(1, 1)
|
||||
Static newSyncObj As New Object
|
||||
syncObj = newSyncObj
|
||||
Else
|
||||
zoomf = e.PaintingObject.Parent.ZoomFactor
|
||||
syncObj = e.PaintingObject.Parent
|
||||
End If
|
||||
|
||||
SyncLock syncObj
|
||||
If obj?.Image Is Nothing Then Return
|
||||
objImg = obj.Image
|
||||
objImgSize = objImg.Size
|
||||
End SyncLock
|
||||
|
||||
image = obj.BufferedImage
|
||||
result = CalculateImageResolution(obj, objImgSize, zoomf)
|
||||
|
||||
If obj.ImageProperties.Rotate = 90 OrElse obj.ImageProperties.Rotate = 270 Then
|
||||
result = CalculateImageResolution(obj, New SizeF(objImgSize.Height, objImgSize.Width), zoomf)
|
||||
End If
|
||||
|
||||
If image Is Nothing Then
|
||||
Dim needRescaleImageBecauseRot As Boolean = False
|
||||
|
||||
image = DrawToNewImage(objImg, result.Size)
|
||||
|
||||
Select Case obj.ImageProperties.Rotate
|
||||
Case 90
|
||||
image.RotateFlip(RotateFlipType.Rotate90FlipNone)
|
||||
needRescaleImageBecauseRot = True
|
||||
Case 180
|
||||
image.RotateFlip(RotateFlipType.Rotate180FlipNone)
|
||||
Case 270
|
||||
image.RotateFlip(RotateFlipType.Rotate270FlipNone)
|
||||
needRescaleImageBecauseRot = True
|
||||
End Select
|
||||
If obj.ImageProperties.FlipX Then
|
||||
image.RotateFlip(RotateFlipType.RotateNoneFlipX)
|
||||
End If
|
||||
If obj.ImageProperties.FlipY Then
|
||||
image.RotateFlip(RotateFlipType.RotateNoneFlipY)
|
||||
End If
|
||||
|
||||
If needRescaleImageBecauseRot Then
|
||||
result = CalculateImageResolution(obj, New SizeF(objImgSize.Height, objImgSize.Width), zoomf)
|
||||
image = DrawToNewImage(image, result.Size)
|
||||
End If
|
||||
|
||||
obj.BufferedImage = image
|
||||
End If
|
||||
|
||||
If image IsNot Nothing Then
|
||||
SyncLock syncObj
|
||||
e.Graphics.DrawImageUnscaled(image, New Rectangle(New Point(obj.Location.X + result.Location.X - e.Offset.X, obj.Location.Y + result.Location.Y - e.Offset.Y), result.Size.ToSize))
|
||||
End SyncLock
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Private Shared Function DrawToNewImage(image As Bitmap, newSize As SizeF) As Bitmap
|
||||
Dim bmp As New Bitmap(CInt(If(newSize.Width < 0, newSize.Width * -1, newSize.Width)),
|
||||
CInt(If(newSize.Height < 0, newSize.Height * -1, newSize.Height)))
|
||||
Dim gimage As Graphics = Graphics.FromImage(bmp)
|
||||
gimage.SmoothingMode = SmoothingMode.HighQuality
|
||||
gimage.PixelOffsetMode = PixelOffsetMode.HighQuality
|
||||
gimage.PageUnit = GraphicsUnit.Pixel
|
||||
gimage.InterpolationMode = InterpolationMode.HighQualityBicubic
|
||||
gimage.DrawImage(image, New RectangleF(PointF.Empty, newSize))
|
||||
gimage.Dispose()
|
||||
Return bmp
|
||||
End Function
|
||||
|
||||
Public Shared Sub DrawLine(e As PaintingObjectPaintEventArgs)
|
||||
Dim obj As PaintingObject = e.PaintingObject
|
||||
Dim p2 As New Pen(obj.OutlineColor, obj.OutlineThicknes) With {
|
||||
.DashStyle = obj.OutlineDashStyle
|
||||
}
|
||||
|
||||
If obj.LineEndCap IsNot Nothing Then
|
||||
Dim args As LineCapConfigurationArgs = obj.LineEndCap.Configure
|
||||
p2.StartCap = args.LineCap
|
||||
p2.CustomStartCap = args.CustomLineCap
|
||||
End If
|
||||
|
||||
If obj.LineStartCap IsNot Nothing Then
|
||||
Dim args As LineCapConfigurationArgs = obj.LineStartCap.Configure
|
||||
p2.EndCap = args.LineCap
|
||||
p2.CustomEndCap = args.CustomLineCap
|
||||
End If
|
||||
|
||||
p2.Alignment = PenAlignment.Center
|
||||
Dim no As PointF = New PointF(e.X, e.Y)
|
||||
e.Graphics.DrawLine(p2, no, no + obj.Size)
|
||||
End Sub
|
||||
|
||||
Private Shared Function CalculateImageResolution(obj As PaintingObject, imageSize As SizeF, zoom As SizeF) As RectangleF
|
||||
Dim result As New RectangleF
|
||||
Dim objrect As New RectangleF(obj.Location, obj.Size)
|
||||
Dim size As SizeF = New SizeF(imageSize.Width * zoom.Width, imageSize.Height * zoom.Height)
|
||||
Dim clientRectangle As RectangleF = objrect
|
||||
Dim val As Single = clientRectangle.Width / size.Width
|
||||
|
||||
clientRectangle = objrect
|
||||
Dim num As Single = Math.Min(val, clientRectangle.Height / size.Height)
|
||||
|
||||
result.Width = CInt(Math.Truncate(size.Width * num))
|
||||
result.Height = CInt(Math.Truncate(size.Height * num))
|
||||
|
||||
clientRectangle = objrect
|
||||
result.X = (clientRectangle.Width - result.Width) \ 2
|
||||
|
||||
clientRectangle = objrect
|
||||
result.Y = (clientRectangle.Height - result.Height) \ 2
|
||||
|
||||
Return result
|
||||
End Function
|
||||
|
||||
Public Shared Sub DrawTriangle(e As PaintingObjectPaintEventArgs)
|
||||
Dim obj As PaintingObject = e.PaintingObject
|
||||
|
||||
Dim p1 As New Point(obj.Size.Width / 2 + e.X, e.Y)
|
||||
Dim p2 As New Point(e.X, e.Y + obj.Size.Height)
|
||||
Dim p3 As New Point(e.X + obj.Size.Width, e.Y + obj.Size.Height)
|
||||
|
||||
If obj.EnableFill Then
|
||||
Dim b As New SolidBrush(obj.FillColor)
|
||||
e.Graphics.FillPolygon(b, {p1, p2, p3})
|
||||
End If
|
||||
|
||||
If obj.EnableOutline Then
|
||||
Dim lw As Single = obj.OutlineThicknes
|
||||
Dim p As New Pen(obj.OutlineColor, obj.OutlineThicknes) With {.DashStyle = obj.OutlineDashStyle, .Alignment = PenAlignment.Inset}
|
||||
e.Graphics.DrawPolygon(p, {p1, p2, p3})
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Public Shared Sub DrawRectangle(e As PaintingObjectPaintEventArgs)
|
||||
Dim obj As PaintingObject = e.PaintingObject
|
||||
Dim hol As Single = obj.OutlineThicknes / 2
|
||||
|
||||
If obj.EnableFill Then
|
||||
Dim b As New SolidBrush(obj.FillColor)
|
||||
Dim rect As Rectangle = If(obj.EnableOutline,
|
||||
New Rectangle(e.X + hol, e.Y + hol, obj.Size.Width - hol * 2, obj.Size.Height - hol * 2),
|
||||
New Rectangle(e.X, e.Y, obj.Size.Width, obj.Size.Height))
|
||||
e.Graphics.FillRectangle(b, rect)
|
||||
End If
|
||||
|
||||
If obj.EnableOutline Then
|
||||
Dim p As New Pen(obj.OutlineColor, obj.OutlineThicknes) With {.DashStyle = obj.OutlineDashStyle, .Alignment = PenAlignment.Inset}
|
||||
Dim rect As New Rectangle(e.X, e.Y, obj.Size.Width, obj.Size.Height)
|
||||
e.Graphics.DrawRectangle(p, rect)
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Public Shared Sub DrawEllipse(e As PaintingObjectPaintEventArgs)
|
||||
Dim obj As PaintingObject = e.PaintingObject
|
||||
|
||||
If obj.EnableFill Then
|
||||
Dim b As New SolidBrush(obj.FillColor)
|
||||
Dim rect As Rectangle = New Rectangle(e.X, e.Y, obj.Size.Width, obj.Size.Height)
|
||||
e.Graphics.FillEllipse(b, rect)
|
||||
End If
|
||||
|
||||
If obj.EnableOutline Then
|
||||
Dim p As New Pen(obj.OutlineColor, obj.OutlineThicknes) With {.DashStyle = obj.OutlineDashStyle, .Alignment = PenAlignment.Inset}
|
||||
Dim rect As New Rectangle(e.X, e.Y, obj.Size.Width, obj.Size.Height)
|
||||
e.Graphics.DrawEllipse(p, rect)
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Public Shared Sub DrawSelection(e As PaintingObjectPaintEventArgs)
|
||||
Dim obj As PaintingObject = e.PaintingObject
|
||||
Dim lw As Single = 2.5!
|
||||
Dim hlw As Single = lw / 2
|
||||
Dim hlwphol As Single = hlw '+ hol
|
||||
Dim hlwpholm2 As Single = hlwphol * 2
|
||||
|
||||
Dim p As New Pen(Color.CornflowerBlue, lw) With {.DashStyle = obj.SelectionDashStyle, .Alignment = PenAlignment.Outset}
|
||||
Dim rect As New Rectangle(e.X - hlwphol, e.Y - hlwphol, obj.Size.Width + hlwpholm2, obj.Size.Height + hlwpholm2)
|
||||
e.Graphics.DrawRectangle(p, rect)
|
||||
End Sub
|
||||
|
||||
Public Shared Sub DrawGrid(e As PaintEventArgs, pc As PaintingControl, offset As PointF)
|
||||
Dim p As New Pen(pc.GridColor, 0.5)
|
||||
|
||||
Dim curX As Integer = pc.GridChunkSize.Width * pc.ZoomFactor.Width - offset.X
|
||||
Do While curX < pc.Width
|
||||
e.Graphics.DrawLine(p, curX, -offset.Y, curX, pc.Height)
|
||||
curX += (pc.GridChunkSize.Width * pc.ZoomFactor.Width)
|
||||
Loop
|
||||
|
||||
Dim curY As Integer = pc.GridChunkSize.Height * pc.ZoomFactor.Height - offset.Y
|
||||
Do While curY < pc.Height
|
||||
e.Graphics.DrawLine(p, -offset.X, curY, pc.Width, curY)
|
||||
curY += (pc.GridChunkSize.Height * pc.ZoomFactor.Height)
|
||||
Loop
|
||||
End Sub
|
||||
|
||||
Public Shared Sub DrawAreaSelection(e As PaintEventArgs, pc As PaintingControl, startMousePos As PointF, lastMousePos As PointF)
|
||||
Dim rectToDraw As RectangleF = HelpfulDrawingFunctions.GetRectangle(startMousePos, lastMousePos)
|
||||
Dim p As New Pen(pc.AreaSelectionColor)
|
||||
p.DashStyle = If(startMousePos.X >= lastMousePos.X, DashStyle.DashDot, DashStyle.Solid)
|
||||
p.Width = 3
|
||||
e.Graphics.DrawRectangle(p, rectToDraw.X, rectToDraw.Y, rectToDraw.Width, rectToDraw.Height)
|
||||
End Sub
|
||||
|
||||
End Class
|
||||
@@ -1,17 +0,0 @@
|
||||
using System.Drawing.Drawing2D;
|
||||
|
||||
namespace Pilz.UI;
|
||||
|
||||
|
||||
public class DefaultLineCapProps : LineCapProps
|
||||
{
|
||||
|
||||
public LineCap LineCap { get; set; } = LineCap.Flat;
|
||||
public CustomLineCap CustomLineCap { get; set; } = null;
|
||||
|
||||
internal override LineCapConfigurationArgs Configure()
|
||||
{
|
||||
return new LineCapConfigurationArgs(LineCap, CustomLineCap);
|
||||
}
|
||||
|
||||
}
|
||||
@@ -1,13 +0,0 @@
|
||||
Imports System.Drawing.Drawing2D
|
||||
|
||||
Public Class DefaultLineCapProps
|
||||
Inherits LineCapProps
|
||||
|
||||
Public Property LineCap As LineCap = LineCap.Flat
|
||||
Public Property CustomLineCap As CustomLineCap = Nothing
|
||||
|
||||
Friend Overrides Function Configure() As LineCapConfigurationArgs
|
||||
Return New LineCapConfigurationArgs(LineCap, CustomLineCap)
|
||||
End Function
|
||||
|
||||
End Class
|
||||
@@ -1,8 +0,0 @@
|
||||
using System;
|
||||
|
||||
namespace Pilz.UI;
|
||||
|
||||
public class PaintingObjectEventArgs(PaintingObject[] paintingObjects) : EventArgs
|
||||
{
|
||||
public PaintingObject[] PaintingObjects { get; private set; } = paintingObjects;
|
||||
}
|
||||
@@ -1,19 +0,0 @@
|
||||
|
||||
' Nicht gemergte Änderung aus Projekt "Pilz.UI (net8.0-windows)"
|
||||
' Vor:
|
||||
' Imports System.Windows.Forms
|
||||
' Imports Newtonsoft.Json
|
||||
' Nach:
|
||||
' Imports System.Windows.Forms
|
||||
'
|
||||
' Imports Newtonsoft.Json
|
||||
Public Class PaintingObjectEventArgs
|
||||
Inherits EventArgs
|
||||
|
||||
Public ReadOnly Property PaintingObjects As PaintingObject() = Nothing
|
||||
|
||||
Friend Sub New(paintingObjects As PaintingObject())
|
||||
_PaintingObjects = paintingObjects
|
||||
End Sub
|
||||
|
||||
End Class
|
||||
@@ -1,53 +0,0 @@
|
||||
using System;
|
||||
using System.Drawing;
|
||||
|
||||
namespace Pilz.UI;
|
||||
|
||||
public class PaintingObjectPaintEventArgs(PaintingObject obj, Graphics g, PointF offset) : EventArgs
|
||||
{
|
||||
/// <summary>
|
||||
/// The Painting Object to draw.
|
||||
/// </summary>
|
||||
/// <returns></returns>
|
||||
public PaintingObject PaintingObject { get; } = obj;
|
||||
|
||||
/// <summary>
|
||||
/// The current offset of the page on the screen.
|
||||
/// </summary>
|
||||
/// <returns></returns>
|
||||
public PointF Offset { get; } = offset;
|
||||
|
||||
/// <summary>
|
||||
/// The Grpahics from the parent PaintingControl.
|
||||
/// </summary>
|
||||
/// <returns></returns>
|
||||
public Graphics Graphics { get; } = g;
|
||||
|
||||
/// <summary>
|
||||
/// The position of the PaintingObject on Screen.
|
||||
/// </summary>
|
||||
/// <returns></returns>
|
||||
public PointF Location => new(X, Y);
|
||||
|
||||
/// <summary>
|
||||
/// The X position of the PaintingObject on Screen.
|
||||
/// </summary>
|
||||
/// <returns></returns>
|
||||
public float X => PaintingObject.X - Offset.X;
|
||||
|
||||
/// <summary>
|
||||
/// The Y position of the PaintingObject on Screen.
|
||||
/// </summary>
|
||||
/// <returns></returns>
|
||||
public float Y => PaintingObject.Y - Offset.Y;
|
||||
|
||||
/// <summary>
|
||||
/// The rectangle of the PaintingObject on Screen.
|
||||
/// </summary>
|
||||
/// <returns></returns>
|
||||
public RectangleF Rectangle => new RectangleF(X, Y, PaintingObject.Width, PaintingObject.Height);
|
||||
|
||||
public PaintingObjectPaintEventArgs(PaintingObject obj, Graphics g) : this(obj, g, obj.Parent.Offset)
|
||||
{
|
||||
}
|
||||
}
|
||||
@@ -1,83 +0,0 @@
|
||||
Imports System.Drawing
|
||||
' Nicht gemergte Änderung aus Projekt "Pilz.UI (net8.0-windows)"
|
||||
' Vor:
|
||||
' Imports System.Windows.Forms
|
||||
' Imports Newtonsoft.Json
|
||||
' Nach:
|
||||
' Imports System.Windows.Forms
|
||||
'
|
||||
' Imports Newtonsoft.Json
|
||||
|
||||
|
||||
Public Class PaintingObjectPaintEventArgs
|
||||
Inherits EventArgs
|
||||
|
||||
''' <summary>
|
||||
''' The Painting Object to draw.
|
||||
''' </summary>
|
||||
''' <returns></returns>
|
||||
Public ReadOnly Property PaintingObject As PaintingObject
|
||||
|
||||
''' <summary>
|
||||
''' The current offset of the page on the screen.
|
||||
''' </summary>
|
||||
''' <returns></returns>
|
||||
Public ReadOnly Property Offset As PointF
|
||||
|
||||
''' <summary>
|
||||
''' The Grpahics from the parent PaintingControl.
|
||||
''' </summary>
|
||||
''' <returns></returns>
|
||||
Public ReadOnly Property Graphics As Graphics
|
||||
|
||||
''' <summary>
|
||||
''' The position of the PaintingObject on Screen.
|
||||
''' </summary>
|
||||
''' <returns></returns>
|
||||
Public ReadOnly Property Location As PointF
|
||||
Get
|
||||
Return New PointF(X, Y)
|
||||
End Get
|
||||
End Property
|
||||
|
||||
''' <summary>
|
||||
''' The X position of the PaintingObject on Screen.
|
||||
''' </summary>
|
||||
''' <returns></returns>
|
||||
Public ReadOnly Property X As Single
|
||||
Get
|
||||
Return PaintingObject.X - Offset.X
|
||||
End Get
|
||||
End Property
|
||||
|
||||
''' <summary>
|
||||
''' The Y position of the PaintingObject on Screen.
|
||||
''' </summary>
|
||||
''' <returns></returns>
|
||||
Public ReadOnly Property Y As Single
|
||||
Get
|
||||
Return PaintingObject.Y - Offset.Y
|
||||
End Get
|
||||
End Property
|
||||
|
||||
''' <summary>
|
||||
''' The rectangle of the PaintingObject on Screen.
|
||||
''' </summary>
|
||||
''' <returns></returns>
|
||||
Public ReadOnly Property Rectangle As RectangleF
|
||||
Get
|
||||
Return New RectangleF(X, Y, PaintingObject.Width, PaintingObject.Height)
|
||||
End Get
|
||||
End Property
|
||||
|
||||
Friend Sub New(obj As PaintingObject, g As Graphics)
|
||||
Me.New(obj, g, obj.Parent.Offset)
|
||||
End Sub
|
||||
|
||||
Friend Sub New(obj As PaintingObject, g As Graphics, offset As PointF)
|
||||
PaintingObject = obj
|
||||
Me.Offset = offset
|
||||
Graphics = g
|
||||
End Sub
|
||||
|
||||
End Class
|
||||
@@ -1,7 +0,0 @@
|
||||
|
||||
namespace Pilz.UI;
|
||||
|
||||
public interface IPaintingObjectContainer
|
||||
{
|
||||
|
||||
}
|
||||
@@ -1,3 +0,0 @@
|
||||
Public Interface IPaintingObjectContainer
|
||||
|
||||
End Interface
|
||||
@@ -1,9 +0,0 @@
|
||||
|
||||
namespace Pilz.UI;
|
||||
|
||||
public class PaintingObjectImageProperties
|
||||
{
|
||||
public bool FlipY { get; set; } = false;
|
||||
public bool FlipX { get; set; } = false;
|
||||
public ushort Rotate { get; set; } = 0;
|
||||
}
|
||||
@@ -1,5 +0,0 @@
|
||||
Public Class PaintingObjectImageProperties
|
||||
Public Property FlipY As Boolean = False
|
||||
Public Property FlipX As Boolean = False
|
||||
Public Property Rotate As UShort = 0
|
||||
End Class
|
||||
@@ -1,26 +0,0 @@
|
||||
using System.Drawing.Drawing2D;
|
||||
|
||||
namespace Pilz.UI;
|
||||
|
||||
|
||||
public class LineCapConfigurationArgs
|
||||
{
|
||||
|
||||
public LineCap LineCap { get; private set; }
|
||||
public CustomLineCap CustomLineCap { get; private set; }
|
||||
|
||||
public LineCapConfigurationArgs(LineCap lineCap) : this(lineCap, null)
|
||||
{
|
||||
}
|
||||
|
||||
public LineCapConfigurationArgs(CustomLineCap customLineCap) : this(default, customLineCap)
|
||||
{
|
||||
}
|
||||
|
||||
public LineCapConfigurationArgs(LineCap lineCap, CustomLineCap customLineCap)
|
||||
{
|
||||
LineCap = lineCap;
|
||||
CustomLineCap = customLineCap;
|
||||
}
|
||||
|
||||
}
|
||||
@@ -1,21 +0,0 @@
|
||||
Imports System.Drawing.Drawing2D
|
||||
|
||||
Public Class LineCapConfigurationArgs
|
||||
|
||||
Public ReadOnly Property LineCap As LineCap
|
||||
Public ReadOnly Property CustomLineCap As CustomLineCap
|
||||
|
||||
Public Sub New(lineCap As LineCap)
|
||||
Me.New(lineCap, Nothing)
|
||||
End Sub
|
||||
|
||||
Public Sub New(customLineCap As CustomLineCap)
|
||||
Me.New(Nothing, customLineCap)
|
||||
End Sub
|
||||
|
||||
Public Sub New(lineCap As LineCap, customLineCap As CustomLineCap)
|
||||
Me.LineCap = lineCap
|
||||
Me.CustomLineCap = customLineCap
|
||||
End Sub
|
||||
|
||||
End Class
|
||||
@@ -1,9 +0,0 @@
|
||||
|
||||
namespace Pilz.UI;
|
||||
|
||||
public abstract class LineCapProps
|
||||
{
|
||||
|
||||
internal abstract LineCapConfigurationArgs Configure();
|
||||
|
||||
}
|
||||
@@ -1,5 +0,0 @@
|
||||
Public MustInherit Class LineCapProps
|
||||
|
||||
Friend MustOverride Function Configure() As LineCapConfigurationArgs
|
||||
|
||||
End Class
|
||||
@@ -1,785 +0,0 @@
|
||||
using Pilz.Drawing;
|
||||
using System;
|
||||
using System.Collections;
|
||||
using System.Collections.Generic;
|
||||
using System.ComponentModel;
|
||||
using System.Data;
|
||||
using System.Drawing;
|
||||
using System.Drawing.Drawing2D;
|
||||
using System.Linq;
|
||||
using System.Windows.Forms;
|
||||
|
||||
namespace Pilz.UI;
|
||||
|
||||
|
||||
public class PaintingControl : UserControl, IPaintingObjectContainer
|
||||
{
|
||||
|
||||
private PaintingObject curObjMouseDown = null;
|
||||
private Color bgColor = Color.White;
|
||||
private Point startMousePos = default;
|
||||
private Point lastMousePos = default;
|
||||
private int lastHashCode = 0;
|
||||
private Point calcOffset_MouseOnTab = Point.Empty;
|
||||
private bool calcOffset_IsActive = false;
|
||||
private PointF calcOffset_LastOffset = PointF.Empty;
|
||||
|
||||
private new Color ForeColor { get; set; }
|
||||
private new Font Font { get; set; }
|
||||
private new string Text { get; set; }
|
||||
|
||||
public PointF Offset { get; set; } = PointF.Empty;
|
||||
public PaintingObjectList PaintingObjects { get; private set; }
|
||||
public bool VisibleForMouseEvents { get; set; } = true;
|
||||
public bool AutoAreaSelection { get; set; } = true;
|
||||
public bool AutoSingleSelection { get; set; } = true;
|
||||
public bool AutoMultiselection { get; set; } = true;
|
||||
public bool AutoRemoveSelection { get; set; } = true;
|
||||
public DashStyle AreaSelectionDashStyle { get; set; } = DashStyle.DashDot;
|
||||
public Color AreaSelectionColor { get; set; } = Color.CornflowerBlue;
|
||||
public bool AutoMoveObjects { get; set; } = true;
|
||||
private bool _IsAreaSelecting = false;
|
||||
public bool IsMovingObjects { get; private set; } = false;
|
||||
public bool GridEnabled { get; set; } = true;
|
||||
public bool GridVisible { get; set; } = false;
|
||||
public Size GridChunkSize { get; set; } = new Size(20, 20);
|
||||
public Color GridColor { get; set; } = Color.LightGray;
|
||||
public DelegateDrawPaintingControlGridMethode DrawGridMethode { get; set; } = DefaultDrawMethodes.DrawGrid;
|
||||
public DelegateDrawPaintingControlAreaSelectionMethode DrawAreaSelectionMethode { get; set; } = DefaultDrawMethodes.DrawAreaSelection;
|
||||
private SizeF _ZoomFactor = new SizeF(1f, 1f);
|
||||
|
||||
private int _stopDrawing = -1;
|
||||
private Image bufferedImg = null;
|
||||
|
||||
private bool pressedShift = false;
|
||||
private bool pressedControl = false;
|
||||
private bool pressedAlt = false;
|
||||
|
||||
private Dictionary<PaintingObject, PointF> savedPos = new Dictionary<PaintingObject, PointF>();
|
||||
|
||||
public event SelectionChangedEventHandler SelectionChanged;
|
||||
|
||||
public delegate void SelectionChangedEventHandler(object sender, PaintingObjectEventArgs e);
|
||||
public event PaintingObjectAddedEventHandler PaintingObjectAdded;
|
||||
|
||||
public delegate void PaintingObjectAddedEventHandler(object sender, PaintingObjectEventArgs e);
|
||||
public event PaintingObjectRemovedEventHandler PaintingObjectRemoved;
|
||||
|
||||
public delegate void PaintingObjectRemovedEventHandler(object sender, PaintingObjectEventArgs e);
|
||||
public event AfterScrollingDoneEventHandler AfterScrollingDone;
|
||||
|
||||
public delegate void AfterScrollingDoneEventHandler(object sender, EventArgs e);
|
||||
public event ZoomFactorChangedEventHandler ZoomFactorChanged;
|
||||
|
||||
public delegate void ZoomFactorChangedEventHandler(object sender, EventArgs e);
|
||||
|
||||
public PaintingObject[] SelectedObjects
|
||||
{
|
||||
get
|
||||
{
|
||||
var objs = new List<PaintingObject>();
|
||||
|
||||
foreach (PaintingObject obj in PaintingObjects)
|
||||
{
|
||||
if (obj.Selected)
|
||||
objs.Add(obj);
|
||||
}
|
||||
|
||||
return objs.ToArray();
|
||||
}
|
||||
}
|
||||
|
||||
public bool IsLayoutSuspended
|
||||
{
|
||||
get
|
||||
{
|
||||
return Convert.ToInt32(GetType().GetField("layoutSuspendCount", System.Reflection.BindingFlags.Instance | System.Reflection.BindingFlags.NonPublic).GetValue(this)) != 0;
|
||||
}
|
||||
}
|
||||
|
||||
public bool StopDrawing
|
||||
{
|
||||
get
|
||||
{
|
||||
return _stopDrawing > -1;
|
||||
}
|
||||
}
|
||||
|
||||
public override Color BackColor
|
||||
{
|
||||
get
|
||||
{
|
||||
return bgColor;
|
||||
}
|
||||
set
|
||||
{
|
||||
bgColor = value;
|
||||
base.BackColor = value;
|
||||
// If value <> Color.Transparent Then
|
||||
// MyBase.BackColor = value
|
||||
// End If
|
||||
}
|
||||
}
|
||||
public bool IsAreaSelecting
|
||||
{
|
||||
get
|
||||
{
|
||||
return _IsAreaSelecting && startMousePos != lastMousePos;
|
||||
}
|
||||
}
|
||||
public SizeF ZoomFactor
|
||||
{
|
||||
get
|
||||
{
|
||||
return _ZoomFactor;
|
||||
}
|
||||
set
|
||||
{
|
||||
if (_ZoomFactor != value)
|
||||
{
|
||||
_ZoomFactor = value;
|
||||
ResetAllBufferedImages();
|
||||
ZoomFactorChanged?.Invoke(this, new EventArgs());
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
public PaintingControl()
|
||||
{
|
||||
PaintingObjects = new(this);
|
||||
PaintingObjectResizing.CheckEnabled += PaintingObjectResizing_CheckEnabled;
|
||||
DoubleBuffered = true;
|
||||
KeyDown += CheckKeyDown;
|
||||
KeyUp += CheckKeyDown;
|
||||
MouseClick += CheckMouseClick;
|
||||
MouseDown += CheckMouseDown;
|
||||
MouseUp += CheckMouseUp;
|
||||
MouseMove += CheckMouseMove;
|
||||
PaintingObjectAdded += PaintingControl_PaintingObjectAdded;
|
||||
PaintingObjectRemoved += PaintingControl_PaintingObjectAdded;
|
||||
MouseWheel += CheckMouseWheel;
|
||||
}
|
||||
|
||||
~PaintingControl()
|
||||
{
|
||||
PaintingObjectResizing.CheckEnabled -= PaintingObjectResizing_CheckEnabled;
|
||||
}
|
||||
|
||||
private void PaintingObjectResizing_CheckEnabled(PaintingObjectResizing sender, ref bool enabled)
|
||||
{
|
||||
if (PaintingObjects.Contains(sender.PaintingObject) && pressedAlt)
|
||||
enabled = false;
|
||||
}
|
||||
|
||||
private void ResetAllBufferedImages()
|
||||
{
|
||||
foreach (PaintingObject ob in PaintingObjects)
|
||||
ob.ResetImageBuffer();
|
||||
Refresh();
|
||||
}
|
||||
|
||||
protected void CheckKeyDown(object sender, KeyEventArgs e)
|
||||
{
|
||||
pressedShift = e.Shift;
|
||||
pressedControl = e.Control;
|
||||
pressedAlt = e.Alt;
|
||||
}
|
||||
|
||||
internal RectangleF AreaSelectionRectangle
|
||||
{
|
||||
get
|
||||
{
|
||||
return HelpfulDrawingFunctions.GetRectangle(startMousePos, lastMousePos);
|
||||
}
|
||||
}
|
||||
|
||||
protected void CheckMouseClick(object sender, MouseEventArgs e)
|
||||
{
|
||||
foreach (PaintingObject obj in GetObjects(new Point((int)Math.Round(e.X + Offset.X), (int)Math.Round(e.Y + Offset.Y))))
|
||||
{
|
||||
if (!obj.MouseTransparency)
|
||||
obj.RaiseMouseClick(GetMouseEventArgs(e, obj));
|
||||
}
|
||||
}
|
||||
|
||||
protected void CheckMouseDown(object sender, MouseEventArgs e)
|
||||
{
|
||||
lastMousePos = new Point((int)Math.Round(e.X + Offset.X), (int)Math.Round(e.Y + Offset.Y));
|
||||
|
||||
curObjMouseDown = GetObjects(lastMousePos).Where(n => !n.MouseTransparency).LastOrDefault();
|
||||
curObjMouseDown?.RaiseMouseDown(GetMouseEventArgs(e, curObjMouseDown));
|
||||
|
||||
if (curObjMouseDown is null || !curObjMouseDown.Selected || pressedControl)
|
||||
{
|
||||
bool hasMovedObjects = false;
|
||||
if (IsMovingObjects)
|
||||
{
|
||||
foreach (PaintingObject obj in GetSelectedObjects())
|
||||
{
|
||||
if (HelpfulDrawingFunctions.IsPointInRectangle(lastMousePos, obj.Rectangle))
|
||||
{
|
||||
hasMovedObjects = true;
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if (!hasMovedObjects && !_IsAreaSelecting)
|
||||
{
|
||||
var selChanged = new List<PaintingObject>();
|
||||
|
||||
if (AutoRemoveSelection && !pressedControl)
|
||||
{
|
||||
foreach (PaintingObject obj in PaintingObjects)
|
||||
{
|
||||
if (obj.Selected)
|
||||
{
|
||||
obj.SelectedDirect = false;
|
||||
if (!selChanged.Contains(obj))
|
||||
selChanged.Add(obj);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
if (AutoSingleSelection && curObjMouseDown is not null)
|
||||
{
|
||||
var objtosel = curObjMouseDown;
|
||||
if (objtosel.EnableSelection)
|
||||
{
|
||||
objtosel.SelectedDirect = !objtosel.Selected;
|
||||
if (!selChanged.Contains(objtosel))
|
||||
selChanged.Add(objtosel);
|
||||
else
|
||||
{
|
||||
selChanged.Remove(objtosel);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
SelectionChanged?.Invoke(this, new PaintingObjectEventArgs(selChanged.ToArray()));
|
||||
}
|
||||
}
|
||||
|
||||
if (pressedAlt)
|
||||
{
|
||||
|
||||
calcOffset_MouseOnTab = new Point(e.X, e.Y);
|
||||
calcOffset_LastOffset = Offset;
|
||||
calcOffset_IsActive = true;
|
||||
Cursor = Cursors.Arrow;
|
||||
}
|
||||
|
||||
else
|
||||
{
|
||||
|
||||
switch (e.Button)
|
||||
{
|
||||
case MouseButtons.Left:
|
||||
{
|
||||
savedPos.Clear();
|
||||
if (AutoMoveObjects)
|
||||
SaveObjectPositions(e, GetSelectedObjects());
|
||||
if (savedPos.Count > 0)
|
||||
IsMovingObjects = true;
|
||||
else if (AutoAreaSelection)
|
||||
{
|
||||
startMousePos = new Point((int)Math.Round(e.X + Offset.X), (int)Math.Round(e.Y + Offset.Y));
|
||||
lastMousePos = startMousePos; // New Point(e.X - Offset.X, e.Y - Offset.Y)
|
||||
_IsAreaSelecting = true;
|
||||
}
|
||||
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
}
|
||||
}
|
||||
public void RaiseSelectionChanged()
|
||||
{
|
||||
SelectionChanged?.Invoke(this, new PaintingObjectEventArgs(SelectedObjects));
|
||||
}
|
||||
protected void CheckMouseUp(object sender, MouseEventArgs e)
|
||||
{
|
||||
if (_IsAreaSelecting)
|
||||
_IsAreaSelecting = false;
|
||||
|
||||
if (IsMovingObjects)
|
||||
{
|
||||
IsMovingObjects = false;
|
||||
foreach (PaintingObject obj in GetSelectedObjects())
|
||||
obj.RaiseMoved(new EventArgs());
|
||||
AutoArrangeToGrid();
|
||||
}
|
||||
|
||||
if (curObjMouseDown is not null)
|
||||
{
|
||||
if (!curObjMouseDown.MouseTransparency)
|
||||
curObjMouseDown.RaiseMouseUp(GetMouseEventArgs(e, curObjMouseDown));
|
||||
curObjMouseDown = null;
|
||||
}
|
||||
|
||||
if (calcOffset_IsActive)
|
||||
{
|
||||
calcOffset_IsActive = false;
|
||||
Cursor = Cursors.Default;
|
||||
CalcNewOffset(e.Location);
|
||||
AfterScrollingDone?.Invoke(this, new EventArgs());
|
||||
}
|
||||
}
|
||||
protected void CheckMouseMove(object sender, MouseEventArgs e)
|
||||
{
|
||||
if (_IsAreaSelecting || IsMovingObjects)
|
||||
lastMousePos = new Point((int)Math.Round(e.X + Offset.X), (int)Math.Round(e.Y + Offset.Y));
|
||||
|
||||
if (_IsAreaSelecting)
|
||||
SelectControlsInArea();
|
||||
|
||||
if (IsMovingObjects)
|
||||
UpdateObjectPositions(e);
|
||||
|
||||
foreach (PaintingObject obj in GetObjects(new Point((int)Math.Round(e.X + Offset.X), (int)Math.Round(e.Y + Offset.Y))))
|
||||
{
|
||||
if (!obj.MouseTransparency)
|
||||
obj.RaiseMouseMove(GetMouseEventArgs(e, obj));
|
||||
}
|
||||
|
||||
var topObj = GetObject(new Point((int)Math.Round(e.X + Offset.X), (int)Math.Round(e.Y + Offset.Y)), true);
|
||||
if (topObj is not null)
|
||||
Cursor = topObj.Cursor;
|
||||
else if (calcOffset_IsActive)
|
||||
{
|
||||
Cursor = Cursors.Arrow;
|
||||
}
|
||||
else
|
||||
{
|
||||
Cursor = Cursors.Default;
|
||||
}
|
||||
|
||||
if (calcOffset_IsActive)
|
||||
{
|
||||
if (pressedAlt)
|
||||
CalcNewOffset(e.Location);
|
||||
else
|
||||
{
|
||||
calcOffset_IsActive = false;
|
||||
}
|
||||
}
|
||||
|
||||
Refresh();
|
||||
}
|
||||
|
||||
private void CalcNewOffset(Point newMousePos)
|
||||
{
|
||||
Offset = new PointF(calcOffset_LastOffset.X - (newMousePos.X - calcOffset_MouseOnTab.X), calcOffset_LastOffset.Y - (newMousePos.Y - calcOffset_MouseOnTab.Y));
|
||||
if (Offset.X < 0f)
|
||||
Offset = new PointF(0f, Offset.Y);
|
||||
if (Offset.Y < 0f)
|
||||
Offset = new PointF(Offset.X, 0f);
|
||||
}
|
||||
|
||||
private PaintingObject[] GetSelectedObjects()
|
||||
{
|
||||
var objs = new List<PaintingObject>();
|
||||
|
||||
foreach (PaintingObject obj in PaintingObjects)
|
||||
{
|
||||
if (obj.Selected)
|
||||
objs.Add(obj);
|
||||
}
|
||||
|
||||
return objs.ToArray();
|
||||
}
|
||||
|
||||
private void SaveObjectPositions(MouseEventArgs e, IList objs)
|
||||
{
|
||||
foreach (PaintingObject obj in objs)
|
||||
{
|
||||
if (!obj.HardcodedLocation && !savedPos.ContainsKey(obj))
|
||||
{
|
||||
savedPos.Add(obj, new PointF(e.X - obj.Location.X + Offset.X, e.Y - obj.Location.Y + Offset.Y));
|
||||
SaveObjectPositions(e, obj.PinnedObjects);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
private void UpdateObjectPositions(MouseEventArgs e)
|
||||
{
|
||||
UpdateObjectPositions(e, GetSelectedObjects());
|
||||
}
|
||||
|
||||
private void UpdateObjectPositions(MouseEventArgs e, IList<PaintingObject> objs, List<PaintingObject> movedObjs = null)
|
||||
{
|
||||
if (IsResizingObjs(objs))
|
||||
return;
|
||||
if (movedObjs is null)
|
||||
movedObjs = new List<PaintingObject>();
|
||||
|
||||
SuspendDrawing();
|
||||
|
||||
foreach (PaintingObject obj in objs)
|
||||
{
|
||||
var sp = savedPos[obj];
|
||||
|
||||
if (!movedObjs.Contains(obj))
|
||||
{
|
||||
if (UpdateObjectPosition(e, obj, sp))
|
||||
movedObjs.Add(obj);
|
||||
}
|
||||
|
||||
if (obj.PinnedObjects.Count > 0)
|
||||
{
|
||||
UpdateObjectPositions(e, obj.PinnedObjects, movedObjs);
|
||||
movedObjs.AddRange(obj.PinnedObjects.ToArray());
|
||||
}
|
||||
}
|
||||
|
||||
ResumeDrawing(false);
|
||||
}
|
||||
|
||||
private bool UpdateObjectPosition(MouseEventArgs e, PaintingObject obj, PointF sp)
|
||||
{
|
||||
bool moved = false;
|
||||
var cancel = new CancelEventArgs(false);
|
||||
obj.RaiseMovingBeforePositionUpdated(cancel);
|
||||
|
||||
if (!cancel.Cancel)
|
||||
{
|
||||
obj.Location = new Point((int)Math.Round(e.X - sp.X + Offset.X), (int)Math.Round(e.Y - sp.Y + Offset.Y));
|
||||
obj.RaiseMoving(new EventArgs());
|
||||
moved = true;
|
||||
}
|
||||
|
||||
return moved;
|
||||
}
|
||||
|
||||
private bool IsResizingObjs(IList<PaintingObject> objs)
|
||||
{
|
||||
foreach (PaintingObject obj in objs)
|
||||
{
|
||||
if (obj.IsResizing)
|
||||
return true;
|
||||
}
|
||||
return false;
|
||||
}
|
||||
|
||||
private MouseEventArgs GetMouseEventArgs(MouseEventArgs e, PaintingObject obj)
|
||||
{
|
||||
return new MouseEventArgs(e.Button, e.Clicks, (int)Math.Round(e.X - obj.X + Offset.X), (int)Math.Round(e.Y - obj.Y + Offset.Y), e.Delta);
|
||||
}
|
||||
|
||||
public PaintingObject GetObject(PointF p, bool UseExtRect = false)
|
||||
{
|
||||
PaintingObject val = null;
|
||||
|
||||
for (int i = PaintingObjects.Count - 1; i >= 0; i -= 1)
|
||||
{
|
||||
var obj = PaintingObjects[i];
|
||||
|
||||
if (val is null)
|
||||
{
|
||||
if (UseExtRect)
|
||||
{
|
||||
if (HelpfulDrawingFunctions.IsPointInRectangle(p, obj.RectangleExtended))
|
||||
val = obj;
|
||||
}
|
||||
else if (HelpfulDrawingFunctions.IsPointInRectangle(p, obj.Rectangle))
|
||||
{
|
||||
val = obj;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
return val;
|
||||
}
|
||||
|
||||
public PaintingObject[] GetObjects(Point p)
|
||||
{
|
||||
var objs = new List<PaintingObject>();
|
||||
|
||||
foreach (PaintingObject obj in PaintingObjects)
|
||||
{
|
||||
if (HelpfulDrawingFunctions.IsPointInRectangle(p, obj.RectangleExtended))
|
||||
objs.Add(obj);
|
||||
}
|
||||
|
||||
return objs.ToArray();
|
||||
}
|
||||
|
||||
public PaintingObject[] GetObjects(Point startPoint, Point endPoint)
|
||||
{
|
||||
return GetObjects(new Rectangle(startPoint, (Size)(endPoint - (Size)startPoint)));
|
||||
}
|
||||
|
||||
public PaintingObject[] GetObjects(Rectangle rect)
|
||||
{
|
||||
var objs = new List<PaintingObject>();
|
||||
|
||||
foreach (PaintingObject obj in PaintingObjects)
|
||||
{
|
||||
var objRect = obj.Rectangle;
|
||||
if (HelpfulDrawingFunctions.IsPointInRectangle(objRect.Location, rect) || HelpfulDrawingFunctions.IsPointInRectangle(objRect.Location + objRect.Size, rect) || HelpfulDrawingFunctions.IsPointInRectangle(new PointF(objRect.Left, objRect.Bottom), rect) || HelpfulDrawingFunctions.IsPointInRectangle(new PointF(objRect.Right, objRect.Top), rect))
|
||||
objs.Add(obj);
|
||||
}
|
||||
|
||||
return objs.ToArray();
|
||||
}
|
||||
|
||||
protected override CreateParams CreateParams
|
||||
{
|
||||
get
|
||||
{
|
||||
var cp = base.CreateParams;
|
||||
|
||||
// If EnableRealTransparency Then
|
||||
// cp.ExStyle = cp.ExStyle Or &H20 'WS_EX_TRANSPARENT
|
||||
// End If
|
||||
|
||||
return cp;
|
||||
}
|
||||
}
|
||||
|
||||
/// <summary>
|
||||
/// Sorg dafür, dass Events durch dieses Control durchdringen zum Parnet-Control.
|
||||
/// </summary>
|
||||
/// <param name="m"></param>
|
||||
protected override void WndProc(ref Message m)
|
||||
{
|
||||
const nint WM_NCHITTEST = 0x84;
|
||||
const nint HTTRANSPARENT = -1;
|
||||
|
||||
if (!VisibleForMouseEvents && m.Msg == WM_NCHITTEST)
|
||||
m.Result = HTTRANSPARENT;
|
||||
else
|
||||
{
|
||||
base.WndProc(ref m);
|
||||
}
|
||||
}
|
||||
|
||||
protected override void OnPaintBackground(PaintEventArgs e)
|
||||
{
|
||||
// Stop Drawing directly to the parent
|
||||
SuspendLayout();
|
||||
|
||||
// Draw Background
|
||||
// If Not EnableRealTransparency Then
|
||||
base.OnPaintBackground(e);
|
||||
// End If
|
||||
}
|
||||
|
||||
protected override void OnPaint(PaintEventArgs e)
|
||||
{
|
||||
// Draw PaintingObjects stuff
|
||||
if (StopDrawing)
|
||||
e.Graphics.DrawImage(bufferedImg, Point.Empty);
|
||||
else
|
||||
{
|
||||
{
|
||||
var withBlock = e.Graphics;
|
||||
withBlock.SmoothingMode = SmoothingMode.HighQuality;
|
||||
withBlock.PixelOffsetMode = PixelOffsetMode.HighQuality;
|
||||
withBlock.PageUnit = GraphicsUnit.Pixel;
|
||||
withBlock.InterpolationMode = InterpolationMode.HighQualityBicubic;
|
||||
}
|
||||
|
||||
if (GridVisible)
|
||||
DrawGridMethode?.Invoke(e, this, Offset);
|
||||
|
||||
var baserect = new RectangleF(Offset, Size);
|
||||
|
||||
foreach (PaintingObject obj in PaintingObjects)
|
||||
{
|
||||
if (obj.Visible && HelpfulDrawingFunctions.OverlapsTwoRectangles(obj.Rectangle, baserect))
|
||||
obj.Draw(e, Offset);
|
||||
}
|
||||
|
||||
if (_IsAreaSelecting)
|
||||
DrawAreaSelectionMethode?.Invoke(e, this, new PointF(startMousePos.X - Offset.X, startMousePos.Y - Offset.Y), new PointF(lastMousePos.X - Offset.X, lastMousePos.Y - Offset.Y));
|
||||
}
|
||||
|
||||
// Do default Drawing Methode
|
||||
base.OnPaint(e);
|
||||
|
||||
// Start Drawing directly to the Form
|
||||
ResumeLayout(false);
|
||||
}
|
||||
|
||||
public new Graphics CreateGraphics()
|
||||
{
|
||||
return base.CreateGraphics();
|
||||
}
|
||||
|
||||
public void PaintFullView(Graphics g)
|
||||
{
|
||||
foreach (PaintingObject obj in PaintingObjects)
|
||||
{
|
||||
if (obj.Visible)
|
||||
obj.Draw(g, PointF.Empty);
|
||||
}
|
||||
}
|
||||
|
||||
private SizeF CalcTextSize(PaintingObject obj)
|
||||
{
|
||||
return CalcTextSize(obj, Parent.CreateGraphics());
|
||||
}
|
||||
|
||||
private SizeF CalcTextSize(PaintingObject obj, Graphics g)
|
||||
{
|
||||
return g.MeasureString(obj.Text, obj.TextFont, (int)Math.Round(obj.Width));
|
||||
}
|
||||
|
||||
private void SelectControlsInArea()
|
||||
{
|
||||
var rect = HelpfulDrawingFunctions.GetRectangle(startMousePos, lastMousePos);
|
||||
foreach (PaintingObject obj in PaintingObjects)
|
||||
obj.Selected = startMousePos.X >= lastMousePos.X ? HelpfulDrawingFunctions.OverlapsTwoRectangles(obj.Rectangle, rect) : HelpfulDrawingFunctions.RectangleContainsRectangle(rect, obj.Rectangle);
|
||||
}
|
||||
|
||||
public void ArrangeToGrid(PaintingObject obj, bool snapPinnedObjects)
|
||||
{
|
||||
if (snapPinnedObjects || !IsPinnedObject(obj))
|
||||
{
|
||||
var zoomedGridChunkSize = new SizeF(GridChunkSize.Width * ZoomFactor.Width, GridChunkSize.Height * ZoomFactor.Height);
|
||||
|
||||
int modTop = (int)Math.Round(obj.Y % zoomedGridChunkSize.Height);
|
||||
int modLeft = (int)Math.Round(obj.X % zoomedGridChunkSize.Width);
|
||||
|
||||
int halfHeight = (int)Math.Round(zoomedGridChunkSize.Height / 2f);
|
||||
int halfWidth = (int)Math.Round(zoomedGridChunkSize.Width / 2f);
|
||||
|
||||
void zoomLocation(PaintingObject obj2)
|
||||
{
|
||||
if (modTop > halfHeight)
|
||||
obj2.Y += zoomedGridChunkSize.Height - modTop;
|
||||
else
|
||||
{
|
||||
obj2.Y -= modTop;
|
||||
}
|
||||
|
||||
if (modLeft > halfWidth)
|
||||
obj2.X += zoomedGridChunkSize.Width - modLeft;
|
||||
else
|
||||
{
|
||||
obj2.X -= modLeft;
|
||||
}
|
||||
};
|
||||
|
||||
zoomLocation(obj);
|
||||
|
||||
foreach (PaintingObject pinned in obj.PinnedObjects)
|
||||
zoomLocation(pinned);
|
||||
|
||||
int modH = (int)Math.Round(obj.Height % zoomedGridChunkSize.Height);
|
||||
int modW = (int)Math.Round(obj.Width % zoomedGridChunkSize.Width);
|
||||
|
||||
|
||||
void zoomSize(PaintingObject obj2) { if (obj2.EnableResize && !obj2.HardcodedSize) { if (modH > halfHeight) obj2.Height += zoomedGridChunkSize.Height - modH; else { obj2.Height -= modH; } if (modW > halfWidth) obj2.Width += zoomedGridChunkSize.Width - modW; else { obj2.Width -= modW; } } };
|
||||
|
||||
zoomSize(obj);
|
||||
|
||||
foreach (PaintingObject pinned in obj.PinnedObjects)
|
||||
zoomSize(pinned);
|
||||
}
|
||||
}
|
||||
|
||||
public bool IsPinnedObject(PaintingObject o)
|
||||
{
|
||||
foreach (PaintingObject obj in PaintingObjects)
|
||||
{
|
||||
if (obj.PinnedObjects.Contains(o))
|
||||
return true;
|
||||
}
|
||||
return false;
|
||||
}
|
||||
|
||||
public void AutoArrangeToGrid()
|
||||
{
|
||||
if (GridEnabled)
|
||||
{
|
||||
foreach (PaintingObject obj in GetSelectedObjects())
|
||||
{
|
||||
if (obj.AutoAlignToGrid)
|
||||
ArrangeToGrid(obj, false);
|
||||
}
|
||||
if (!StopDrawing)
|
||||
Refresh();
|
||||
}
|
||||
}
|
||||
|
||||
public SizeF GetFullSize()
|
||||
{
|
||||
return GetFullSize(PaintingObjects);
|
||||
}
|
||||
|
||||
public static SizeF GetFullSize(IEnumerable<PaintingObject> objects)
|
||||
{
|
||||
float curX = 0f;
|
||||
float curY = 0f;
|
||||
|
||||
foreach (PaintingObject po in objects)
|
||||
{
|
||||
float myX = po.X + po.Width;
|
||||
if (curX < myX)
|
||||
curX = myX;
|
||||
float myY = po.Y + po.Height;
|
||||
if (curY < myY)
|
||||
curY = myY;
|
||||
}
|
||||
|
||||
return new SizeF(curX + 20f, curY + 20f);
|
||||
}
|
||||
|
||||
internal void RaisePaintingObjectAdded(PaintingObjectEventArgs args)
|
||||
{
|
||||
PaintingObjectAdded?.Invoke(this, args);
|
||||
}
|
||||
internal void RaisePaintingObjectRemoved(PaintingObjectEventArgs args)
|
||||
{
|
||||
PaintingObjectRemoved?.Invoke(this, args);
|
||||
}
|
||||
|
||||
private void PaintingControl_PaintingObjectAdded(object sender, PaintingObjectEventArgs e)
|
||||
{
|
||||
// CalculateScrollValues()
|
||||
}
|
||||
|
||||
private void CheckMouseWheel(object sender, MouseEventArgs e)
|
||||
{
|
||||
if (pressedAlt)
|
||||
{
|
||||
float val = (float)(e.Delta / 120d / 10d);
|
||||
ZoomFactor = new SizeF((float)Math.Max((double)(ZoomFactor.Width + val), 0.25d), (float)Math.Max((double)(ZoomFactor.Height + val), 0.25d));
|
||||
Refresh();
|
||||
}
|
||||
else
|
||||
{
|
||||
// ...
|
||||
}
|
||||
}
|
||||
|
||||
public void SuspendDrawing()
|
||||
{
|
||||
if (_stopDrawing < 0)
|
||||
// bufferedImg = New Bitmap(Width, Height)
|
||||
// DrawToBitmap(bufferedImg, New Rectangle(0, 0, bufferedImg.Width, bufferedImg.Height))
|
||||
Utils.DrawingControl.SuspendDrawing(this);
|
||||
_stopDrawing += 1;
|
||||
}
|
||||
|
||||
public void ResumeDrawing()
|
||||
{
|
||||
ResumeDrawing(true);
|
||||
}
|
||||
|
||||
public void ResumeDrawing(bool executeRefresh)
|
||||
{
|
||||
if (_stopDrawing >= 0)
|
||||
_stopDrawing -= 1;
|
||||
|
||||
if (_stopDrawing == -1)
|
||||
// bufferedImg.Dispose()
|
||||
// bufferedImg = Nothing
|
||||
// If executeRefresh Then Refresh()
|
||||
Utils.DrawingControl.ResumeDrawing(this, executeRefresh);
|
||||
}
|
||||
|
||||
}
|
||||
@@ -1,120 +0,0 @@
|
||||
<?xml version="1.0" encoding="utf-8"?>
|
||||
<root>
|
||||
<!--
|
||||
Microsoft ResX Schema
|
||||
|
||||
Version 2.0
|
||||
|
||||
The primary goals of this format is to allow a simple XML format
|
||||
that is mostly human readable. The generation and parsing of the
|
||||
various data types are done through the TypeConverter classes
|
||||
associated with the data types.
|
||||
|
||||
Example:
|
||||
|
||||
... ado.net/XML headers & schema ...
|
||||
<resheader name="resmimetype">text/microsoft-resx</resheader>
|
||||
<resheader name="version">2.0</resheader>
|
||||
<resheader name="reader">System.Resources.ResXResourceReader, System.Windows.Forms, ...</resheader>
|
||||
<resheader name="writer">System.Resources.ResXResourceWriter, System.Windows.Forms, ...</resheader>
|
||||
<data name="Name1"><value>this is my long string</value><comment>this is a comment</comment></data>
|
||||
<data name="Color1" type="System.Drawing.Color, System.Drawing">Blue</data>
|
||||
<data name="Bitmap1" mimetype="application/x-microsoft.net.object.binary.base64">
|
||||
<value>[base64 mime encoded serialized .NET Framework object]</value>
|
||||
</data>
|
||||
<data name="Icon1" type="System.Drawing.Icon, System.Drawing" mimetype="application/x-microsoft.net.object.bytearray.base64">
|
||||
<value>[base64 mime encoded string representing a byte array form of the .NET Framework object]</value>
|
||||
<comment>This is a comment</comment>
|
||||
</data>
|
||||
|
||||
There are any number of "resheader" rows that contain simple
|
||||
name/value pairs.
|
||||
|
||||
Each data row contains a name, and value. The row also contains a
|
||||
type or mimetype. Type corresponds to a .NET class that support
|
||||
text/value conversion through the TypeConverter architecture.
|
||||
Classes that don't support this are serialized and stored with the
|
||||
mimetype set.
|
||||
|
||||
The mimetype is used for serialized objects, and tells the
|
||||
ResXResourceReader how to depersist the object. This is currently not
|
||||
extensible. For a given mimetype the value must be set accordingly:
|
||||
|
||||
Note - application/x-microsoft.net.object.binary.base64 is the format
|
||||
that the ResXResourceWriter will generate, however the reader can
|
||||
read any of the formats listed below.
|
||||
|
||||
mimetype: application/x-microsoft.net.object.binary.base64
|
||||
value : The object must be serialized with
|
||||
: System.Runtime.Serialization.Formatters.Binary.BinaryFormatter
|
||||
: and then encoded with base64 encoding.
|
||||
|
||||
mimetype: application/x-microsoft.net.object.soap.base64
|
||||
value : The object must be serialized with
|
||||
: System.Runtime.Serialization.Formatters.Soap.SoapFormatter
|
||||
: and then encoded with base64 encoding.
|
||||
|
||||
mimetype: application/x-microsoft.net.object.bytearray.base64
|
||||
value : The object must be serialized into a byte array
|
||||
: using a System.ComponentModel.TypeConverter
|
||||
: and then encoded with base64 encoding.
|
||||
-->
|
||||
<xsd:schema id="root" xmlns="" xmlns:xsd="http://www.w3.org/2001/XMLSchema" xmlns:msdata="urn:schemas-microsoft-com:xml-msdata">
|
||||
<xsd:import namespace="http://www.w3.org/XML/1998/namespace" />
|
||||
<xsd:element name="root" msdata:IsDataSet="true">
|
||||
<xsd:complexType>
|
||||
<xsd:choice maxOccurs="unbounded">
|
||||
<xsd:element name="metadata">
|
||||
<xsd:complexType>
|
||||
<xsd:sequence>
|
||||
<xsd:element name="value" type="xsd:string" minOccurs="0" />
|
||||
</xsd:sequence>
|
||||
<xsd:attribute name="name" use="required" type="xsd:string" />
|
||||
<xsd:attribute name="type" type="xsd:string" />
|
||||
<xsd:attribute name="mimetype" type="xsd:string" />
|
||||
<xsd:attribute ref="xml:space" />
|
||||
</xsd:complexType>
|
||||
</xsd:element>
|
||||
<xsd:element name="assembly">
|
||||
<xsd:complexType>
|
||||
<xsd:attribute name="alias" type="xsd:string" />
|
||||
<xsd:attribute name="name" type="xsd:string" />
|
||||
</xsd:complexType>
|
||||
</xsd:element>
|
||||
<xsd:element name="data">
|
||||
<xsd:complexType>
|
||||
<xsd:sequence>
|
||||
<xsd:element name="value" type="xsd:string" minOccurs="0" msdata:Ordinal="1" />
|
||||
<xsd:element name="comment" type="xsd:string" minOccurs="0" msdata:Ordinal="2" />
|
||||
</xsd:sequence>
|
||||
<xsd:attribute name="name" type="xsd:string" use="required" msdata:Ordinal="1" />
|
||||
<xsd:attribute name="type" type="xsd:string" msdata:Ordinal="3" />
|
||||
<xsd:attribute name="mimetype" type="xsd:string" msdata:Ordinal="4" />
|
||||
<xsd:attribute ref="xml:space" />
|
||||
</xsd:complexType>
|
||||
</xsd:element>
|
||||
<xsd:element name="resheader">
|
||||
<xsd:complexType>
|
||||
<xsd:sequence>
|
||||
<xsd:element name="value" type="xsd:string" minOccurs="0" msdata:Ordinal="1" />
|
||||
</xsd:sequence>
|
||||
<xsd:attribute name="name" type="xsd:string" use="required" />
|
||||
</xsd:complexType>
|
||||
</xsd:element>
|
||||
</xsd:choice>
|
||||
</xsd:complexType>
|
||||
</xsd:element>
|
||||
</xsd:schema>
|
||||
<resheader name="resmimetype">
|
||||
<value>text/microsoft-resx</value>
|
||||
</resheader>
|
||||
<resheader name="version">
|
||||
<value>2.0</value>
|
||||
</resheader>
|
||||
<resheader name="reader">
|
||||
<value>System.Resources.ResXResourceReader, System.Windows.Forms, Version=4.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089</value>
|
||||
</resheader>
|
||||
<resheader name="writer">
|
||||
<value>System.Resources.ResXResourceWriter, System.Windows.Forms, Version=4.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089</value>
|
||||
</resheader>
|
||||
</root>
|
||||
@@ -1,689 +0,0 @@
|
||||
Imports System.ComponentModel
|
||||
Imports System.Drawing
|
||||
Imports System.Drawing.Drawing2D
|
||||
Imports System.Windows.Forms
|
||||
|
||||
Imports Pilz.Drawing
|
||||
|
||||
Public Class PaintingControl
|
||||
Inherits UserControl
|
||||
Implements IPaintingObjectContainer
|
||||
|
||||
Private curObjMouseDown As PaintingObject = Nothing
|
||||
Private bgColor As Color = Color.White
|
||||
Private startMousePos As Point = Nothing
|
||||
Private lastMousePos As Point = Nothing
|
||||
Private lastHashCode As Integer = 0
|
||||
Private calcOffset_MouseOnTab As Point = Point.Empty
|
||||
Private calcOffset_IsActive As Boolean = False
|
||||
Private calcOffset_LastOffset As PointF = PointF.Empty
|
||||
|
||||
Private Overloads Property ForeColor As Color
|
||||
Private Overloads Property Font As Font
|
||||
Private Overloads Property Text As String
|
||||
|
||||
Public Property Offset As PointF = PointF.Empty
|
||||
Public ReadOnly Property PaintingObjects As New PaintingObjectList(Me)
|
||||
Public Property VisibleForMouseEvents As Boolean = True
|
||||
Public Property AutoAreaSelection As Boolean = True
|
||||
Public Property AutoSingleSelection As Boolean = True
|
||||
Public Property AutoMultiselection As Boolean = True
|
||||
Public Property AutoRemoveSelection As Boolean = True
|
||||
Public Property AreaSelectionDashStyle As DashStyle = DashStyle.DashDot
|
||||
Public Property AreaSelectionColor As Color = Color.CornflowerBlue
|
||||
Public Property AutoMoveObjects As Boolean = True
|
||||
Private _IsAreaSelecting As Boolean = False
|
||||
Public ReadOnly Property IsMovingObjects As Boolean = False
|
||||
Public Property GridEnabled As Boolean = True
|
||||
Public Property GridVisible As Boolean = False
|
||||
Public Property GridChunkSize As New Size(20, 20)
|
||||
Public Property GridColor As Color = Color.LightGray
|
||||
Public Property DrawGridMethode As DelegateDrawPaintingControlGridMethode = AddressOf DefaultDrawMethodes.DrawGrid
|
||||
Public Property DrawAreaSelectionMethode As DelegateDrawPaintingControlAreaSelectionMethode = AddressOf DefaultDrawMethodes.DrawAreaSelection
|
||||
Private _ZoomFactor As New SizeF(1, 1)
|
||||
|
||||
Private _stopDrawing As Integer = -1
|
||||
Private bufferedImg As Image = Nothing
|
||||
|
||||
Private pressedShift As Boolean = False
|
||||
Private pressedControl As Boolean = False
|
||||
Private pressedAlt As Boolean = False
|
||||
|
||||
Private savedPos As New Dictionary(Of PaintingObject, PointF)
|
||||
|
||||
Public Event SelectionChanged(sender As Object, e As PaintingObjectEventArgs)
|
||||
Public Event PaintingObjectAdded(sender As Object, e As PaintingObjectEventArgs)
|
||||
Public Event PaintingObjectRemoved(sender As Object, e As PaintingObjectEventArgs)
|
||||
Public Event AfterScrollingDone(sender As Object, e As EventArgs)
|
||||
Public Event ZoomFactorChanged(sender As Object, e As EventArgs)
|
||||
|
||||
Public ReadOnly Property SelectedObjects As PaintingObject()
|
||||
Get
|
||||
Dim objs As New List(Of PaintingObject)
|
||||
|
||||
For Each obj As PaintingObject In PaintingObjects
|
||||
If obj.Selected Then
|
||||
objs.Add(obj)
|
||||
End If
|
||||
Next
|
||||
|
||||
Return objs.ToArray
|
||||
End Get
|
||||
End Property
|
||||
|
||||
Public ReadOnly Property IsLayoutSuspended As Boolean
|
||||
Get
|
||||
Return CInt(Me.GetType.GetField("layoutSuspendCount", Reflection.BindingFlags.Instance Or Reflection.BindingFlags.NonPublic).GetValue(Me)) <> 0
|
||||
End Get
|
||||
End Property
|
||||
|
||||
Public ReadOnly Property StopDrawing As Boolean
|
||||
Get
|
||||
Return _stopDrawing > -1
|
||||
End Get
|
||||
End Property
|
||||
|
||||
Public Overrides Property BackColor As Color
|
||||
Get
|
||||
Return bgColor
|
||||
End Get
|
||||
Set(value As Color)
|
||||
bgColor = value
|
||||
MyBase.BackColor = value
|
||||
'If value <> Color.Transparent Then
|
||||
' MyBase.BackColor = value
|
||||
'End If
|
||||
End Set
|
||||
End Property
|
||||
Public ReadOnly Property IsAreaSelecting As Boolean
|
||||
Get
|
||||
Return _IsAreaSelecting AndAlso startMousePos <> lastMousePos
|
||||
End Get
|
||||
End Property
|
||||
Public Property ZoomFactor As SizeF
|
||||
Get
|
||||
Return _ZoomFactor
|
||||
End Get
|
||||
Set
|
||||
If _ZoomFactor <> Value Then
|
||||
_ZoomFactor = Value
|
||||
ResetAllBufferedImages()
|
||||
RaiseEvent ZoomFactorChanged(Me, New EventArgs)
|
||||
End If
|
||||
End Set
|
||||
End Property
|
||||
|
||||
Public Sub New()
|
||||
AddHandler PaintingObjectResizing.CheckEnabled, AddressOf PaintingObjectResizing_CheckEnabled
|
||||
DoubleBuffered = True
|
||||
End Sub
|
||||
|
||||
Protected Overrides Sub Finalize()
|
||||
RemoveHandler PaintingObjectResizing.CheckEnabled, AddressOf PaintingObjectResizing_CheckEnabled
|
||||
MyBase.Finalize()
|
||||
End Sub
|
||||
|
||||
Private Sub PaintingObjectResizing_CheckEnabled(sender As PaintingObjectResizing, ByRef enabled As Boolean)
|
||||
If PaintingObjects.Contains(sender.PaintingObject) AndAlso pressedAlt Then
|
||||
enabled = False
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Private Sub ResetAllBufferedImages()
|
||||
For Each ob As PaintingObject In PaintingObjects
|
||||
ob.ResetImageBuffer()
|
||||
Next
|
||||
Refresh()
|
||||
End Sub
|
||||
|
||||
Protected Sub CheckKeyDown(sender As Object, e As KeyEventArgs) Handles Me.KeyDown, Me.KeyUp
|
||||
pressedShift = e.Shift
|
||||
pressedControl = e.Control
|
||||
pressedAlt = e.Alt
|
||||
End Sub
|
||||
|
||||
Friend ReadOnly Property AreaSelectionRectangle As RectangleF
|
||||
Get
|
||||
Return HelpfulDrawingFunctions.GetRectangle(startMousePos, lastMousePos)
|
||||
End Get
|
||||
End Property
|
||||
|
||||
Protected Sub CheckMouseClick(sender As Object, e As MouseEventArgs) Handles Me.MouseClick
|
||||
For Each obj As PaintingObject In GetObjects(New Point(e.X + Offset.X, e.Y + Offset.Y))
|
||||
If Not obj.MouseTransparency Then
|
||||
obj.RaiseMouseClick(GetMouseEventArgs(e, obj))
|
||||
End If
|
||||
Next
|
||||
End Sub
|
||||
|
||||
Protected Sub CheckMouseDown(sender As Object, e As MouseEventArgs) Handles Me.MouseDown
|
||||
lastMousePos = New Point(e.X + Offset.X, e.Y + Offset.Y)
|
||||
|
||||
curObjMouseDown = GetObjects(lastMousePos).Where(Function(n) Not n.MouseTransparency).LastOrDefault
|
||||
curObjMouseDown?.RaiseMouseDown(GetMouseEventArgs(e, curObjMouseDown))
|
||||
|
||||
If curObjMouseDown Is Nothing OrElse Not curObjMouseDown.Selected OrElse pressedControl Then
|
||||
Dim hasMovedObjects As Boolean = False
|
||||
If _IsMovingObjects Then
|
||||
For Each obj As PaintingObject In GetSelectedObjects()
|
||||
If HelpfulDrawingFunctions.IsPointInRectangle(lastMousePos, obj.Rectangle) Then
|
||||
hasMovedObjects = True
|
||||
Exit For
|
||||
End If
|
||||
Next
|
||||
End If
|
||||
|
||||
If (Not hasMovedObjects) AndAlso (Not _IsAreaSelecting) Then
|
||||
Dim selChanged As New List(Of PaintingObject)
|
||||
|
||||
If AutoRemoveSelection AndAlso Not pressedControl Then
|
||||
For Each obj As PaintingObject In PaintingObjects
|
||||
If obj.Selected Then
|
||||
obj.SelectedDirect = False
|
||||
If Not selChanged.Contains(obj) Then
|
||||
selChanged.Add(obj)
|
||||
End If
|
||||
End If
|
||||
Next
|
||||
End If
|
||||
|
||||
If AutoSingleSelection AndAlso curObjMouseDown IsNot Nothing Then
|
||||
Dim objtosel As PaintingObject = curObjMouseDown
|
||||
If objtosel.EnableSelection Then
|
||||
objtosel.SelectedDirect = Not objtosel.Selected
|
||||
If Not selChanged.Contains(objtosel) Then
|
||||
selChanged.Add(objtosel)
|
||||
Else
|
||||
selChanged.Remove(objtosel)
|
||||
End If
|
||||
End If
|
||||
End If
|
||||
|
||||
RaiseEvent SelectionChanged(Me, New PaintingObjectEventArgs(selChanged.ToArray))
|
||||
End If
|
||||
End If
|
||||
|
||||
If pressedAlt Then
|
||||
|
||||
calcOffset_MouseOnTab = New Point(e.X, e.Y)
|
||||
calcOffset_LastOffset = Offset
|
||||
calcOffset_IsActive = True
|
||||
Cursor = Cursors.Arrow
|
||||
|
||||
Else
|
||||
|
||||
Select Case e.Button
|
||||
Case MouseButtons.Left
|
||||
savedPos.Clear()
|
||||
If AutoMoveObjects Then
|
||||
SaveObjectPositions(e, GetSelectedObjects)
|
||||
End If
|
||||
If savedPos.Count > 0 Then
|
||||
_IsMovingObjects = True
|
||||
ElseIf AutoAreaSelection Then
|
||||
startMousePos = New Point(e.X + Offset.X, e.Y + Offset.Y)
|
||||
lastMousePos = startMousePos 'New Point(e.X - Offset.X, e.Y - Offset.Y)
|
||||
_IsAreaSelecting = True
|
||||
End If
|
||||
End Select
|
||||
|
||||
End If
|
||||
End Sub
|
||||
Public Sub RaiseSelectionChanged()
|
||||
RaiseEvent SelectionChanged(Me, New PaintingObjectEventArgs(SelectedObjects))
|
||||
End Sub
|
||||
Protected Sub CheckMouseUp(sender As Object, e As MouseEventArgs) Handles Me.MouseUp
|
||||
If _IsAreaSelecting Then
|
||||
_IsAreaSelecting = False
|
||||
End If
|
||||
|
||||
If _IsMovingObjects Then
|
||||
_IsMovingObjects = False
|
||||
For Each obj As PaintingObject In GetSelectedObjects()
|
||||
obj.RaiseMoved(New EventArgs)
|
||||
Next
|
||||
AutoArrangeToGrid()
|
||||
End If
|
||||
|
||||
If curObjMouseDown IsNot Nothing Then
|
||||
If Not curObjMouseDown.MouseTransparency Then
|
||||
curObjMouseDown.RaiseMouseUp(GetMouseEventArgs(e, curObjMouseDown))
|
||||
End If
|
||||
curObjMouseDown = Nothing
|
||||
End If
|
||||
|
||||
If calcOffset_IsActive Then
|
||||
calcOffset_IsActive = False
|
||||
Cursor = Cursors.Default
|
||||
CalcNewOffset(e.Location)
|
||||
RaiseEvent AfterScrollingDone(Me, New EventArgs)
|
||||
End If
|
||||
End Sub
|
||||
Protected Sub CheckMouseMove(sender As Object, e As MouseEventArgs) Handles Me.MouseMove
|
||||
If _IsAreaSelecting OrElse _IsMovingObjects Then
|
||||
lastMousePos = New Point(e.X + Offset.X, e.Y + Offset.Y)
|
||||
End If
|
||||
|
||||
If _IsAreaSelecting Then
|
||||
SelectControlsInArea()
|
||||
End If
|
||||
|
||||
If _IsMovingObjects Then
|
||||
UpdateObjectPositions(e)
|
||||
End If
|
||||
|
||||
For Each obj As PaintingObject In GetObjects(New Point(e.X + Offset.X, e.Y + Offset.Y))
|
||||
If Not obj.MouseTransparency Then
|
||||
obj.RaiseMouseMove(GetMouseEventArgs(e, obj))
|
||||
End If
|
||||
Next
|
||||
|
||||
Dim topObj As PaintingObject = GetObject(New Point(e.X + Offset.X, e.Y + Offset.Y), True)
|
||||
If topObj IsNot Nothing Then
|
||||
Cursor = topObj.Cursor
|
||||
ElseIf calcOffset_IsActive Then
|
||||
Cursor = Cursors.Arrow
|
||||
Else
|
||||
Cursor = Cursors.Default
|
||||
End If
|
||||
|
||||
If calcOffset_IsActive Then
|
||||
If pressedAlt Then
|
||||
CalcNewOffset(e.Location)
|
||||
Else
|
||||
calcOffset_IsActive = False
|
||||
End If
|
||||
End If
|
||||
|
||||
Refresh()
|
||||
End Sub
|
||||
|
||||
Private Sub CalcNewOffset(newMousePos As Point)
|
||||
Offset = New PointF(calcOffset_LastOffset.X - (newMousePos.X - calcOffset_MouseOnTab.X),
|
||||
calcOffset_LastOffset.Y - (newMousePos.Y - calcOffset_MouseOnTab.Y))
|
||||
If Offset.X < 0 Then
|
||||
Offset = New PointF(0, Offset.Y)
|
||||
End If
|
||||
If Offset.Y < 0 Then
|
||||
Offset = New PointF(Offset.X, 0)
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Private Function GetSelectedObjects() As PaintingObject()
|
||||
Dim objs As New List(Of PaintingObject)
|
||||
|
||||
For Each obj As PaintingObject In PaintingObjects
|
||||
If obj.Selected Then objs.Add(obj)
|
||||
Next
|
||||
|
||||
Return objs.ToArray
|
||||
End Function
|
||||
|
||||
Private Sub SaveObjectPositions(e As MouseEventArgs, objs As IList)
|
||||
For Each obj As PaintingObject In objs
|
||||
If Not obj.HardcodedLocation AndAlso Not savedPos.ContainsKey(obj) Then
|
||||
savedPos.Add(obj, New PointF(e.X - obj.Location.X + Offset.X, e.Y - obj.Location.Y + Offset.Y))
|
||||
SaveObjectPositions(e, obj.PinnedObjects)
|
||||
End If
|
||||
Next
|
||||
End Sub
|
||||
|
||||
Private Sub UpdateObjectPositions(e As MouseEventArgs)
|
||||
UpdateObjectPositions(e, GetSelectedObjects)
|
||||
End Sub
|
||||
|
||||
Private Sub UpdateObjectPositions(e As MouseEventArgs, objs As IList(Of PaintingObject), Optional movedObjs As List(Of PaintingObject) = Nothing)
|
||||
If IsResizingObjs(objs) Then Return
|
||||
If movedObjs Is Nothing Then movedObjs = New List(Of PaintingObject)
|
||||
|
||||
SuspendDrawing()
|
||||
|
||||
For Each obj As PaintingObject In objs
|
||||
Dim sp As PointF = savedPos(obj)
|
||||
|
||||
If Not movedObjs.Contains(obj) Then
|
||||
If UpdateObjectPosition(e, obj, sp) Then
|
||||
movedObjs.Add(obj)
|
||||
End If
|
||||
End If
|
||||
|
||||
If obj.PinnedObjects.Count > 0 Then
|
||||
UpdateObjectPositions(e, obj.PinnedObjects, movedObjs)
|
||||
movedObjs.AddRange(obj.PinnedObjects.ToArray)
|
||||
End If
|
||||
Next
|
||||
|
||||
ResumeDrawing(False)
|
||||
End Sub
|
||||
|
||||
Private Function UpdateObjectPosition(e As MouseEventArgs, obj As PaintingObject, sp As PointF) As Boolean
|
||||
Dim moved As Boolean = False
|
||||
Dim cancel As New CancelEventArgs(False)
|
||||
obj.RaiseMovingBeforePositionUpdated(cancel)
|
||||
|
||||
If Not cancel.Cancel Then
|
||||
obj.Location = New Point(e.X - sp.X + Offset.X,
|
||||
e.Y - sp.Y + Offset.Y)
|
||||
obj.RaiseMoving(New EventArgs)
|
||||
moved = True
|
||||
End If
|
||||
|
||||
Return moved
|
||||
End Function
|
||||
|
||||
Private Function IsResizingObjs(objs As IList(Of PaintingObject)) As Boolean
|
||||
For Each obj As PaintingObject In objs
|
||||
If obj.IsResizing Then Return True
|
||||
Next
|
||||
Return False
|
||||
End Function
|
||||
|
||||
Private Function GetMouseEventArgs(e As MouseEventArgs, obj As PaintingObject) As MouseEventArgs
|
||||
Return New MouseEventArgs(e.Button, e.Clicks, e.X - obj.X + Offset.X, e.Y - obj.Y + Offset.Y, e.Delta)
|
||||
End Function
|
||||
|
||||
Public Function GetObject(p As PointF, Optional UseExtRect As Boolean = False) As PaintingObject
|
||||
Dim val As PaintingObject = Nothing
|
||||
|
||||
For i As Integer = PaintingObjects.Count - 1 To 0 Step -1
|
||||
Dim obj As PaintingObject = PaintingObjects(i)
|
||||
|
||||
If val Is Nothing Then
|
||||
If UseExtRect Then
|
||||
If HelpfulDrawingFunctions.IsPointInRectangle(p, obj.RectangleExtended) Then
|
||||
val = obj
|
||||
End If
|
||||
Else
|
||||
If HelpfulDrawingFunctions.IsPointInRectangle(p, obj.Rectangle) Then
|
||||
val = obj
|
||||
End If
|
||||
End If
|
||||
End If
|
||||
Next
|
||||
|
||||
Return val
|
||||
End Function
|
||||
|
||||
Public Function GetObjects(p As Point) As PaintingObject()
|
||||
Dim objs As New List(Of PaintingObject)
|
||||
|
||||
For Each obj As PaintingObject In PaintingObjects
|
||||
If HelpfulDrawingFunctions.IsPointInRectangle(p, obj.RectangleExtended) Then
|
||||
objs.Add(obj)
|
||||
End If
|
||||
Next
|
||||
|
||||
Return objs.ToArray
|
||||
End Function
|
||||
|
||||
Public Function GetObjects(startPoint As Point, endPoint As Point) As PaintingObject()
|
||||
Return GetObjects(New Rectangle(startPoint, CType(endPoint - startPoint, Size)))
|
||||
End Function
|
||||
|
||||
Public Function GetObjects(rect As Rectangle) As PaintingObject()
|
||||
Dim objs As New List(Of PaintingObject)
|
||||
|
||||
For Each obj As PaintingObject In PaintingObjects
|
||||
Dim objRect As RectangleF = obj.Rectangle
|
||||
If HelpfulDrawingFunctions.IsPointInRectangle(objRect.Location, rect) OrElse
|
||||
HelpfulDrawingFunctions.IsPointInRectangle(objRect.Location + objRect.Size, rect) OrElse
|
||||
HelpfulDrawingFunctions.IsPointInRectangle(New PointF(objRect.Left, objRect.Bottom), rect) OrElse
|
||||
HelpfulDrawingFunctions.IsPointInRectangle(New PointF(objRect.Right, objRect.Top), rect) Then
|
||||
objs.Add(obj)
|
||||
End If
|
||||
Next
|
||||
|
||||
Return objs.ToArray
|
||||
End Function
|
||||
|
||||
Protected Overrides ReadOnly Property CreateParams As CreateParams
|
||||
Get
|
||||
Dim cp = MyBase.CreateParams
|
||||
|
||||
'If EnableRealTransparency Then
|
||||
' cp.ExStyle = cp.ExStyle Or &H20 'WS_EX_TRANSPARENT
|
||||
'End If
|
||||
|
||||
Return cp
|
||||
End Get
|
||||
End Property
|
||||
|
||||
''' <summary>
|
||||
''' Sorg dafür, dass Events durch dieses Control durchdringen zum Parnet-Control.
|
||||
''' </summary>
|
||||
''' <param name="m"></param>
|
||||
Protected Overrides Sub WndProc(ByRef m As Message)
|
||||
Const WM_NCHITTEST As Integer = &H84
|
||||
Const HTTRANSPARENT As Integer = -1
|
||||
|
||||
If Not VisibleForMouseEvents AndAlso m.Msg = WM_NCHITTEST Then
|
||||
m.Result = CType(HTTRANSPARENT, IntPtr)
|
||||
Else
|
||||
MyBase.WndProc(m)
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Protected Overrides Sub OnPaintBackground(e As PaintEventArgs)
|
||||
'Stop Drawing directly to the parent
|
||||
Me.SuspendLayout()
|
||||
|
||||
'Draw Background
|
||||
'If Not EnableRealTransparency Then
|
||||
MyBase.OnPaintBackground(e)
|
||||
'End If
|
||||
End Sub
|
||||
|
||||
Protected Overrides Sub OnPaint(e As PaintEventArgs)
|
||||
'Draw PaintingObjects stuff
|
||||
If StopDrawing Then
|
||||
e.Graphics.DrawImage(bufferedImg, Point.Empty)
|
||||
Else
|
||||
With e.Graphics
|
||||
.SmoothingMode = SmoothingMode.HighQuality
|
||||
.PixelOffsetMode = PixelOffsetMode.HighQuality
|
||||
.PageUnit = GraphicsUnit.Pixel
|
||||
.InterpolationMode = InterpolationMode.HighQualityBicubic
|
||||
End With
|
||||
|
||||
If GridVisible Then
|
||||
DrawGridMethode?.Invoke(e, Me, Offset)
|
||||
End If
|
||||
|
||||
Dim baserect As RectangleF = New RectangleF(Offset, Size)
|
||||
|
||||
For Each obj As PaintingObject In PaintingObjects
|
||||
If obj.Visible AndAlso HelpfulDrawingFunctions.OverlapsTwoRectangles(obj.Rectangle, baserect) Then
|
||||
obj.Draw(e, Offset)
|
||||
End If
|
||||
Next
|
||||
|
||||
If _IsAreaSelecting Then
|
||||
DrawAreaSelectionMethode?.Invoke(e, Me, New PointF(startMousePos.X - Offset.X, startMousePos.Y - Offset.Y), New PointF(lastMousePos.X - Offset.X, lastMousePos.Y - Offset.Y))
|
||||
End If
|
||||
End If
|
||||
|
||||
'Do default Drawing Methode
|
||||
MyBase.OnPaint(e)
|
||||
|
||||
'Start Drawing directly to the Form
|
||||
ResumeLayout(False)
|
||||
End Sub
|
||||
|
||||
Public Overloads Function CreateGraphics() As Graphics
|
||||
Return MyBase.CreateGraphics
|
||||
End Function
|
||||
|
||||
Public Sub PaintFullView(g As Graphics)
|
||||
For Each obj As PaintingObject In PaintingObjects
|
||||
If obj.Visible Then
|
||||
obj.Draw(g, PointF.Empty)
|
||||
End If
|
||||
Next
|
||||
End Sub
|
||||
|
||||
Private Function CalcTextSize(obj As PaintingObject) As SizeF
|
||||
Return CalcTextSize(obj, Parent.CreateGraphics)
|
||||
End Function
|
||||
|
||||
Private Function CalcTextSize(obj As PaintingObject, g As Graphics) As SizeF
|
||||
Return g.MeasureString(obj.Text, obj.TextFont, CInt(obj.Width))
|
||||
End Function
|
||||
|
||||
Private Sub SelectControlsInArea()
|
||||
Dim rect As RectangleF = GetRectangle(startMousePos, lastMousePos)
|
||||
For Each obj As PaintingObject In PaintingObjects
|
||||
obj.Selected = If(startMousePos.X >= lastMousePos.X,
|
||||
OverlapsTwoRectangles(obj.Rectangle, rect),
|
||||
RectangleContainsRectangle(rect, obj.Rectangle))
|
||||
Next
|
||||
End Sub
|
||||
|
||||
Public Sub ArrangeToGrid(obj As PaintingObject, snapPinnedObjects As Boolean)
|
||||
If snapPinnedObjects OrElse Not IsPinnedObject(obj) Then
|
||||
Dim zoomedGridChunkSize As New SizeF(GridChunkSize.Width * ZoomFactor.Width, Me.GridChunkSize.Height * ZoomFactor.Height)
|
||||
|
||||
Dim modTop As Integer = obj.Y Mod zoomedGridChunkSize.Height
|
||||
Dim modLeft As Integer = obj.X Mod zoomedGridChunkSize.Width
|
||||
|
||||
Dim halfHeight As Integer = zoomedGridChunkSize.Height / 2
|
||||
Dim halfWidth As Integer = zoomedGridChunkSize.Width / 2
|
||||
|
||||
Dim zoomLocation =
|
||||
Sub(obj2 As PaintingObject)
|
||||
If modTop > halfHeight Then
|
||||
obj2.Y += (zoomedGridChunkSize.Height - modTop)
|
||||
Else
|
||||
obj2.Y -= modTop
|
||||
End If
|
||||
|
||||
If modLeft > halfWidth Then
|
||||
obj2.X += (zoomedGridChunkSize.Width - modLeft)
|
||||
Else
|
||||
obj2.X -= modLeft
|
||||
End If
|
||||
End Sub
|
||||
|
||||
zoomLocation(obj)
|
||||
|
||||
For Each pinned As PaintingObject In obj.PinnedObjects
|
||||
zoomLocation(pinned)
|
||||
Next
|
||||
|
||||
Dim modH As Integer = obj.Height Mod zoomedGridChunkSize.Height
|
||||
Dim modW As Integer = obj.Width Mod zoomedGridChunkSize.Width
|
||||
|
||||
Dim zoomSize =
|
||||
Sub(obj2 As PaintingObject)
|
||||
If obj2.EnableResize AndAlso Not obj2.HardcodedSize Then
|
||||
If modH > halfHeight Then
|
||||
obj2.Height += (zoomedGridChunkSize.Height - modH)
|
||||
Else
|
||||
obj2.Height -= modH
|
||||
End If
|
||||
|
||||
If modW > halfWidth Then
|
||||
obj2.Width += (zoomedGridChunkSize.Width - modW)
|
||||
Else
|
||||
obj2.Width -= modW
|
||||
End If
|
||||
End If
|
||||
End Sub
|
||||
|
||||
zoomSize(obj)
|
||||
|
||||
For Each pinned As PaintingObject In obj.PinnedObjects
|
||||
zoomSize(pinned)
|
||||
Next
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Public Function IsPinnedObject(o As PaintingObject) As Boolean
|
||||
For Each obj As PaintingObject In PaintingObjects
|
||||
If obj.PinnedObjects.Contains(o) Then
|
||||
Return True
|
||||
End If
|
||||
Next
|
||||
Return False
|
||||
End Function
|
||||
|
||||
Public Sub AutoArrangeToGrid()
|
||||
If GridEnabled Then
|
||||
For Each obj As PaintingObject In GetSelectedObjects()
|
||||
If obj.AutoAlignToGrid Then
|
||||
ArrangeToGrid(obj, False)
|
||||
End If
|
||||
Next
|
||||
If Not StopDrawing Then Refresh()
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Public Function GetFullSize() As SizeF
|
||||
Return GetFullSize(PaintingObjects)
|
||||
End Function
|
||||
|
||||
Public Shared Function GetFullSize(objects As IEnumerable(Of PaintingObject)) As SizeF
|
||||
Dim curX As Single = 0
|
||||
Dim curY As Single = 0
|
||||
|
||||
For Each po As PaintingObject In objects
|
||||
Dim myX As Single = po.X + po.Width
|
||||
If curX < myX Then
|
||||
curX = myX
|
||||
End If
|
||||
Dim myY As Single = po.Y + po.Height
|
||||
If curY < myY Then
|
||||
curY = myY
|
||||
End If
|
||||
Next
|
||||
|
||||
Return New SizeF(curX + 20, curY + 20)
|
||||
End Function
|
||||
|
||||
Friend Sub RaisePaintingObjectAdded(args As PaintingObjectEventArgs)
|
||||
RaiseEvent PaintingObjectAdded(Me, args)
|
||||
End Sub
|
||||
Friend Sub RaisePaintingObjectRemoved(args As PaintingObjectEventArgs)
|
||||
RaiseEvent PaintingObjectRemoved(Me, args)
|
||||
End Sub
|
||||
|
||||
Private Sub PaintingControl_PaintingObjectAdded(sender As Object, e As PaintingObjectEventArgs) Handles Me.PaintingObjectAdded, Me.PaintingObjectRemoved
|
||||
'CalculateScrollValues()
|
||||
End Sub
|
||||
|
||||
Private Sub CheckMouseWheel(sender As Object, e As MouseEventArgs) Handles Me.MouseWheel
|
||||
If pressedAlt Then
|
||||
Dim val As Single = e.Delta / 120 / 10
|
||||
ZoomFactor = New SizeF(Math.Max(ZoomFactor.Width + val, 0.25), Math.Max(ZoomFactor.Height + val, 0.25))
|
||||
Refresh()
|
||||
Else
|
||||
'...
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Public Sub SuspendDrawing()
|
||||
If _stopDrawing < 0 Then
|
||||
'bufferedImg = New Bitmap(Width, Height)
|
||||
'DrawToBitmap(bufferedImg, New Rectangle(0, 0, bufferedImg.Width, bufferedImg.Height))
|
||||
Utils.SuspendDrawing(Me)
|
||||
End If
|
||||
_stopDrawing += 1
|
||||
End Sub
|
||||
|
||||
Public Sub ResumeDrawing()
|
||||
ResumeDrawing(True)
|
||||
End Sub
|
||||
|
||||
Public Sub ResumeDrawing(executeRefresh As Boolean)
|
||||
If _stopDrawing >= 0 Then
|
||||
_stopDrawing -= 1
|
||||
End If
|
||||
|
||||
If _stopDrawing = -1 Then
|
||||
'bufferedImg.Dispose()
|
||||
'bufferedImg = Nothing
|
||||
'If executeRefresh Then Refresh()
|
||||
Utils.ResumeDrawing(Me, executeRefresh)
|
||||
End If
|
||||
End Sub
|
||||
|
||||
End Class
|
||||
@@ -1,11 +0,0 @@
|
||||
using System.Drawing;
|
||||
using System.Windows.Forms;
|
||||
|
||||
namespace Pilz.UI;
|
||||
|
||||
|
||||
public delegate void DelegateDrawPaintingObjectMethode(PaintingObjectPaintEventArgs e);
|
||||
|
||||
public delegate void DelegateDrawPaintingControlGridMethode(PaintEventArgs e, PaintingControl pc, PointF offset);
|
||||
|
||||
public delegate void DelegateDrawPaintingControlAreaSelectionMethode(PaintEventArgs e, PaintingControl pc, PointF startMousePos, PointF lastMousePos);
|
||||
@@ -1,6 +0,0 @@
|
||||
Imports System.Drawing
|
||||
Imports System.Windows.Forms
|
||||
|
||||
Public Delegate Sub DelegateDrawPaintingObjectMethode(e As PaintingObjectPaintEventArgs)
|
||||
Public Delegate Sub DelegateDrawPaintingControlGridMethode(e As PaintEventArgs, pc As PaintingControl, offset As PointF)
|
||||
Public Delegate Sub DelegateDrawPaintingControlAreaSelectionMethode(e As PaintEventArgs, pc As PaintingControl, startMousePos As PointF, lastMousePos As PointF)
|
||||
@@ -1,828 +0,0 @@
|
||||
using Newtonsoft.Json;
|
||||
using System;
|
||||
using System.Collections.Generic;
|
||||
using System.ComponentModel;
|
||||
using System.Drawing;
|
||||
using System.Drawing.Drawing2D;
|
||||
using System.Linq;
|
||||
using System.Reflection;
|
||||
using System.Windows.Forms;
|
||||
|
||||
namespace Pilz.UI;
|
||||
|
||||
|
||||
[Serializable]
|
||||
public class PaintingObject : ICloneable, IPaintingObjectContainer
|
||||
{
|
||||
|
||||
private PaintingObjectResizing resizeEngine = null;
|
||||
private bool _Selected = false;
|
||||
|
||||
private PaintingControl _Parent = null;
|
||||
public Color FillColor { get; set; } = Color.Blue;
|
||||
public Color OutlineColor { get; set; } = Color.DarkBlue;
|
||||
public float OutlineThicknes { get; set; } = 1f;
|
||||
public DashStyle OutlineDashStyle { get; set; } = DashStyle.Solid;
|
||||
public LineCapProps LineStartCap { get; set; } = null;
|
||||
public LineCapProps LineEndCap { get; set; } = null;
|
||||
[JsonProperty]
|
||||
private string _Text = "";
|
||||
public TextPosition TextPosition { get; set; } = TextPosition.FullCenter;
|
||||
public StringAlignment VerticalTextAlignment { get; set; } = StringAlignment.Center;
|
||||
public StringAlignment HorizontalTextAlignment { get; set; } = StringAlignment.Center;
|
||||
public Font TextFont { get; set; } = new Font(FontFamily.GenericSansSerif, 8.25f);
|
||||
public Color TextColor { get; set; } = Color.Black;
|
||||
[JsonProperty]
|
||||
private PointF _Location = new PointF(50f, 50f);
|
||||
[JsonProperty]
|
||||
private SizeF _Size = new SizeF(50f, 80f);
|
||||
public bool EnableFill { get; set; } = true;
|
||||
public bool EnableOutline { get; set; } = true;
|
||||
public Color SelectionColor { get; set; } = Color.CornflowerBlue;
|
||||
public DashStyle SelectionDashStyle { get; set; } = DashStyle.Dot;
|
||||
[JsonProperty]
|
||||
private bool _EnableSelection = true;
|
||||
public Image Image { get; set; } = null;
|
||||
[JsonIgnore]
|
||||
public Image BufferedImage { get; set; } = null;
|
||||
public ImageSizeMode ImageSizeMode { get; set; }
|
||||
public PaintingObjectImageProperties ImageProperties { get; set; } = new PaintingObjectImageProperties();
|
||||
[JsonIgnore]
|
||||
public object Tag { get; set; } = null;
|
||||
public string Name { get; set; } = "";
|
||||
public List<PaintingObject> PinnedObjects { get; private set; } = new List<PaintingObject>();
|
||||
[JsonIgnore]
|
||||
public List<DelegateDrawPaintingObjectMethode> DrawMethodes { get; private set; } = new List<DelegateDrawPaintingObjectMethode>();
|
||||
[JsonIgnore]
|
||||
public DelegateDrawPaintingObjectMethode DrawSelectionMethode { get; private set; } = DefaultDrawMethodes.DrawSelection;
|
||||
public Cursor Cursor { get; set; } = Cursors.Default;
|
||||
public bool HardcodedSize { get; set; } = false;
|
||||
public bool HardcodedLocation { get; set; } = false;
|
||||
[JsonProperty]
|
||||
private bool _Visible = true;
|
||||
[JsonProperty]
|
||||
private bool _AutoAlignToGrid = false;
|
||||
public bool MouseTransparency { get; set; } = false;
|
||||
public PaintingObjectLayering Layering { get; private set; }
|
||||
public PaintingObjectList PaintingObjects { get; private set; }
|
||||
[JsonIgnore]
|
||||
public ulong ErrorsAtDrawing { get; private set; } = 0UL;
|
||||
|
||||
public event MouseClickEventHandler MouseClick;
|
||||
|
||||
public delegate void MouseClickEventHandler(PaintingObject sender, MouseEventArgs e);
|
||||
public event MouseDownEventHandler MouseDown;
|
||||
|
||||
public delegate void MouseDownEventHandler(PaintingObject sender, MouseEventArgs e);
|
||||
public event MouseUpEventHandler MouseUp;
|
||||
|
||||
public delegate void MouseUpEventHandler(PaintingObject sender, MouseEventArgs e);
|
||||
public event MouseMoveEventHandler MouseMove;
|
||||
|
||||
public delegate void MouseMoveEventHandler(PaintingObject sender, MouseEventArgs e);
|
||||
public event SelectedChangedEventHandler SelectedChanged;
|
||||
|
||||
public delegate void SelectedChangedEventHandler(PaintingObject sender, EventArgs e);
|
||||
public event PaintEventHandler Paint;
|
||||
|
||||
public delegate void PaintEventHandler(PaintingObject sender, PaintEventArgs e);
|
||||
public event ParentChangedEventHandler ParentChanged;
|
||||
|
||||
public delegate void ParentChangedEventHandler(PaintingObject sender, EventArgs e);
|
||||
public event VisibleChangedEventHandler VisibleChanged;
|
||||
|
||||
public delegate void VisibleChangedEventHandler(PaintingObject sender, EventArgs e);
|
||||
public event MovedEventHandler Moved;
|
||||
|
||||
public delegate void MovedEventHandler(PaintingObject sender, EventArgs e);
|
||||
public event MovingEventHandler Moving;
|
||||
|
||||
public delegate void MovingEventHandler(PaintingObject sender, EventArgs e);
|
||||
public event MovingBeforePositionUpdatedEventHandler MovingBeforePositionUpdated;
|
||||
|
||||
public delegate void MovingBeforePositionUpdatedEventHandler(PaintingObject sender, CancelEventArgs e);
|
||||
|
||||
public PaintingObject()
|
||||
{
|
||||
Layering = new(this);
|
||||
PaintingObjects = new PaintingObjectList(_Parent) { EnableRaisingEvents = false };
|
||||
}
|
||||
|
||||
public PaintingObject(PaintingObjectType @type) : this()
|
||||
{
|
||||
Type = type;
|
||||
}
|
||||
|
||||
public PaintingObject(PaintingObjectType @type, DelegateDrawPaintingObjectMethode[] drawMethodes) : this(type)
|
||||
{
|
||||
DrawMethodes.AddRange(drawMethodes);
|
||||
}
|
||||
|
||||
internal void RaiseMouseClick(MouseEventArgs e)
|
||||
{
|
||||
MouseClick?.Invoke(this, e);
|
||||
}
|
||||
internal void RaiseMouseDown(MouseEventArgs e)
|
||||
{
|
||||
MouseDown?.Invoke(this, e);
|
||||
}
|
||||
internal void RaiseMouseUp(MouseEventArgs e)
|
||||
{
|
||||
MouseUp?.Invoke(this, e);
|
||||
}
|
||||
internal void RaiseMouseMove(MouseEventArgs e)
|
||||
{
|
||||
MouseMove?.Invoke(this, e);
|
||||
}
|
||||
private void RaisePaint(PaintEventArgs e)
|
||||
{
|
||||
Paint?.Invoke(this, e);
|
||||
}
|
||||
internal void RaiseMoved(EventArgs e)
|
||||
{
|
||||
Moved?.Invoke(this, e);
|
||||
}
|
||||
internal void RaiseMoving(EventArgs e)
|
||||
{
|
||||
Moving?.Invoke(this, e);
|
||||
}
|
||||
internal void RaiseMovingBeforePositionUpdated(EventArgs e)
|
||||
{
|
||||
MovingBeforePositionUpdated?.Invoke(this, (CancelEventArgs)e);
|
||||
}
|
||||
|
||||
public PaintingObjectType Type
|
||||
{
|
||||
get
|
||||
{
|
||||
var tt = PaintingObjectType.Custom;
|
||||
|
||||
foreach (DelegateDrawPaintingObjectMethode d in DrawMethodes)
|
||||
{
|
||||
if (ReferenceEquals(d.Method.DeclaringType, typeof(DefaultDrawMethodes)))
|
||||
{
|
||||
switch (d.Method.Name ?? "")
|
||||
{
|
||||
case "DrawPicture":
|
||||
{
|
||||
tt = tt | PaintingObjectType.Picture;
|
||||
break;
|
||||
}
|
||||
case "DrawText":
|
||||
{
|
||||
tt = tt | PaintingObjectType.Text;
|
||||
break;
|
||||
}
|
||||
case "DrawRectangle":
|
||||
{
|
||||
tt = tt | PaintingObjectType.Rectangle;
|
||||
break;
|
||||
}
|
||||
case "DrawEllipse":
|
||||
{
|
||||
tt = tt | PaintingObjectType.Elipse;
|
||||
break;
|
||||
}
|
||||
case "DrawTriangle":
|
||||
{
|
||||
tt = tt | PaintingObjectType.Triangle;
|
||||
break;
|
||||
}
|
||||
case "DrawLine":
|
||||
{
|
||||
tt = tt | PaintingObjectType.Line;
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
return tt;
|
||||
}
|
||||
set
|
||||
{
|
||||
DrawMethodes.Clear();
|
||||
|
||||
if ((value & PaintingObjectType.Picture) == PaintingObjectType.Picture)
|
||||
DrawMethodes.Add(DefaultDrawMethodes.DrawPicture);
|
||||
|
||||
if ((value & PaintingObjectType.Rectangle) == PaintingObjectType.Rectangle)
|
||||
DrawMethodes.Add(DefaultDrawMethodes.DrawRectangle);
|
||||
|
||||
if ((value & PaintingObjectType.Elipse) == PaintingObjectType.Elipse)
|
||||
DrawMethodes.Add(DefaultDrawMethodes.DrawEllipse);
|
||||
|
||||
if ((value & PaintingObjectType.Triangle) == PaintingObjectType.Triangle)
|
||||
DrawMethodes.Add(DefaultDrawMethodes.DrawTriangle);
|
||||
|
||||
if ((value & PaintingObjectType.Line) == PaintingObjectType.Line)
|
||||
DrawMethodes.Add(DefaultDrawMethodes.DrawLine);
|
||||
|
||||
if ((value & PaintingObjectType.Text) == PaintingObjectType.Text)
|
||||
DrawMethodes.Add(DefaultDrawMethodes.DrawText);
|
||||
}
|
||||
}
|
||||
|
||||
[JsonIgnore]
|
||||
public PointF Location
|
||||
{
|
||||
get
|
||||
{
|
||||
if (Parent is not null)
|
||||
return new PointF(_Location.X * Parent.ZoomFactor.Width, _Location.Y * Parent.ZoomFactor.Height);
|
||||
else
|
||||
{
|
||||
return _Location;
|
||||
}
|
||||
}
|
||||
set
|
||||
{
|
||||
if (Parent is not null)
|
||||
_Location = new PointF(value.X / Parent.ZoomFactor.Width, value.Y / Parent.ZoomFactor.Height);
|
||||
else
|
||||
{
|
||||
_Location = value;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
[JsonIgnore]
|
||||
public PointF LocationDirect
|
||||
{
|
||||
get
|
||||
{
|
||||
return _Location;
|
||||
}
|
||||
set
|
||||
{
|
||||
_Location = value;
|
||||
}
|
||||
}
|
||||
|
||||
[JsonIgnore]
|
||||
public SizeF Size
|
||||
{
|
||||
get
|
||||
{
|
||||
if (Parent is not null)
|
||||
return new SizeF(_Size.Width * Parent.ZoomFactor.Width, _Size.Height * Parent.ZoomFactor.Height);
|
||||
else
|
||||
{
|
||||
return _Size;
|
||||
}
|
||||
}
|
||||
set
|
||||
{
|
||||
if (Parent is not null)
|
||||
_Size = new SizeF(value.Width / Parent.ZoomFactor.Width, value.Height / Parent.ZoomFactor.Height);
|
||||
else
|
||||
{
|
||||
_Size = value;
|
||||
}
|
||||
ResetImageBuffer();
|
||||
}
|
||||
}
|
||||
|
||||
[JsonIgnore]
|
||||
public SizeF SizeDirect
|
||||
{
|
||||
get
|
||||
{
|
||||
return _Size;
|
||||
}
|
||||
set
|
||||
{
|
||||
_Size = value;
|
||||
ResetImageBuffer();
|
||||
}
|
||||
}
|
||||
|
||||
[JsonIgnore]
|
||||
public bool AutoAlignToGrid
|
||||
{
|
||||
get
|
||||
{
|
||||
return _AutoAlignToGrid;
|
||||
}
|
||||
set
|
||||
{
|
||||
_AutoAlignToGrid = value;
|
||||
if (value)
|
||||
ArrangeToGrid();
|
||||
}
|
||||
}
|
||||
|
||||
[JsonIgnore]
|
||||
public bool IsResizing
|
||||
{
|
||||
get
|
||||
{
|
||||
if (resizeEngine is null)
|
||||
return false;
|
||||
else
|
||||
{
|
||||
return (bool)resizeEngine?.IsResizing;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
[JsonIgnore]
|
||||
public PaintingControl Parent
|
||||
{
|
||||
get
|
||||
{
|
||||
return _Parent;
|
||||
}
|
||||
set
|
||||
{
|
||||
bool re = !ReferenceEquals(value, _Parent);
|
||||
_Parent = value;
|
||||
if (re)
|
||||
ParentChanged?.Invoke(this, new EventArgs());
|
||||
}
|
||||
}
|
||||
|
||||
[JsonIgnore]
|
||||
public bool Visible
|
||||
{
|
||||
get
|
||||
{
|
||||
return _Visible;
|
||||
}
|
||||
set
|
||||
{
|
||||
if (value != _Visible)
|
||||
{
|
||||
_Visible = value;
|
||||
if (!value && !_EnableSelection)
|
||||
EnableResize = false;
|
||||
VisibleChanged?.Invoke(this, new EventArgs());
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
[JsonIgnore]
|
||||
public bool Selected
|
||||
{
|
||||
get
|
||||
{
|
||||
return _Selected;
|
||||
}
|
||||
set
|
||||
{
|
||||
SetSelection(value, true);
|
||||
}
|
||||
}
|
||||
|
||||
[JsonIgnore]
|
||||
public bool SelectedDirect
|
||||
{
|
||||
get
|
||||
{
|
||||
return Selected;
|
||||
}
|
||||
set
|
||||
{
|
||||
SetSelection(value, false);
|
||||
}
|
||||
}
|
||||
|
||||
private void SetSelection(bool value, bool raiseEventOnParent)
|
||||
{
|
||||
if (EnableSelection)
|
||||
{
|
||||
if (_Selected != value)
|
||||
{
|
||||
_Selected = value;
|
||||
SelectedChanged?.Invoke(this, new EventArgs());
|
||||
if (raiseEventOnParent)
|
||||
Parent.RaiseSelectionChanged();
|
||||
}
|
||||
}
|
||||
else
|
||||
{
|
||||
_Selected = false;
|
||||
}
|
||||
}
|
||||
|
||||
[JsonIgnore]
|
||||
public float Width
|
||||
{
|
||||
get
|
||||
{
|
||||
return Size.Width;
|
||||
}
|
||||
set
|
||||
{
|
||||
Size = new SizeF(value, Size.Height);
|
||||
}
|
||||
}
|
||||
[JsonIgnore]
|
||||
public float Height
|
||||
{
|
||||
get
|
||||
{
|
||||
return Size.Height;
|
||||
}
|
||||
set
|
||||
{
|
||||
Size = new SizeF(Size.Width, value);
|
||||
}
|
||||
}
|
||||
|
||||
[JsonIgnore]
|
||||
public float X
|
||||
{
|
||||
get
|
||||
{
|
||||
return Location.X;
|
||||
}
|
||||
set
|
||||
{
|
||||
Location = new PointF(value, Location.Y);
|
||||
}
|
||||
}
|
||||
[JsonIgnore]
|
||||
public float Y
|
||||
{
|
||||
get
|
||||
{
|
||||
return Location.Y;
|
||||
}
|
||||
set
|
||||
{
|
||||
Location = new PointF(Location.X, value);
|
||||
}
|
||||
}
|
||||
|
||||
[JsonIgnore]
|
||||
public string Text
|
||||
{
|
||||
get
|
||||
{
|
||||
return _Text;
|
||||
}
|
||||
set
|
||||
{
|
||||
_Text = value;
|
||||
}
|
||||
}
|
||||
|
||||
[JsonIgnore]
|
||||
public RectangleF Rectangle
|
||||
{
|
||||
get
|
||||
{
|
||||
return new RectangleF(Location, Size);
|
||||
}
|
||||
set
|
||||
{
|
||||
Location = value.Location;
|
||||
Size = value.Size;
|
||||
}
|
||||
}
|
||||
|
||||
[JsonIgnore]
|
||||
public bool EnableSelection
|
||||
{
|
||||
get
|
||||
{
|
||||
return _EnableSelection;
|
||||
}
|
||||
set
|
||||
{
|
||||
_EnableSelection = value;
|
||||
if (!value && !_Visible)
|
||||
EnableResize = false;
|
||||
if (!value)
|
||||
Selected = false;
|
||||
}
|
||||
}
|
||||
|
||||
[JsonIgnore]
|
||||
public Rectangle RectangleExtended
|
||||
{
|
||||
get
|
||||
{
|
||||
return new Rectangle((int)Math.Round(X - 12f), (int)Math.Round(Y - 12f), (int)Math.Round(Width + 12f + 12f), (int)Math.Round(Height + 12f + 12f));
|
||||
}
|
||||
set
|
||||
{
|
||||
X = value.X + 12;
|
||||
Y = value.Y + 12;
|
||||
Width = value.Width - 12 - 12;
|
||||
Height = value.Height - 12 - 12;
|
||||
}
|
||||
}
|
||||
|
||||
public void FitSizeToText()
|
||||
{
|
||||
if (Parent is null)
|
||||
throw new Exception("You have to put that PaintingObject to a PaintingControl before.");
|
||||
|
||||
var g = Parent.CreateGraphics();
|
||||
var newSize = g.MeasureString(Text, TextFont);
|
||||
SizeDirect = newSize + new SizeF(1f, 0f);
|
||||
}
|
||||
|
||||
public void SetBounds(int x, int y, int width, int height)
|
||||
{
|
||||
Location = new Point(x, y);
|
||||
Size = new Size(width, height);
|
||||
}
|
||||
|
||||
[JsonIgnore]
|
||||
public int Left
|
||||
{
|
||||
get
|
||||
{
|
||||
return (int)Math.Round(X);
|
||||
}
|
||||
set
|
||||
{
|
||||
X = value;
|
||||
}
|
||||
}
|
||||
|
||||
[JsonIgnore]
|
||||
public int Top
|
||||
{
|
||||
get
|
||||
{
|
||||
return (int)Math.Round(Y);
|
||||
}
|
||||
set
|
||||
{
|
||||
Y = value;
|
||||
}
|
||||
}
|
||||
|
||||
[JsonIgnore]
|
||||
public int Right
|
||||
{
|
||||
get
|
||||
{
|
||||
return (int)Math.Round(X + Width);
|
||||
}
|
||||
set
|
||||
{
|
||||
X = value - Width;
|
||||
}
|
||||
}
|
||||
|
||||
[JsonIgnore]
|
||||
public int Bottom
|
||||
{
|
||||
get
|
||||
{
|
||||
return (int)Math.Round(Y + Height);
|
||||
}
|
||||
set
|
||||
{
|
||||
Y = value - Height;
|
||||
}
|
||||
}
|
||||
|
||||
[JsonProperty(nameof(Tag))]
|
||||
public string TagString
|
||||
{
|
||||
get
|
||||
{
|
||||
if (Tag is string)
|
||||
return Convert.ToString(Tag);
|
||||
else
|
||||
{
|
||||
return string.Empty;
|
||||
}
|
||||
}
|
||||
set
|
||||
{
|
||||
Tag = value;
|
||||
}
|
||||
}
|
||||
|
||||
public bool EnableResize
|
||||
{
|
||||
get
|
||||
{
|
||||
if (resizeEngine is null)
|
||||
return false;
|
||||
else
|
||||
{
|
||||
return resizeEngine.Enabled;
|
||||
}
|
||||
}
|
||||
set
|
||||
{
|
||||
if (resizeEngine is null && value)
|
||||
resizeEngine = new PaintingObjectResizing(this);
|
||||
else if (resizeEngine is not null)
|
||||
{
|
||||
resizeEngine.Enabled = value;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
public void Remove()
|
||||
{
|
||||
Parent?.PaintingObjects.Remove(this);
|
||||
}
|
||||
|
||||
public void AutoArrangeToGrid()
|
||||
{
|
||||
if (((Parent?.GridEnabled) is var arg1 && !arg1.HasValue || arg1.Value) && AutoAlignToGrid && arg1.HasValue)
|
||||
ArrangeToGrid();
|
||||
}
|
||||
|
||||
public void ArrangeToGrid()
|
||||
{
|
||||
if (Parent is not null)
|
||||
{
|
||||
Parent.ArrangeToGrid(this, true);
|
||||
if (!Parent.StopDrawing)
|
||||
Parent.Refresh();
|
||||
}
|
||||
}
|
||||
|
||||
public void Draw(PaintEventArgs e)
|
||||
{
|
||||
Draw(e, e.ClipRectangle.Location);
|
||||
}
|
||||
|
||||
public void Draw(PaintEventArgs e, PointF offset)
|
||||
{
|
||||
Draw(e.Graphics, offset);
|
||||
|
||||
if (Visible)
|
||||
RaisePaint(e);
|
||||
}
|
||||
|
||||
public void Draw(Graphics g, PointF offset)
|
||||
{
|
||||
if (Visible)
|
||||
{
|
||||
var poevargs = new PaintingObjectPaintEventArgs(this, g, offset);
|
||||
|
||||
foreach (DelegateDrawPaintingObjectMethode dm in DrawMethodes)
|
||||
{
|
||||
try
|
||||
{
|
||||
dm?.Invoke(poevargs);
|
||||
}
|
||||
catch (Exception ex)
|
||||
{
|
||||
ErrorsAtDrawing = (ulong)Math.Round(ErrorsAtDrawing + 1m);
|
||||
}
|
||||
}
|
||||
|
||||
if (Selected && DrawSelectionMethode is not null)
|
||||
DrawSelectionMethode?.Invoke(poevargs);
|
||||
}
|
||||
}
|
||||
|
||||
public object Clone()
|
||||
{
|
||||
return Clone(true);
|
||||
}
|
||||
|
||||
public object Clone(bool includePinnedObject)
|
||||
{
|
||||
var obj = new PaintingObject();
|
||||
var metype = GetType();
|
||||
string[] blackField = new[] { nameof(PinnedObjects), nameof(resizeEngine), nameof(_Parent), nameof(BufferedImage), nameof(ImageProperties) };
|
||||
|
||||
void copyFields(object source, object dest, string[] blackFields, Type t)
|
||||
{
|
||||
var fields = new List<FieldInfo>(t.GetFields(BindingFlags.Public | BindingFlags.NonPublic | BindingFlags.IgnoreCase | BindingFlags.Instance));
|
||||
foreach (FieldInfo @field in fields)
|
||||
{
|
||||
if (!blackFields.Contains(@field.Name))
|
||||
@field.SetValue(dest, @field.GetValue(source));
|
||||
}
|
||||
};
|
||||
|
||||
copyFields(this, obj, blackField, metype);
|
||||
copyFields(ImageProperties, obj.ImageProperties, Array.Empty<string>(), ImageProperties.GetType());
|
||||
|
||||
if (includePinnedObject)
|
||||
obj.PinnedObjects.AddRange(PinnedObjects);
|
||||
|
||||
obj.EnableResize = EnableResize;
|
||||
|
||||
return obj;
|
||||
}
|
||||
|
||||
[Obsolete("Use Layering.BringToTop() instead!")]
|
||||
public void BringToFront()
|
||||
{
|
||||
Layering.BringToTop();
|
||||
}
|
||||
|
||||
[Obsolete("Use Layering.SendToBack() instead!")]
|
||||
public void SendToBack()
|
||||
{
|
||||
Layering.SendToBack();
|
||||
}
|
||||
|
||||
public void ResetImageBuffer()
|
||||
{
|
||||
BufferedImage = null;
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
public class PaintingObjectList : List<PaintingObject>
|
||||
{
|
||||
|
||||
[JsonIgnore]
|
||||
internal PaintingControl MyParent { get; private set; }
|
||||
internal bool EnableRaisingEvents { get; set; } = true;
|
||||
[JsonIgnore]
|
||||
public PaintingObjectListLayering Layering { get; private set; }
|
||||
|
||||
public PaintingObjectList() : this(null)
|
||||
{
|
||||
}
|
||||
|
||||
public PaintingObjectList(PaintingControl parent)
|
||||
{
|
||||
Layering = new(this);
|
||||
MyParent = parent;
|
||||
}
|
||||
|
||||
public new void Add(PaintingObject item)
|
||||
{
|
||||
item.Parent = MyParent;
|
||||
base.Add(item);
|
||||
item.AutoArrangeToGrid();
|
||||
if (EnableRaisingEvents)
|
||||
MyParent?.RaisePaintingObjectAdded(new PaintingObjectEventArgs(new[] { item }));
|
||||
}
|
||||
|
||||
public void AddRange(PaintingObject[] items)
|
||||
{
|
||||
foreach (PaintingObject item in items)
|
||||
item.Parent = MyParent;
|
||||
base.AddRange(items);
|
||||
foreach (PaintingObject item in items)
|
||||
item.AutoArrangeToGrid();
|
||||
if (EnableRaisingEvents)
|
||||
MyParent?.RaisePaintingObjectAdded(new PaintingObjectEventArgs(items));
|
||||
}
|
||||
|
||||
public new void Insert(int index, PaintingObject item)
|
||||
{
|
||||
item.Parent = MyParent;
|
||||
base.Insert(index, item);
|
||||
MyParent?.AutoArrangeToGrid();
|
||||
if (EnableRaisingEvents)
|
||||
MyParent?.RaisePaintingObjectAdded(new PaintingObjectEventArgs(new[] { item }));
|
||||
}
|
||||
|
||||
public new void Remove(PaintingObject item)
|
||||
{
|
||||
item.Parent = null;
|
||||
base.Remove(item);
|
||||
if (EnableRaisingEvents)
|
||||
MyParent?.RaisePaintingObjectRemoved(new PaintingObjectEventArgs(new[] { item }));
|
||||
}
|
||||
|
||||
public new void RemoveAt(int index)
|
||||
{
|
||||
this[index].Parent = null;
|
||||
var item = this[index];
|
||||
base.RemoveAt(index);
|
||||
if (EnableRaisingEvents)
|
||||
MyParent?.RaisePaintingObjectRemoved(new PaintingObjectEventArgs(new[] { item }));
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
public enum PaintingObjectType
|
||||
{
|
||||
Custom = 0,
|
||||
Text = 1,
|
||||
Picture = 2,
|
||||
Line = 4,
|
||||
Triangle = 8,
|
||||
Rectangle = 16,
|
||||
Elipse = 32
|
||||
}
|
||||
|
||||
public enum ImageSizeMode
|
||||
{
|
||||
Fit,
|
||||
Zoom,
|
||||
Original
|
||||
}
|
||||
|
||||
public enum TextPosition
|
||||
{
|
||||
HLeft = 0x1,
|
||||
HRight = 0x2,
|
||||
HCenter = 0x4,
|
||||
VUp = 0x10,
|
||||
VDown = 0x20,
|
||||
VCenter = 0x40,
|
||||
FullCenter = HCenter | VCenter
|
||||
}
|
||||
@@ -1,655 +0,0 @@
|
||||
Imports System.ComponentModel
|
||||
Imports System.Drawing
|
||||
Imports System.Drawing.Drawing2D
|
||||
Imports System.Reflection
|
||||
Imports System.Windows.Forms
|
||||
|
||||
Imports Newtonsoft.Json
|
||||
|
||||
<Serializable> Public Class PaintingObject
|
||||
Implements ICloneable, IPaintingObjectContainer
|
||||
|
||||
Private resizeEngine As PaintingObjectResizing = Nothing
|
||||
Private _Selected As Boolean = False
|
||||
|
||||
Private _Parent As PaintingControl = Nothing
|
||||
Public Property FillColor As Color = Color.Blue
|
||||
Public Property OutlineColor As Color = Color.DarkBlue
|
||||
Public Property OutlineThicknes As Single = 1
|
||||
Public Property OutlineDashStyle As DashStyle = DashStyle.Solid
|
||||
Public Property LineStartCap As LineCapProps = Nothing
|
||||
Public Property LineEndCap As LineCapProps = Nothing
|
||||
<JsonProperty>
|
||||
Private _Text As String = ""
|
||||
Public Property TextPosition As TextPosition = TextPosition.FullCenter
|
||||
Public Property VerticalTextAlignment As StringAlignment = StringAlignment.Center
|
||||
Public Property HorizontalTextAlignment As StringAlignment = StringAlignment.Center
|
||||
Public Property TextFont As New Font(FontFamily.GenericSansSerif, 8.25)
|
||||
Public Property TextColor As Color = Color.Black
|
||||
<JsonProperty>
|
||||
Private _Location As New PointF(50, 50)
|
||||
<JsonProperty>
|
||||
Private _Size As New SizeF(50, 80)
|
||||
Public Property EnableFill As Boolean = True
|
||||
Public Property EnableOutline As Boolean = True
|
||||
Public Property SelectionColor As Color = Color.CornflowerBlue
|
||||
Public Property SelectionDashStyle As DashStyle = DashStyle.Dot
|
||||
<JsonProperty>
|
||||
Private _EnableSelection As Boolean = True
|
||||
Public Property Image As Image = Nothing
|
||||
<JsonIgnore> Public Property BufferedImage As Image = Nothing
|
||||
Public Property ImageSizeMode As ImageSizeMode
|
||||
Public Property ImageProperties As New PaintingObjectImageProperties
|
||||
<JsonIgnore>
|
||||
Public Property Tag As Object = Nothing
|
||||
Public Property Name As String = ""
|
||||
Public ReadOnly Property PinnedObjects As New List(Of PaintingObject)
|
||||
<JsonIgnore>
|
||||
Public ReadOnly Property DrawMethodes As New List(Of DelegateDrawPaintingObjectMethode)
|
||||
<JsonIgnore>
|
||||
Public ReadOnly Property DrawSelectionMethode As DelegateDrawPaintingObjectMethode = AddressOf DefaultDrawMethodes.DrawSelection
|
||||
Public Property Cursor As Cursor = Cursors.Default
|
||||
Public Property HardcodedSize As Boolean = False
|
||||
Public Property HardcodedLocation As Boolean = False
|
||||
<JsonProperty>
|
||||
Private _Visible As Boolean = True
|
||||
<JsonProperty>
|
||||
Private _AutoAlignToGrid As Boolean = False
|
||||
Public Property MouseTransparency As Boolean = False
|
||||
Public ReadOnly Property Layering As New PaintingObjectLayering(Me)
|
||||
Public ReadOnly Property PaintingObjects As New PaintingObjectList(_Parent) With {.EnableRaisingEvents = False}
|
||||
<JsonIgnore>
|
||||
Public ReadOnly Property ErrorsAtDrawing As ULong = 0
|
||||
|
||||
Public Event MouseClick(sender As PaintingObject, e As MouseEventArgs)
|
||||
Public Event MouseDown(sender As PaintingObject, e As MouseEventArgs)
|
||||
Public Event MouseUp(sender As PaintingObject, e As MouseEventArgs)
|
||||
Public Event MouseMove(sender As PaintingObject, e As MouseEventArgs)
|
||||
Public Event SelectedChanged(sender As PaintingObject, e As EventArgs)
|
||||
Public Event Paint(sender As PaintingObject, e As PaintEventArgs)
|
||||
Public Event ParentChanged(sender As PaintingObject, e As EventArgs)
|
||||
Public Event VisibleChanged(sender As PaintingObject, e As EventArgs)
|
||||
Public Event Moved(sender As PaintingObject, e As EventArgs)
|
||||
Public Event Moving(sender As PaintingObject, e As EventArgs)
|
||||
Public Event MovingBeforePositionUpdated(sender As PaintingObject, e As CancelEventArgs)
|
||||
|
||||
Public Sub New()
|
||||
End Sub
|
||||
|
||||
Public Sub New(type As PaintingObjectType)
|
||||
Me.Type = type
|
||||
End Sub
|
||||
|
||||
Public Sub New(type As PaintingObjectType, drawMethodes As DelegateDrawPaintingObjectMethode())
|
||||
Me.New(type)
|
||||
Me.DrawMethodes.AddRange(drawMethodes)
|
||||
End Sub
|
||||
|
||||
Friend Sub RaiseMouseClick(e As MouseEventArgs)
|
||||
RaiseEvent MouseClick(Me, e)
|
||||
End Sub
|
||||
Friend Sub RaiseMouseDown(e As MouseEventArgs)
|
||||
RaiseEvent MouseDown(Me, e)
|
||||
End Sub
|
||||
Friend Sub RaiseMouseUp(e As MouseEventArgs)
|
||||
RaiseEvent MouseUp(Me, e)
|
||||
End Sub
|
||||
Friend Sub RaiseMouseMove(e As MouseEventArgs)
|
||||
RaiseEvent MouseMove(Me, e)
|
||||
End Sub
|
||||
Private Sub RaisePaint(e As PaintEventArgs)
|
||||
RaiseEvent Paint(Me, e)
|
||||
End Sub
|
||||
Friend Sub RaiseMoved(e As EventArgs)
|
||||
RaiseEvent Moved(Me, e)
|
||||
End Sub
|
||||
Friend Sub RaiseMoving(e As EventArgs)
|
||||
RaiseEvent Moving(Me, e)
|
||||
End Sub
|
||||
Friend Sub RaiseMovingBeforePositionUpdated(e As EventArgs)
|
||||
RaiseEvent MovingBeforePositionUpdated(Me, e)
|
||||
End Sub
|
||||
|
||||
Public Property Type As PaintingObjectType
|
||||
Get
|
||||
Dim tt As PaintingObjectType = PaintingObjectType.Custom
|
||||
|
||||
For Each d As DelegateDrawPaintingObjectMethode In DrawMethodes
|
||||
If d.Method.DeclaringType Is GetType(DefaultDrawMethodes) Then
|
||||
Select Case d.Method.Name
|
||||
Case "DrawPicture"
|
||||
tt = tt Or PaintingObjectType.Picture
|
||||
Case "DrawText"
|
||||
tt = tt Or PaintingObjectType.Text
|
||||
Case "DrawRectangle"
|
||||
tt = tt Or PaintingObjectType.Rectangle
|
||||
Case "DrawEllipse"
|
||||
tt = tt Or PaintingObjectType.Elipse
|
||||
Case "DrawTriangle"
|
||||
tt = tt Or PaintingObjectType.Triangle
|
||||
Case "DrawLine"
|
||||
tt = tt Or PaintingObjectType.Line
|
||||
End Select
|
||||
End If
|
||||
Next
|
||||
|
||||
Return tt
|
||||
End Get
|
||||
Set(value As PaintingObjectType)
|
||||
DrawMethodes.Clear()
|
||||
|
||||
If (value And PaintingObjectType.Picture) = PaintingObjectType.Picture Then
|
||||
DrawMethodes.Add(AddressOf DefaultDrawMethodes.DrawPicture)
|
||||
End If
|
||||
|
||||
If (value And PaintingObjectType.Rectangle) = PaintingObjectType.Rectangle Then
|
||||
DrawMethodes.Add(AddressOf DefaultDrawMethodes.DrawRectangle)
|
||||
End If
|
||||
|
||||
If (value And PaintingObjectType.Elipse) = PaintingObjectType.Elipse Then
|
||||
DrawMethodes.Add(AddressOf DefaultDrawMethodes.DrawEllipse)
|
||||
End If
|
||||
|
||||
If (value And PaintingObjectType.Triangle) = PaintingObjectType.Triangle Then
|
||||
DrawMethodes.Add(AddressOf DefaultDrawMethodes.DrawTriangle)
|
||||
End If
|
||||
|
||||
If (value And PaintingObjectType.Line) = PaintingObjectType.Line Then
|
||||
DrawMethodes.Add(AddressOf DefaultDrawMethodes.DrawLine)
|
||||
End If
|
||||
|
||||
If (value And PaintingObjectType.Text) = PaintingObjectType.Text Then
|
||||
DrawMethodes.Add(AddressOf DefaultDrawMethodes.DrawText)
|
||||
End If
|
||||
End Set
|
||||
End Property
|
||||
|
||||
<JsonIgnore> Public Property Location As PointF
|
||||
Get
|
||||
If Parent IsNot Nothing Then
|
||||
Return New PointF(_Location.X * Parent.ZoomFactor.Width,
|
||||
_Location.Y * Parent.ZoomFactor.Height)
|
||||
Else
|
||||
Return _Location
|
||||
End If
|
||||
End Get
|
||||
Set(value As PointF)
|
||||
If Parent IsNot Nothing Then
|
||||
_Location = New PointF(value.X / Parent.ZoomFactor.Width,
|
||||
value.Y / Parent.ZoomFactor.Height)
|
||||
Else
|
||||
_Location = value
|
||||
End If
|
||||
End Set
|
||||
End Property
|
||||
|
||||
<JsonIgnore> Public Property LocationDirect As PointF
|
||||
Get
|
||||
Return _Location
|
||||
End Get
|
||||
Set(value As PointF)
|
||||
_Location = value
|
||||
End Set
|
||||
End Property
|
||||
|
||||
<JsonIgnore> Public Property Size As SizeF
|
||||
Get
|
||||
If Parent IsNot Nothing Then
|
||||
Return New SizeF(_Size.Width * Parent.ZoomFactor.Width,
|
||||
_Size.Height * Parent.ZoomFactor.Height)
|
||||
Else
|
||||
Return _Size
|
||||
End If
|
||||
End Get
|
||||
Set(value As SizeF)
|
||||
If Parent IsNot Nothing Then
|
||||
_Size = New SizeF(value.Width / Parent.ZoomFactor.Width,
|
||||
value.Height / Parent.ZoomFactor.Height)
|
||||
Else
|
||||
_Size = value
|
||||
End If
|
||||
ResetImageBuffer()
|
||||
End Set
|
||||
End Property
|
||||
|
||||
<JsonIgnore> Public Property SizeDirect As SizeF
|
||||
Get
|
||||
Return _Size
|
||||
End Get
|
||||
Set(value As SizeF)
|
||||
_Size = value
|
||||
ResetImageBuffer()
|
||||
End Set
|
||||
End Property
|
||||
|
||||
<JsonIgnore> Public Property AutoAlignToGrid As Boolean
|
||||
Get
|
||||
Return _AutoAlignToGrid
|
||||
End Get
|
||||
Set(value As Boolean)
|
||||
_AutoAlignToGrid = value
|
||||
If value Then ArrangeToGrid()
|
||||
End Set
|
||||
End Property
|
||||
|
||||
<JsonIgnore> Public ReadOnly Property IsResizing As Boolean
|
||||
Get
|
||||
If resizeEngine Is Nothing Then
|
||||
Return False
|
||||
Else
|
||||
Return resizeEngine?.IsResizing
|
||||
End If
|
||||
End Get
|
||||
End Property
|
||||
|
||||
<JsonIgnore> Public Property Parent As PaintingControl
|
||||
Get
|
||||
Return _Parent
|
||||
End Get
|
||||
Set(value As PaintingControl)
|
||||
Dim re As Boolean = value IsNot _Parent
|
||||
_Parent = value
|
||||
If re Then RaiseEvent ParentChanged(Me, New EventArgs)
|
||||
End Set
|
||||
End Property
|
||||
|
||||
<JsonIgnore> Public Property Visible As Boolean
|
||||
Get
|
||||
Return _Visible
|
||||
End Get
|
||||
Set(value As Boolean)
|
||||
If value <> _Visible Then
|
||||
_Visible = value
|
||||
If Not value AndAlso Not _EnableSelection Then EnableResize = False
|
||||
RaiseEvent VisibleChanged(Me, New EventArgs)
|
||||
End If
|
||||
End Set
|
||||
End Property
|
||||
|
||||
<JsonIgnore>
|
||||
Public Property Selected As Boolean
|
||||
Get
|
||||
Return _Selected
|
||||
End Get
|
||||
Set(value As Boolean)
|
||||
SetSelection(value, True)
|
||||
End Set
|
||||
End Property
|
||||
|
||||
<JsonIgnore> Public Property SelectedDirect As Boolean
|
||||
Get
|
||||
Return Selected
|
||||
End Get
|
||||
Set(value As Boolean)
|
||||
SetSelection(value, False)
|
||||
End Set
|
||||
End Property
|
||||
|
||||
Private Sub SetSelection(value As Boolean, raiseEventOnParent As Boolean)
|
||||
If EnableSelection Then
|
||||
If _Selected <> value Then
|
||||
_Selected = value
|
||||
RaiseEvent SelectedChanged(Me, New EventArgs)
|
||||
If raiseEventOnParent Then
|
||||
Parent.RaiseSelectionChanged()
|
||||
End If
|
||||
End If
|
||||
Else
|
||||
_Selected = False
|
||||
End If
|
||||
End Sub
|
||||
|
||||
<JsonIgnore> Public Property Width As Single
|
||||
Get
|
||||
Return Size.Width
|
||||
End Get
|
||||
Set(value As Single)
|
||||
Size = New SizeF(value, Size.Height)
|
||||
End Set
|
||||
End Property
|
||||
<JsonIgnore> Public Property Height As Single
|
||||
Get
|
||||
Return Size.Height
|
||||
End Get
|
||||
Set(value As Single)
|
||||
Size = New SizeF(Size.Width, value)
|
||||
End Set
|
||||
End Property
|
||||
|
||||
<JsonIgnore> Public Property X As Single
|
||||
Get
|
||||
Return Location.X
|
||||
End Get
|
||||
Set(value As Single)
|
||||
Location = New PointF(value, Location.Y)
|
||||
End Set
|
||||
End Property
|
||||
<JsonIgnore> Public Property Y As Single
|
||||
Get
|
||||
Return Location.Y
|
||||
End Get
|
||||
Set(value As Single)
|
||||
Location = New PointF(Location.X, value)
|
||||
End Set
|
||||
End Property
|
||||
|
||||
<JsonIgnore> Public Property Text As String
|
||||
Get
|
||||
Return _Text
|
||||
End Get
|
||||
Set(value As String)
|
||||
_Text = value
|
||||
End Set
|
||||
End Property
|
||||
|
||||
<JsonIgnore>
|
||||
Public Property Rectangle As RectangleF
|
||||
Get
|
||||
Return New RectangleF(Location, Size)
|
||||
End Get
|
||||
Set(value As RectangleF)
|
||||
Location = value.Location
|
||||
Size = value.Size
|
||||
End Set
|
||||
End Property
|
||||
|
||||
<JsonIgnore> Public Property EnableSelection As Boolean
|
||||
Get
|
||||
Return _EnableSelection
|
||||
End Get
|
||||
Set(value As Boolean)
|
||||
_EnableSelection = value
|
||||
If Not value AndAlso Not _Visible Then EnableResize = False
|
||||
If Not value Then Selected = False
|
||||
End Set
|
||||
End Property
|
||||
|
||||
<JsonIgnore> Public Property RectangleExtended As Rectangle
|
||||
Get
|
||||
Return New Rectangle(X - 12,
|
||||
Y - 12,
|
||||
Width + 12 + 12,
|
||||
Height + 12 + 12)
|
||||
End Get
|
||||
Set(value As Rectangle)
|
||||
X = value.X + 12
|
||||
Y = value.Y + 12
|
||||
Width = value.Width - 12 - 12
|
||||
Height = value.Height - 12 - 12
|
||||
End Set
|
||||
End Property
|
||||
|
||||
Public Sub FitSizeToText()
|
||||
If Parent Is Nothing Then
|
||||
Throw New Exception("You have to put that PaintingObject to a PaintingControl before.")
|
||||
End If
|
||||
|
||||
Dim g As Graphics = Parent.CreateGraphics()
|
||||
Dim newSize As SizeF = g.MeasureString(Text, TextFont)
|
||||
SizeDirect = newSize + New SizeF(1, 0)
|
||||
End Sub
|
||||
|
||||
Public Sub SetBounds(x As Integer, y As Integer, width As Integer, height As Integer)
|
||||
Location = New Point(x, y)
|
||||
Size = New Size(width, height)
|
||||
End Sub
|
||||
|
||||
<JsonIgnore> Public Property Left As Integer
|
||||
Get
|
||||
Return X
|
||||
End Get
|
||||
Set(value As Integer)
|
||||
X = value
|
||||
End Set
|
||||
End Property
|
||||
|
||||
<JsonIgnore> Public Property Top() As Integer
|
||||
Get
|
||||
Return Y
|
||||
End Get
|
||||
Set(value As Integer)
|
||||
Y = value
|
||||
End Set
|
||||
End Property
|
||||
|
||||
<JsonIgnore> Public Property Right As Integer
|
||||
Get
|
||||
Return X + Width
|
||||
End Get
|
||||
Set(value As Integer)
|
||||
X = value - Width
|
||||
End Set
|
||||
End Property
|
||||
|
||||
<JsonIgnore> Public Property Bottom() As Integer
|
||||
Get
|
||||
Return Y + Height
|
||||
End Get
|
||||
Set(value As Integer)
|
||||
Y = value - Height
|
||||
End Set
|
||||
End Property
|
||||
|
||||
<JsonProperty(NameOf(Tag))>
|
||||
Public Property TagString As String
|
||||
Get
|
||||
If TypeOf Tag Is String Then
|
||||
Return Tag
|
||||
Else
|
||||
Return String.Empty
|
||||
End If
|
||||
End Get
|
||||
Set(value As String)
|
||||
Tag = value
|
||||
End Set
|
||||
End Property
|
||||
|
||||
Public Property EnableResize As Boolean
|
||||
Get
|
||||
If resizeEngine Is Nothing Then
|
||||
Return False
|
||||
Else
|
||||
Return resizeEngine.Enabled
|
||||
End If
|
||||
End Get
|
||||
Set(value As Boolean)
|
||||
If resizeEngine Is Nothing AndAlso value Then
|
||||
resizeEngine = New PaintingObjectResizing(Me)
|
||||
ElseIf resizeEngine IsNot Nothing Then
|
||||
resizeEngine.Enabled = value
|
||||
End If
|
||||
End Set
|
||||
End Property
|
||||
|
||||
Public Sub Remove()
|
||||
Parent?.PaintingObjects.Remove(Me)
|
||||
End Sub
|
||||
|
||||
Public Sub AutoArrangeToGrid()
|
||||
If Parent?.GridEnabled AndAlso AutoAlignToGrid Then
|
||||
ArrangeToGrid()
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Public Sub ArrangeToGrid()
|
||||
If Parent IsNot Nothing Then
|
||||
Parent.ArrangeToGrid(Me, True)
|
||||
If Not Parent.StopDrawing Then Parent.Refresh()
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Public Sub Draw(e As PaintEventArgs)
|
||||
Draw(e, e.ClipRectangle.Location)
|
||||
End Sub
|
||||
|
||||
Public Sub Draw(e As PaintEventArgs, offset As PointF)
|
||||
Draw(e.Graphics, offset)
|
||||
|
||||
If Visible Then
|
||||
RaisePaint(e)
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Public Sub Draw(g As Graphics, offset As PointF)
|
||||
If Visible Then
|
||||
Dim poevargs As New PaintingObjectPaintEventArgs(Me, g, offset)
|
||||
|
||||
For Each dm As DelegateDrawPaintingObjectMethode In DrawMethodes
|
||||
Try
|
||||
dm?.Invoke(poevargs)
|
||||
Catch ex As Exception
|
||||
_ErrorsAtDrawing += 1
|
||||
End Try
|
||||
Next
|
||||
|
||||
If Selected AndAlso DrawSelectionMethode IsNot Nothing Then
|
||||
DrawSelectionMethode?.Invoke(poevargs)
|
||||
End If
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Public Function Clone() As Object Implements ICloneable.Clone
|
||||
Return Clone(True)
|
||||
End Function
|
||||
|
||||
Public Function Clone(includePinnedObject As Boolean) As Object
|
||||
Dim obj As New PaintingObject
|
||||
Dim metype As Type = Me.GetType
|
||||
Dim blackField As String() = {
|
||||
NameOf(_PinnedObjects),
|
||||
NameOf(resizeEngine),
|
||||
NameOf(_Parent),
|
||||
NameOf(BufferedImage),
|
||||
NameOf(_ImageProperties)
|
||||
}
|
||||
|
||||
Dim copyFields =
|
||||
Sub(source As Object, dest As Object, blackFields As String(), t As Type)
|
||||
Dim fields As New List(Of FieldInfo)(t.GetFields(BindingFlags.Public Or BindingFlags.NonPublic Or BindingFlags.IgnoreCase Or BindingFlags.Instance))
|
||||
For Each field As FieldInfo In fields
|
||||
If Not blackFields.Contains(field.Name) Then
|
||||
field.SetValue(dest, field.GetValue(source))
|
||||
End If
|
||||
Next
|
||||
End Sub
|
||||
|
||||
copyFields(Me, obj, blackField, metype)
|
||||
copyFields(ImageProperties, obj.ImageProperties, {}, ImageProperties.GetType)
|
||||
|
||||
If includePinnedObject Then
|
||||
obj.PinnedObjects.AddRange(PinnedObjects)
|
||||
End If
|
||||
|
||||
obj.EnableResize = EnableResize
|
||||
|
||||
Return obj
|
||||
End Function
|
||||
|
||||
<Obsolete("Use Layering.BringToTop() instead!")>
|
||||
Public Sub BringToFront()
|
||||
Layering.BringToTop()
|
||||
End Sub
|
||||
|
||||
<Obsolete("Use Layering.SendToBack() instead!")>
|
||||
Public Sub SendToBack()
|
||||
Layering.SendToBack()
|
||||
End Sub
|
||||
|
||||
Public Sub ResetImageBuffer()
|
||||
BufferedImage = Nothing
|
||||
End Sub
|
||||
|
||||
End Class
|
||||
|
||||
Public Class PaintingObjectList
|
||||
Inherits List(Of PaintingObject)
|
||||
|
||||
<JsonIgnore>
|
||||
Friend ReadOnly Property MyParent As PaintingControl
|
||||
Friend Property EnableRaisingEvents As Boolean = True
|
||||
<JsonIgnore>
|
||||
Public ReadOnly Property Layering As New PaintingObjectListLayering(Me)
|
||||
|
||||
Public Sub New()
|
||||
Me.New(Nothing)
|
||||
End Sub
|
||||
|
||||
Public Sub New(parent As PaintingControl)
|
||||
MyParent = parent
|
||||
End Sub
|
||||
|
||||
Public Overloads Sub Add(item As PaintingObject)
|
||||
item.Parent = MyParent
|
||||
MyBase.Add(item)
|
||||
item.AutoArrangeToGrid()
|
||||
If EnableRaisingEvents Then
|
||||
MyParent?.RaisePaintingObjectAdded(New PaintingObjectEventArgs({item}))
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Public Overloads Sub AddRange(items As PaintingObject())
|
||||
For Each item As PaintingObject In items
|
||||
item.Parent = MyParent
|
||||
Next
|
||||
MyBase.AddRange(items)
|
||||
For Each item As PaintingObject In items
|
||||
item.AutoArrangeToGrid()
|
||||
Next
|
||||
If EnableRaisingEvents Then
|
||||
MyParent?.RaisePaintingObjectAdded(New PaintingObjectEventArgs(items))
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Public Overloads Sub Insert(index As Integer, item As PaintingObject)
|
||||
item.Parent = MyParent
|
||||
MyBase.Insert(index, item)
|
||||
MyParent?.AutoArrangeToGrid()
|
||||
If EnableRaisingEvents Then
|
||||
MyParent?.RaisePaintingObjectAdded(New PaintingObjectEventArgs({item}))
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Public Overloads Sub Remove(item As PaintingObject)
|
||||
item.Parent = Nothing
|
||||
MyBase.Remove(item)
|
||||
If EnableRaisingEvents Then
|
||||
MyParent?.RaisePaintingObjectRemoved(New PaintingObjectEventArgs({item}))
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Public Overloads Sub RemoveAt(index As Integer)
|
||||
Me(index).Parent = Nothing
|
||||
Dim item As PaintingObject = Me(index)
|
||||
MyBase.RemoveAt(index)
|
||||
If EnableRaisingEvents Then
|
||||
MyParent?.RaisePaintingObjectRemoved(New PaintingObjectEventArgs({item}))
|
||||
End If
|
||||
End Sub
|
||||
|
||||
End Class
|
||||
|
||||
Public Enum PaintingObjectType
|
||||
Custom = 0
|
||||
Text = 1
|
||||
Picture = 2
|
||||
Line = 4
|
||||
Triangle = 8
|
||||
Rectangle = 16
|
||||
Elipse = 32
|
||||
End Enum
|
||||
|
||||
Public Enum ImageSizeMode
|
||||
Fit
|
||||
Zoom
|
||||
Original
|
||||
End Enum
|
||||
|
||||
Public Enum TextPosition
|
||||
HLeft = &H1
|
||||
HRight = &H2
|
||||
HCenter = &H4
|
||||
VUp = &H10
|
||||
VDown = &H20
|
||||
VCenter = &H40
|
||||
FullCenter = HCenter Or VCenter
|
||||
End Enum
|
||||
@@ -1,7 +0,0 @@
|
||||
|
||||
namespace Pilz.UI;
|
||||
|
||||
public class PaintingObjectJsonSerializer
|
||||
{
|
||||
|
||||
}
|
||||
@@ -1,3 +0,0 @@
|
||||
Public Class PaintingObjectJsonSerializer
|
||||
|
||||
End Class
|
||||
@@ -1,112 +0,0 @@
|
||||
using Newtonsoft.Json;
|
||||
|
||||
namespace Pilz.UI;
|
||||
|
||||
|
||||
public class PaintingObjectLayering
|
||||
{
|
||||
|
||||
// <JsonProperty(NameOf(PaintingObject))>
|
||||
private readonly PaintingObject _PaintingObject;
|
||||
|
||||
[JsonIgnore]
|
||||
public PaintingObject PaintingObject
|
||||
{
|
||||
get
|
||||
{
|
||||
return _PaintingObject;
|
||||
}
|
||||
}
|
||||
|
||||
/// <summary>
|
||||
/// Get the current object list from the painting object.
|
||||
/// </summary>
|
||||
/// <returns>Returns the current object list from the painting object.</returns>
|
||||
[JsonIgnore]
|
||||
public PaintingObjectList ObjectList
|
||||
{
|
||||
get
|
||||
{
|
||||
return PaintingObject.Parent.PaintingObjects;
|
||||
}
|
||||
}
|
||||
|
||||
/// <summary>
|
||||
/// Create a new instance of object layer managing.
|
||||
/// </summary>
|
||||
/// <param name="obj"></param>
|
||||
public PaintingObjectLayering(PaintingObject obj)
|
||||
{
|
||||
_PaintingObject = obj;
|
||||
}
|
||||
|
||||
/// <summary>
|
||||
/// Moves the object by the given number of indicies.
|
||||
/// </summary>
|
||||
/// <param name="count">The number how many objects it should be moved.</param>
|
||||
public void MoveObject(int count)
|
||||
{
|
||||
int oldIndex = ObjectList.IndexOf(PaintingObject);
|
||||
int newIndex = oldIndex + count;
|
||||
MoveObjectTo(newIndex);
|
||||
}
|
||||
|
||||
/// <summary>
|
||||
/// Moves the object to the new index.
|
||||
/// </summary>
|
||||
/// <param name="newIndex"></param>
|
||||
public void MoveObjectTo(int newIndex)
|
||||
{
|
||||
var list = ObjectList;
|
||||
|
||||
// Check & make index valid
|
||||
if (newIndex >= ObjectList.Count)
|
||||
newIndex = ObjectList.Count - 1;
|
||||
else if (newIndex < 0)
|
||||
{
|
||||
newIndex = 0;
|
||||
}
|
||||
|
||||
// Remove object
|
||||
list.Remove(PaintingObject);
|
||||
|
||||
// Insert object at new index
|
||||
list.Insert(newIndex, PaintingObject);
|
||||
|
||||
// Order all objects again
|
||||
list.Layering.OrderAll();
|
||||
}
|
||||
|
||||
/// <summary>
|
||||
/// Moves the object to the front.
|
||||
/// </summary>
|
||||
public void BringToTop()
|
||||
{
|
||||
MoveObjectTo(ObjectList.Count - 1);
|
||||
}
|
||||
|
||||
/// <summary>
|
||||
/// Moves the object to the back.
|
||||
/// </summary>
|
||||
public void SendToBack()
|
||||
{
|
||||
MoveObjectTo(0);
|
||||
}
|
||||
|
||||
/// <summary>
|
||||
/// Moves the object fordward by one
|
||||
/// </summary>
|
||||
public void OneToTop()
|
||||
{
|
||||
MoveObject(+1);
|
||||
}
|
||||
|
||||
/// <summary>
|
||||
/// Moves the object backward by one
|
||||
/// </summary>
|
||||
public void OneToBack()
|
||||
{
|
||||
MoveObject(-1);
|
||||
}
|
||||
|
||||
}
|
||||
@@ -1,96 +0,0 @@
|
||||
Imports Newtonsoft.Json
|
||||
|
||||
Public Class PaintingObjectLayering
|
||||
|
||||
'<JsonProperty(NameOf(PaintingObject))>
|
||||
Private ReadOnly _PaintingObject As PaintingObject
|
||||
|
||||
<JsonIgnore>
|
||||
Public ReadOnly Property PaintingObject As PaintingObject
|
||||
Get
|
||||
Return _PaintingObject
|
||||
End Get
|
||||
End Property
|
||||
|
||||
''' <summary>
|
||||
''' Get the current object list from the painting object.
|
||||
''' </summary>
|
||||
''' <returns>Returns the current object list from the painting object.</returns>
|
||||
<JsonIgnore>
|
||||
Public ReadOnly Property ObjectList As PaintingObjectList
|
||||
Get
|
||||
Return PaintingObject.Parent.PaintingObjects
|
||||
End Get
|
||||
End Property
|
||||
|
||||
''' <summary>
|
||||
''' Create a new instance of object layer managing.
|
||||
''' </summary>
|
||||
''' <param name="obj"></param>
|
||||
Public Sub New(obj As PaintingObject)
|
||||
_PaintingObject = obj
|
||||
End Sub
|
||||
|
||||
''' <summary>
|
||||
''' Moves the object by the given number of indicies.
|
||||
''' </summary>
|
||||
''' <param name="count">The number how many objects it should be moved.</param>
|
||||
Public Sub MoveObject(count As Integer)
|
||||
Dim oldIndex As Integer = ObjectList.IndexOf(PaintingObject)
|
||||
Dim newIndex As Integer = oldIndex + count
|
||||
MoveObjectTo(newIndex)
|
||||
End Sub
|
||||
|
||||
''' <summary>
|
||||
''' Moves the object to the new index.
|
||||
''' </summary>
|
||||
''' <param name="newIndex"></param>
|
||||
Public Sub MoveObjectTo(newIndex As Integer)
|
||||
Dim list As PaintingObjectList = ObjectList
|
||||
|
||||
'Check & make index valid
|
||||
If newIndex >= ObjectList.Count Then
|
||||
newIndex = ObjectList.Count - 1
|
||||
ElseIf newIndex < 0 Then
|
||||
newIndex = 0
|
||||
End If
|
||||
|
||||
'Remove object
|
||||
list.Remove(PaintingObject)
|
||||
|
||||
'Insert object at new index
|
||||
list.Insert(newIndex, PaintingObject)
|
||||
|
||||
'Order all objects again
|
||||
list.Layering.OrderAll()
|
||||
End Sub
|
||||
|
||||
''' <summary>
|
||||
''' Moves the object to the front.
|
||||
''' </summary>
|
||||
Public Sub BringToTop()
|
||||
MoveObjectTo(ObjectList.Count - 1)
|
||||
End Sub
|
||||
|
||||
''' <summary>
|
||||
''' Moves the object to the back.
|
||||
''' </summary>
|
||||
Public Sub SendToBack()
|
||||
MoveObjectTo(0)
|
||||
End Sub
|
||||
|
||||
''' <summary>
|
||||
''' Moves the object fordward by one
|
||||
''' </summary>
|
||||
Public Sub OneToTop()
|
||||
MoveObject(+1)
|
||||
End Sub
|
||||
|
||||
''' <summary>
|
||||
''' Moves the object backward by one
|
||||
''' </summary>
|
||||
Public Sub OneToBack()
|
||||
MoveObject(-1)
|
||||
End Sub
|
||||
|
||||
End Class
|
||||
@@ -1,87 +0,0 @@
|
||||
using System;
|
||||
using System.Collections.Generic;
|
||||
using System.Data;
|
||||
using System.Linq;
|
||||
|
||||
namespace Pilz.UI;
|
||||
|
||||
public class PaintingObjectListLayering
|
||||
{
|
||||
|
||||
|
||||
public PaintingObjectList ObjectList { get; private set; }
|
||||
public Dictionary<int, Func<PaintingObject, bool>> Conditions { get; private set; } = new Dictionary<int, Func<PaintingObject, bool>>();
|
||||
|
||||
/// <summary>
|
||||
/// Get the order function will checkout the conditions.
|
||||
/// </summary>
|
||||
/// <returns>Returns true, if conditions are aviable, otherwise false.</returns>
|
||||
public bool EnableConditions
|
||||
{
|
||||
get
|
||||
{
|
||||
return Conditions.Any();
|
||||
}
|
||||
}
|
||||
|
||||
/// <summary>
|
||||
/// Create a new instance of object list layer managing.
|
||||
/// </summary>
|
||||
/// <param name="list"></param>
|
||||
public PaintingObjectListLayering(PaintingObjectList list)
|
||||
{
|
||||
ObjectList = list;
|
||||
}
|
||||
|
||||
/// <summary>
|
||||
/// Order all objects using the conditions. If no conditions are setted, this method will do nothing.
|
||||
/// </summary>
|
||||
public void OrderAll()
|
||||
{
|
||||
if (EnableConditions)
|
||||
OrderAllPrivate();
|
||||
}
|
||||
|
||||
private void OrderAllPrivate()
|
||||
{
|
||||
var list = ObjectList;
|
||||
var listOld = list.ToList();
|
||||
var toRemove = new List<PaintingObject>();
|
||||
|
||||
// Disable raising events
|
||||
ObjectList.EnableRaisingEvents = false;
|
||||
|
||||
// Clear list
|
||||
list.Clear();
|
||||
|
||||
// Add ordered
|
||||
foreach (var kvp in Conditions.OrderBy(n => n.Key))
|
||||
{
|
||||
var func = kvp.Value;
|
||||
|
||||
foreach (PaintingObject obj in listOld)
|
||||
{
|
||||
if (func(obj))
|
||||
{
|
||||
// Add to list
|
||||
list.Add(obj);
|
||||
|
||||
// Add to remove
|
||||
toRemove.Add(obj);
|
||||
}
|
||||
}
|
||||
|
||||
// Remove remembered objects
|
||||
foreach (PaintingObject obj in toRemove)
|
||||
listOld.Remove(obj);
|
||||
toRemove.Clear();
|
||||
}
|
||||
|
||||
// Enable raising events
|
||||
ObjectList.EnableRaisingEvents = true;
|
||||
|
||||
// Refresh
|
||||
ObjectList.MyParent?.Refresh();
|
||||
}
|
||||
|
||||
}
|
||||
@@ -1,73 +0,0 @@
|
||||
Public Class PaintingObjectListLayering
|
||||
|
||||
|
||||
Public ReadOnly Property ObjectList As PaintingObjectList
|
||||
Public ReadOnly Property Conditions As New Dictionary(Of Integer, Func(Of PaintingObject, Boolean))
|
||||
|
||||
''' <summary>
|
||||
''' Get the order function will checkout the conditions.
|
||||
''' </summary>
|
||||
''' <returns>Returns true, if conditions are aviable, otherwise false.</returns>
|
||||
Public ReadOnly Property EnableConditions As Boolean
|
||||
Get
|
||||
Return Conditions.Any
|
||||
End Get
|
||||
End Property
|
||||
|
||||
''' <summary>
|
||||
''' Create a new instance of object list layer managing.
|
||||
''' </summary>
|
||||
''' <param name="list"></param>
|
||||
Public Sub New(list As PaintingObjectList)
|
||||
ObjectList = list
|
||||
End Sub
|
||||
|
||||
''' <summary>
|
||||
''' Order all objects using the conditions. If no conditions are setted, this method will do nothing.
|
||||
''' </summary>
|
||||
Public Sub OrderAll()
|
||||
If EnableConditions Then
|
||||
OrderAllPrivate()
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Private Sub OrderAllPrivate()
|
||||
Dim list As PaintingObjectList = ObjectList
|
||||
Dim listOld As List(Of PaintingObject) = list.ToList
|
||||
Dim toRemove As New List(Of PaintingObject)
|
||||
|
||||
'Disable raising events
|
||||
ObjectList.EnableRaisingEvents = False
|
||||
|
||||
'Clear list
|
||||
list.Clear()
|
||||
|
||||
'Add ordered
|
||||
For Each kvp In Conditions.OrderBy(Function(n) n.Key)
|
||||
Dim func = kvp.Value
|
||||
|
||||
For Each obj As PaintingObject In listOld
|
||||
If func(obj) Then
|
||||
'Add to list
|
||||
list.Add(obj)
|
||||
|
||||
'Add to remove
|
||||
toRemove.Add(obj)
|
||||
End If
|
||||
Next
|
||||
|
||||
'Remove remembered objects
|
||||
For Each obj As PaintingObject In toRemove
|
||||
listOld.Remove(obj)
|
||||
Next
|
||||
toRemove.Clear()
|
||||
Next
|
||||
|
||||
'Enable raising events
|
||||
ObjectList.EnableRaisingEvents = True
|
||||
|
||||
'Refresh
|
||||
ObjectList.MyParent?.Refresh()
|
||||
End Sub
|
||||
|
||||
End Class
|
||||
@@ -1,346 +0,0 @@
|
||||
using Pilz.Drawing;
|
||||
using System;
|
||||
using System.Drawing;
|
||||
using System.Runtime.CompilerServices;
|
||||
using System.Windows.Forms;
|
||||
|
||||
namespace Pilz.UI;
|
||||
|
||||
|
||||
[Serializable]
|
||||
internal class PaintingObjectResizing
|
||||
{
|
||||
|
||||
public static event CheckEnabledEventHandler CheckEnabled;
|
||||
|
||||
public delegate void CheckEnabledEventHandler(PaintingObjectResizing sender, ref bool enabled);
|
||||
|
||||
private PaintingObject _mObj;
|
||||
|
||||
private PaintingObject mObj
|
||||
{
|
||||
[MethodImpl(MethodImplOptions.Synchronized)]
|
||||
get
|
||||
{
|
||||
return _mObj;
|
||||
}
|
||||
|
||||
[MethodImpl(MethodImplOptions.Synchronized)]
|
||||
set
|
||||
{
|
||||
if (_mObj != null)
|
||||
{
|
||||
_mObj.MouseDown -= mControl_MouseDown;
|
||||
_mObj.MouseUp -= mControl_MouseUp;
|
||||
_mObj.Paint -= mControl_Paint;
|
||||
_mObj.SelectedChanged -= mControl_MouseLeave;
|
||||
_mObj.ParentChanged -= mObj_ParentChanged;
|
||||
}
|
||||
|
||||
_mObj = value;
|
||||
if (_mObj != null)
|
||||
{
|
||||
_mObj.MouseDown += mControl_MouseDown;
|
||||
_mObj.MouseUp += mControl_MouseUp;
|
||||
_mObj.Paint += mControl_Paint;
|
||||
_mObj.SelectedChanged += mControl_MouseLeave;
|
||||
_mObj.ParentChanged += mObj_ParentChanged;
|
||||
}
|
||||
}
|
||||
}
|
||||
private Control _mObjParent;
|
||||
|
||||
private Control mObjParent
|
||||
{
|
||||
[MethodImpl(MethodImplOptions.Synchronized)]
|
||||
get
|
||||
{
|
||||
return _mObjParent;
|
||||
}
|
||||
|
||||
[MethodImpl(MethodImplOptions.Synchronized)]
|
||||
set
|
||||
{
|
||||
_mObjParent = value;
|
||||
}
|
||||
}
|
||||
private Control _mObjControl;
|
||||
|
||||
private Control mObjControl
|
||||
{
|
||||
[MethodImpl(MethodImplOptions.Synchronized)]
|
||||
get
|
||||
{
|
||||
return _mObjControl;
|
||||
}
|
||||
|
||||
[MethodImpl(MethodImplOptions.Synchronized)]
|
||||
set
|
||||
{
|
||||
if (_mObjControl != null)
|
||||
{
|
||||
_mObjControl.MouseMove -= mControl_MouseMove;
|
||||
_mObjControl.ParentChanged -= mObjParent_ParentChanged;
|
||||
}
|
||||
|
||||
_mObjControl = value;
|
||||
if (_mObjControl != null)
|
||||
{
|
||||
_mObjControl.MouseMove += mControl_MouseMove;
|
||||
_mObjControl.ParentChanged += mObjParent_ParentChanged;
|
||||
}
|
||||
}
|
||||
}
|
||||
private bool mMouseDown = false;
|
||||
private EdgeEnum mEdge = EdgeEnum.None;
|
||||
private int mWidth = 4;
|
||||
private int qWidth = 4 * 4;
|
||||
private Rectangle rect = new Rectangle();
|
||||
|
||||
public bool Enabled { get; set; } = true;
|
||||
public SizeF MinimumSize { get; set; } = new SizeF(15f, 15f);
|
||||
|
||||
[Serializable]
|
||||
private enum EdgeEnum
|
||||
{
|
||||
None,
|
||||
Right,
|
||||
Left,
|
||||
Top,
|
||||
Bottom,
|
||||
TopLeft,
|
||||
TopRight,
|
||||
BottomLeft,
|
||||
BottomRight
|
||||
}
|
||||
|
||||
public bool IsResizing
|
||||
{
|
||||
get
|
||||
{
|
||||
return mMouseDown && mEdge != EdgeEnum.None;
|
||||
}
|
||||
}
|
||||
|
||||
public PaintingObject PaintingObject
|
||||
{
|
||||
get
|
||||
{
|
||||
return mObj;
|
||||
}
|
||||
}
|
||||
|
||||
public PaintingObjectResizing(PaintingObject obj)
|
||||
{
|
||||
mObjParent = null;
|
||||
mObjControl = null;
|
||||
mObj = obj;
|
||||
mObjControl = mObj.Parent;
|
||||
}
|
||||
|
||||
private bool IsEnabled()
|
||||
{
|
||||
bool enabled = Enabled;
|
||||
|
||||
CheckEnabled?.Invoke(this, ref enabled);
|
||||
|
||||
return enabled;
|
||||
}
|
||||
|
||||
private void mControl_MouseDown(object sender, MouseEventArgs e)
|
||||
{
|
||||
if (e.Button == MouseButtons.Left)
|
||||
mMouseDown = true;
|
||||
}
|
||||
|
||||
private void mControl_MouseUp(object sender, MouseEventArgs e)
|
||||
{
|
||||
mMouseDown = false;
|
||||
|
||||
if (mObj.Selected)
|
||||
mObj.AutoArrangeToGrid();
|
||||
}
|
||||
|
||||
private void KeepInRange(ref SizeF size)
|
||||
{
|
||||
if (size.Height < MinimumSize.Height || size.Width < MinimumSize.Width)
|
||||
size = new SizeF(Math.Max(size.Width, MinimumSize.Width), Math.Max(size.Height, MinimumSize.Height));
|
||||
}
|
||||
|
||||
private void mControl_MouseMove(object sender, MouseEventArgs e)
|
||||
{
|
||||
if (mMouseDown && mEdge != EdgeEnum.None)
|
||||
{
|
||||
|
||||
int eX = (int)Math.Round(e.X + mObj.Parent.Offset.X);
|
||||
int eY = (int)Math.Round(e.Y + mObj.Parent.Offset.Y);
|
||||
|
||||
switch (mEdge)
|
||||
{
|
||||
case EdgeEnum.TopLeft:
|
||||
{
|
||||
mObj.SetBounds(eX, eY, (int)Math.Round(mObj.Width + (mObj.Left - eX)), (int)Math.Round(mObj.Height + (mObj.Top - eY)));
|
||||
break;
|
||||
}
|
||||
case EdgeEnum.TopRight:
|
||||
{
|
||||
mObj.SetBounds(mObj.Left, eY, eX - mObj.Left, (int)Math.Round(mObj.Height + (mObj.Top - eY)));
|
||||
break;
|
||||
}
|
||||
case EdgeEnum.BottomRight:
|
||||
{
|
||||
mObj.SetBounds(mObj.Left, mObj.Top, eX - mObj.Left, eY - mObj.Top);
|
||||
break;
|
||||
}
|
||||
case EdgeEnum.BottomLeft:
|
||||
{
|
||||
mObj.SetBounds(eX, mObj.Top, (int)Math.Round(mObj.Width + (mObj.Left - eX)), eY - mObj.Top);
|
||||
break;
|
||||
}
|
||||
case EdgeEnum.Left:
|
||||
{
|
||||
mObj.SetBounds(eX, mObj.Top, (int)Math.Round(mObj.Width + (mObj.Left - eX)), (int)Math.Round(mObj.Height));
|
||||
break;
|
||||
}
|
||||
case EdgeEnum.Right:
|
||||
{
|
||||
mObj.SetBounds(mObj.Left, mObj.Top, eX - mObj.Left, (int)Math.Round(mObj.Height));
|
||||
break;
|
||||
}
|
||||
case EdgeEnum.Top:
|
||||
{
|
||||
mObj.SetBounds(mObj.Left, eY, (int)Math.Round(mObj.Width), (int)Math.Round(mObj.Height + (mObj.Top - eY)));
|
||||
break;
|
||||
}
|
||||
case EdgeEnum.Bottom:
|
||||
{
|
||||
mObj.SetBounds(mObj.Left, mObj.Top, (int)Math.Round(mObj.Width), eY - mObj.Top);
|
||||
break;
|
||||
}
|
||||
}
|
||||
|
||||
var argsize = mObj.Size;
|
||||
KeepInRange(ref argsize);
|
||||
mObj.Size = argsize;
|
||||
}
|
||||
|
||||
else if (!mMouseDown)
|
||||
{
|
||||
|
||||
int eXo = e.X;
|
||||
int eYo = e.Y;
|
||||
int realX = (int)Math.Round(eXo + mObj.Parent.Offset.X);
|
||||
int realY = (int)Math.Round(eYo + mObj.Parent.Offset.Y);
|
||||
int eXwo = (int)Math.Round(eXo - mObj.X);
|
||||
int eYwo = (int)Math.Round(eYo - mObj.Y);
|
||||
int eX = (int)Math.Round(eXwo + mObj.Parent.Offset.X);
|
||||
int eY = (int)Math.Round(eYwo + mObj.Parent.Offset.Y);
|
||||
var eLocation = new Point(eX, eY);
|
||||
RectangleF extRect = mObj.RectangleExtended;
|
||||
var oldRect = mObj.Rectangle;
|
||||
|
||||
var newRect = new RectangleF();
|
||||
newRect.X = extRect.X - oldRect.X;
|
||||
newRect.Y = extRect.Y - oldRect.Y;
|
||||
newRect.Width = (extRect.Width - oldRect.Width) / 2f;
|
||||
newRect.Height = (extRect.Height - oldRect.Height) / 2f;
|
||||
|
||||
bool setToNone = false;
|
||||
bool isOnTop = ReferenceEquals(mObj.Parent.GetObject(new PointF(realX, realY), true), mObj);
|
||||
|
||||
if (IsEnabled() && isOnTop)
|
||||
{
|
||||
switch (true)
|
||||
{
|
||||
case object _ when HelpfulDrawingFunctions.IsPointInRectangle(eLocation, new Rectangle((int)Math.Round(newRect.X), (int)Math.Round(newRect.Y), (int)Math.Round(newRect.Width), (int)Math.Round(newRect.Height))):
|
||||
{
|
||||
mObj.Cursor = Cursors.SizeNWSE;
|
||||
mEdge = EdgeEnum.TopLeft;
|
||||
break;
|
||||
}
|
||||
case object _ when HelpfulDrawingFunctions.IsPointInRectangle(eLocation, new Rectangle((int)Math.Round(mObj.Width), (int)Math.Round(newRect.Y), (int)Math.Round(newRect.Width), (int)Math.Round(newRect.Height))):
|
||||
{
|
||||
mObj.Cursor = Cursors.SizeNESW;
|
||||
mEdge = EdgeEnum.TopRight;
|
||||
break;
|
||||
}
|
||||
case object _ when HelpfulDrawingFunctions.IsPointInRectangle(eLocation, new Rectangle((int)Math.Round(mObj.Width), (int)Math.Round(mObj.Height), (int)Math.Round(newRect.Width), (int)Math.Round(newRect.Height))):
|
||||
{
|
||||
mObj.Cursor = Cursors.SizeNWSE;
|
||||
mEdge = EdgeEnum.BottomRight;
|
||||
break;
|
||||
}
|
||||
case object _ when HelpfulDrawingFunctions.IsPointInRectangle(eLocation, new Rectangle((int)Math.Round(newRect.X), (int)Math.Round(mObj.Height), (int)Math.Round(newRect.Width), (int)Math.Round(newRect.Height))):
|
||||
{
|
||||
mObj.Cursor = Cursors.SizeNESW;
|
||||
mEdge = EdgeEnum.BottomLeft;
|
||||
break;
|
||||
}
|
||||
case object _ when HelpfulDrawingFunctions.IsPointInRectangle(eLocation, new Rectangle((int)Math.Round(-newRect.Width), 0, (int)Math.Round(newRect.Width), (int)Math.Round(mObj.Height))):
|
||||
{
|
||||
mObj.Cursor = Cursors.SizeWE;
|
||||
mEdge = EdgeEnum.Left;
|
||||
break;
|
||||
}
|
||||
case object _ when HelpfulDrawingFunctions.IsPointInRectangle(eLocation, new Rectangle((int)Math.Round(mObj.Width), 0, (int)Math.Round(newRect.Width), (int)Math.Round(mObj.Height))):
|
||||
{
|
||||
mObj.Cursor = Cursors.SizeWE;
|
||||
mEdge = EdgeEnum.Right;
|
||||
break;
|
||||
}
|
||||
case object _ when HelpfulDrawingFunctions.IsPointInRectangle(eLocation, new Rectangle(0, (int)Math.Round(-newRect.Height), (int)Math.Round(mObj.Width), (int)Math.Round(newRect.Height))):
|
||||
{
|
||||
mObj.Cursor = Cursors.SizeNS;
|
||||
mEdge = EdgeEnum.Top;
|
||||
break;
|
||||
}
|
||||
case object _ when HelpfulDrawingFunctions.IsPointInRectangle(eLocation, new Rectangle(0, (int)Math.Round(mObj.Height), (int)Math.Round(mObj.Width), (int)Math.Round(newRect.Height))):
|
||||
{
|
||||
mObj.Cursor = Cursors.SizeNS;
|
||||
mEdge = EdgeEnum.Bottom;
|
||||
break;
|
||||
}
|
||||
|
||||
default:
|
||||
{
|
||||
setToNone = true;
|
||||
break;
|
||||
}
|
||||
}
|
||||
}
|
||||
else
|
||||
{
|
||||
setToNone = true;
|
||||
}
|
||||
|
||||
if (setToNone)
|
||||
{
|
||||
mObj.Cursor = Cursors.Default;
|
||||
mEdge = EdgeEnum.None;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
private void mControl_Paint(PaintingObject sender, PaintEventArgs e)
|
||||
{
|
||||
// e.Graphics.FillRectangle(brush, rect)
|
||||
}
|
||||
|
||||
private void mControl_MouseLeave(PaintingObject sender, EventArgs e)
|
||||
{
|
||||
if (!sender.Selected)
|
||||
mEdge = EdgeEnum.None;
|
||||
}
|
||||
|
||||
private void mObjParent_ParentChanged(object sender, EventArgs e)
|
||||
{
|
||||
mObjParent = mObjControl.Parent;
|
||||
}
|
||||
|
||||
private void mObj_ParentChanged(PaintingObject sender, EventArgs e)
|
||||
{
|
||||
mObjControl = mObj.Parent;
|
||||
mObjParent = mObjControl?.Parent;
|
||||
}
|
||||
|
||||
}
|
||||
@@ -1,189 +0,0 @@
|
||||
Imports System.Drawing
|
||||
Imports System.Windows.Forms
|
||||
|
||||
Imports Pilz.Drawing
|
||||
|
||||
<Serializable> Friend Class PaintingObjectResizing
|
||||
|
||||
Public Shared Event CheckEnabled(sender As PaintingObjectResizing, ByRef enabled As Boolean)
|
||||
|
||||
Private WithEvents mObj As PaintingObject
|
||||
Private WithEvents mObjParent As Control = Nothing
|
||||
Private WithEvents mObjControl As Control = Nothing
|
||||
Private mMouseDown As Boolean = False
|
||||
Private mEdge As EdgeEnum = EdgeEnum.None
|
||||
Private mWidth As Integer = 4
|
||||
Private qWidth As Integer = 4 * 4
|
||||
Private rect As New Rectangle
|
||||
|
||||
Public Property Enabled As Boolean = True
|
||||
Public Property MinimumSize As New SizeF(15, 15)
|
||||
|
||||
<Serializable> Private Enum EdgeEnum
|
||||
None
|
||||
Right
|
||||
Left
|
||||
Top
|
||||
Bottom
|
||||
TopLeft
|
||||
TopRight
|
||||
BottomLeft
|
||||
BottomRight
|
||||
End Enum
|
||||
|
||||
Public ReadOnly Property IsResizing As Boolean
|
||||
Get
|
||||
Return mMouseDown AndAlso mEdge <> EdgeEnum.None
|
||||
End Get
|
||||
End Property
|
||||
|
||||
Public ReadOnly Property PaintingObject As PaintingObject
|
||||
Get
|
||||
Return mObj
|
||||
End Get
|
||||
End Property
|
||||
|
||||
Public Sub New(obj As PaintingObject)
|
||||
mObj = obj
|
||||
mObjControl = mObj.Parent
|
||||
End Sub
|
||||
|
||||
Private Function IsEnabled() As Boolean
|
||||
Dim enabled = Me.Enabled
|
||||
|
||||
RaiseEvent CheckEnabled(Me, enabled)
|
||||
|
||||
Return enabled
|
||||
End Function
|
||||
|
||||
Private Sub mControl_MouseDown(sender As Object, e As MouseEventArgs) Handles mObj.MouseDown
|
||||
If e.Button = System.Windows.Forms.MouseButtons.Left Then
|
||||
mMouseDown = True
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Private Sub mControl_MouseUp(sender As Object, e As MouseEventArgs) Handles mObj.MouseUp
|
||||
mMouseDown = False
|
||||
|
||||
If mObj.Selected Then
|
||||
mObj.AutoArrangeToGrid()
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Private Sub KeepInRange(ByRef size As SizeF)
|
||||
If size.Height < MinimumSize.Height OrElse size.Width < MinimumSize.Width Then
|
||||
size = New SizeF(Math.Max(size.Width, MinimumSize.Width),
|
||||
Math.Max(size.Height, MinimumSize.Height))
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Private Sub mControl_MouseMove(sender As Object, e As MouseEventArgs) Handles mObjControl.MouseMove
|
||||
If mMouseDown AndAlso mEdge <> EdgeEnum.None Then
|
||||
|
||||
Dim eX As Integer = e.X + mObj.Parent.Offset.X
|
||||
Dim eY As Integer = e.Y + mObj.Parent.Offset.Y
|
||||
|
||||
Select Case mEdge
|
||||
Case EdgeEnum.TopLeft
|
||||
mObj.SetBounds(eX, eY, mObj.Width + (mObj.Left - eX), mObj.Height + (mObj.Top - eY))
|
||||
Case EdgeEnum.TopRight
|
||||
mObj.SetBounds(mObj.Left, eY, eX - mObj.Left, mObj.Height + (mObj.Top - eY))
|
||||
Case EdgeEnum.BottomRight
|
||||
mObj.SetBounds(mObj.Left, mObj.Top, eX - mObj.Left, eY - mObj.Top)
|
||||
Case EdgeEnum.BottomLeft
|
||||
mObj.SetBounds(eX, mObj.Top, mObj.Width + (mObj.Left - eX), eY - mObj.Top)
|
||||
Case EdgeEnum.Left
|
||||
mObj.SetBounds(eX, mObj.Top, mObj.Width + (mObj.Left - eX), mObj.Height)
|
||||
Case EdgeEnum.Right
|
||||
mObj.SetBounds(mObj.Left, mObj.Top, eX - mObj.Left, mObj.Height)
|
||||
Case EdgeEnum.Top
|
||||
mObj.SetBounds(mObj.Left, eY, mObj.Width, mObj.Height + (mObj.Top - eY))
|
||||
Case EdgeEnum.Bottom
|
||||
mObj.SetBounds(mObj.Left, mObj.Top, mObj.Width, eY - mObj.Top)
|
||||
End Select
|
||||
|
||||
KeepInRange(mObj.Size)
|
||||
|
||||
ElseIf Not mMouseDown Then
|
||||
|
||||
Dim eXo As Integer = e.X
|
||||
Dim eYo As Integer = e.Y
|
||||
Dim realX As Integer = eXo + mObj.Parent.Offset.X
|
||||
Dim realY As Integer = eYo + mObj.Parent.Offset.Y
|
||||
Dim eXwo As Integer = eXo - mObj.X
|
||||
Dim eYwo As Integer = eYo - mObj.Y
|
||||
Dim eX As Integer = eXwo + mObj.Parent.Offset.X
|
||||
Dim eY As Integer = eYwo + mObj.Parent.Offset.Y
|
||||
Dim eLocation As New Point(eX, eY)
|
||||
Dim extRect As RectangleF = mObj.RectangleExtended
|
||||
Dim oldRect As RectangleF = mObj.Rectangle
|
||||
|
||||
Dim newRect As New RectangleF
|
||||
newRect.X = extRect.X - oldRect.X
|
||||
newRect.Y = extRect.Y - oldRect.Y
|
||||
newRect.Width = (extRect.Width - oldRect.Width) / 2
|
||||
newRect.Height = (extRect.Height - oldRect.Height) / 2
|
||||
|
||||
Dim setToNone As Boolean = False
|
||||
Dim isOnTop As Boolean = mObj.Parent.GetObject(New PointF(realX, realY), True) Is mObj
|
||||
|
||||
If IsEnabled() AndAlso isOnTop Then
|
||||
Select Case True
|
||||
Case HelpfulDrawingFunctions.IsPointInRectangle(eLocation, New Rectangle(newRect.X, newRect.Y, newRect.Width, newRect.Height))
|
||||
mObj.Cursor = Cursors.SizeNWSE
|
||||
mEdge = EdgeEnum.TopLeft
|
||||
Case HelpfulDrawingFunctions.IsPointInRectangle(eLocation, New Rectangle(mObj.Width, newRect.Y, newRect.Width, newRect.Height))
|
||||
mObj.Cursor = Cursors.SizeNESW
|
||||
mEdge = EdgeEnum.TopRight
|
||||
Case HelpfulDrawingFunctions.IsPointInRectangle(eLocation, New Rectangle(mObj.Width, mObj.Height, newRect.Width, newRect.Height))
|
||||
mObj.Cursor = Cursors.SizeNWSE
|
||||
mEdge = EdgeEnum.BottomRight
|
||||
Case HelpfulDrawingFunctions.IsPointInRectangle(eLocation, New Rectangle(newRect.X, mObj.Height, newRect.Width, newRect.Height))
|
||||
mObj.Cursor = Cursors.SizeNESW
|
||||
mEdge = EdgeEnum.BottomLeft
|
||||
Case HelpfulDrawingFunctions.IsPointInRectangle(eLocation, New Rectangle(-newRect.Width, 0, newRect.Width, mObj.Height))
|
||||
mObj.Cursor = Cursors.SizeWE
|
||||
mEdge = EdgeEnum.Left
|
||||
Case HelpfulDrawingFunctions.IsPointInRectangle(eLocation, New Rectangle(mObj.Width, 0, newRect.Width, mObj.Height))
|
||||
mObj.Cursor = Cursors.SizeWE
|
||||
mEdge = EdgeEnum.Right
|
||||
Case HelpfulDrawingFunctions.IsPointInRectangle(eLocation, New Rectangle(0, -newRect.Height, mObj.Width, newRect.Height))
|
||||
mObj.Cursor = Cursors.SizeNS
|
||||
mEdge = EdgeEnum.Top
|
||||
Case HelpfulDrawingFunctions.IsPointInRectangle(eLocation, New Rectangle(0, mObj.Height, mObj.Width, newRect.Height))
|
||||
mObj.Cursor = Cursors.SizeNS
|
||||
mEdge = EdgeEnum.Bottom
|
||||
Case Else
|
||||
setToNone = True
|
||||
End Select
|
||||
Else
|
||||
setToNone = True
|
||||
End If
|
||||
|
||||
If setToNone Then
|
||||
mObj.Cursor = Cursors.Default
|
||||
mEdge = EdgeEnum.None
|
||||
End If
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Private Sub mControl_Paint(sender As PaintingObject, e As PaintEventArgs) Handles mObj.Paint
|
||||
'e.Graphics.FillRectangle(brush, rect)
|
||||
End Sub
|
||||
|
||||
Private Sub mControl_MouseLeave(ByVal sender As PaintingObject, ByVal e As EventArgs) Handles mObj.SelectedChanged
|
||||
If Not sender.Selected Then
|
||||
mEdge = EdgeEnum.None
|
||||
End If
|
||||
End Sub
|
||||
|
||||
Private Sub mObjParent_ParentChanged(sender As Object, e As EventArgs) Handles mObjControl.ParentChanged
|
||||
mObjParent = mObjControl.Parent
|
||||
End Sub
|
||||
|
||||
Private Sub mObj_ParentChanged(sender As PaintingObject, e As EventArgs) Handles mObj.ParentChanged
|
||||
mObjControl = mObj.Parent
|
||||
mObjParent = mObjControl?.Parent
|
||||
End Sub
|
||||
|
||||
End Class
|
||||
@@ -1,52 +0,0 @@
|
||||
<Project Sdk="Microsoft.NET.Sdk">
|
||||
<PropertyGroup>
|
||||
<MyType>Windows</MyType>
|
||||
<TargetFrameworks>net8.0-windows</TargetFrameworks>
|
||||
<LangVersion>latest</LangVersion>
|
||||
<DocumentationFile>Pilz.UI.xml</DocumentationFile>
|
||||
<UseWindowsForms>true</UseWindowsForms>
|
||||
<DefaultItemExcludes>$(DefaultItemExcludes);$(ProjectDir)**\*.vb</DefaultItemExcludes>
|
||||
<ImplicitUsings>enable</ImplicitUsings>
|
||||
<Nullable>annotations</Nullable>
|
||||
</PropertyGroup>
|
||||
<PropertyGroup>
|
||||
<Version>2.4.7</Version>
|
||||
</PropertyGroup>
|
||||
<ItemGroup>
|
||||
<PackageReference Include="Newtonsoft.Json" Version="13.0.3" />
|
||||
</ItemGroup>
|
||||
<ItemGroup>
|
||||
<Import Include="Microsoft.VisualBasic" />
|
||||
<Import Include="System" />
|
||||
<Import Include="System.Collections" />
|
||||
<Import Include="System.Collections.Generic" />
|
||||
<Import Include="System.Data" />
|
||||
<Import Include="System.Diagnostics" />
|
||||
<Import Include="System.Linq" />
|
||||
<Import Include="System.Xml.Linq" />
|
||||
<Import Include="System.Threading.Tasks" />
|
||||
</ItemGroup>
|
||||
<ItemGroup>
|
||||
<Compile Update="PaintingControl\PaintingControl.cs" />
|
||||
<Compile Update="Resources.Designer.cs">
|
||||
<AutoGen>True</AutoGen>
|
||||
<DesignTime>True</DesignTime>
|
||||
<DependentUpon>Resources.resx</DependentUpon>
|
||||
</Compile>
|
||||
</ItemGroup>
|
||||
<ItemGroup>
|
||||
<EmbeddedResource Update="Resources.resx">
|
||||
<Generator>ResXFileCodeGenerator</Generator>
|
||||
<LastGenOutput>Resources.Designer.cs</LastGenOutput>
|
||||
<CustomToolNamespace>Pilz.UI.My.Resources</CustomToolNamespace>
|
||||
<SubType>Designer</SubType>
|
||||
</EmbeddedResource>
|
||||
<EmbeddedResource Update="PaintingControl\PaintingControl.resx">
|
||||
<DependentUpon>PaintingControl.cs</DependentUpon>
|
||||
</EmbeddedResource>
|
||||
</ItemGroup>
|
||||
<ItemGroup>
|
||||
<ProjectReference Include="..\Pilz.Drawing\Pilz.Drawing.vbproj" />
|
||||
<ProjectReference Include="..\Pilz.Win32\Pilz.Win32.csproj" />
|
||||
</ItemGroup>
|
||||
</Project>
|
||||
@@ -1,104 +0,0 @@
|
||||
<Project Sdk="Microsoft.NET.Sdk">
|
||||
<PropertyGroup>
|
||||
<MyType>Windows</MyType>
|
||||
<TargetFrameworks>net6.0-windows;net8.0-windows</TargetFrameworks>
|
||||
<NoWarn>42016,41999,42017,42018,42019,42032,42036,42020,42021,42022</NoWarn>
|
||||
<DocumentationFile>Pilz.UI.xml</DocumentationFile>
|
||||
<DefineTrace>true</DefineTrace>
|
||||
<UseWindowsForms>true</UseWindowsForms>
|
||||
</PropertyGroup>
|
||||
<PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Debug|AnyCPU' ">
|
||||
<DefineDebug>true</DefineDebug>
|
||||
</PropertyGroup>
|
||||
<PropertyGroup Condition=" '$(Configuration)|$(Platform)' == 'Release|AnyCPU' ">
|
||||
<DefineDebug>false</DefineDebug>
|
||||
<RemoveIntegerChecks>true</RemoveIntegerChecks>
|
||||
</PropertyGroup>
|
||||
<PropertyGroup>
|
||||
<OptionExplicit>On</OptionExplicit>
|
||||
</PropertyGroup>
|
||||
<PropertyGroup>
|
||||
<OptionCompare>Binary</OptionCompare>
|
||||
</PropertyGroup>
|
||||
<PropertyGroup>
|
||||
<OptionStrict>Off</OptionStrict>
|
||||
</PropertyGroup>
|
||||
<PropertyGroup>
|
||||
<OptionInfer>On</OptionInfer>
|
||||
</PropertyGroup>
|
||||
<PropertyGroup Condition="'$(Configuration)|$(Platform)' == 'Debug|x86'">
|
||||
<DefineDebug>true</DefineDebug>
|
||||
<OutputPath>bin\$(Platform)\$(Configuration)\</OutputPath>
|
||||
<CodeAnalysisRuleSet>MinimumRecommendedRules.ruleset</CodeAnalysisRuleSet>
|
||||
<UseVSHostingProcess>true</UseVSHostingProcess>
|
||||
</PropertyGroup>
|
||||
<PropertyGroup Condition="'$(Configuration)|$(Platform)' == 'Release|x86'">
|
||||
<OutputPath>bin\$(Platform)\$(Configuration)\</OutputPath>
|
||||
<RemoveIntegerChecks>true</RemoveIntegerChecks>
|
||||
<CodeAnalysisRuleSet>MinimumRecommendedRules.ruleset</CodeAnalysisRuleSet>
|
||||
</PropertyGroup>
|
||||
<PropertyGroup>
|
||||
<Version>2.0.0</Version>
|
||||
</PropertyGroup>
|
||||
<ItemGroup>
|
||||
<PackageReference Include="System.Data.DataSetExtensions" Version="4.5.0" />
|
||||
<PackageReference Include="System.Net.Http" Version="4.3.4" />
|
||||
</ItemGroup>
|
||||
<ItemGroup>
|
||||
<PackageReference Include="Newtonsoft.Json" Version="13.0.3" />
|
||||
</ItemGroup>
|
||||
<ItemGroup>
|
||||
<Import Include="Microsoft.VisualBasic" />
|
||||
<Import Include="System" />
|
||||
<Import Include="System.Collections" />
|
||||
<Import Include="System.Collections.Generic" />
|
||||
<Import Include="System.Data" />
|
||||
<Import Include="System.Diagnostics" />
|
||||
<Import Include="System.Linq" />
|
||||
<Import Include="System.Xml.Linq" />
|
||||
<Import Include="System.Threading.Tasks" />
|
||||
</ItemGroup>
|
||||
<ItemGroup>
|
||||
<Compile Update="PaintingControl\PaintingControl.vb" />
|
||||
<Compile Update="My Project\Application.Designer.vb">
|
||||
<AutoGen>True</AutoGen>
|
||||
<DependentUpon>Application.myapp</DependentUpon>
|
||||
</Compile>
|
||||
<Compile Update="My Project\Resources.Designer.vb">
|
||||
<AutoGen>True</AutoGen>
|
||||
<DesignTime>True</DesignTime>
|
||||
<DependentUpon>Resources.resx</DependentUpon>
|
||||
</Compile>
|
||||
<Compile Update="My Project\Settings.Designer.vb">
|
||||
<AutoGen>True</AutoGen>
|
||||
<DependentUpon>Settings.settings</DependentUpon>
|
||||
<DesignTimeSharedInput>True</DesignTimeSharedInput>
|
||||
</Compile>
|
||||
</ItemGroup>
|
||||
<ItemGroup>
|
||||
<EmbeddedResource Update="My Project\Resources.resx">
|
||||
<Generator>VbMyResourcesResXFileCodeGenerator</Generator>
|
||||
<LastGenOutput>Resources.Designer.vb</LastGenOutput>
|
||||
<CustomToolNamespace>My.Resources</CustomToolNamespace>
|
||||
<SubType>Designer</SubType>
|
||||
</EmbeddedResource>
|
||||
<EmbeddedResource Update="PaintingControl\PaintingControl.resx">
|
||||
<DependentUpon>PaintingControl.vb</DependentUpon>
|
||||
</EmbeddedResource>
|
||||
</ItemGroup>
|
||||
<ItemGroup>
|
||||
<None Include="My Project\Application.myapp">
|
||||
<Generator>MyApplicationCodeGenerator</Generator>
|
||||
<LastGenOutput>Application.Designer.vb</LastGenOutput>
|
||||
</None>
|
||||
<None Include="My Project\Settings.settings">
|
||||
<Generator>SettingsSingleFileGenerator</Generator>
|
||||
<CustomToolNamespace>My</CustomToolNamespace>
|
||||
<LastGenOutput>Settings.Designer.vb</LastGenOutput>
|
||||
</None>
|
||||
</ItemGroup>
|
||||
<ItemGroup>
|
||||
<ProjectReference Include="..\Pilz.Drawing\Pilz.Drawing.vbproj" />
|
||||
<ProjectReference Include="..\Pilz.Win32\Pilz.Win32.vbproj" />
|
||||
</ItemGroup>
|
||||
</Project>
|
||||
69
Pilz.UI/Resources.Designer.cs
generated
69
Pilz.UI/Resources.Designer.cs
generated
@@ -1,69 +0,0 @@
|
||||
// ------------------------------------------------------------------------------
|
||||
// <auto-generated>
|
||||
// Dieser Code wurde von einem Tool generiert.
|
||||
// Laufzeitversion:4.0.30319.42000
|
||||
//
|
||||
// Änderungen an dieser Datei können falsches Verhalten verursachen und gehen verloren, wenn
|
||||
// der Code erneut generiert wird.
|
||||
// </auto-generated>
|
||||
// ------------------------------------------------------------------------------
|
||||
|
||||
|
||||
using System.Diagnostics;
|
||||
using Microsoft.VisualBasic;
|
||||
|
||||
namespace Pilz.UI.My.Resources
|
||||
{
|
||||
|
||||
// Diese Klasse wurde von der StronglyTypedResourceBuilder automatisch generiert
|
||||
// -Klasse über ein Tool wie ResGen oder Visual Studio automatisch generiert.
|
||||
// Um einen Member hinzuzufügen oder zu entfernen, bearbeiten Sie die .ResX-Datei und führen dann ResGen
|
||||
// mit der /str-Option erneut aus, oder Sie erstellen Ihr VS-Projekt neu.
|
||||
/// <summary>
|
||||
/// Eine stark typisierte Ressourcenklasse zum Suchen von lokalisierten Zeichenfolgen usw.
|
||||
/// </summary>
|
||||
[System.CodeDom.Compiler.GeneratedCode("System.Resources.Tools.StronglyTypedResourceBuilder", "17.0.0.0")]
|
||||
[DebuggerNonUserCode()]
|
||||
[System.Runtime.CompilerServices.CompilerGenerated()]
|
||||
internal static class Resources
|
||||
{
|
||||
|
||||
private static System.Resources.ResourceManager resourceMan;
|
||||
|
||||
private static System.Globalization.CultureInfo resourceCulture;
|
||||
|
||||
/// <summary>
|
||||
/// Gibt die zwischengespeicherte ResourceManager-Instanz zurück, die von dieser Klasse verwendet wird.
|
||||
/// </summary>
|
||||
[System.ComponentModel.EditorBrowsable(System.ComponentModel.EditorBrowsableState.Advanced)]
|
||||
internal static System.Resources.ResourceManager ResourceManager
|
||||
{
|
||||
get
|
||||
{
|
||||
if (ReferenceEquals(resourceMan, null))
|
||||
{
|
||||
var temp = new System.Resources.ResourceManager("Pilz.UI.Resources", typeof(Resources).Assembly);
|
||||
resourceMan = temp;
|
||||
}
|
||||
return resourceMan;
|
||||
}
|
||||
}
|
||||
|
||||
/// <summary>
|
||||
/// Überschreibt die CurrentUICulture-Eigenschaft des aktuellen Threads für alle
|
||||
/// Ressourcenzuordnungen, die diese stark typisierte Ressourcenklasse verwenden.
|
||||
/// </summary>
|
||||
[System.ComponentModel.EditorBrowsable(System.ComponentModel.EditorBrowsableState.Advanced)]
|
||||
internal static System.Globalization.CultureInfo Culture
|
||||
{
|
||||
get
|
||||
{
|
||||
return resourceCulture;
|
||||
}
|
||||
set
|
||||
{
|
||||
resourceCulture = value;
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,117 +0,0 @@
|
||||
<?xml version="1.0" encoding="utf-8"?>
|
||||
<root>
|
||||
<!--
|
||||
Microsoft ResX Schema
|
||||
|
||||
Version 2.0
|
||||
|
||||
The primary goals of this format is to allow a simple XML format
|
||||
that is mostly human readable. The generation and parsing of the
|
||||
various data types are done through the TypeConverter classes
|
||||
associated with the data types.
|
||||
|
||||
Example:
|
||||
|
||||
... ado.net/XML headers & schema ...
|
||||
<resheader name="resmimetype">text/microsoft-resx</resheader>
|
||||
<resheader name="version">2.0</resheader>
|
||||
<resheader name="reader">System.Resources.ResXResourceReader, System.Windows.Forms, ...</resheader>
|
||||
<resheader name="writer">System.Resources.ResXResourceWriter, System.Windows.Forms, ...</resheader>
|
||||
<data name="Name1"><value>this is my long string</value><comment>this is a comment</comment></data>
|
||||
<data name="Color1" type="System.Drawing.Color, System.Drawing">Blue</data>
|
||||
<data name="Bitmap1" mimetype="application/x-microsoft.net.object.binary.base64">
|
||||
<value>[base64 mime encoded serialized .NET Framework object]</value>
|
||||
</data>
|
||||
<data name="Icon1" type="System.Drawing.Icon, System.Drawing" mimetype="application/x-microsoft.net.object.bytearray.base64">
|
||||
<value>[base64 mime encoded string representing a byte array form of the .NET Framework object]</value>
|
||||
<comment>This is a comment</comment>
|
||||
</data>
|
||||
|
||||
There are any number of "resheader" rows that contain simple
|
||||
name/value pairs.
|
||||
|
||||
Each data row contains a name, and value. The row also contains a
|
||||
type or mimetype. Type corresponds to a .NET class that support
|
||||
text/value conversion through the TypeConverter architecture.
|
||||
Classes that don't support this are serialized and stored with the
|
||||
mimetype set.
|
||||
|
||||
The mimetype is used for serialized objects, and tells the
|
||||
ResXResourceReader how to depersist the object. This is currently not
|
||||
extensible. For a given mimetype the value must be set accordingly:
|
||||
|
||||
Note - application/x-microsoft.net.object.binary.base64 is the format
|
||||
that the ResXResourceWriter will generate, however the reader can
|
||||
read any of the formats listed below.
|
||||
|
||||
mimetype: application/x-microsoft.net.object.binary.base64
|
||||
value : The object must be serialized with
|
||||
: System.Serialization.Formatters.Binary.BinaryFormatter
|
||||
: and then encoded with base64 encoding.
|
||||
|
||||
mimetype: application/x-microsoft.net.object.soap.base64
|
||||
value : The object must be serialized with
|
||||
: System.Runtime.Serialization.Formatters.Soap.SoapFormatter
|
||||
: and then encoded with base64 encoding.
|
||||
|
||||
mimetype: application/x-microsoft.net.object.bytearray.base64
|
||||
value : The object must be serialized into a byte array
|
||||
: using a System.ComponentModel.TypeConverter
|
||||
: and then encoded with base64 encoding.
|
||||
-->
|
||||
<xsd:schema id="root" xmlns="" xmlns:xsd="http://www.w3.org/2001/XMLSchema" xmlns:msdata="urn:schemas-microsoft-com:xml-msdata">
|
||||
<xsd:element name="root" msdata:IsDataSet="true">
|
||||
<xsd:complexType>
|
||||
<xsd:choice maxOccurs="unbounded">
|
||||
<xsd:element name="metadata">
|
||||
<xsd:complexType>
|
||||
<xsd:sequence>
|
||||
<xsd:element name="value" type="xsd:string" minOccurs="0" />
|
||||
</xsd:sequence>
|
||||
<xsd:attribute name="name" type="xsd:string" />
|
||||
<xsd:attribute name="type" type="xsd:string" />
|
||||
<xsd:attribute name="mimetype" type="xsd:string" />
|
||||
</xsd:complexType>
|
||||
</xsd:element>
|
||||
<xsd:element name="assembly">
|
||||
<xsd:complexType>
|
||||
<xsd:attribute name="alias" type="xsd:string" />
|
||||
<xsd:attribute name="name" type="xsd:string" />
|
||||
</xsd:complexType>
|
||||
</xsd:element>
|
||||
<xsd:element name="data">
|
||||
<xsd:complexType>
|
||||
<xsd:sequence>
|
||||
<xsd:element name="value" type="xsd:string" minOccurs="0" msdata:Ordinal="1" />
|
||||
<xsd:element name="comment" type="xsd:string" minOccurs="0" msdata:Ordinal="2" />
|
||||
</xsd:sequence>
|
||||
<xsd:attribute name="name" type="xsd:string" msdata:Ordinal="1" />
|
||||
<xsd:attribute name="type" type="xsd:string" msdata:Ordinal="3" />
|
||||
<xsd:attribute name="mimetype" type="xsd:string" msdata:Ordinal="4" />
|
||||
</xsd:complexType>
|
||||
</xsd:element>
|
||||
<xsd:element name="resheader">
|
||||
<xsd:complexType>
|
||||
<xsd:sequence>
|
||||
<xsd:element name="value" type="xsd:string" minOccurs="0" msdata:Ordinal="1" />
|
||||
</xsd:sequence>
|
||||
<xsd:attribute name="name" type="xsd:string" use="required" />
|
||||
</xsd:complexType>
|
||||
</xsd:element>
|
||||
</xsd:choice>
|
||||
</xsd:complexType>
|
||||
</xsd:element>
|
||||
</xsd:schema>
|
||||
<resheader name="resmimetype">
|
||||
<value>text/microsoft-resx</value>
|
||||
</resheader>
|
||||
<resheader name="version">
|
||||
<value>2.0</value>
|
||||
</resheader>
|
||||
<resheader name="reader">
|
||||
<value>System.Resources.ResXResourceReader, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089</value>
|
||||
</resheader>
|
||||
<resheader name="writer">
|
||||
<value>System.Resources.ResXResourceWriter, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089</value>
|
||||
</resheader>
|
||||
</root>
|
||||
@@ -1,12 +0,0 @@
|
||||
using System.Reflection;
|
||||
|
||||
namespace Pilz.UI.Symbols;
|
||||
|
||||
public interface ISymbolFactory<TSymbols>
|
||||
{
|
||||
Image? GetImage(TSymbols svgImage, Size size);
|
||||
Image? GetImage(TSymbols svgImage, SymbolSize size);
|
||||
Assembly GetImageResourceAssembly();
|
||||
string GetImageRessourcePath(TSymbols svgImage);
|
||||
Stream? GetImageRessourceStream(TSymbols svgImage);
|
||||
}
|
||||
@@ -1,54 +0,0 @@
|
||||
using System.Reflection;
|
||||
|
||||
namespace Pilz.UI.Symbols;
|
||||
|
||||
public abstract class SymbolFactory<TSymbols> : ISymbolFactory<TSymbols>
|
||||
{
|
||||
public abstract string GetImageRessourcePath(TSymbols svgImage);
|
||||
public abstract Assembly GetImageResourceAssembly();
|
||||
|
||||
protected virtual Size ResolveCommonSize(SymbolSize size)
|
||||
{
|
||||
return size switch
|
||||
{
|
||||
SymbolSize.Default => Size.Empty,
|
||||
SymbolSize.Small => new Size(16, 16),
|
||||
SymbolSize.Medium => new Size(20, 20),
|
||||
SymbolSize.Large => new Size(32, 32),
|
||||
_ => new Size((int)size, (int)size),
|
||||
};
|
||||
}
|
||||
|
||||
public virtual Stream? GetImageRessourceStream(TSymbols svgImage)
|
||||
{
|
||||
var asm = GetImageResourceAssembly();
|
||||
var path = GetImageRessourcePath(svgImage);
|
||||
return asm.GetManifestResourceStream(path);
|
||||
}
|
||||
|
||||
public virtual Image? GetImage(TSymbols svgImage, SymbolSize size)
|
||||
{
|
||||
return GetImage(svgImage, ResolveCommonSize(size));
|
||||
}
|
||||
|
||||
public virtual Image? GetImage(TSymbols svgImage, Size size)
|
||||
{
|
||||
using var stream = GetImageRessourceStream(svgImage);
|
||||
|
||||
if (stream is null)
|
||||
return null;
|
||||
|
||||
var img = Image.FromStream(stream);
|
||||
|
||||
if (!size.IsEmpty)
|
||||
{
|
||||
var img2 = new Bitmap(size.Width, size.Height);
|
||||
using var g = Graphics.FromImage(img2);
|
||||
g.DrawImage(img2, 0, 0, size.Width, size.Height);
|
||||
img.Dispose();
|
||||
img = img2;
|
||||
}
|
||||
|
||||
return img;
|
||||
}
|
||||
}
|
||||
@@ -1,72 +0,0 @@
|
||||
namespace Pilz.UI.Symbols;
|
||||
|
||||
public enum SymbolSize
|
||||
{
|
||||
/// <summary>
|
||||
/// Don't resize and just returns the original size.
|
||||
/// </summary>
|
||||
Default,
|
||||
/// <summary>
|
||||
/// Resizes the symbol to 16 x 16 pixels.
|
||||
/// <br/><b>Deprecated!</b> This is just present due legacy reasons. Use <see cref="x16"/> instead.
|
||||
/// </summary>
|
||||
Small,
|
||||
/// <summary>
|
||||
/// Resizes the symbol to 20 x 20 pixels.
|
||||
/// <br/><b>Deprecated!</b> This is just present due legacy reasons. Use <see cref="x20"/> instead.
|
||||
/// </summary>
|
||||
Medium,
|
||||
/// <summary>
|
||||
/// Resizes the symbol to 32 x 32 pixels.
|
||||
/// <br/><b>Deprecated!</b> This is just present due legacy reasons. Use <see cref="x32"/> instead.
|
||||
/// </summary>
|
||||
Large,
|
||||
/// <summary>
|
||||
/// Resizes the symbol to 8 x 8 pixels.
|
||||
/// </summary>
|
||||
x8 = 8,
|
||||
/// <summary>
|
||||
/// Resizes the symbol to 12 x 12 pixels.
|
||||
/// </summary>
|
||||
x12 = 12,
|
||||
/// <summary>
|
||||
/// Resizes the symbol to 16 x 16 pixels.
|
||||
/// </summary>
|
||||
x16 = 16,
|
||||
/// <summary>
|
||||
/// Resizes the symbol to 20 x 20 pixels.
|
||||
/// </summary>
|
||||
x20 = 20,
|
||||
/// <summary>
|
||||
/// Resizes the symbol to 32 x 32 pixels.
|
||||
/// </summary>
|
||||
x32 = 32,
|
||||
/// <summary>
|
||||
/// Resizes the symbol to 48 x 48 pixels.
|
||||
/// </summary>
|
||||
x48 = 48,
|
||||
/// <summary>
|
||||
/// Resizes the symbol to 64 x 64 pixels.
|
||||
/// </summary>
|
||||
x64 = 64,
|
||||
/// <summary>
|
||||
/// Resizes the symbol to 96 x 96 pixels.
|
||||
/// </summary>
|
||||
x96 = 96,
|
||||
/// <summary>
|
||||
/// Resizes the symbol to 128 x 128 pixels.
|
||||
/// </summary>
|
||||
x128 = 128,
|
||||
/// <summary>
|
||||
/// Resizes the symbol to 192 x 192 pixels.
|
||||
/// </summary>
|
||||
x192 = 192,
|
||||
/// <summary>
|
||||
/// Resizes the symbol to 256 x 256 pixels.
|
||||
/// </summary>
|
||||
x256 = 256,
|
||||
/// <summary>
|
||||
/// Resizes the symbol to 512 x 512 pixels.
|
||||
/// </summary>
|
||||
x512 = 512,
|
||||
}
|
||||
@@ -1,50 +0,0 @@
|
||||
using System.Collections.Generic;
|
||||
using System.Windows.Forms;
|
||||
|
||||
namespace Pilz.UI.Utils;
|
||||
|
||||
|
||||
public static class DrawingControl
|
||||
{
|
||||
|
||||
private const int WM_SETREDRAW = 11;
|
||||
private readonly static Dictionary<nint, int> dicSuspendCount = new Dictionary<nint, int>();
|
||||
|
||||
public static void SuspendDrawing(this Control control)
|
||||
{
|
||||
if (!dicSuspendCount.ContainsKey(control.Handle))
|
||||
dicSuspendCount.Add(control.Handle, 1);
|
||||
else
|
||||
{
|
||||
dicSuspendCount[control.Handle] += 1;
|
||||
}
|
||||
|
||||
if (dicSuspendCount[control.Handle] == 1)
|
||||
User32Bridge.SendMessage(control.Handle, WM_SETREDRAW, false, 0);
|
||||
}
|
||||
|
||||
public static void ResumeDrawing(this Control control)
|
||||
{
|
||||
control.ResumeDrawing(true);
|
||||
}
|
||||
|
||||
public static void ResumeDrawing(this Control control, bool redraw)
|
||||
{
|
||||
bool doRedraw = true;
|
||||
|
||||
if (dicSuspendCount.ContainsKey(control.Handle))
|
||||
{
|
||||
dicSuspendCount[control.Handle] -= 1;
|
||||
if (dicSuspendCount[control.Handle] >= 1)
|
||||
doRedraw = false;
|
||||
}
|
||||
|
||||
if (doRedraw)
|
||||
{
|
||||
User32Bridge.SendMessage(control.Handle, WM_SETREDRAW, true, 0);
|
||||
if (redraw)
|
||||
control.Refresh();
|
||||
}
|
||||
}
|
||||
|
||||
}
|
||||
@@ -1,48 +0,0 @@
|
||||
Imports System.Runtime.CompilerServices
|
||||
Imports System.Windows.Forms
|
||||
|
||||
Namespace Utils
|
||||
|
||||
Public Module DrawingControl
|
||||
|
||||
Private Const WM_SETREDRAW = 11
|
||||
Private ReadOnly dicSuspendCount As New Dictionary(Of IntPtr, Integer)
|
||||
|
||||
<Extension>
|
||||
Public Sub SuspendDrawing(control As Control)
|
||||
If Not dicSuspendCount.ContainsKey(control.Handle) Then
|
||||
dicSuspendCount.Add(control.Handle, 1)
|
||||
Else
|
||||
dicSuspendCount(control.Handle) += 1
|
||||
End If
|
||||
|
||||
If dicSuspendCount(control.Handle) = 1 Then
|
||||
SendMessage(control.Handle, WM_SETREDRAW, False, 0)
|
||||
End If
|
||||
End Sub
|
||||
|
||||
<Extension>
|
||||
Public Sub ResumeDrawing(control As Control)
|
||||
ResumeDrawing(control, True)
|
||||
End Sub
|
||||
|
||||
<Extension>
|
||||
Public Sub ResumeDrawing(control As Control, redraw As Boolean)
|
||||
Dim doRedraw As Boolean = True
|
||||
|
||||
If dicSuspendCount.ContainsKey(control.Handle) Then
|
||||
dicSuspendCount(control.Handle) -= 1
|
||||
If dicSuspendCount(control.Handle) >= 1 Then
|
||||
doRedraw = False
|
||||
End If
|
||||
End If
|
||||
|
||||
If doRedraw Then
|
||||
SendMessage(control.Handle, WM_SETREDRAW, True, 0)
|
||||
If redraw Then control.Refresh()
|
||||
End If
|
||||
End Sub
|
||||
|
||||
End Module
|
||||
|
||||
End Namespace
|
||||
@@ -1,9 +0,0 @@
|
||||
using System.Runtime.InteropServices;
|
||||
|
||||
namespace Pilz.UI;
|
||||
|
||||
public static class User32Bridge
|
||||
{
|
||||
[DllImport("user32.dll", CharSet = CharSet.Auto)]
|
||||
internal static extern int SendMessage(nint hWnd, int Msg, bool wParam, int lParam);
|
||||
}
|
||||
@@ -1,5 +0,0 @@
|
||||
Public Module User32Bridge
|
||||
|
||||
Friend Declare Auto Function SendMessage Lib "user32.dll" (hWnd As IntPtr, Msg As Integer, wParam As Boolean, lParam As Integer) As Integer
|
||||
|
||||
End Module
|
||||
Reference in New Issue
Block a user