diff --git a/Pilz.Collections/App.config b/Pilz.Collections/App.config
new file mode 100644
index 0000000..1729194
--- /dev/null
+++ b/Pilz.Collections/App.config
@@ -0,0 +1,6 @@
+
+
+
+
+
+
diff --git a/Pilz.Collections/My Project/Application.Designer.vb b/Pilz.Collections/My Project/Application.Designer.vb
new file mode 100644
index 0000000..8ab460b
--- /dev/null
+++ b/Pilz.Collections/My Project/Application.Designer.vb
@@ -0,0 +1,13 @@
+'------------------------------------------------------------------------------
+'
+' Dieser Code wurde von einem Tool generiert.
+' Laufzeitversion:4.0.30319.42000
+'
+' Änderungen an dieser Datei können falsches Verhalten verursachen und gehen verloren, wenn
+' der Code erneut generiert wird.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
diff --git a/Pilz.Collections/My Project/Application.myapp b/Pilz.Collections/My Project/Application.myapp
new file mode 100644
index 0000000..1243847
--- /dev/null
+++ b/Pilz.Collections/My Project/Application.myapp
@@ -0,0 +1,11 @@
+
+
+ true
+ Form1
+ false
+ 0
+ true
+ 0
+ 0
+ true
+
diff --git a/Pilz.Collections/My Project/AssemblyInfo.vb b/Pilz.Collections/My Project/AssemblyInfo.vb
new file mode 100644
index 0000000..16e3ed2
--- /dev/null
+++ b/Pilz.Collections/My Project/AssemblyInfo.vb
@@ -0,0 +1,35 @@
+Imports System
+Imports System.Reflection
+Imports System.Runtime.InteropServices
+
+' Allgemeine Informationen über eine Assembly werden über die folgenden
+' Attribute gesteuert. Ändern Sie diese Attributwerte, um die Informationen zu ändern,
+' die einer Assembly zugeordnet sind.
+
+' Werte der Assemblyattribute überprüfen
+
+
+
+
+
+
+
+
+
+
+'Die folgende GUID bestimmt die ID der Typbibliothek, wenn dieses Projekt für COM verfügbar gemacht wird.
+
+
+' Versionsinformationen für eine Assembly bestehen aus den folgenden vier Werten:
+'
+' Hauptversion
+' Nebenversion
+' Buildnummer
+' Revision
+'
+' Sie können alle Werte angeben oder Standardwerte für die Build- und Revisionsnummern verwenden,
+' übernehmen, indem Sie "*" eingeben:
+'
+
+
+
diff --git a/Pilz.Collections/My Project/Resources.Designer.vb b/Pilz.Collections/My Project/Resources.Designer.vb
new file mode 100644
index 0000000..efc949e
--- /dev/null
+++ b/Pilz.Collections/My Project/Resources.Designer.vb
@@ -0,0 +1,63 @@
+'------------------------------------------------------------------------------
+'
+' Dieser Code wurde von einem Tool generiert.
+' Laufzeitversion:4.0.30319.42000
+'
+' Änderungen an dieser Datei können falsches Verhalten verursachen und gehen verloren, wenn
+' der Code erneut generiert wird.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
+Imports System
+
+Namespace My.Resources
+
+ 'Diese Klasse wurde von der StronglyTypedResourceBuilder automatisch generiert
+ '-Klasse über ein Tool wie ResGen oder Visual Studio automatisch generiert.
+ 'Um einen Member hinzuzufügen oder zu entfernen, bearbeiten Sie die .ResX-Datei und führen dann ResGen
+ 'mit der /str-Option erneut aus, oder Sie erstellen Ihr VS-Projekt neu.
+ '''
+ ''' Eine stark typisierte Ressourcenklasse zum Suchen von lokalisierten Zeichenfolgen usw.
+ '''
+ _
+ Friend Module Resources
+
+ Private resourceMan As Global.System.Resources.ResourceManager
+
+ Private resourceCulture As Global.System.Globalization.CultureInfo
+
+ '''
+ ''' Gibt die zwischengespeicherte ResourceManager-Instanz zurück, die von dieser Klasse verwendet wird.
+ '''
+ _
+ Friend ReadOnly Property ResourceManager() As Global.System.Resources.ResourceManager
+ Get
+ If Object.ReferenceEquals(resourceMan, Nothing) Then
+ Dim temp As Global.System.Resources.ResourceManager = New Global.System.Resources.ResourceManager("Pilz.Collections.Resources", GetType(Resources).Assembly)
+ resourceMan = temp
+ End If
+ Return resourceMan
+ End Get
+ End Property
+
+ '''
+ ''' Überschreibt die CurrentUICulture-Eigenschaft des aktuellen Threads für alle
+ ''' Ressourcenzuordnungen, die diese stark typisierte Ressourcenklasse verwenden.
+ '''
+ _
+ Friend Property Culture() As Global.System.Globalization.CultureInfo
+ Get
+ Return resourceCulture
+ End Get
+ Set
+ resourceCulture = value
+ End Set
+ End Property
+ End Module
+End Namespace
diff --git a/Pilz.Collections/My Project/Resources.resx b/Pilz.Collections/My Project/Resources.resx
new file mode 100644
index 0000000..af7dbeb
--- /dev/null
+++ b/Pilz.Collections/My Project/Resources.resx
@@ -0,0 +1,117 @@
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ text/microsoft-resx
+
+
+ 2.0
+
+
+ System.Resources.ResXResourceReader, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089
+
+
+ System.Resources.ResXResourceWriter, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089
+
+
\ No newline at end of file
diff --git a/Pilz.Collections/My Project/Settings.Designer.vb b/Pilz.Collections/My Project/Settings.Designer.vb
new file mode 100644
index 0000000..69fe663
--- /dev/null
+++ b/Pilz.Collections/My Project/Settings.Designer.vb
@@ -0,0 +1,73 @@
+'------------------------------------------------------------------------------
+'
+' Dieser Code wurde von einem Tool generiert.
+' Laufzeitversion:4.0.30319.42000
+'
+' Änderungen an dieser Datei können falsches Verhalten verursachen und gehen verloren, wenn
+' der Code erneut generiert wird.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
+
+Namespace My
+
+ _
+ Partial Friend NotInheritable Class MySettings
+ Inherits Global.System.Configuration.ApplicationSettingsBase
+
+ Private Shared defaultInstance As MySettings = CType(Global.System.Configuration.ApplicationSettingsBase.Synchronized(New MySettings()),MySettings)
+
+#Region "Automatische My.Settings-Speicherfunktion"
+#If _MyType = "WindowsForms" Then
+ Private Shared addedHandler As Boolean
+
+ Private Shared addedHandlerLockObject As New Object
+
+ _
+ Private Shared Sub AutoSaveSettings(sender As Global.System.Object, e As Global.System.EventArgs)
+ If My.Application.SaveMySettingsOnExit Then
+ My.Settings.Save()
+ End If
+ End Sub
+#End If
+#End Region
+
+ Public Shared ReadOnly Property [Default]() As MySettings
+ Get
+
+#If _MyType = "WindowsForms" Then
+ If Not addedHandler Then
+ SyncLock addedHandlerLockObject
+ If Not addedHandler Then
+ AddHandler My.Application.Shutdown, AddressOf AutoSaveSettings
+ addedHandler = True
+ End If
+ End SyncLock
+ End If
+#End If
+ Return defaultInstance
+ End Get
+ End Property
+ End Class
+End Namespace
+
+Namespace My
+
+ _
+ Friend Module MySettingsProperty
+
+ _
+ Friend ReadOnly Property Settings() As Global.Pilz.Collections.My.MySettings
+ Get
+ Return Global.Pilz.Collections.My.MySettings.Default
+ End Get
+ End Property
+ End Module
+End Namespace
diff --git a/Pilz.Collections/My Project/Settings.settings b/Pilz.Collections/My Project/Settings.settings
new file mode 100644
index 0000000..85b890b
--- /dev/null
+++ b/Pilz.Collections/My Project/Settings.settings
@@ -0,0 +1,7 @@
+
+
+
+
+
+
+
diff --git a/Pilz.Collections/Pilz.Collections.vbproj b/Pilz.Collections/Pilz.Collections.vbproj
new file mode 100644
index 0000000..b0fc5b8
--- /dev/null
+++ b/Pilz.Collections/Pilz.Collections.vbproj
@@ -0,0 +1,145 @@
+
+
+
+
+ Debug
+ AnyCPU
+ {E4B2D294-8479-4014-942D-0B460E453DEA}
+ Library
+
+
+ Pilz.Collections
+ Pilz.Collections
+ 512
+ Windows
+ v4.5
+
+
+
+ AnyCPU
+ true
+ full
+ true
+ true
+ bin\Debug\
+ Pilz.Collections.xml
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022,40008
+ false
+
+
+ AnyCPU
+ none
+ false
+ true
+ true
+ bin\Release\
+ Pilz.Collections.xml
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+ false
+ true
+
+
+ On
+
+
+ Binary
+
+
+ Off
+
+
+ On
+
+
+ true
+ true
+ true
+ bin\x86\Debug\
+ Pilz.Collections.xml
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022,40008
+ full
+ x86
+ MinimumRecommendedRules.ruleset
+ true
+
+
+ true
+ bin\x86\Release\
+ true
+ Pilz.Collections.xml
+ true
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+ x86
+ MinimumRecommendedRules.ruleset
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ True
+ Application.myapp
+
+
+ True
+ True
+ Resources.resx
+
+
+ True
+ Settings.settings
+ True
+
+
+
+
+
+
+
+
+ VbMyResourcesResXFileCodeGenerator
+ Resources.Designer.vb
+ My.Resources
+ Designer
+
+
+
+
+ MyApplicationCodeGenerator
+ Application.Designer.vb
+
+
+ SettingsSingleFileGenerator
+ My
+ Settings.Designer.vb
+
+
+
+
+
\ No newline at end of file
diff --git a/Pilz.Collections/SimpleHistory/Enums.vb b/Pilz.Collections/SimpleHistory/Enums.vb
new file mode 100644
index 0000000..8438552
--- /dev/null
+++ b/Pilz.Collections/SimpleHistory/Enums.vb
@@ -0,0 +1,12 @@
+Namespace SimpleHistory
+
+ '''
+ ''' Specify which member types you would include.
+ '''
+ Public Enum ObjectValueType
+ None = 0
+ Field = 1
+ [Property] = 2
+ End Enum
+
+End Namespace
\ No newline at end of file
diff --git a/Pilz.Collections/SimpleHistory/HistoryPoint.vb b/Pilz.Collections/SimpleHistory/HistoryPoint.vb
new file mode 100644
index 0000000..a023780
--- /dev/null
+++ b/Pilz.Collections/SimpleHistory/HistoryPoint.vb
@@ -0,0 +1,543 @@
+Imports System.Reflection
+
+Namespace SimpleHistory
+
+ '''
+ ''' Represent some Object States and Actions.
+ '''
+ Public Class HistoryPoint
+
+ '''
+ ''' Represents the Name of this History Point
+ '''
+ '''
+ Public Property Name As String = ""
+ '''
+ ''' A List of Object States and Actions.
+ '''
+ '''
+ Public ReadOnly Property Entries As New List(Of ObjectBase)
+ '''
+ ''' Some data can be refered on this HistoryPoint. Don't know, in some situations this can be helpful.
+ '''
+ Public ReadOnly Tag As Object = Nothing
+
+ Public Function HasEntries(Of T As ObjectBase)() As Boolean
+ Return Entries.Where(Function(n) TypeOf n Is T).Count > 0
+ End Function
+
+ Friend Sub Undo()
+ For Each s As ObjectBase In Entries.OrderBy(Function(n) n.UndoPriority)
+ If TypeOf s Is ObjectState Then
+ CType(s, ObjectState).Patch()
+ ElseIf TypeOf s Is ObjectAction Then
+ CType(s, ObjectAction).Undo()
+ End If
+ Next
+ End Sub
+
+ Friend Sub Redo()
+ For Each s As ObjectBase In Entries.OrderBy(Function(n) n.RedoPriority)
+ If TypeOf s Is ObjectState Then
+ CType(s, ObjectState).Patch()
+ ElseIf TypeOf s Is ObjectAction Then
+ CType(s, ObjectAction).Redo()
+ End If
+ Next
+ End Sub
+
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The objects that should be included.
+ ''' Specify which members to include.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object(), whiteList As MemberWhiteList) As HistoryPoint
+ Return FromObject({obj}, ObjectValueType.None, CObj(whiteList), BindingFlags.Default)
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The objects that should be included.
+ ''' Specify which members to exclude.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object(), blackList As MemberBlackList) As HistoryPoint
+ Return FromObject({obj}, ObjectValueType.None, CObj(blackList), BindingFlags.Default)
+ End Function
+
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The objects that should be included.
+ ''' The member names to include.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object(), ParamArray memberName As String()) As HistoryPoint
+ Return FromObject(obj, True, memberName)
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The objects that should be included.
+ ''' If true, the memberName-Array has member names that should be included.
+ ''' The member names to include/exclude.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object(), isWhiteList As Boolean, ParamArray memberName As String()) As HistoryPoint
+ If isWhiteList Then
+ Return FromObject({obj}, ObjectValueType.None, CObj(New MemberWhiteList(memberName)), BindingFlags.Default)
+ Else
+ Return FromObject({obj}, ObjectValueType.None, CObj(New MemberBlackList(memberName)), BindingFlags.Default)
+ End If
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The objects that should be included.
+ ''' Specify what member types to include.
+ ''' The member names to include.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object(), membersToStore As ObjectValueType, ParamArray memberName As String()) As HistoryPoint
+ Return FromObject(obj, membersToStore, True, memberName)
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The objects that should be included.
+ ''' Specify what member types to include.
+ ''' If true, the memberName-Array has member names that should be included.
+ ''' The member names to include/exclude.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object(), membersToStore As ObjectValueType, isWhiteList As Boolean, ParamArray memberName As String()) As HistoryPoint
+ If isWhiteList Then
+ Return FromObject({obj}, membersToStore, CObj(New MemberWhiteList(memberName)), BindingFlags.Default)
+ Else
+ Return FromObject({obj}, membersToStore, CObj(New MemberBlackList(memberName)), BindingFlags.Default)
+ End If
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The objects that should be included.
+ ''' The Binding Flags that the members should have.
+ ''' The member names to include.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object(), flags As BindingFlags, ParamArray memberName As String()) As HistoryPoint
+ Return FromObject(obj, flags, True, memberName)
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The objects that should be included.
+ ''' The Binding Flags that the members should have.
+ ''' If true, the memberName-Array has member names that should be included.
+ ''' The member names to include/exclude.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object(), flags As BindingFlags, isWhiteList As Boolean, ParamArray memberName As String()) As HistoryPoint
+ If isWhiteList Then
+ Return FromObject({obj}, ObjectValueType.None, CObj(New MemberWhiteList(memberName)), flags)
+ Else
+ Return FromObject({obj}, ObjectValueType.None, CObj(New MemberBlackList(memberName)), flags)
+ End If
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The objects that should be included.
+ ''' Specify what member types to include.
+ ''' The Binding Flags that the members should have.
+ ''' The member names to include.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object(), membersToStore As ObjectValueType, flags As BindingFlags, ParamArray memberName As String()) As HistoryPoint
+ Return FromObject(obj, flags, True, memberName)
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The objects that should be included.
+ ''' Specify what member types to include.
+ ''' The Binding Flags that the members should have.
+ ''' If true, the memberName-Array has member names that should be included.
+ ''' The member names to include/exclude.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object(), membersToStore As ObjectValueType, flags As BindingFlags, isWhiteList As Boolean, ParamArray memberName As String()) As HistoryPoint
+ If isWhiteList Then
+ Return FromObject({obj}, membersToStore, CObj(New MemberWhiteList(memberName)), flags)
+ Else
+ Return FromObject({obj}, membersToStore, CObj(New MemberBlackList(memberName)), flags)
+ End If
+ End Function
+
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The object that should be included.
+ ''' Specify which members to include.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object, whiteList As MemberWhiteList) As HistoryPoint
+ Return FromObject({obj}, ObjectValueType.None, CObj(whiteList), BindingFlags.Default)
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The object that should be included.
+ ''' Specify which members to exclude.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object, blackList As MemberBlackList) As HistoryPoint
+ Return FromObject({obj}, ObjectValueType.None, CObj(blackList), BindingFlags.Default)
+ End Function
+
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The object that should be included.
+ ''' The member names to include/exclude.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object, ParamArray memberName As String()) As HistoryPoint
+ Return FromObject(obj, True, memberName)
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The object that should be included.
+ ''' If true, the memberName-Array has member names that should be included.
+ ''' The member names to include/exclude.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object, isWhiteList As Boolean, ParamArray memberName As String()) As HistoryPoint
+ If isWhiteList Then
+ Return FromObject({obj}, ObjectValueType.None, CObj(New MemberWhiteList(memberName)), BindingFlags.Default)
+ Else
+ Return FromObject({obj}, ObjectValueType.None, CObj(New MemberBlackList(memberName)), BindingFlags.Default)
+ End If
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The object that should be included.
+ ''' Specify what member types to include.
+ ''' The member names to include.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object, membersToStore As ObjectValueType, ParamArray memberName As String()) As HistoryPoint
+ Return FromObject(obj, membersToStore, True, memberName)
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The object that should be included.
+ ''' Specify what member types to include.
+ ''' If true, the memberName-Array has member names that should be included.
+ ''' The member names to include/exclude.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object, membersToStore As ObjectValueType, isWhiteList As Boolean, ParamArray memberName As String()) As HistoryPoint
+ If isWhiteList Then
+ Return FromObject({obj}, membersToStore, CObj(New MemberWhiteList(memberName)), BindingFlags.Default)
+ Else
+ Return FromObject({obj}, membersToStore, CObj(New MemberBlackList(memberName)), BindingFlags.Default)
+ End If
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The object that should be included.
+ ''' The Binding Flags that the members should have.
+ ''' The member names to include.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object, flags As BindingFlags, ParamArray memberName As String()) As HistoryPoint
+ Return FromObject(obj, flags, True, memberName)
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The object that should be included.
+ ''' The Binding Flags that the members should have.
+ ''' If true, the memberName-Array has member names that should be included.
+ ''' The member names to include/exclude.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object, flags As BindingFlags, isWhiteList As Boolean, ParamArray memberName As String()) As HistoryPoint
+ If isWhiteList Then
+ Return FromObject({obj}, ObjectValueType.None, CObj(New MemberWhiteList(memberName)), flags)
+ Else
+ Return FromObject({obj}, ObjectValueType.None, CObj(New MemberBlackList(memberName)), flags)
+ End If
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The object that should be included.
+ ''' Specify what member types to include.
+ ''' The Binding Flags that the members should have.
+ ''' The member names to include.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object, membersToStore As ObjectValueType, flags As BindingFlags, ParamArray memberName As String()) As HistoryPoint
+ Return FromObject(obj, flags, True, memberName)
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The object that should be included.
+ ''' Specify what member types to include.
+ ''' The Binding Flags that the members should have.
+ ''' If true, the memberName-Array has member names that should be included.
+ ''' The member names to include/exclude.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object, membersToStore As ObjectValueType, flags As BindingFlags, isWhiteList As Boolean, ParamArray memberName As String()) As HistoryPoint
+ If isWhiteList Then
+ Return FromObject({obj}, membersToStore, CObj(New MemberWhiteList(memberName)), flags)
+ Else
+ Return FromObject({obj}, membersToStore, CObj(New MemberBlackList(memberName)), flags)
+ End If
+ End Function
+
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The object that should be included.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object) As HistoryPoint
+ Return FromObject({obj}, ObjectValueType.None, CObj(Nothing), BindingFlags.Default)
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The object that should be included.
+ ''' Specify what member types to include.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object, membersToStore As ObjectValueType) As HistoryPoint
+ Return FromObject({obj}, membersToStore, CObj(Nothing), BindingFlags.Default)
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The object that should be included.
+ ''' Specify what member types to include.
+ ''' Specify which members to include.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object, membersToStore As ObjectValueType, whiteList As MemberWhiteList) As HistoryPoint
+ Return FromObject({obj}, membersToStore, CObj(whiteList), BindingFlags.Default)
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The object that should be included.
+ ''' Specify what member types to include.
+ ''' Specify which members to exclude.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object, membersToStore As ObjectValueType, blackList As MemberBlackList) As HistoryPoint
+ Return FromObject({obj}, membersToStore, CObj(blackList), BindingFlags.Default)
+ End Function
+
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The object that should be included.
+ ''' The Binding Flags that the members should have.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object, flags As BindingFlags) As HistoryPoint
+ Return FromObject({obj}, ObjectValueType.None, CObj(Nothing), flags)
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The object that should be included.
+ ''' Specify what member types to include.
+ ''' The Binding Flags that the members should have.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object, membersToStore As ObjectValueType, flags As BindingFlags) As HistoryPoint
+ Return FromObject({obj}, membersToStore, CObj(Nothing), flags)
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The object that should be included.
+ ''' Specify what member types to include.
+ ''' Specify which members to include.
+ ''' The Binding Flags that the members should have.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object, membersToStore As ObjectValueType, whiteList As MemberWhiteList, flags As BindingFlags) As HistoryPoint
+ Return FromObject({obj}, membersToStore, CObj(whiteList), flags)
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The object that should be included.
+ ''' Specify what member types to include.
+ ''' Specify which members to exclude.
+ ''' The Binding Flags that the members should have.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(obj As Object, membersToStore As ObjectValueType, blackList As MemberBlackList, flags As BindingFlags) As HistoryPoint
+ Return FromObject({obj}, membersToStore, CObj(blackList), flags)
+ End Function
+
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The objects that should be included.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(objs As Object()) As HistoryPoint
+ Return FromObject(objs, ObjectValueType.None, CObj(Nothing), BindingFlags.Default)
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The objects that should be included.
+ ''' Specify what member types to include.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(objs As Object(), membersToStore As ObjectValueType) As HistoryPoint
+ Return FromObject(objs, membersToStore, CObj(Nothing), BindingFlags.Default)
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The objects that should be included.
+ ''' Specify what member types to include.
+ ''' Specify which members to include.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(objs As Object(), membersToStore As ObjectValueType, whiteList As MemberWhiteList) As HistoryPoint
+ Return FromObject(objs, membersToStore, CObj(whiteList), BindingFlags.Default)
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The objects that should be included.
+ ''' Specify what member types to include.
+ ''' Specify which members to exclude.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(objs As Object(), membersToStore As ObjectValueType, blackList As MemberBlackList) As HistoryPoint
+ Return FromObject(objs, membersToStore, CObj(blackList), BindingFlags.Default)
+ End Function
+
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The objects that should be included.
+ ''' The Binding Flags that the members should have.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(objs As Object(), flags As BindingFlags) As HistoryPoint
+ Return FromObject(objs, ObjectValueType.None, CObj(Nothing), flags)
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The objects that should be included.
+ ''' Specify what member types to include.
+ ''' The Binding Flags that the members should have.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(objs As Object(), membersToStore As ObjectValueType, flags As BindingFlags) As HistoryPoint
+ Return FromObject(objs, membersToStore, CObj(Nothing), flags)
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The objects that should be included.
+ ''' Specify what member types to include.
+ ''' Specify which members to include.
+ ''' The Binding Flags that the members should have.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(objs As Object(), membersToStore As ObjectValueType, whiteList As MemberWhiteList, flags As BindingFlags) As HistoryPoint
+ Return FromObject(objs, membersToStore, CObj(whiteList), flags)
+ End Function
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The objects that should be included.
+ ''' Specify what member types to include.
+ ''' Specify which members to exclude.
+ ''' The Binding Flags that the members should have.
+ ''' A History Point with Object States.
+ Public Shared Function FromObject(objs As Object(), membersToStore As ObjectValueType, blackList As MemberBlackList, flags As BindingFlags) As HistoryPoint
+ Return FromObject(objs, membersToStore, CObj(blackList), flags)
+ End Function
+
+ '''
+ ''' Creates an History Point with Object States automaticly from input.
+ '''
+ ''' The objects that should be included.
+ ''' Specify what member types to include.
+ ''' Specify which members to include.
+ ''' The Binding Flags that the members should have.
+ ''' A History Point with Object States.
+ Private Shared Function FromObject(objs As Object(), membersToStore As ObjectValueType, whiteOrBlackList As Object, flags As BindingFlags) As HistoryPoint
+ Dim hp As New HistoryPoint
+
+ If whiteOrBlackList Is Nothing Then whiteOrBlackList = New MemberBlackList
+ Dim isWhiteList As Boolean = TypeOf whiteOrBlackList Is MemberWhiteList
+
+ If flags = BindingFlags.Default Then
+ flags = BindingFlags.Instance Or BindingFlags.Public Or BindingFlags.NonPublic
+ End If
+ If membersToStore = ObjectValueType.None Then
+ membersToStore = ObjectValueType.Field Or ObjectValueType.Property
+ End If
+
+ For Each obj As Object In objs
+ If (membersToStore And ObjectValueType.Field) = ObjectValueType.Field Then
+
+ For Each fi As FieldInfo In obj.GetType.GetFields(flags)
+
+ Dim contains As Boolean = whiteOrBlackList.Contains(fi.Name)
+ If If(isWhiteList, contains, Not contains) Then
+
+ Dim os As New ObjectState
+ os.Object = obj
+ os.MemberName = fi.Name
+ os.MemberType = ObjectValueType.Field
+ os.MemberFlags = flags
+ os.ValueToPatch = fi.GetValue(obj)
+ hp.Entries.Add(os)
+
+ End If
+
+ Next
+
+ End If
+
+ If (membersToStore And ObjectValueType.Property) = ObjectValueType.Property Then
+
+ For Each pi As PropertyInfo In obj.GetType.GetProperties(flags)
+
+ Dim contains As Boolean = whiteOrBlackList.Contains(pi.Name)
+ If If(isWhiteList, contains, Not contains) Then
+
+ Dim os As New ObjectState
+ os.Object = obj
+ os.MemberName = pi.Name
+ os.MemberType = ObjectValueType.Property
+ os.MemberFlags = flags
+ os.ValueToPatch = pi.GetValue(obj)
+ hp.Entries.Add(os)
+
+ End If
+
+ Next
+
+ End If
+ Next
+
+ Return hp
+ End Function
+
+ '''
+ ''' Combines some History Points to one.
+ '''
+ ''' An array of History Points to combine.
+ ''' One History Point that contains all Data of inputted History Points.
+ Public Shared Function Concat(ParamArray hps As HistoryPoint()) As HistoryPoint
+ Return Concat(hps.FirstOrDefault?.Name, hps)
+ End Function
+
+ '''
+ ''' Combines some History Points to one.
+ '''
+ ''' An array of History Points to combine.
+ ''' One History Point that contains all Data of inputted History Points.
+ Public Shared Function Concat(newName As String, ParamArray hps As HistoryPoint()) As HistoryPoint
+ Dim hp As New HistoryPoint
+
+ For Each _hp As HistoryPoint In hps
+ hp.Entries.AddRange(_hp.Entries)
+ Next
+
+ Return hp
+ End Function
+
+ End Class
+
+End Namespace
diff --git a/Pilz.Collections/SimpleHistory/MemberLists.vb b/Pilz.Collections/SimpleHistory/MemberLists.vb
new file mode 100644
index 0000000..05fdf82
--- /dev/null
+++ b/Pilz.Collections/SimpleHistory/MemberLists.vb
@@ -0,0 +1,33 @@
+Namespace SimpleHistory
+
+ '''
+ ''' List contianing member names to include.
+ '''
+ Public Class MemberWhiteList
+ Inherits List(Of String)
+
+ Public Sub New()
+ MyBase.New
+ End Sub
+
+ Public Sub New(entries As String())
+ MyBase.New(entries)
+ End Sub
+ End Class
+
+ '''
+ ''' List contianing member names to exclude
+ '''
+ Public Class MemberBlackList
+ Inherits List(Of String)
+
+ Public Sub New()
+ MyBase.New
+ End Sub
+
+ Public Sub New(entries As String())
+ MyBase.New(entries)
+ End Sub
+ End Class
+
+End Namespace
\ No newline at end of file
diff --git a/Pilz.Collections/SimpleHistory/ObjectAction.vb b/Pilz.Collections/SimpleHistory/ObjectAction.vb
new file mode 100644
index 0000000..7861237
--- /dev/null
+++ b/Pilz.Collections/SimpleHistory/ObjectAction.vb
@@ -0,0 +1,165 @@
+Imports System.Reflection
+Imports System.Runtime.InteropServices
+
+Namespace SimpleHistory
+
+ Public Class ObjectAction
+ Inherits ObjectBase
+
+ Public Property [Object] As Object = Nothing
+ Public ReadOnly Property ParametersUndo As New List(Of Object)
+ Public ReadOnly Property ParametersRedo As New List(Of Object)
+ Public Property MethodUndo As MethodInfo = Nothing
+ Public Property MethodRedo As MethodInfo = Nothing
+ Public Property AutogenerateObject As Boolean = True
+
+ '''
+ ''' Creates a new Instance of Object Action.
+ '''
+ Public Sub New()
+ End Sub
+
+ Private Function GetMethodInfo(obj As Object, name As String, flags As BindingFlags)
+ Return obj.GetType.GetMethod(name, flags)
+ End Function
+
+ '''
+ ''' Creates a new Instance of Object Action.
+ '''
+ ''' The Objects that contains the methodes to call.
+ ''' The name of the methode to call on Undo.
+ ''' The name of the methode to call on Redo.
+ Public Sub New(obj As Object, methodNameUndo As String, methodNameRedo As String)
+ Me.New(obj, methodNameUndo, methodNameRedo, {}, {}, BindingFlags.Default, BindingFlags.Default)
+ End Sub
+ '''
+ ''' Creates a new Instance of Object Action.
+ '''
+ ''' The Objects that contains the methodes to call.
+ ''' The name of the methode to call on Undo.
+ ''' The name of the methode to call on Redo.
+ ''' The parameters for calling the methode on Undo.
+ ''' The parameters for calling the methode on Redo.
+ Public Sub New(obj As Object, methodNameUndo As String, methodNameRedo As String, paramsUndo As Object(), paramsRedo As Object())
+ Me.New(obj, methodNameUndo, methodNameRedo, paramsUndo, paramsRedo, BindingFlags.Default, BindingFlags.Default)
+ End Sub
+ '''
+ ''' Creates a new Instance of Object Action.
+ '''
+ ''' The Objects that contains the methodes to call.
+ ''' The name of the methode to call on Undo.
+ ''' The name of the methode to call on Redo.
+ ''' The parameters for calling the methode on Undo.
+ ''' The parameters for calling the methode on Redo.
+ ''' The Binding Flags of Methode on Undo.
+ ''' The Binding Flags of Methode on Redo.
+ Public Sub New(obj As Object, methodNameUndo As String, methodNameRedo As String, paramsUndo As Object(), paramsRedo As Object(), methodFlagsUndo As BindingFlags, methodFlagsRedo As BindingFlags)
+ [Object] = obj
+ ParametersUndo.AddRange(paramsUndo)
+ ParametersRedo.AddRange(paramsRedo)
+ MethodUndo = GetMethodInfo(obj, methodNameUndo, GetFlags(methodFlagsUndo))
+ MethodRedo = GetMethodInfo(obj, methodNameRedo, GetFlags(methodFlagsRedo))
+ End Sub
+ '''
+ ''' Creates a new Instance of Object Action.
+ '''
+ ''' The Objects that contains the methodes to call.
+ ''' The name of the methode to call on Undo.
+ ''' The name of the methode to call on Redo.
+ ''' The Binding Flags of Methode on Undo.
+ ''' The Binding Flags of Methode on Redo.
+ Public Sub New(obj As Object, methodNameUndo As String, methodNameRedo As String, methodFlagsUndo As BindingFlags, methodFlagsRedo As BindingFlags)
+ Me.New(obj, methodNameUndo, methodNameRedo, {}, {}, methodFlagsUndo, methodFlagsRedo)
+ End Sub
+
+ '''
+ ''' Creates a new Instance of Object Action.
+ '''
+ ''' The Objects that contains the methodes to call.
+ ''' The MethodInfo of the methode to call on Undo.
+ ''' The MethodInfo of the methode to call on Redo.
+ Public Sub New(obj As Object, methodUndo As MethodInfo, methodRedo As MethodInfo)
+ [Object] = obj
+ Me.MethodUndo = methodUndo
+ Me.MethodRedo = methodRedo
+ End Sub
+ '''
+ ''' Creates a new Instance of Object Action.
+ '''
+ ''' The Objects that contains the methodes to call.
+ ''' The MethodInfo of the methode to call on Undo.
+ ''' The MethodInfo of the methode to call on Redo.
+ ''' The parameters for calling the methode on Undo.
+ ''' The parameters for calling the methode on Redo.
+ Public Sub New(obj As Object, methodUndo As MethodInfo, methodRedo As MethodInfo, paramsUndo As Object(), paramsRedo As Object())
+ Me.New(obj, methodUndo, methodRedo)
+ ParametersUndo.AddRange(paramsUndo)
+ ParametersRedo.AddRange(paramsRedo)
+ End Sub
+ '''
+ ''' Creates a new Instance of Object Action.
+ '''
+ ''' The Objects that contains the methodes to call.
+ ''' The Delegate of the methode to call on Undo.
+ ''' The Delegate of the methode to call on Redo.
+ Public Sub New(obj As Object, methodUndo As [Delegate], methodRedo As [Delegate])
+ [Object] = obj
+ Me.MethodUndo = methodUndo.Method
+ Me.MethodRedo = methodRedo.Method
+ End Sub
+ '''
+ ''' Creates a new Instance of Object Action.
+ '''
+ ''' The Objects that contains the methodes to call.
+ ''' The Delegate of the methode to call on Undo.
+ ''' The Delegate of the methode to call on Redo.
+ ''' The parameters for calling the methode on Undo.
+ ''' The parameters for calling the methode on Redo.
+ Public Sub New(obj As Object, methodUndo As [Delegate], methodRedo As [Delegate], paramsUndo As Object(), paramsRedo As Object())
+ Me.New(obj, methodUndo, methodRedo)
+ ParametersUndo.AddRange(paramsUndo)
+ ParametersRedo.AddRange(paramsRedo)
+ End Sub
+ '''
+ ''' Creates a new Instance of Object Action.
+ '''
+ ''' The Objects that contains the methodes to call.
+ ''' The Action of the methode to call on Undo.
+ ''' The Action of the methode to call on Redo.
+ Public Sub New(obj As Object, methodUndo As Action, methodRedo As Action)
+ [Object] = obj
+ Me.MethodUndo = methodUndo.Method
+ Me.MethodRedo = methodRedo.Method
+ End Sub
+
+ Private Function GetFlags(flags As BindingFlags) As BindingFlags
+ If flags = BindingFlags.Default Then
+ flags = BindingFlags.Instance Or BindingFlags.Public Or BindingFlags.NonPublic
+ End If
+ Return flags
+ End Function
+
+ Friend Sub Undo()
+ CheckIfObjIsNothing(MethodUndo)
+ MethodUndo?.Invoke([Object], ParametersUndo.ToArray)
+ End Sub
+
+ Friend Sub Redo()
+ CheckIfObjIsNothing(MethodRedo)
+ MethodRedo?.Invoke([Object], ParametersRedo.ToArray)
+ End Sub
+
+ Private Sub CheckIfObjIsNothing(mi As MethodInfo)
+ If mi IsNot Nothing AndAlso Not mi.IsStatic AndAlso AutogenerateObject Then
+ If (Me.Object Is Nothing OrElse Me.Object.GetType <> mi.ReflectedType) AndAlso Not mi.IsStatic Then
+ Dim constructor As ConstructorInfo = mi.ReflectedType.GetConstructor(Type.EmptyTypes)
+ Dim classObject As Object = constructor.Invoke({})
+ Me.Object = classObject
+ End If
+ End If
+ End Sub
+
+ End Class
+
+
+End Namespace
\ No newline at end of file
diff --git a/Pilz.Collections/SimpleHistory/ObjectBase.vb b/Pilz.Collections/SimpleHistory/ObjectBase.vb
new file mode 100644
index 0000000..76a201e
--- /dev/null
+++ b/Pilz.Collections/SimpleHistory/ObjectBase.vb
@@ -0,0 +1,13 @@
+Namespace SimpleHistory
+
+ Public Class ObjectBase
+
+ Public Shared Property DefaultPriorityValue As Integer = 1000
+
+ Public Property UndoPriority As Integer = DefaultPriorityValue
+ Public Property RedoPriority As Integer = DefaultPriorityValue
+
+ End Class
+
+
+End Namespace
\ No newline at end of file
diff --git a/Pilz.Collections/SimpleHistory/ObjectState.vb b/Pilz.Collections/SimpleHistory/ObjectState.vb
new file mode 100644
index 0000000..9678686
--- /dev/null
+++ b/Pilz.Collections/SimpleHistory/ObjectState.vb
@@ -0,0 +1,84 @@
+Imports System.Reflection
+
+Namespace SimpleHistory
+
+ Public Class ObjectState
+ Inherits ObjectBase
+
+ '''
+ ''' The Object including the members to patch.
+ '''
+ '''
+ Public Property [Object] As Object = Nothing
+ '''
+ ''' The name of the Member to patch.
+ '''
+ '''
+ Public Property MemberName As String = ""
+ '''
+ ''' The Value that should be patched.
+ '''
+ '''
+ Public Property ValueToPatch As Object = Nothing
+ '''
+ ''' The member types to include at searching for the member.
+ '''
+ '''
+ Public Property MemberType As ObjectValueType = ObjectValueType.Field
+ '''
+ ''' The Binding Flags that are used at searching for the member.
+ '''
+ '''
+ Public Property MemberFlags As BindingFlags = BindingFlags.Default
+
+ '''
+ ''' Creates a new Instance of ObjectState from input.
+ '''
+ ''' The Object including the members to patch.
+ ''' The name of the Member to patch.
+ ''' The member types to include at searching for the member.
+ ''' The Binding Flags that are used at searching for the member.
+ Public Sub New(obj As Object, valname As String, valToPatch As Object, valtype As ObjectValueType)
+ [Object] = obj
+ MemberName = valname
+ ValueToPatch = valToPatch
+ MemberType = valtype
+ End Sub
+
+ '''
+ ''' Creates a new Instance of ObjectState.
+ '''
+ Public Sub New()
+ End Sub
+
+ Friend Sub Patch()
+ Dim t As Type = [Object].GetType
+ Select Case MemberType
+ Case ObjectValueType.Field
+ Dim f As FieldInfo = t.GetField(MemberName, MemberFlags)
+ Dim temp As Object = Nothing
+
+ If f IsNot Nothing Then
+ temp = f.GetValue([Object])
+ f.SetValue([Object], ValueToPatch)
+ ValueToPatch = temp
+ End If
+
+ Case ObjectValueType.Property
+ Dim p As PropertyInfo = t.GetProperty(MemberName, BindingFlags.Instance Or BindingFlags.Public Or BindingFlags.NonPublic Or BindingFlags.Static)
+ Dim temp As Object = Nothing
+
+ If p IsNot Nothing Then
+ temp = p.GetValue([Object])
+ p.SetValue([Object], ValueToPatch)
+ ValueToPatch = temp
+ End If
+
+ Case Else
+ Throw New Exception("ValueType is invalid!")
+ End Select
+ End Sub
+
+ End Class
+
+End Namespace
\ No newline at end of file
diff --git a/Pilz.Collections/SimpleHistory/SimpleHistory.vb b/Pilz.Collections/SimpleHistory/SimpleHistory.vb
new file mode 100644
index 0000000..46dc39d
--- /dev/null
+++ b/Pilz.Collections/SimpleHistory/SimpleHistory.vb
@@ -0,0 +1,89 @@
+Imports System.Reflection
+
+Namespace SimpleHistory
+
+ Public Class HistoryStack
+
+ Private stackPast As New Stack(Of HistoryPoint)
+ Private stackFuture As New Stack(Of HistoryPoint)
+
+ '''
+ ''' Checks if the History has past changes.
+ '''
+ '''
+ Public Function HasChanges() As Boolean
+ Return stackPast.Count > 0
+ End Function
+
+ '''
+ ''' Patch Object States and call Undo Actions.
+ '''
+ Public Function Undo() As HistoryPoint
+ Dim ret As HistoryPoint
+
+ If stackPast.Count > 0 Then
+
+ Dim hp As HistoryPoint = stackPast.Pop
+ hp.Undo()
+ stackFuture.Push(hp)
+ ret = hp
+
+ Else
+ ret = Nothing
+
+ End If
+
+ Return ret
+ End Function
+
+ '''
+ ''' Patch Object States and call Redo Actions.
+ '''
+ Public Function Redo() As HistoryPoint
+ Dim ret As HistoryPoint
+
+ If stackFuture.Count > 0 Then
+
+ Dim hp As HistoryPoint = stackFuture.Pop
+ hp.Redo()
+ stackPast.Push(hp)
+ ret = hp
+
+ Else
+ ret = Nothing
+
+ End If
+
+ Return ret
+ End Function
+
+ '''
+ ''' Clear the History.
+ '''
+ Public Sub Clear()
+ stackPast.Clear()
+ stackFuture.Clear()
+ End Sub
+
+ '''
+ ''' Store a History Point.
+ '''
+ ''' The History Point to add to the past changes.
+ ''' The name to set for the History Point.
+ Public Sub Store(point As HistoryPoint, newName As String)
+ point.Name = newName
+ Store(point)
+ End Sub
+
+ '''
+ ''' Store a History Point.
+ '''
+ ''' The History Point to add to the past changes.
+ Public Sub Store(point As HistoryPoint)
+ stackPast.Push(point)
+ stackFuture.Clear()
+ End Sub
+
+ End Class
+
+End Namespace
diff --git a/Pilz.Configuration/ISettingsManager.vb b/Pilz.Configuration/ISettingsManager.vb
new file mode 100644
index 0000000..7be6f54
--- /dev/null
+++ b/Pilz.Configuration/ISettingsManager.vb
@@ -0,0 +1,6 @@
+Public Interface ISettingsManager
+ Property ConfigFilePath As String
+ Sub Save()
+ Sub Load()
+ Sub Reset()
+End Interface
\ No newline at end of file
diff --git a/Pilz.Configuration/My Project/Application.Designer.vb b/Pilz.Configuration/My Project/Application.Designer.vb
new file mode 100644
index 0000000..88dd01c
--- /dev/null
+++ b/Pilz.Configuration/My Project/Application.Designer.vb
@@ -0,0 +1,13 @@
+'------------------------------------------------------------------------------
+'
+' This code was generated by a tool.
+' Runtime Version:4.0.30319.42000
+'
+' Changes to this file may cause incorrect behavior and will be lost if
+' the code is regenerated.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
diff --git a/Pilz.Configuration/My Project/Application.myapp b/Pilz.Configuration/My Project/Application.myapp
new file mode 100644
index 0000000..758895d
--- /dev/null
+++ b/Pilz.Configuration/My Project/Application.myapp
@@ -0,0 +1,10 @@
+
+
+ false
+ false
+ 0
+ true
+ 0
+ 1
+ true
+
diff --git a/Pilz.Configuration/My Project/AssemblyInfo.vb b/Pilz.Configuration/My Project/AssemblyInfo.vb
new file mode 100644
index 0000000..d92aa5f
--- /dev/null
+++ b/Pilz.Configuration/My Project/AssemblyInfo.vb
@@ -0,0 +1,35 @@
+Imports System
+Imports System.Reflection
+Imports System.Runtime.InteropServices
+
+' Allgemeine Informationen über eine Assembly werden über die folgenden
+' Attribute gesteuert. Ändern Sie diese Attributwerte, um die Informationen zu ändern,
+' die einer Assembly zugeordnet sind.
+
+' Werte der Assemblyattribute überprüfen
+
+
+
+
+
+
+
+
+
+
+'Die folgende GUID bestimmt die ID der Typbibliothek, wenn dieses Projekt für COM verfügbar gemacht wird.
+
+
+' Versionsinformationen für eine Assembly bestehen aus den folgenden vier Werten:
+'
+' Hauptversion
+' Nebenversion
+' Buildnummer
+' Revision
+'
+' Sie können alle Werte angeben oder Standardwerte für die Build- und Revisionsnummern verwenden,
+' übernehmen, indem Sie "*" eingeben:
+'
+
+
+
diff --git a/Pilz.Configuration/My Project/Resources.Designer.vb b/Pilz.Configuration/My Project/Resources.Designer.vb
new file mode 100644
index 0000000..9c23f4c
--- /dev/null
+++ b/Pilz.Configuration/My Project/Resources.Designer.vb
@@ -0,0 +1,62 @@
+'------------------------------------------------------------------------------
+'
+' This code was generated by a tool.
+' Runtime Version:4.0.30319.42000
+'
+' Changes to this file may cause incorrect behavior and will be lost if
+' the code is regenerated.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
+
+Namespace My.Resources
+
+ 'This class was auto-generated by the StronglyTypedResourceBuilder
+ 'class via a tool like ResGen or Visual Studio.
+ 'To add or remove a member, edit your .ResX file then rerun ResGen
+ 'with the /str option, or rebuild your VS project.
+ '''
+ ''' A strongly-typed resource class, for looking up localized strings, etc.
+ '''
+ _
+ Friend Module Resources
+
+ Private resourceMan As Global.System.Resources.ResourceManager
+
+ Private resourceCulture As Global.System.Globalization.CultureInfo
+
+ '''
+ ''' Returns the cached ResourceManager instance used by this class.
+ '''
+ _
+ Friend ReadOnly Property ResourceManager() As Global.System.Resources.ResourceManager
+ Get
+ If Object.ReferenceEquals(resourceMan, Nothing) Then
+ Dim temp As Global.System.Resources.ResourceManager = New Global.System.Resources.ResourceManager("Pilz.Configuration.Resources", GetType(Resources).Assembly)
+ resourceMan = temp
+ End If
+ Return resourceMan
+ End Get
+ End Property
+
+ '''
+ ''' Overrides the current thread's CurrentUICulture property for all
+ ''' resource lookups using this strongly typed resource class.
+ '''
+ _
+ Friend Property Culture() As Global.System.Globalization.CultureInfo
+ Get
+ Return resourceCulture
+ End Get
+ Set(ByVal value As Global.System.Globalization.CultureInfo)
+ resourceCulture = value
+ End Set
+ End Property
+ End Module
+End Namespace
diff --git a/Pilz.Configuration/My Project/Resources.resx b/Pilz.Configuration/My Project/Resources.resx
new file mode 100644
index 0000000..af7dbeb
--- /dev/null
+++ b/Pilz.Configuration/My Project/Resources.resx
@@ -0,0 +1,117 @@
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ text/microsoft-resx
+
+
+ 2.0
+
+
+ System.Resources.ResXResourceReader, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089
+
+
+ System.Resources.ResXResourceWriter, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089
+
+
\ No newline at end of file
diff --git a/Pilz.Configuration/My Project/Settings.Designer.vb b/Pilz.Configuration/My Project/Settings.Designer.vb
new file mode 100644
index 0000000..1470709
--- /dev/null
+++ b/Pilz.Configuration/My Project/Settings.Designer.vb
@@ -0,0 +1,73 @@
+'------------------------------------------------------------------------------
+'
+' This code was generated by a tool.
+' Runtime Version:4.0.30319.42000
+'
+' Changes to this file may cause incorrect behavior and will be lost if
+' the code is regenerated.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
+
+Namespace My
+
+ _
+ Partial Friend NotInheritable Class MySettings
+ Inherits Global.System.Configuration.ApplicationSettingsBase
+
+ Private Shared defaultInstance As MySettings = CType(Global.System.Configuration.ApplicationSettingsBase.Synchronized(New MySettings), MySettings)
+
+#Region "My.Settings Auto-Save Functionality"
+#If _MyType = "WindowsForms" Then
+ Private Shared addedHandler As Boolean
+
+ Private Shared addedHandlerLockObject As New Object
+
+ _
+ Private Shared Sub AutoSaveSettings(ByVal sender As Global.System.Object, ByVal e As Global.System.EventArgs)
+ If My.Application.SaveMySettingsOnExit Then
+ My.Settings.Save()
+ End If
+ End Sub
+#End If
+#End Region
+
+ Public Shared ReadOnly Property [Default]() As MySettings
+ Get
+
+#If _MyType = "WindowsForms" Then
+ If Not addedHandler Then
+ SyncLock addedHandlerLockObject
+ If Not addedHandler Then
+ AddHandler My.Application.Shutdown, AddressOf AutoSaveSettings
+ addedHandler = True
+ End If
+ End SyncLock
+ End If
+#End If
+ Return defaultInstance
+ End Get
+ End Property
+ End Class
+End Namespace
+
+Namespace My
+
+ _
+ Friend Module MySettingsProperty
+
+ _
+ Friend ReadOnly Property Settings() As Global.Pilz.Configuration.My.MySettings
+ Get
+ Return Global.Pilz.Configuration.My.MySettings.Default
+ End Get
+ End Property
+ End Module
+End Namespace
diff --git a/Pilz.Configuration/My Project/Settings.settings b/Pilz.Configuration/My Project/Settings.settings
new file mode 100644
index 0000000..85b890b
--- /dev/null
+++ b/Pilz.Configuration/My Project/Settings.settings
@@ -0,0 +1,7 @@
+
+
+
+
+
+
+
diff --git a/Pilz.Configuration/Pilz.Configuration.vbproj b/Pilz.Configuration/Pilz.Configuration.vbproj
new file mode 100644
index 0000000..6d1c540
--- /dev/null
+++ b/Pilz.Configuration/Pilz.Configuration.vbproj
@@ -0,0 +1,111 @@
+
+
+
+
+ Debug
+ AnyCPU
+ {A56C6153-C61F-4B10-BE06-35EB0448CFDC}
+ Library
+ Pilz.Configuration
+ Pilz.Configuration
+ 512
+ Windows
+ v4.5
+ true
+
+
+ true
+ full
+ true
+ true
+ bin\Debug\
+ Pilz.Configuration.xml
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+
+
+ pdbonly
+ false
+ true
+ true
+ bin\Release\
+ Pilz.Configuration.xml
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+
+
+ On
+
+
+ Binary
+
+
+ Off
+
+
+ On
+
+
+
+ ..\packages\Newtonsoft.Json.12.0.1\lib\net45\Newtonsoft.Json.dll
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ True
+ Application.myapp
+
+
+ True
+ True
+ Resources.resx
+
+
+ True
+ Settings.settings
+ True
+
+
+
+
+
+
+ VbMyResourcesResXFileCodeGenerator
+ Resources.Designer.vb
+ My.Resources
+ Designer
+
+
+
+
+ MyApplicationCodeGenerator
+ Application.Designer.vb
+
+
+ SettingsSingleFileGenerator
+ My
+ Settings.Designer.vb
+
+
+
+
+
\ No newline at end of file
diff --git a/Pilz.Configuration/SettingsBase.vb b/Pilz.Configuration/SettingsBase.vb
new file mode 100644
index 0000000..2f2ee29
--- /dev/null
+++ b/Pilz.Configuration/SettingsBase.vb
@@ -0,0 +1,20 @@
+Imports Newtonsoft.Json
+
+Public MustInherit Class SettingsBase
+
+ Public Sub New()
+ ResetValues()
+ End Sub
+
+
+ Friend _settingsManager As ISettingsManager
+
+ Public ReadOnly Property SettingsManager As ISettingsManager
+ Get
+ Return _settingsManager
+ End Get
+ End Property
+
+ Public MustOverride Sub ResetValues()
+
+End Class
diff --git a/Pilz.Configuration/SettingsManager.vb b/Pilz.Configuration/SettingsManager.vb
new file mode 100644
index 0000000..6649651
--- /dev/null
+++ b/Pilz.Configuration/SettingsManager.vb
@@ -0,0 +1,110 @@
+Imports System.IO
+Imports System.Reflection
+Imports Newtonsoft.Json.Linq
+
+Public NotInheritable Class SettingsManager(Of T As SettingsBase)
+ Implements ISettingsManager
+
+ Private defaultInstance As T = Nothing
+ Private enableAutoSave As Boolean = False
+ Private addedHandler As Boolean = False
+
+ Public Property ConfigFilePath As String Implements ISettingsManager.ConfigFilePath
+
+ Public Property AutoSaveOnExit As Boolean
+ Get
+ Return enableAutoSave
+ End Get
+ Set
+ If enableAutoSave <> Value Then
+ enableAutoSave = Value
+ Select Case enableAutoSave
+ Case True
+ If Not addedHandler Then
+ AddAutoSaveHandler()
+ End If
+ Case False
+ If addedHandler Then
+ RemoveAutoSaveHandler()
+ End If
+ End Select
+ End If
+ End Set
+ End Property
+
+ Private Sub AddAutoSaveHandler()
+ AddHandler Windows.Forms.Application.ApplicationExit, AddressOf AutoSaveSettingsOnExit
+ addedHandler = True
+ End Sub
+ Private Sub RemoveAutoSaveHandler()
+ RemoveHandler Windows.Forms.Application.ApplicationExit, AddressOf AutoSaveSettingsOnExit
+ addedHandler = False
+ End Sub
+
+ Public ReadOnly Property Instance As T
+ Get
+ If defaultInstance Is Nothing Then
+ Load()
+ End If
+ Return defaultInstance
+ End Get
+ End Property
+
+ Public Sub New()
+ ConfigFilePath = ""
+ AutoSaveOnExit = False
+ End Sub
+ Public Sub New(fileName As String, autoSaveOnExit As Boolean)
+ ConfigFilePath = fileName
+ Me.AutoSaveOnExit = autoSaveOnExit
+ End Sub
+
+ Private Sub AutoSaveSettingsOnExit(sender As Object, e As EventArgs)
+ Save()
+ End Sub
+
+ Public Sub Save() Implements ISettingsManager.Save
+ If Not String.IsNullOrEmpty(ConfigFilePath) AndAlso defaultInstance IsNot Nothing Then
+ SavePrivate()
+ End If
+ End Sub
+
+ Public Sub Load() Implements ISettingsManager.Load
+ If Not String.IsNullOrEmpty(ConfigFilePath) AndAlso File.Exists(ConfigFilePath) Then
+ LoadPrivate()
+ Else
+ CreateNewInstance()
+ End If
+
+ If defaultInstance IsNot Nothing Then
+ defaultInstance._settingsManager = Me
+ End If
+ End Sub
+
+ Public Sub Reset() Implements ISettingsManager.Reset
+ Instance.ResetValues()
+ End Sub
+
+ Private Sub CreateNewInstance()
+ Dim ctor As ConstructorInfo = GetType(T).GetConstructor({})
+ If ctor IsNot Nothing Then
+ defaultInstance = ctor.Invoke({})
+
+ defaultInstance.ResetValues()
+ Else
+ Throw New Exception("The base type has no constructor with no parameters.")
+ End If
+ End Sub
+
+ Private Sub LoadPrivate()
+ defaultInstance = JObject.Parse(File.ReadAllText(ConfigFilePath)).ToObject(Of T)
+ End Sub
+
+ Private Sub SavePrivate()
+ Dim obj As JObject = JObject.FromObject(defaultInstance)
+ If obj IsNot Nothing Then
+ File.WriteAllText(ConfigFilePath, obj.ToString)
+ End If
+ End Sub
+
+End Class
\ No newline at end of file
diff --git a/Pilz.Configuration/packages.config b/Pilz.Configuration/packages.config
new file mode 100644
index 0000000..7f83af3
--- /dev/null
+++ b/Pilz.Configuration/packages.config
@@ -0,0 +1,4 @@
+
+
+
+
\ No newline at end of file
diff --git a/Pilz.Cryptography/My Project/Application.Designer.vb b/Pilz.Cryptography/My Project/Application.Designer.vb
new file mode 100644
index 0000000..88dd01c
--- /dev/null
+++ b/Pilz.Cryptography/My Project/Application.Designer.vb
@@ -0,0 +1,13 @@
+'------------------------------------------------------------------------------
+'
+' This code was generated by a tool.
+' Runtime Version:4.0.30319.42000
+'
+' Changes to this file may cause incorrect behavior and will be lost if
+' the code is regenerated.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
diff --git a/Pilz.Cryptography/My Project/Application.myapp b/Pilz.Cryptography/My Project/Application.myapp
new file mode 100644
index 0000000..758895d
--- /dev/null
+++ b/Pilz.Cryptography/My Project/Application.myapp
@@ -0,0 +1,10 @@
+
+
+ false
+ false
+ 0
+ true
+ 0
+ 1
+ true
+
diff --git a/Pilz.Cryptography/My Project/AssemblyInfo.vb b/Pilz.Cryptography/My Project/AssemblyInfo.vb
new file mode 100644
index 0000000..0eae44b
--- /dev/null
+++ b/Pilz.Cryptography/My Project/AssemblyInfo.vb
@@ -0,0 +1,35 @@
+Imports System
+Imports System.Reflection
+Imports System.Runtime.InteropServices
+
+' Allgemeine Informationen über eine Assembly werden über die folgenden
+' Attribute gesteuert. Ändern Sie diese Attributwerte, um die Informationen zu ändern,
+' die einer Assembly zugeordnet sind.
+
+' Werte der Assemblyattribute überprüfen
+
+
+
+
+
+
+
+
+
+
+'Die folgende GUID bestimmt die ID der Typbibliothek, wenn dieses Projekt für COM verfügbar gemacht wird.
+
+
+' Versionsinformationen für eine Assembly bestehen aus den folgenden vier Werten:
+'
+' Hauptversion
+' Nebenversion
+' Buildnummer
+' Revision
+'
+' Sie können alle Werte angeben oder Standardwerte für die Build- und Revisionsnummern verwenden,
+' übernehmen, indem Sie "*" eingeben:
+'
+
+
+
diff --git a/Pilz.Cryptography/My Project/Resources.Designer.vb b/Pilz.Cryptography/My Project/Resources.Designer.vb
new file mode 100644
index 0000000..1309395
--- /dev/null
+++ b/Pilz.Cryptography/My Project/Resources.Designer.vb
@@ -0,0 +1,62 @@
+'------------------------------------------------------------------------------
+'
+' This code was generated by a tool.
+' Runtime Version:4.0.30319.42000
+'
+' Changes to this file may cause incorrect behavior and will be lost if
+' the code is regenerated.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
+
+Namespace My.Resources
+
+ 'This class was auto-generated by the StronglyTypedResourceBuilder
+ 'class via a tool like ResGen or Visual Studio.
+ 'To add or remove a member, edit your .ResX file then rerun ResGen
+ 'with the /str option, or rebuild your VS project.
+ '''
+ ''' A strongly-typed resource class, for looking up localized strings, etc.
+ '''
+ _
+ Friend Module Resources
+
+ Private resourceMan As Global.System.Resources.ResourceManager
+
+ Private resourceCulture As Global.System.Globalization.CultureInfo
+
+ '''
+ ''' Returns the cached ResourceManager instance used by this class.
+ '''
+ _
+ Friend ReadOnly Property ResourceManager() As Global.System.Resources.ResourceManager
+ Get
+ If Object.ReferenceEquals(resourceMan, Nothing) Then
+ Dim temp As Global.System.Resources.ResourceManager = New Global.System.Resources.ResourceManager("Pilz.Cryptography.Resources", GetType(Resources).Assembly)
+ resourceMan = temp
+ End If
+ Return resourceMan
+ End Get
+ End Property
+
+ '''
+ ''' Overrides the current thread's CurrentUICulture property for all
+ ''' resource lookups using this strongly typed resource class.
+ '''
+ _
+ Friend Property Culture() As Global.System.Globalization.CultureInfo
+ Get
+ Return resourceCulture
+ End Get
+ Set(ByVal value As Global.System.Globalization.CultureInfo)
+ resourceCulture = value
+ End Set
+ End Property
+ End Module
+End Namespace
diff --git a/Pilz.Cryptography/My Project/Resources.resx b/Pilz.Cryptography/My Project/Resources.resx
new file mode 100644
index 0000000..af7dbeb
--- /dev/null
+++ b/Pilz.Cryptography/My Project/Resources.resx
@@ -0,0 +1,117 @@
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ text/microsoft-resx
+
+
+ 2.0
+
+
+ System.Resources.ResXResourceReader, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089
+
+
+ System.Resources.ResXResourceWriter, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089
+
+
\ No newline at end of file
diff --git a/Pilz.Cryptography/My Project/Settings.Designer.vb b/Pilz.Cryptography/My Project/Settings.Designer.vb
new file mode 100644
index 0000000..0a6103e
--- /dev/null
+++ b/Pilz.Cryptography/My Project/Settings.Designer.vb
@@ -0,0 +1,73 @@
+'------------------------------------------------------------------------------
+'
+' This code was generated by a tool.
+' Runtime Version:4.0.30319.42000
+'
+' Changes to this file may cause incorrect behavior and will be lost if
+' the code is regenerated.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
+
+Namespace My
+
+ _
+ Partial Friend NotInheritable Class MySettings
+ Inherits Global.System.Configuration.ApplicationSettingsBase
+
+ Private Shared defaultInstance As MySettings = CType(Global.System.Configuration.ApplicationSettingsBase.Synchronized(New MySettings), MySettings)
+
+#Region "My.Settings Auto-Save Functionality"
+#If _MyType = "WindowsForms" Then
+ Private Shared addedHandler As Boolean
+
+ Private Shared addedHandlerLockObject As New Object
+
+ _
+ Private Shared Sub AutoSaveSettings(ByVal sender As Global.System.Object, ByVal e As Global.System.EventArgs)
+ If My.Application.SaveMySettingsOnExit Then
+ My.Settings.Save()
+ End If
+ End Sub
+#End If
+#End Region
+
+ Public Shared ReadOnly Property [Default]() As MySettings
+ Get
+
+#If _MyType = "WindowsForms" Then
+ If Not addedHandler Then
+ SyncLock addedHandlerLockObject
+ If Not addedHandler Then
+ AddHandler My.Application.Shutdown, AddressOf AutoSaveSettings
+ addedHandler = True
+ End If
+ End SyncLock
+ End If
+#End If
+ Return defaultInstance
+ End Get
+ End Property
+ End Class
+End Namespace
+
+Namespace My
+
+ _
+ Friend Module MySettingsProperty
+
+ _
+ Friend ReadOnly Property Settings() As Global.Pilz.Cryptography.My.MySettings
+ Get
+ Return Global.Pilz.Cryptography.My.MySettings.Default
+ End Get
+ End Property
+ End Module
+End Namespace
diff --git a/Pilz.Cryptography/My Project/Settings.settings b/Pilz.Cryptography/My Project/Settings.settings
new file mode 100644
index 0000000..85b890b
--- /dev/null
+++ b/Pilz.Cryptography/My Project/Settings.settings
@@ -0,0 +1,7 @@
+
+
+
+
+
+
+
diff --git a/Pilz.Cryptography/Pilz.Cryptography.vbproj b/Pilz.Cryptography/Pilz.Cryptography.vbproj
new file mode 100644
index 0000000..bc64c81
--- /dev/null
+++ b/Pilz.Cryptography/Pilz.Cryptography.vbproj
@@ -0,0 +1,103 @@
+
+
+
+
+ Debug
+ AnyCPU
+ {DF980F5D-820C-4CD3-A865-C40791BF7CE4}
+ Library
+ Pilz.Cryptography
+ Pilz.Cryptography
+ 512
+ Windows
+ v4.5
+ true
+
+
+ true
+ full
+ true
+ true
+ bin\Debug\
+ Pilz.Cryptography.xml
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+
+
+ pdbonly
+ false
+ true
+ true
+ bin\Release\
+ Pilz.Cryptography.xml
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+
+
+ On
+
+
+ Binary
+
+
+ Off
+
+
+ On
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ True
+ Application.myapp
+
+
+ True
+ True
+ Resources.resx
+
+
+ True
+ Settings.settings
+ True
+
+
+
+
+ VbMyResourcesResXFileCodeGenerator
+ Resources.Designer.vb
+ My.Resources
+ Designer
+
+
+
+
+ MyApplicationCodeGenerator
+ Application.Designer.vb
+
+
+ SettingsSingleFileGenerator
+ My
+ Settings.Designer.vb
+
+
+
+
\ No newline at end of file
diff --git a/Pilz.Drawing/BitmapExtensions.vb b/Pilz.Drawing/BitmapExtensions.vb
new file mode 100644
index 0000000..afe580f
--- /dev/null
+++ b/Pilz.Drawing/BitmapExtensions.vb
@@ -0,0 +1,20 @@
+Imports System.Drawing
+Imports System.Runtime.CompilerServices
+
+Public Module BitmapExtensions
+
+
+ Public Sub InvertColors(bmp As Bitmap)
+ For y As Integer = 0 To bmp.Height - 1
+ For x As Integer = 0 To bmp.Width - 1
+ Dim inv As Color = bmp.GetPixel(x, y)
+ inv = Color.FromArgb(inv.A,
+ Byte.MaxValue - inv.R,
+ Byte.MaxValue - inv.G,
+ Byte.MaxValue - inv.B)
+ bmp.SetPixel(x, y, inv)
+ Next
+ Next
+ End Sub
+
+End Module
diff --git a/Pilz.Drawing/HelpfulDrawingFunctions.vb b/Pilz.Drawing/HelpfulDrawingFunctions.vb
new file mode 100644
index 0000000..b7d74d3
--- /dev/null
+++ b/Pilz.Drawing/HelpfulDrawingFunctions.vb
@@ -0,0 +1,41 @@
+Imports System.Drawing
+Imports System.Drawing.Drawing2D
+
+Public Class HelpfulDrawingFunctions
+
+ Public Shared Function IsPointInRectangle(p As PointF, rect As RectangleF) As Boolean
+ Dim bList As New List(Of Boolean)
+
+ bList.Add(p.X > rect.Left)
+ bList.Add(p.X < rect.Right)
+ bList.Add(p.Y > rect.Top)
+ bList.Add(p.Y < rect.Bottom)
+
+ Return Not bList.Contains(False)
+ End Function
+
+ Public Shared Function OverlapsTwoRectangles(a As RectangleF, b As RectangleF) As Boolean
+ Return a.IntersectsWith(b) 'RectangleF.Intersect(a, b) <> RectangleF.Empty
+ End Function
+
+ Public Shared Function GetRectangle(p1 As PointF, p2 As PointF) As RectangleF
+ Dim rect As New RectangleF
+ Dim startIsEnd As Boolean = p1.X > p2.X AndAlso p1.Y > p2.Y
+
+ Dim xValues() As Integer = {p1.X, p2.X}
+ Dim yValues() As Integer = {p1.Y, p2.Y}
+
+ rect.Location = New PointF(xValues.OrderBy(Function(n) n).First,
+ yValues.OrderBy(Function(n) n).First)
+
+ rect.Size = New SizeF(xValues.OrderByDescending(Function(n) n).First,
+ yValues.OrderByDescending(Function(n) n).First)
+
+ rect.Size = New SizeF(rect.Size.Width - rect.Location.X,
+ rect.Size.Height - rect.Location.Y)
+
+ Return rect
+ End Function
+
+End Class
+
diff --git a/Pilz.Drawing/My Project/Application.Designer.vb b/Pilz.Drawing/My Project/Application.Designer.vb
new file mode 100644
index 0000000..88dd01c
--- /dev/null
+++ b/Pilz.Drawing/My Project/Application.Designer.vb
@@ -0,0 +1,13 @@
+'------------------------------------------------------------------------------
+'
+' This code was generated by a tool.
+' Runtime Version:4.0.30319.42000
+'
+' Changes to this file may cause incorrect behavior and will be lost if
+' the code is regenerated.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
diff --git a/Pilz.Drawing/My Project/Application.myapp b/Pilz.Drawing/My Project/Application.myapp
new file mode 100644
index 0000000..758895d
--- /dev/null
+++ b/Pilz.Drawing/My Project/Application.myapp
@@ -0,0 +1,10 @@
+
+
+ false
+ false
+ 0
+ true
+ 0
+ 1
+ true
+
diff --git a/Pilz.Drawing/My Project/AssemblyInfo.vb b/Pilz.Drawing/My Project/AssemblyInfo.vb
new file mode 100644
index 0000000..c0a2a4b
--- /dev/null
+++ b/Pilz.Drawing/My Project/AssemblyInfo.vb
@@ -0,0 +1,35 @@
+Imports System
+Imports System.Reflection
+Imports System.Runtime.InteropServices
+
+' Allgemeine Informationen über eine Assembly werden über die folgenden
+' Attribute gesteuert. Ändern Sie diese Attributwerte, um die Informationen zu ändern,
+' die einer Assembly zugeordnet sind.
+
+' Werte der Assemblyattribute überprüfen
+
+
+
+
+
+
+
+
+
+
+'Die folgende GUID bestimmt die ID der Typbibliothek, wenn dieses Projekt für COM verfügbar gemacht wird.
+
+
+' Versionsinformationen für eine Assembly bestehen aus den folgenden vier Werten:
+'
+' Hauptversion
+' Nebenversion
+' Buildnummer
+' Revision
+'
+' Sie können alle Werte angeben oder Standardwerte für die Build- und Revisionsnummern verwenden,
+' übernehmen, indem Sie "*" eingeben:
+'
+
+
+
diff --git a/Pilz.Drawing/My Project/Resources.Designer.vb b/Pilz.Drawing/My Project/Resources.Designer.vb
new file mode 100644
index 0000000..e4895af
--- /dev/null
+++ b/Pilz.Drawing/My Project/Resources.Designer.vb
@@ -0,0 +1,62 @@
+'------------------------------------------------------------------------------
+'
+' This code was generated by a tool.
+' Runtime Version:4.0.30319.42000
+'
+' Changes to this file may cause incorrect behavior and will be lost if
+' the code is regenerated.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
+
+Namespace My.Resources
+
+ 'This class was auto-generated by the StronglyTypedResourceBuilder
+ 'class via a tool like ResGen or Visual Studio.
+ 'To add or remove a member, edit your .ResX file then rerun ResGen
+ 'with the /str option, or rebuild your VS project.
+ '''
+ ''' A strongly-typed resource class, for looking up localized strings, etc.
+ '''
+ _
+ Friend Module Resources
+
+ Private resourceMan As Global.System.Resources.ResourceManager
+
+ Private resourceCulture As Global.System.Globalization.CultureInfo
+
+ '''
+ ''' Returns the cached ResourceManager instance used by this class.
+ '''
+ _
+ Friend ReadOnly Property ResourceManager() As Global.System.Resources.ResourceManager
+ Get
+ If Object.ReferenceEquals(resourceMan, Nothing) Then
+ Dim temp As Global.System.Resources.ResourceManager = New Global.System.Resources.ResourceManager("Pilz.Drawing.Resources", GetType(Resources).Assembly)
+ resourceMan = temp
+ End If
+ Return resourceMan
+ End Get
+ End Property
+
+ '''
+ ''' Overrides the current thread's CurrentUICulture property for all
+ ''' resource lookups using this strongly typed resource class.
+ '''
+ _
+ Friend Property Culture() As Global.System.Globalization.CultureInfo
+ Get
+ Return resourceCulture
+ End Get
+ Set(ByVal value As Global.System.Globalization.CultureInfo)
+ resourceCulture = value
+ End Set
+ End Property
+ End Module
+End Namespace
diff --git a/Pilz.Drawing/My Project/Resources.resx b/Pilz.Drawing/My Project/Resources.resx
new file mode 100644
index 0000000..af7dbeb
--- /dev/null
+++ b/Pilz.Drawing/My Project/Resources.resx
@@ -0,0 +1,117 @@
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ text/microsoft-resx
+
+
+ 2.0
+
+
+ System.Resources.ResXResourceReader, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089
+
+
+ System.Resources.ResXResourceWriter, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089
+
+
\ No newline at end of file
diff --git a/Pilz.Drawing/My Project/Settings.Designer.vb b/Pilz.Drawing/My Project/Settings.Designer.vb
new file mode 100644
index 0000000..d79ad0b
--- /dev/null
+++ b/Pilz.Drawing/My Project/Settings.Designer.vb
@@ -0,0 +1,73 @@
+'------------------------------------------------------------------------------
+'
+' This code was generated by a tool.
+' Runtime Version:4.0.30319.42000
+'
+' Changes to this file may cause incorrect behavior and will be lost if
+' the code is regenerated.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
+
+Namespace My
+
+ _
+ Partial Friend NotInheritable Class MySettings
+ Inherits Global.System.Configuration.ApplicationSettingsBase
+
+ Private Shared defaultInstance As MySettings = CType(Global.System.Configuration.ApplicationSettingsBase.Synchronized(New MySettings), MySettings)
+
+#Region "My.Settings Auto-Save Functionality"
+#If _MyType = "WindowsForms" Then
+ Private Shared addedHandler As Boolean
+
+ Private Shared addedHandlerLockObject As New Object
+
+ _
+ Private Shared Sub AutoSaveSettings(ByVal sender As Global.System.Object, ByVal e As Global.System.EventArgs)
+ If My.Application.SaveMySettingsOnExit Then
+ My.Settings.Save()
+ End If
+ End Sub
+#End If
+#End Region
+
+ Public Shared ReadOnly Property [Default]() As MySettings
+ Get
+
+#If _MyType = "WindowsForms" Then
+ If Not addedHandler Then
+ SyncLock addedHandlerLockObject
+ If Not addedHandler Then
+ AddHandler My.Application.Shutdown, AddressOf AutoSaveSettings
+ addedHandler = True
+ End If
+ End SyncLock
+ End If
+#End If
+ Return defaultInstance
+ End Get
+ End Property
+ End Class
+End Namespace
+
+Namespace My
+
+ _
+ Friend Module MySettingsProperty
+
+ _
+ Friend ReadOnly Property Settings() As Global.Pilz.Drawing.My.MySettings
+ Get
+ Return Global.Pilz.Drawing.My.MySettings.Default
+ End Get
+ End Property
+ End Module
+End Namespace
diff --git a/Pilz.Drawing/My Project/Settings.settings b/Pilz.Drawing/My Project/Settings.settings
new file mode 100644
index 0000000..85b890b
--- /dev/null
+++ b/Pilz.Drawing/My Project/Settings.settings
@@ -0,0 +1,7 @@
+
+
+
+
+
+
+
diff --git a/Pilz.Drawing/Pilz.Drawing.vbproj b/Pilz.Drawing/Pilz.Drawing.vbproj
new file mode 100644
index 0000000..a7b8251
--- /dev/null
+++ b/Pilz.Drawing/Pilz.Drawing.vbproj
@@ -0,0 +1,107 @@
+
+
+
+
+ Debug
+ AnyCPU
+ {1A0B8106-2449-4908-B5E1-A00D8E9CF8F6}
+ Library
+ Pilz.Drawing
+ Pilz.Drawing
+ 512
+ Windows
+ v4.5
+ true
+
+
+ true
+ full
+ true
+ true
+ bin\Debug\
+ Pilz.Drawing.xml
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+
+
+ pdbonly
+ false
+ true
+ true
+ bin\Release\
+ Pilz.Drawing.xml
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+
+
+ On
+
+
+ Binary
+
+
+ Off
+
+
+ On
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ True
+ Application.myapp
+
+
+ True
+ True
+ Resources.resx
+
+
+ True
+ Settings.settings
+ True
+
+
+
+
+
+
+ VbMyResourcesResXFileCodeGenerator
+ Resources.Designer.vb
+ My.Resources
+ Designer
+
+
+
+
+ MyApplicationCodeGenerator
+ Application.Designer.vb
+
+
+ SettingsSingleFileGenerator
+ My
+ Settings.Designer.vb
+
+
+
+
\ No newline at end of file
diff --git a/Pilz.Drawing/PointD.vb b/Pilz.Drawing/PointD.vb
new file mode 100644
index 0000000..f37d80f
--- /dev/null
+++ b/Pilz.Drawing/PointD.vb
@@ -0,0 +1,31 @@
+Public Class PointD
+
+ Public Property X As Double
+ Public Property Y As Double
+
+ Public Sub New()
+ X = 0
+ Y = 0
+ End Sub
+
+ Public Sub New(x As Double, y As Double)
+ Me.X = x
+ Me.Y = y
+ End Sub
+
+ Public Shared ReadOnly Property Empty As PointD
+ Get
+ Return New PointD
+ End Get
+ End Property
+
+ Public Shared Operator =(val1 As PointD, val2 As PointD) As Boolean
+ Return val1.X = val2.X AndAlso val1.Y = val2.Y
+ End Operator
+
+ Public Shared Operator <>(val1 As PointD, val2 As PointD) As Boolean
+ Return val1.X <> val2.X OrElse val1.Y <> val2.Y
+ End Operator
+
+
+End Class
diff --git a/Pilz.IO/EventArgs/DataEventargs.vb b/Pilz.IO/EventArgs/DataEventargs.vb
new file mode 100644
index 0000000..83073f9
--- /dev/null
+++ b/Pilz.IO/EventArgs/DataEventargs.vb
@@ -0,0 +1,10 @@
+Public Class DataEventArgs : Inherits EventArgs
+
+ Public ReadOnly Data As Byte()
+
+ Public Sub New(bytes As Byte())
+ MyBase.New()
+ Data = bytes
+ End Sub
+
+End Class
diff --git a/Pilz.IO/ManagedPipes/ManagedPipe.vb b/Pilz.IO/ManagedPipes/ManagedPipe.vb
new file mode 100644
index 0000000..ff64541
--- /dev/null
+++ b/Pilz.IO/ManagedPipes/ManagedPipe.vb
@@ -0,0 +1,53 @@
+'''
+''' stellt den Erben "Server" und "Client" 2 verschiedene
+''' Message-Events zur Verfügung, und ein Event-Raisendes Dispose
+'''
+Public MustInherit Class ManagedPipe : Implements IDisposable
+
+ Public Delegate Sub EventHandlerWithOneArgument(Of T0)(Sender As T0)
+
+ '''
+ ''' Zur Ausgabe chat-verwaltungstechnischer Status-Informationen
+ '''
+ Public Event StatusMessage As EventHandler(Of DataEventArgs)
+ ''' Zur Ausgabe von Chat-Messages
+ Public Event RetriveData As EventHandler(Of DataEventArgs)
+ Public Event Disposed As EventHandlerWithOneArgument(Of ManagedPipe)
+
+ Private _IsDisposed As Boolean = False
+
+ Protected MustOverride Sub Dispose(disposing As Boolean)
+ Public MustOverride Sub Send(bytes As Byte())
+ Public MustOverride Function SendAsnyc(bytes As Byte()) As Task
+
+ Protected Sub OnStatusMessage(ByVal e As DataEventArgs)
+ RaiseEvent StatusMessage(Me, e)
+ End Sub
+
+ Protected Sub OnRetriveData(ByVal e As DataEventArgs)
+ RaiseEvent RetriveData(Me, e)
+ End Sub
+
+ Public Sub RemoveFrom(Of T As ManagedPipe)(ByVal Coll As ICollection(Of T))
+ Coll.Remove(DirectCast(Me, T))
+ End Sub
+
+ Public ReadOnly Property IsDisposed() As Boolean
+ Get
+ Return _IsDisposed
+ End Get
+ End Property
+
+ Public Sub AddTo(Of T As ManagedPipe)(ByVal Coll As ICollection(Of T))
+ Coll.Add(Me)
+ End Sub
+
+ Public Sub Dispose() Implements IDisposable.Dispose
+ If _IsDisposed Then Return
+ _IsDisposed = True
+ Dispose(True) ' rufe die erzwungenen Überschreibungen von Sub Dispose(Boolean)
+ RaiseEvent Disposed(Me)
+ GC.SuppressFinalize(Me)
+ End Sub
+
+End Class
diff --git a/Pilz.IO/ManagedPipes/ManagedPipeClient.vb b/Pilz.IO/ManagedPipes/ManagedPipeClient.vb
new file mode 100644
index 0000000..d0ef505
--- /dev/null
+++ b/Pilz.IO/ManagedPipes/ManagedPipeClient.vb
@@ -0,0 +1,91 @@
+Imports System.Net
+Imports System.Text
+Imports System.IO.Pipes
+Imports Pilz.Threading
+
+Public Class ManagedPipeClient : Inherits ManagedPipe
+
+ Private pipeStream As PipeStream
+ Private _Buf(&H400 - 1) As Byte
+
+ Public Property RaiseEventsGui As Boolean = True
+
+ Public Sub New(pipeName As String)
+ Me.New(pipeName, ".")
+ End Sub
+
+ Public Sub New(pipeName As String, serverName As String)
+ Me.New(pipeName, serverName, -1)
+ End Sub
+
+ Public Sub New(pipeName As String, connectionTimeout As Integer)
+ Me.New(pipeName, ".", connectionTimeout)
+ End Sub
+
+ Public Sub New(pipeName As String, serverName As String, connectionTimeout As Integer)
+ Dim clnt As New NamedPipeClientStream(serverName, pipeName, PipeDirection.InOut, PipeOptions.Asynchronous)
+ clnt.Connect(connectionTimeout)
+ If Not clnt.IsConnected Then
+ Throw New TimeoutException("Connection timeout!")
+ End If
+ SetPipe(clnt)
+ End Sub
+
+ Public Sub New(pipe As PipeStream)
+ SetPipe(pipe)
+ End Sub
+
+ Private Sub SetPipe(pipe As PipeStream)
+ pipeStream = pipe
+ pipeStream.BeginRead(_Buf, 0, _Buf.Length, AddressOf EndRead, Nothing)
+ End Sub
+
+ Private Sub EndRead(ar As IAsyncResult)
+ If IsDisposed Then Return
+
+ Dim bytesCount As Integer = pipeStream.EndRead(ar)
+ If bytesCount = 0 Then 'leere Datenübermittlung signalisiert Verbindungsabbruch
+ If RaiseEventsGui Then
+ CrossThreadsInvokeing.RunGui(AddressOf Dispose)
+ Else
+ Dispose()
+ End If
+ Return
+ End If
+
+ Dim list As New List(Of Byte)
+
+ For i As Integer = 0 To bytesCount - 1
+ list.Add(_Buf(i))
+ Next
+
+ Do While bytesCount = _Buf.Length
+ bytesCount = pipeStream.Read(_Buf, 0, _Buf.Length)
+ For i As Integer = 0 To bytesCount - 1
+ list.Add(_Buf(i))
+ Next
+ Loop
+
+ Dim deargs As New DataEventArgs(list.ToArray)
+ If RaiseEventsGui Then
+ CrossThreadsInvokeing.RunGui(AddressOf OnRetriveData, deargs)
+ Else
+ OnRetriveData(deargs)
+ End If
+
+ pipeStream.BeginRead(_Buf, 0, _Buf.Length, AddressOf EndRead, Nothing)
+ End Sub
+
+ Public Overrides Function SendAsnyc(bytes() As Byte) As Task
+ Return Task.Run(Sub() Send(bytes))
+ End Function
+
+ Public Overrides Sub Send(data As Byte())
+ pipeStream.Write(data, 0, data.Length)
+ End Sub
+
+ Protected Overrides Sub Dispose(ByVal disposing As Boolean)
+ pipeStream.Dispose()
+ End Sub
+
+End Class
diff --git a/Pilz.IO/ManagedPipes/ManagedPipeServer.vb b/Pilz.IO/ManagedPipes/ManagedPipeServer.vb
new file mode 100644
index 0000000..9d50580
--- /dev/null
+++ b/Pilz.IO/ManagedPipes/ManagedPipeServer.vb
@@ -0,0 +1,104 @@
+Imports System.Net
+Imports System.IO.Pipes
+Imports Pilz.Threading
+
+Public Class ManagedPipeServer : Inherits ManagedPipe
+
+ 'Pro Verbindung(sanfrage) wird ein Client-Objekt generiert, das den Datenaustausch dieser Verbindung abwickelt
+ Private _Clients As New List(Of ManagedPipeClient)
+ Private ReadOnly pipeName As String = ""
+ Private ReadOnly maxNumbersOfServerInstances As Integer
+ Private numberOfStartedServerInstances As Integer = 0
+
+ Public Sub New(ByVal pipeName As String)
+ Me.New(pipeName, 1)
+ End Sub
+
+ Public Sub New(pipeName As String, maxNumbersOfServerInstances As Integer)
+ Me.pipeName = pipeName
+ Me.maxNumbersOfServerInstances = maxNumbersOfServerInstances
+ CreateWaitingStream()
+ End Sub
+
+ Private Sub CreateWaitingStream()
+ If numberOfStartedServerInstances < maxNumbersOfServerInstances Then
+ Dim strm = New NamedPipeServerStream(pipeName, PipeDirection.InOut, maxNumbersOfServerInstances, PipeTransmissionMode.Byte, PipeOptions.Asynchronous)
+ numberOfStartedServerInstances += 1
+ strm.BeginWaitForConnection(AddressOf EndAccept, strm)
+ Console.WriteLine("Start Waiting for new Connection ...")
+ End If
+ End Sub
+
+ Private Sub EndAccept(ByVal ar As IAsyncResult)
+ Dim strm = DirectCast(ar.AsyncState, NamedPipeServerStream)
+
+ strm.EndWaitForConnection(ar)
+
+ If IsDisposed Then
+ strm.Dispose()
+ Return
+ End If
+
+ With New ManagedPipeClient(strm)
+ AddHandler .RetriveData, AddressOf Client_RetriveData
+ AddHandler .StatusMessage, AddressOf Client_StatusMessage
+ AddHandler .Disposed, AddressOf Client_Disposed
+ .AddTo(_Clients)
+ End With
+
+ Console.WriteLine("Client accepted!")
+
+ CreateWaitingStream()
+ End Sub
+
+#Region "_Clients-Ereignisverarbeitung"
+
+ Private Sub Client_Disposed(ByVal Sender As ManagedPipe)
+ 'den Client für die beendete Verbindung entfernen
+ Sender.RemoveFrom(_Clients)
+ numberOfStartedServerInstances -= 1
+ CreateWaitingStream()
+ End Sub
+
+ Private Sub Client_RetriveData(ByVal sender As Object, ByVal e As DataEventArgs)
+ 'einkommende ChatMessages anzeigen, und an alle versenden
+ OnRetriveData(e)
+ End Sub
+
+ Private Sub Client_StatusMessage(ByVal sender As Object, ByVal e As DataEventArgs)
+ 'einkommende StatusMessages durchreichen (zur Anzeige)
+ OnStatusMessage(e)
+ End Sub
+
+#End Region '_Clients-Ereignisverarbeitung
+
+ Public Overrides Function SendAsnyc(bytes() As Byte) As Task
+ Return Task.Run(Sub() Send(bytes))
+ End Function
+
+ Public Overrides Sub Send(data As Byte())
+ Console.WriteLine("Sending Data ...")
+
+ 'OnRetriveData(New DataEventargs(data)) ' anzeigen
+
+ For Each client As ManagedPipeClient In _Clients ' an alle versenden
+ client.Send(data)
+ Next
+
+ Console.WriteLine("Data send!")
+ End Sub
+
+ Protected Overrides Sub Dispose(ByVal disposing As Boolean)
+ If numberOfStartedServerInstances < maxNumbersOfServerInstances Then
+ Using clnt As New NamedPipeClientStream(pipeName)
+ 'Herstellen einer Dummi-Verbindung, damit der ServerStream aus dem Wartezustand herauskommt.
+ clnt.Connect()
+ End Using
+ End If
+
+ For i As Integer = _Clients.Count - 1 To 0 Step -1
+ _Clients(i).Dispose()
+ Next
+ End Sub
+
+End Class
diff --git a/Pilz.IO/My Project/Application.Designer.vb b/Pilz.IO/My Project/Application.Designer.vb
new file mode 100644
index 0000000..8ab460b
--- /dev/null
+++ b/Pilz.IO/My Project/Application.Designer.vb
@@ -0,0 +1,13 @@
+'------------------------------------------------------------------------------
+'
+' Dieser Code wurde von einem Tool generiert.
+' Laufzeitversion:4.0.30319.42000
+'
+' Änderungen an dieser Datei können falsches Verhalten verursachen und gehen verloren, wenn
+' der Code erneut generiert wird.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
diff --git a/Pilz.IO/My Project/Application.myapp b/Pilz.IO/My Project/Application.myapp
new file mode 100644
index 0000000..758895d
--- /dev/null
+++ b/Pilz.IO/My Project/Application.myapp
@@ -0,0 +1,10 @@
+
+
+ false
+ false
+ 0
+ true
+ 0
+ 1
+ true
+
diff --git a/Pilz.IO/My Project/AssemblyInfo.vb b/Pilz.IO/My Project/AssemblyInfo.vb
new file mode 100644
index 0000000..ed26f17
--- /dev/null
+++ b/Pilz.IO/My Project/AssemblyInfo.vb
@@ -0,0 +1,35 @@
+Imports System
+Imports System.Reflection
+Imports System.Runtime.InteropServices
+
+' Allgemeine Informationen über eine Assembly werden über die folgenden
+' Attribute gesteuert. Ändern Sie diese Attributwerte, um die Informationen zu ändern,
+' die einer Assembly zugeordnet sind.
+
+' Werte der Assemblyattribute überprüfen
+
+
+
+
+
+
+
+
+
+
+'Die folgende GUID bestimmt die ID der Typbibliothek, wenn dieses Projekt für COM verfügbar gemacht wird.
+
+
+' Versionsinformationen für eine Assembly bestehen aus den folgenden vier Werten:
+'
+' Hauptversion
+' Nebenversion
+' Buildnummer
+' Revision
+'
+' Sie können alle Werte angeben oder Standardwerte für die Build- und Revisionsnummern verwenden,
+' übernehmen, indem Sie "*" eingeben:
+'
+
+
+
diff --git a/Pilz.IO/My Project/Resources.Designer.vb b/Pilz.IO/My Project/Resources.Designer.vb
new file mode 100644
index 0000000..1d554f0
--- /dev/null
+++ b/Pilz.IO/My Project/Resources.Designer.vb
@@ -0,0 +1,63 @@
+'------------------------------------------------------------------------------
+'
+' Dieser Code wurde von einem Tool generiert.
+' Laufzeitversion:4.0.30319.42000
+'
+' Änderungen an dieser Datei können falsches Verhalten verursachen und gehen verloren, wenn
+' der Code erneut generiert wird.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
+Imports System
+
+Namespace My.Resources
+
+ 'Diese Klasse wurde von der StronglyTypedResourceBuilder automatisch generiert
+ '-Klasse über ein Tool wie ResGen oder Visual Studio automatisch generiert.
+ 'Um einen Member hinzuzufügen oder zu entfernen, bearbeiten Sie die .ResX-Datei und führen dann ResGen
+ 'mit der /str-Option erneut aus, oder Sie erstellen Ihr VS-Projekt neu.
+ '''
+ ''' Eine stark typisierte Ressourcenklasse zum Suchen von lokalisierten Zeichenfolgen usw.
+ '''
+ _
+ Friend Module Resources
+
+ Private resourceMan As Global.System.Resources.ResourceManager
+
+ Private resourceCulture As Global.System.Globalization.CultureInfo
+
+ '''
+ ''' Gibt die zwischengespeicherte ResourceManager-Instanz zurück, die von dieser Klasse verwendet wird.
+ '''
+ _
+ Friend ReadOnly Property ResourceManager() As Global.System.Resources.ResourceManager
+ Get
+ If Object.ReferenceEquals(resourceMan, Nothing) Then
+ Dim temp As Global.System.Resources.ResourceManager = New Global.System.Resources.ResourceManager("Pilz.IO.Resources", GetType(Resources).Assembly)
+ resourceMan = temp
+ End If
+ Return resourceMan
+ End Get
+ End Property
+
+ '''
+ ''' Überschreibt die CurrentUICulture-Eigenschaft des aktuellen Threads für alle
+ ''' Ressourcenzuordnungen, die diese stark typisierte Ressourcenklasse verwenden.
+ '''
+ _
+ Friend Property Culture() As Global.System.Globalization.CultureInfo
+ Get
+ Return resourceCulture
+ End Get
+ Set
+ resourceCulture = value
+ End Set
+ End Property
+ End Module
+End Namespace
diff --git a/Pilz.IO/My Project/Resources.resx b/Pilz.IO/My Project/Resources.resx
new file mode 100644
index 0000000..af7dbeb
--- /dev/null
+++ b/Pilz.IO/My Project/Resources.resx
@@ -0,0 +1,117 @@
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ text/microsoft-resx
+
+
+ 2.0
+
+
+ System.Resources.ResXResourceReader, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089
+
+
+ System.Resources.ResXResourceWriter, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089
+
+
\ No newline at end of file
diff --git a/Pilz.IO/My Project/Settings.Designer.vb b/Pilz.IO/My Project/Settings.Designer.vb
new file mode 100644
index 0000000..784f9bc
--- /dev/null
+++ b/Pilz.IO/My Project/Settings.Designer.vb
@@ -0,0 +1,73 @@
+'------------------------------------------------------------------------------
+'
+' Dieser Code wurde von einem Tool generiert.
+' Laufzeitversion:4.0.30319.42000
+'
+' Änderungen an dieser Datei können falsches Verhalten verursachen und gehen verloren, wenn
+' der Code erneut generiert wird.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
+
+Namespace My
+
+ _
+ Partial Friend NotInheritable Class MySettings
+ Inherits Global.System.Configuration.ApplicationSettingsBase
+
+ Private Shared defaultInstance As MySettings = CType(Global.System.Configuration.ApplicationSettingsBase.Synchronized(New MySettings()),MySettings)
+
+#Region "Automatische My.Settings-Speicherfunktion"
+#If _MyType = "WindowsForms" Then
+ Private Shared addedHandler As Boolean
+
+ Private Shared addedHandlerLockObject As New Object
+
+ _
+ Private Shared Sub AutoSaveSettings(sender As Global.System.Object, e As Global.System.EventArgs)
+ If My.Application.SaveMySettingsOnExit Then
+ My.Settings.Save()
+ End If
+ End Sub
+#End If
+#End Region
+
+ Public Shared ReadOnly Property [Default]() As MySettings
+ Get
+
+#If _MyType = "WindowsForms" Then
+ If Not addedHandler Then
+ SyncLock addedHandlerLockObject
+ If Not addedHandler Then
+ AddHandler My.Application.Shutdown, AddressOf AutoSaveSettings
+ addedHandler = True
+ End If
+ End SyncLock
+ End If
+#End If
+ Return defaultInstance
+ End Get
+ End Property
+ End Class
+End Namespace
+
+Namespace My
+
+ _
+ Friend Module MySettingsProperty
+
+ _
+ Friend ReadOnly Property Settings() As Global.Pilz.IO.My.MySettings
+ Get
+ Return Global.Pilz.IO.My.MySettings.Default
+ End Get
+ End Property
+ End Module
+End Namespace
diff --git a/Pilz.IO/My Project/Settings.settings b/Pilz.IO/My Project/Settings.settings
new file mode 100644
index 0000000..85b890b
--- /dev/null
+++ b/Pilz.IO/My Project/Settings.settings
@@ -0,0 +1,7 @@
+
+
+
+
+
+
+
diff --git a/Pilz.IO/Pilz.IO.vbproj b/Pilz.IO/Pilz.IO.vbproj
new file mode 100644
index 0000000..d70fe2d
--- /dev/null
+++ b/Pilz.IO/Pilz.IO.vbproj
@@ -0,0 +1,135 @@
+
+
+
+
+ Debug
+ AnyCPU
+ {35591965-8339-41A2-8CD3-962ED54670AC}
+ Library
+ Pilz.IO
+ Pilz.IO
+ 512
+ Windows
+ v4.5
+ true
+
+
+ true
+ full
+ true
+ true
+ bin\Debug\
+ Pilz.IO.xml
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+
+
+ pdbonly
+ false
+ true
+ true
+ bin\Release\
+ Pilz.IO.xml
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+
+
+ On
+
+
+ Binary
+
+
+ Off
+
+
+ On
+
+
+ true
+ true
+ true
+ bin\x86\Debug\
+ Pilz.IO.xml
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+ full
+ x86
+ MinimumRecommendedRules.ruleset
+ true
+
+
+ true
+ bin\x86\Release\
+ Pilz.IO.xml
+ true
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+ pdbonly
+ x86
+ MinimumRecommendedRules.ruleset
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ True
+ Application.myapp
+
+
+ True
+ True
+ Resources.resx
+
+
+ True
+ Settings.settings
+ True
+
+
+
+
+
+ VbMyResourcesResXFileCodeGenerator
+ Resources.Designer.vb
+ My.Resources
+ Designer
+
+
+
+
+ MyApplicationCodeGenerator
+ Application.Designer.vb
+
+
+ SettingsSingleFileGenerator
+ My
+ Settings.Designer.vb
+
+
+
+
+ {d9c8655e-4f1c-4348-a51c-ab00fd9a14bb}
+ CrossThreads
+
+
+
+
\ No newline at end of file
diff --git a/Pilz.Reflection.PluginSystem/Attributes/FuncWithCodeMethodAttribute.vb b/Pilz.Reflection.PluginSystem/Attributes/FuncWithCodeMethodAttribute.vb
new file mode 100644
index 0000000..e3b1c1e
--- /dev/null
+++ b/Pilz.Reflection.PluginSystem/Attributes/FuncWithCodeMethodAttribute.vb
@@ -0,0 +1,19 @@
+Namespace Attributes
+
+ Public Class PluginFunctionAttribute
+ Inherits Attribute
+
+ Public ReadOnly Property FunctionCode As String
+ Public ReadOnly Property Params As Object()
+
+ '''
+ ''' The function code for this PluginFunction.
+ ''' The parameters for this PluginFunction.
+ Public Sub New(funcCode As String, ParamArray params As Object())
+ Me.FunctionCode = funcCode
+ Me.Params = params
+ End Sub
+
+ End Class
+
+End Namespace
diff --git a/Pilz.Reflection.PluginSystem/Attributes/LoadMethodAttribute.vb b/Pilz.Reflection.PluginSystem/Attributes/LoadMethodAttribute.vb
new file mode 100644
index 0000000..d898afc
--- /dev/null
+++ b/Pilz.Reflection.PluginSystem/Attributes/LoadMethodAttribute.vb
@@ -0,0 +1,7 @@
+Namespace Attributes
+
+ Public Class LoadMethodAttribute
+ Inherits Attribute
+ End Class
+
+End Namespace
diff --git a/Pilz.Reflection.PluginSystem/My Project/Application.Designer.vb b/Pilz.Reflection.PluginSystem/My Project/Application.Designer.vb
new file mode 100644
index 0000000..88dd01c
--- /dev/null
+++ b/Pilz.Reflection.PluginSystem/My Project/Application.Designer.vb
@@ -0,0 +1,13 @@
+'------------------------------------------------------------------------------
+'
+' This code was generated by a tool.
+' Runtime Version:4.0.30319.42000
+'
+' Changes to this file may cause incorrect behavior and will be lost if
+' the code is regenerated.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
diff --git a/Pilz.Reflection.PluginSystem/My Project/Application.myapp b/Pilz.Reflection.PluginSystem/My Project/Application.myapp
new file mode 100644
index 0000000..758895d
--- /dev/null
+++ b/Pilz.Reflection.PluginSystem/My Project/Application.myapp
@@ -0,0 +1,10 @@
+
+
+ false
+ false
+ 0
+ true
+ 0
+ 1
+ true
+
diff --git a/Pilz.Reflection.PluginSystem/My Project/AssemblyInfo.vb b/Pilz.Reflection.PluginSystem/My Project/AssemblyInfo.vb
new file mode 100644
index 0000000..6cc80cf
--- /dev/null
+++ b/Pilz.Reflection.PluginSystem/My Project/AssemblyInfo.vb
@@ -0,0 +1,35 @@
+Imports System
+Imports System.Reflection
+Imports System.Runtime.InteropServices
+
+' Allgemeine Informationen über eine Assembly werden über die folgenden
+' Attribute gesteuert. Ändern Sie diese Attributwerte, um die Informationen zu ändern,
+' die einer Assembly zugeordnet sind.
+
+' Werte der Assemblyattribute überprüfen
+
+
+
+
+
+
+
+
+
+
+'Die folgende GUID bestimmt die ID der Typbibliothek, wenn dieses Projekt für COM verfügbar gemacht wird.
+
+
+' Versionsinformationen für eine Assembly bestehen aus den folgenden vier Werten:
+'
+' Hauptversion
+' Nebenversion
+' Buildnummer
+' Revision
+'
+' Sie können alle Werte angeben oder Standardwerte für die Build- und Revisionsnummern verwenden,
+' übernehmen, indem Sie "*" eingeben:
+'
+
+
+
diff --git a/Pilz.Reflection.PluginSystem/My Project/Resources.Designer.vb b/Pilz.Reflection.PluginSystem/My Project/Resources.Designer.vb
new file mode 100644
index 0000000..a3fab67
--- /dev/null
+++ b/Pilz.Reflection.PluginSystem/My Project/Resources.Designer.vb
@@ -0,0 +1,62 @@
+'------------------------------------------------------------------------------
+'
+' This code was generated by a tool.
+' Runtime Version:4.0.30319.42000
+'
+' Changes to this file may cause incorrect behavior and will be lost if
+' the code is regenerated.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
+
+Namespace My.Resources
+
+ 'This class was auto-generated by the StronglyTypedResourceBuilder
+ 'class via a tool like ResGen or Visual Studio.
+ 'To add or remove a member, edit your .ResX file then rerun ResGen
+ 'with the /str option, or rebuild your VS project.
+ '''
+ ''' A strongly-typed resource class, for looking up localized strings, etc.
+ '''
+ _
+ Friend Module Resources
+
+ Private resourceMan As Global.System.Resources.ResourceManager
+
+ Private resourceCulture As Global.System.Globalization.CultureInfo
+
+ '''
+ ''' Returns the cached ResourceManager instance used by this class.
+ '''
+ _
+ Friend ReadOnly Property ResourceManager() As Global.System.Resources.ResourceManager
+ Get
+ If Object.ReferenceEquals(resourceMan, Nothing) Then
+ Dim temp As Global.System.Resources.ResourceManager = New Global.System.Resources.ResourceManager("Pilz.Reflection.PluginSystem.Resources", GetType(Resources).Assembly)
+ resourceMan = temp
+ End If
+ Return resourceMan
+ End Get
+ End Property
+
+ '''
+ ''' Overrides the current thread's CurrentUICulture property for all
+ ''' resource lookups using this strongly typed resource class.
+ '''
+ _
+ Friend Property Culture() As Global.System.Globalization.CultureInfo
+ Get
+ Return resourceCulture
+ End Get
+ Set(ByVal value As Global.System.Globalization.CultureInfo)
+ resourceCulture = value
+ End Set
+ End Property
+ End Module
+End Namespace
diff --git a/Pilz.Reflection.PluginSystem/My Project/Resources.resx b/Pilz.Reflection.PluginSystem/My Project/Resources.resx
new file mode 100644
index 0000000..af7dbeb
--- /dev/null
+++ b/Pilz.Reflection.PluginSystem/My Project/Resources.resx
@@ -0,0 +1,117 @@
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ text/microsoft-resx
+
+
+ 2.0
+
+
+ System.Resources.ResXResourceReader, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089
+
+
+ System.Resources.ResXResourceWriter, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089
+
+
\ No newline at end of file
diff --git a/Pilz.Reflection.PluginSystem/My Project/Settings.Designer.vb b/Pilz.Reflection.PluginSystem/My Project/Settings.Designer.vb
new file mode 100644
index 0000000..6cda84d
--- /dev/null
+++ b/Pilz.Reflection.PluginSystem/My Project/Settings.Designer.vb
@@ -0,0 +1,73 @@
+'------------------------------------------------------------------------------
+'
+' This code was generated by a tool.
+' Runtime Version:4.0.30319.42000
+'
+' Changes to this file may cause incorrect behavior and will be lost if
+' the code is regenerated.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
+
+Namespace My
+
+ _
+ Partial Friend NotInheritable Class MySettings
+ Inherits Global.System.Configuration.ApplicationSettingsBase
+
+ Private Shared defaultInstance As MySettings = CType(Global.System.Configuration.ApplicationSettingsBase.Synchronized(New MySettings), MySettings)
+
+#Region "My.Settings Auto-Save Functionality"
+#If _MyType = "WindowsForms" Then
+ Private Shared addedHandler As Boolean
+
+ Private Shared addedHandlerLockObject As New Object
+
+ _
+ Private Shared Sub AutoSaveSettings(ByVal sender As Global.System.Object, ByVal e As Global.System.EventArgs)
+ If My.Application.SaveMySettingsOnExit Then
+ My.Settings.Save()
+ End If
+ End Sub
+#End If
+#End Region
+
+ Public Shared ReadOnly Property [Default]() As MySettings
+ Get
+
+#If _MyType = "WindowsForms" Then
+ If Not addedHandler Then
+ SyncLock addedHandlerLockObject
+ If Not addedHandler Then
+ AddHandler My.Application.Shutdown, AddressOf AutoSaveSettings
+ addedHandler = True
+ End If
+ End SyncLock
+ End If
+#End If
+ Return defaultInstance
+ End Get
+ End Property
+ End Class
+End Namespace
+
+Namespace My
+
+ _
+ Friend Module MySettingsProperty
+
+ _
+ Friend ReadOnly Property Settings() As Global.Pilz.Reflection.PluginSystem.My.MySettings
+ Get
+ Return Global.Pilz.Reflection.PluginSystem.My.MySettings.Default
+ End Get
+ End Property
+ End Module
+End Namespace
diff --git a/Pilz.Reflection.PluginSystem/My Project/Settings.settings b/Pilz.Reflection.PluginSystem/My Project/Settings.settings
new file mode 100644
index 0000000..85b890b
--- /dev/null
+++ b/Pilz.Reflection.PluginSystem/My Project/Settings.settings
@@ -0,0 +1,7 @@
+
+
+
+
+
+
+
diff --git a/Pilz.Reflection.PluginSystem/Pilz.Reflection.PluginSystem.vbproj b/Pilz.Reflection.PluginSystem/Pilz.Reflection.PluginSystem.vbproj
new file mode 100644
index 0000000..b07f49c
--- /dev/null
+++ b/Pilz.Reflection.PluginSystem/Pilz.Reflection.PluginSystem.vbproj
@@ -0,0 +1,109 @@
+
+
+
+
+ Debug
+ AnyCPU
+ {F7975470-4CA3-4FAB-BB6A-A3AF3978ABB7}
+ Library
+ Pilz.Reflection.PluginSystem
+ Pilz.Reflection.PluginSystem
+ 512
+ Windows
+ v4.5
+ true
+
+
+ true
+ full
+ true
+ true
+ bin\Debug\
+ Pilz.Reflection.PluginSystem.xml
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+
+
+ pdbonly
+ false
+ true
+ true
+ bin\Release\
+ Pilz.Reflection.PluginSystem.xml
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+
+
+ On
+
+
+ Binary
+
+
+ Off
+
+
+ On
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ True
+ Application.myapp
+
+
+ True
+ True
+ Resources.resx
+
+
+ True
+ Settings.settings
+ True
+
+
+
+
+
+
+
+ VbMyResourcesResXFileCodeGenerator
+ Resources.Designer.vb
+ My.Resources
+ Designer
+
+
+
+
+ MyApplicationCodeGenerator
+ Application.Designer.vb
+
+
+ SettingsSingleFileGenerator
+ My
+ Settings.Designer.vb
+
+
+
+
\ No newline at end of file
diff --git a/Pilz.Reflection.PluginSystem/Plugin.vb b/Pilz.Reflection.PluginSystem/Plugin.vb
new file mode 100644
index 0000000..c978598
--- /dev/null
+++ b/Pilz.Reflection.PluginSystem/Plugin.vb
@@ -0,0 +1,118 @@
+Imports System.IO
+Imports System.Reflection
+Imports Pilz.Reflection.PluginSystem.Attributes
+
+Public Class Plugin
+
+ '''
+ ''' A collection of Methods that contains PluginFunctions that will be called automatically when loading the Plugin, as long as the property AutoCallMainFunctions is set to True.
+ '''
+ '''
+ Public ReadOnly Property MainFunctions As IReadOnlyList(Of PluginFunction)
+
+ '''
+ ''' A collection of Methods with a FunctionCode (excluding all PluginFunctions from MainFunctions).
+ '''
+ '''
+ Public ReadOnly Property PluginFunctions As IReadOnlyList(Of PluginFunction)
+
+ '''
+ ''' Load a new Plugin and its PluginFunctions.
+ '''
+ '''
+ ''' If true, all MainMethods of a Plugin will be called as soon as a Plugin is loaded.
+ ''' The name of the type where to search for Methods when loading a new Plugin.
+ Public Sub New(filePath As String, autoCallMainFunction As Boolean, entryTypeName As String)
+ Dim asm As Assembly = Assembly.LoadFile(filePath)
+ Dim modul As Type = asm.GetType(entryTypeName)
+
+ If modul Is Nothing Then
+ Throw New PluginLoadException("Plugin Modul not found!")
+ End If
+
+ 'Define the attribute types to observe
+ Dim entryMethodType As Type = GetType(LoadMethodAttribute)
+ Dim implementMethodType As Type = GetType(PluginFunctionAttribute)
+
+ 'Create the lists
+ Dim mainMethods As New List(Of PluginFunction)
+ Dim implementMethods As New List(Of PluginFunction)
+
+ 'Search for PluginFunctions
+ For Each mi As MethodInfo In modul.GetMethods
+ Dim found As Boolean = False
+
+ 'Check if the method has one of the defined attributes
+ For Each attr As Attribute In Attribute.GetCustomAttributes(mi)
+ If Not found Then
+ Dim t As Type = attr.GetType
+
+ Select Case t
+ Case entryMethodType
+ mainMethods.Add(New PluginFunction(mi, Me))
+
+ Case implementMethodType
+ With CType(attr, PluginFunctionAttribute)
+ implementMethods.Add(New PluginFunction(mi, Me, .Params, .FunctionCode))
+ End With
+
+ End Select
+
+ found = True
+ End If
+ Next
+ Next
+
+ 'Set the collections
+ Me.MainFunctions = mainMethods
+ Me.PluginFunctions = implementMethods
+
+ 'Call all PluginFunctions in MainFunctions
+ If autoCallMainFunction Then
+ For Each func As PluginFunction In mainMethods
+ Dim params As ParameterInfo() = func.Method.GetParameters
+ If params.Length = 1 Then
+ Dim startupExe As String = Assembly.GetEntryAssembly.Location
+ Dim args As String() = {startupExe, filePath}
+ func.Invoke({args})
+ ElseIf Not params.Any Then
+ func.Invoke()
+ End If
+ Next
+ End If
+ End Sub
+
+ '''
+ ''' Get all PluginFunctions that have one of the given function codes.
+ '''
+ '''
+ '''
+ Public Function GetFunctions(ParamArray funcCodes As String()) As IEnumerable(Of PluginFunction)
+ Dim funcs As New List(Of PluginFunction)
+
+ For Each func As PluginFunction In PluginFunctions
+ If funcCodes.Contains(func.FunctionCode) Then
+ funcs.Add(func)
+ End If
+ Next
+
+ Return funcs
+ End Function
+
+ '''
+ ''' Get the first PluginFunction that have the one of the given function codes.
+ '''
+ '''
+ Public Function GetFunction(ParamArray funcCodes As String()) As PluginFunction
+ Dim f As PluginFunction = Nothing
+
+ For Each func As PluginFunction In PluginFunctions
+ If f Is Nothing AndAlso funcCodes.Contains(func.FunctionCode) Then
+ f = func
+ End If
+ Next
+
+ Return f
+ End Function
+
+End Class
diff --git a/Pilz.Reflection.PluginSystem/PluginFunction.vb b/Pilz.Reflection.PluginSystem/PluginFunction.vb
new file mode 100644
index 0000000..28c0b3f
--- /dev/null
+++ b/Pilz.Reflection.PluginSystem/PluginFunction.vb
@@ -0,0 +1,73 @@
+Imports System.Reflection
+
+Public Class PluginFunction
+
+ '''
+ ''' Gets the method to invoke when invoking this PluginFunction.
+ '''
+ '''
+ Public ReadOnly Property Method As MethodInfo
+
+ '''
+ ''' Gets the refered Plugin for this PluginFunction, if it has one.
+ '''
+ '''
+ Public ReadOnly Property Plugin As Plugin
+
+ '''
+ ''' Gets the Parameters that was given by the attribute.
+ '''
+ '''
+ Public ReadOnly Property Params As Object()
+
+ '''
+ ''' Gets the function code for this PluginFunction.
+ '''
+ '''
+ Public ReadOnly Property FunctionCode As String
+
+ '''
+ ''' Creates a new instance of a PluginFunction.
+ '''
+ ''' The Method to invoke when invoking this PluginFunction.
+ ''' The Plugin that is the Parent of this PluginFunction. This value can be NULL.
+ Public Sub New(method As MethodInfo, plugin As Plugin)
+ Me.Method = method
+ Me.Plugin = plugin
+ End Sub
+
+ '''
+ ''' Creates a new instance of a PluginFunction.
+ '''
+ ''' The Method to invoke when invoking this PluginFunction..
+ ''' The Plugin that is the Parent of this PluginFunction. This value can be NULL.
+ ''' The Parameters that was given by the attribute.
+ ''' The function code for this PluginFunction.
+ Public Sub New(method As MethodInfo, plugin As Plugin, params As Object(), funcCode As String)
+ Me.New(method, plugin)
+ Me.Params = params
+ Me.FunctionCode = funcCode
+ End Sub
+
+ '''
+ ''' Invokes the Method of the PluginFunction.
+ '''
+ Public Sub Invoke()
+ Method.Invoke(Nothing, Nothing)
+ End Sub
+
+ '''
+ ''' Invokes the Method of the PluginFunction.
+ '''
+ Public Sub Invoke(ParamArray params As Object())
+ Method.Invoke(Nothing, params)
+ End Sub
+
+ '''
+ ''' Invokes the Method of the PluginFunction and returns the return value.
+ '''
+ Public Function InvokeGet(ParamArray params As Object()) As Object
+ Return Method.Invoke(Nothing, params)
+ End Function
+
+End Class
diff --git a/Pilz.Reflection.PluginSystem/PluginLoadException.vb b/Pilz.Reflection.PluginSystem/PluginLoadException.vb
new file mode 100644
index 0000000..fef7f10
--- /dev/null
+++ b/Pilz.Reflection.PluginSystem/PluginLoadException.vb
@@ -0,0 +1,11 @@
+Public Class PluginLoadException
+ Inherits Exception
+
+ Public Sub New()
+ MyBase.New
+ End Sub
+
+ Public Sub New(message As String)
+ MyBase.New(message)
+ End Sub
+End Class
diff --git a/Pilz.Reflection.PluginSystem/PluginManager.vb b/Pilz.Reflection.PluginSystem/PluginManager.vb
new file mode 100644
index 0000000..c7acaa8
--- /dev/null
+++ b/Pilz.Reflection.PluginSystem/PluginManager.vb
@@ -0,0 +1,129 @@
+Imports System.IO
+
+Public Class PluginManager
+
+ '''
+ ''' The name of the type where to search for Methods when loading a new Plugin.
+ '''
+ '''
+ Public Property EntryTypeName As String = "Plugin"
+
+ '''
+ ''' If true, all MainMethods of a Plugin will be called as soon as a Plugin is loaded.
+ '''
+ '''
+ Public Property AutoCallMainFunctions As Boolean = True
+
+ '''
+ ''' A collection of all loaded Plugins.
+ '''
+ '''
+ Public ReadOnly Property Plugins As New Dictionary(Of String, Plugin)
+
+ '''
+ ''' Loads Plugins that can be found at the given path and adds them to the Plugins-List.
+ '''
+ ''' The path where to search for Plugins to load.
+ Public Function LoadPlugins(pluginPath As String) As IEnumerable(Of Plugin)
+ Return LoadPlugins(pluginPath, True)
+ End Function
+
+ '''
+ ''' Loads Plugins that can be found at the given path and adds them to the Plugins-List.
+ '''
+ ''' The path where to search for Plugins to load.
+ ''' If true, the Plugins will be added to Plugins-List after loading.
+ Public Function LoadPlugins(pluginPath As String, addToList As Boolean) As IEnumerable(Of Plugin)
+ Return LoadPlugins(pluginPath, addToList, AutoCallMainFunctions, EntryTypeName)
+ End Function
+
+ '''
+ ''' Loads Plugins that can be found at the given path and adds them to the Plugins-List.
+ '''
+ ''' The path where to search for Plugins to load.
+ ''' If true, the Plugins will be added to Plugins-List after loading.
+ ''' If true, all MainMethods of a Plugin will be called as soon as a Plugin is loaded.
+ ''' The name of the type where to search for Methods when loading a new Plugin.
+ Public Function LoadPlugins(pluginPath As String, addToList As Boolean, autoCallMainFunction As Boolean, entryTypeName As String) As IEnumerable(Of Plugin)
+ Dim loaded As New List(Of Plugin)
+
+ For Each f As String In Directory.GetFiles(pluginPath, "*.dll", SearchOption.AllDirectories)
+ Dim p As Plugin = LoadPlugin(f, addToList)
+ If p IsNot Nothing Then
+ loaded.Add(p)
+ End If
+ Next
+
+ Return loaded
+ End Function
+
+ '''
+ ''' Loads a Plugin and adds it to the Plugins-List.
+ '''
+ ''' The path to the plugin to load.
+ ''' If true, the Plugin will be added to Plugins-List after loading.
+ Public Function LoadPlugin(filePath As String, addToList As Boolean) As Plugin
+ Return LoadPlugin(filePath, addToList, AutoCallMainFunctions, EntryTypeName)
+ End Function
+
+ '''
+ ''' Loads a Plugin and adds it to the Plugins-List.
+ '''
+ ''' The path to the plugin to load.
+ ''' If true, the Plugin will be added to Plugins-List after loading.
+ ''' If true, all MainMethods of a Plugin will be called as soon as a Plugin is loaded.
+ ''' The name of the type where to search for Methods when loading a new Plugin.
+ Public Function LoadPlugin(filePath As String, addToList As Boolean, autoCallMainFunction As Boolean, entryTypeName As String) As Plugin
+ Try
+ Dim plugin As New Plugin(filePath, autoCallMainFunction, entryTypeName)
+ If addToList Then Plugins.Add(filePath, plugin)
+ Return plugin
+ Catch ex As Exception
+ Return Nothing
+ End Try
+ End Function
+
+ '''
+ ''' Loads a Plugin and adds it to the Plugins-List.
+ '''
+ ''' The path to the plugin to load.
+ Public Function LoadPlugin(filePath As String) As Plugin
+ Return LoadPlugin(filePath, True)
+ End Function
+
+ '''
+ ''' Get all PluginFunctions that have one of the given function codes.
+ '''
+ '''
+ '''
+ Public Function GetFunctions(ParamArray funcCodes As String()) As IEnumerable(Of PluginFunction)
+ Dim list As New List(Of PluginFunction)
+
+ For Each kvp In Plugins
+ list.AddRange(kvp.Value.GetFunctions(funcCodes))
+ Next
+
+ Return list
+ End Function
+
+ '''
+ ''' Get the first PluginFunction that have the one of the given function codes.
+ '''
+ '''
+ Public Function GetFunction(ParamArray funcCodes As String()) As PluginFunction
+ Dim f As PluginFunction = Nothing
+
+ For Each kvp In Plugins
+ If f Is Nothing Then
+ For Each func As PluginFunction In kvp.Value.GetFunctions(funcCodes)
+ If f Is Nothing Then
+ f = func
+ End If
+ Next
+ End If
+ Next
+
+ Return f
+ End Function
+
+End Class
diff --git a/Pilz.Threading/CrossThreadsInvokeing.vb b/Pilz.Threading/CrossThreadsInvokeing.vb
new file mode 100644
index 0000000..a37f0ae
--- /dev/null
+++ b/Pilz.Threading/CrossThreadsInvokeing.vb
@@ -0,0 +1,65 @@
+'IDE-Voreinstellungen:
+'Option Explicit On
+'Option Strict On
+
+'"My Project"-Einstellungen:
+'Imports Microsoft.VisualBasic.ControlChars
+'Imports System.Windows.Forms
+'Imports System
+
+Imports System.Windows.Forms
+
+'''
+''' Stellt Methoden bereit, mit denen ein beliebiger Methoden-Aufruf mit bis zu 3 Argumenten
+''' in einen Nebenthread verlegt werden kann, bzw. aus einem Nebenthread in den Hauptthread
+'''
+Public Class CrossThreadsInvokeing
+
+ Public Shared Sub RunAsync(Of T1, T2, T3)(ByVal Action As Action(Of T1, T2, T3), ByVal Arg1 As T1, ByVal Arg2 As T2, ByVal Arg3 As T3)
+ ' Aufruf von Action.EndInvoke() gewährleisten, indem er als Callback-Argument mitgegeben wird
+ Action.BeginInvoke(Arg1, Arg2, Arg3, AddressOf Action.EndInvoke, Nothing)
+ End Sub
+ Public Shared Sub RunAsync(Of T1, T2)(ByVal Action As Action(Of T1, T2), ByVal Arg1 As T1, ByVal Arg2 As T2)
+ Action.BeginInvoke(Arg1, Arg2, AddressOf Action.EndInvoke, Nothing)
+ End Sub
+ Public Shared Sub RunAsync(Of T1)(ByVal Action As Action(Of T1), ByVal Arg1 As T1)
+ Action.BeginInvoke(Arg1, AddressOf Action.EndInvoke, Nothing)
+ End Sub
+ Public Shared Sub RunAsync(ByVal Action As Action)
+ Action.BeginInvoke(AddressOf Action.EndInvoke, Nothing)
+ End Sub
+
+ Private Shared Function GuiCrossInvoke(ByVal Action As [Delegate], ByVal ParamArray Args() As Object) As Boolean
+ Dim frms As FormCollection = Application.OpenForms
+
+ 'If frms.Count = 0 Then
+ ' 'wenn kein Form mehr da ist, so tun, als ob das Invoking ausgeführt wäre
+ ' Return True
+ 'ElseIf frms(0).InvokeRequired Then
+ 'frms(0).BeginInvoke(Action, Args)
+ 'Return True
+ 'End If
+
+ If frms.Count > 0 AndAlso frms(0).InvokeRequired Then
+ frms(0).BeginInvoke(Action, Args)
+ Return True
+ End If
+
+ Return False
+ End Function
+
+ Public Shared Sub RunGui(Of T1, T2, T3)(ByVal Action As Action(Of T1, T2, T3), ByVal Arg1 As T1, ByVal Arg2 As T2, ByVal Arg3 As T3)
+ 'falls Invoking nicht erforderlich, die Action direkt ausführen
+ If Not GuiCrossInvoke(Action, Arg1, Arg2, Arg3) Then Action(Arg1, Arg2, Arg3)
+ End Sub
+ Public Shared Sub RunGui(Of T1, T2)(ByVal Action As Action(Of T1, T2), ByVal Arg1 As T1, ByVal Arg2 As T2)
+ If Not GuiCrossInvoke(Action, Arg1, Arg2) Then Action(Arg1, Arg2)
+ End Sub
+ Public Shared Sub RunGui(Of T1)(ByVal Action As Action(Of T1), ByVal Arg1 As T1)
+ If Not GuiCrossInvoke(Action, Arg1) Then Action(Arg1)
+ End Sub
+ Public Shared Sub RunGui(ByVal Action As Action)
+ If Not GuiCrossInvoke(Action) Then Action()
+ End Sub
+
+End Class
diff --git a/Pilz.Threading/My Project/Application.Designer.vb b/Pilz.Threading/My Project/Application.Designer.vb
new file mode 100644
index 0000000..8ab460b
--- /dev/null
+++ b/Pilz.Threading/My Project/Application.Designer.vb
@@ -0,0 +1,13 @@
+'------------------------------------------------------------------------------
+'
+' Dieser Code wurde von einem Tool generiert.
+' Laufzeitversion:4.0.30319.42000
+'
+' Änderungen an dieser Datei können falsches Verhalten verursachen und gehen verloren, wenn
+' der Code erneut generiert wird.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
diff --git a/Pilz.Threading/My Project/Application.myapp b/Pilz.Threading/My Project/Application.myapp
new file mode 100644
index 0000000..758895d
--- /dev/null
+++ b/Pilz.Threading/My Project/Application.myapp
@@ -0,0 +1,10 @@
+
+
+ false
+ false
+ 0
+ true
+ 0
+ 1
+ true
+
diff --git a/Pilz.Threading/My Project/AssemblyInfo.vb b/Pilz.Threading/My Project/AssemblyInfo.vb
new file mode 100644
index 0000000..4418d63
--- /dev/null
+++ b/Pilz.Threading/My Project/AssemblyInfo.vb
@@ -0,0 +1,35 @@
+Imports System
+Imports System.Reflection
+Imports System.Runtime.InteropServices
+
+' Allgemeine Informationen über eine Assembly werden über die folgenden
+' Attribute gesteuert. Ändern Sie diese Attributwerte, um die Informationen zu ändern,
+' die einer Assembly zugeordnet sind.
+
+' Werte der Assemblyattribute überprüfen
+
+
+
+
+
+
+
+
+
+
+'Die folgende GUID bestimmt die ID der Typbibliothek, wenn dieses Projekt für COM verfügbar gemacht wird.
+
+
+' Versionsinformationen für eine Assembly bestehen aus den folgenden vier Werten:
+'
+' Hauptversion
+' Nebenversion
+' Buildnummer
+' Revision
+'
+' Sie können alle Werte angeben oder Standardwerte für die Build- und Revisionsnummern verwenden,
+' übernehmen, indem Sie "*" eingeben:
+'
+
+
+
diff --git a/Pilz.Threading/My Project/Resources.Designer.vb b/Pilz.Threading/My Project/Resources.Designer.vb
new file mode 100644
index 0000000..cd77810
--- /dev/null
+++ b/Pilz.Threading/My Project/Resources.Designer.vb
@@ -0,0 +1,63 @@
+'------------------------------------------------------------------------------
+'
+' Dieser Code wurde von einem Tool generiert.
+' Laufzeitversion:4.0.30319.42000
+'
+' Änderungen an dieser Datei können falsches Verhalten verursachen und gehen verloren, wenn
+' der Code erneut generiert wird.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
+Imports System
+
+Namespace My.Resources
+
+ 'Diese Klasse wurde von der StronglyTypedResourceBuilder automatisch generiert
+ '-Klasse über ein Tool wie ResGen oder Visual Studio automatisch generiert.
+ 'Um einen Member hinzuzufügen oder zu entfernen, bearbeiten Sie die .ResX-Datei und führen dann ResGen
+ 'mit der /str-Option erneut aus, oder Sie erstellen Ihr VS-Projekt neu.
+ '''
+ ''' Eine stark typisierte Ressourcenklasse zum Suchen von lokalisierten Zeichenfolgen usw.
+ '''
+ _
+ Friend Module Resources
+
+ Private resourceMan As Global.System.Resources.ResourceManager
+
+ Private resourceCulture As Global.System.Globalization.CultureInfo
+
+ '''
+ ''' Gibt die zwischengespeicherte ResourceManager-Instanz zurück, die von dieser Klasse verwendet wird.
+ '''
+ _
+ Friend ReadOnly Property ResourceManager() As Global.System.Resources.ResourceManager
+ Get
+ If Object.ReferenceEquals(resourceMan, Nothing) Then
+ Dim temp As Global.System.Resources.ResourceManager = New Global.System.Resources.ResourceManager("Pilz.Threading.Resources", GetType(Resources).Assembly)
+ resourceMan = temp
+ End If
+ Return resourceMan
+ End Get
+ End Property
+
+ '''
+ ''' Überschreibt die CurrentUICulture-Eigenschaft des aktuellen Threads für alle
+ ''' Ressourcenzuordnungen, die diese stark typisierte Ressourcenklasse verwenden.
+ '''
+ _
+ Friend Property Culture() As Global.System.Globalization.CultureInfo
+ Get
+ Return resourceCulture
+ End Get
+ Set
+ resourceCulture = value
+ End Set
+ End Property
+ End Module
+End Namespace
diff --git a/Pilz.Threading/My Project/Resources.resx b/Pilz.Threading/My Project/Resources.resx
new file mode 100644
index 0000000..af7dbeb
--- /dev/null
+++ b/Pilz.Threading/My Project/Resources.resx
@@ -0,0 +1,117 @@
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ text/microsoft-resx
+
+
+ 2.0
+
+
+ System.Resources.ResXResourceReader, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089
+
+
+ System.Resources.ResXResourceWriter, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089
+
+
\ No newline at end of file
diff --git a/Pilz.Threading/My Project/Settings.Designer.vb b/Pilz.Threading/My Project/Settings.Designer.vb
new file mode 100644
index 0000000..6a2281a
--- /dev/null
+++ b/Pilz.Threading/My Project/Settings.Designer.vb
@@ -0,0 +1,73 @@
+'------------------------------------------------------------------------------
+'
+' Dieser Code wurde von einem Tool generiert.
+' Laufzeitversion:4.0.30319.42000
+'
+' Änderungen an dieser Datei können falsches Verhalten verursachen und gehen verloren, wenn
+' der Code erneut generiert wird.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
+
+Namespace My
+
+ _
+ Partial Friend NotInheritable Class MySettings
+ Inherits Global.System.Configuration.ApplicationSettingsBase
+
+ Private Shared defaultInstance As MySettings = CType(Global.System.Configuration.ApplicationSettingsBase.Synchronized(New MySettings()),MySettings)
+
+#Region "Automatische My.Settings-Speicherfunktion"
+#If _MyType = "WindowsForms" Then
+ Private Shared addedHandler As Boolean
+
+ Private Shared addedHandlerLockObject As New Object
+
+ _
+ Private Shared Sub AutoSaveSettings(sender As Global.System.Object, e As Global.System.EventArgs)
+ If My.Application.SaveMySettingsOnExit Then
+ My.Settings.Save()
+ End If
+ End Sub
+#End If
+#End Region
+
+ Public Shared ReadOnly Property [Default]() As MySettings
+ Get
+
+#If _MyType = "WindowsForms" Then
+ If Not addedHandler Then
+ SyncLock addedHandlerLockObject
+ If Not addedHandler Then
+ AddHandler My.Application.Shutdown, AddressOf AutoSaveSettings
+ addedHandler = True
+ End If
+ End SyncLock
+ End If
+#End If
+ Return defaultInstance
+ End Get
+ End Property
+ End Class
+End Namespace
+
+Namespace My
+
+ _
+ Friend Module MySettingsProperty
+
+ _
+ Friend ReadOnly Property Settings() As Global.Pilz.Threading.My.MySettings
+ Get
+ Return Global.Pilz.Threading.My.MySettings.Default
+ End Get
+ End Property
+ End Module
+End Namespace
diff --git a/Pilz.Threading/My Project/Settings.settings b/Pilz.Threading/My Project/Settings.settings
new file mode 100644
index 0000000..85b890b
--- /dev/null
+++ b/Pilz.Threading/My Project/Settings.settings
@@ -0,0 +1,7 @@
+
+
+
+
+
+
+
diff --git a/Pilz.Threading/Pilz.Threading.vbproj b/Pilz.Threading/Pilz.Threading.vbproj
new file mode 100644
index 0000000..5d6f578
--- /dev/null
+++ b/Pilz.Threading/Pilz.Threading.vbproj
@@ -0,0 +1,127 @@
+
+
+
+
+ Debug
+ AnyCPU
+ {D9C8655E-4F1C-4348-A51C-AB00FD9A14BB}
+ Library
+ Pilz.Threading
+ Pilz.Threading
+ 512
+ Windows
+ v4.5
+ true
+
+
+ true
+ full
+ true
+ true
+ bin\Debug\
+ Pilz.Threading.xml
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+
+
+ pdbonly
+ false
+ true
+ true
+ bin\Release\
+ Pilz.Threading.xml
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+
+
+ On
+
+
+ Binary
+
+
+ Off
+
+
+ On
+
+
+ true
+ true
+ true
+ bin\x86\Debug\
+ Pilz.Threading.xml
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+ full
+ x86
+ MinimumRecommendedRules.ruleset
+ true
+
+
+ true
+ bin\x86\Release\
+ Pilz.Threading.xml
+ true
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+ pdbonly
+ x86
+ MinimumRecommendedRules.ruleset
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ True
+ Application.myapp
+
+
+ True
+ True
+ Resources.resx
+
+
+ True
+ Settings.settings
+ True
+
+
+
+
+ VbMyResourcesResXFileCodeGenerator
+ Resources.Designer.vb
+ My.Resources
+ Designer
+
+
+
+
+ MyApplicationCodeGenerator
+ Application.Designer.vb
+
+
+ SettingsSingleFileGenerator
+ My
+ Settings.Designer.vb
+
+
+
+
\ No newline at end of file
diff --git a/Pilz.UI/My Project/Application.Designer.vb b/Pilz.UI/My Project/Application.Designer.vb
new file mode 100644
index 0000000..8ab460b
--- /dev/null
+++ b/Pilz.UI/My Project/Application.Designer.vb
@@ -0,0 +1,13 @@
+'------------------------------------------------------------------------------
+'
+' Dieser Code wurde von einem Tool generiert.
+' Laufzeitversion:4.0.30319.42000
+'
+' Änderungen an dieser Datei können falsches Verhalten verursachen und gehen verloren, wenn
+' der Code erneut generiert wird.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
diff --git a/Pilz.UI/My Project/Application.myapp b/Pilz.UI/My Project/Application.myapp
new file mode 100644
index 0000000..758895d
--- /dev/null
+++ b/Pilz.UI/My Project/Application.myapp
@@ -0,0 +1,10 @@
+
+
+ false
+ false
+ 0
+ true
+ 0
+ 1
+ true
+
diff --git a/Pilz.UI/My Project/AssemblyInfo.vb b/Pilz.UI/My Project/AssemblyInfo.vb
new file mode 100644
index 0000000..31f117b
--- /dev/null
+++ b/Pilz.UI/My Project/AssemblyInfo.vb
@@ -0,0 +1,35 @@
+Imports System
+Imports System.Reflection
+Imports System.Runtime.InteropServices
+
+' Allgemeine Informationen über eine Assembly werden über die folgenden
+' Attribute gesteuert. Ändern Sie diese Attributwerte, um die Informationen zu ändern,
+' die einer Assembly zugeordnet sind.
+
+' Werte der Assemblyattribute überprüfen
+
+
+
+
+
+
+
+
+
+
+'Die folgende GUID bestimmt die ID der Typbibliothek, wenn dieses Projekt für COM verfügbar gemacht wird.
+
+
+' Versionsinformationen für eine Assembly bestehen aus den folgenden vier Werten:
+'
+' Hauptversion
+' Nebenversion
+' Buildnummer
+' Revision
+'
+' Sie können alle Werte angeben oder Standardwerte für die Build- und Revisionsnummern verwenden,
+' übernehmen, indem Sie "*" eingeben:
+'
+
+
+
diff --git a/Pilz.UI/My Project/Resources.Designer.vb b/Pilz.UI/My Project/Resources.Designer.vb
new file mode 100644
index 0000000..b6cfcb8
--- /dev/null
+++ b/Pilz.UI/My Project/Resources.Designer.vb
@@ -0,0 +1,63 @@
+'------------------------------------------------------------------------------
+'
+' Dieser Code wurde von einem Tool generiert.
+' Laufzeitversion:4.0.30319.42000
+'
+' Änderungen an dieser Datei können falsches Verhalten verursachen und gehen verloren, wenn
+' der Code erneut generiert wird.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
+Imports System
+
+Namespace My.Resources
+
+ 'Diese Klasse wurde von der StronglyTypedResourceBuilder automatisch generiert
+ '-Klasse über ein Tool wie ResGen oder Visual Studio automatisch generiert.
+ 'Um einen Member hinzuzufügen oder zu entfernen, bearbeiten Sie die .ResX-Datei und führen dann ResGen
+ 'mit der /str-Option erneut aus, oder Sie erstellen Ihr VS-Projekt neu.
+ '''
+ ''' Eine stark typisierte Ressourcenklasse zum Suchen von lokalisierten Zeichenfolgen usw.
+ '''
+ _
+ Friend Module Resources
+
+ Private resourceMan As Global.System.Resources.ResourceManager
+
+ Private resourceCulture As Global.System.Globalization.CultureInfo
+
+ '''
+ ''' Gibt die zwischengespeicherte ResourceManager-Instanz zurück, die von dieser Klasse verwendet wird.
+ '''
+ _
+ Friend ReadOnly Property ResourceManager() As Global.System.Resources.ResourceManager
+ Get
+ If Object.ReferenceEquals(resourceMan, Nothing) Then
+ Dim temp As Global.System.Resources.ResourceManager = New Global.System.Resources.ResourceManager("Pilz.UI.Resources", GetType(Resources).Assembly)
+ resourceMan = temp
+ End If
+ Return resourceMan
+ End Get
+ End Property
+
+ '''
+ ''' Überschreibt die CurrentUICulture-Eigenschaft des aktuellen Threads für alle
+ ''' Ressourcenzuordnungen, die diese stark typisierte Ressourcenklasse verwenden.
+ '''
+ _
+ Friend Property Culture() As Global.System.Globalization.CultureInfo
+ Get
+ Return resourceCulture
+ End Get
+ Set
+ resourceCulture = value
+ End Set
+ End Property
+ End Module
+End Namespace
diff --git a/Pilz.UI/My Project/Resources.resx b/Pilz.UI/My Project/Resources.resx
new file mode 100644
index 0000000..af7dbeb
--- /dev/null
+++ b/Pilz.UI/My Project/Resources.resx
@@ -0,0 +1,117 @@
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ text/microsoft-resx
+
+
+ 2.0
+
+
+ System.Resources.ResXResourceReader, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089
+
+
+ System.Resources.ResXResourceWriter, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089
+
+
\ No newline at end of file
diff --git a/Pilz.UI/My Project/Settings.Designer.vb b/Pilz.UI/My Project/Settings.Designer.vb
new file mode 100644
index 0000000..d282691
--- /dev/null
+++ b/Pilz.UI/My Project/Settings.Designer.vb
@@ -0,0 +1,73 @@
+'------------------------------------------------------------------------------
+'
+' Dieser Code wurde von einem Tool generiert.
+' Laufzeitversion:4.0.30319.42000
+'
+' Änderungen an dieser Datei können falsches Verhalten verursachen und gehen verloren, wenn
+' der Code erneut generiert wird.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
+
+Namespace My
+
+ _
+ Partial Friend NotInheritable Class MySettings
+ Inherits Global.System.Configuration.ApplicationSettingsBase
+
+ Private Shared defaultInstance As MySettings = CType(Global.System.Configuration.ApplicationSettingsBase.Synchronized(New MySettings()),MySettings)
+
+#Region "Automatische My.Settings-Speicherfunktion"
+#If _MyType = "WindowsForms" Then
+ Private Shared addedHandler As Boolean
+
+ Private Shared addedHandlerLockObject As New Object
+
+ _
+ Private Shared Sub AutoSaveSettings(sender As Global.System.Object, e As Global.System.EventArgs)
+ If My.Application.SaveMySettingsOnExit Then
+ My.Settings.Save()
+ End If
+ End Sub
+#End If
+#End Region
+
+ Public Shared ReadOnly Property [Default]() As MySettings
+ Get
+
+#If _MyType = "WindowsForms" Then
+ If Not addedHandler Then
+ SyncLock addedHandlerLockObject
+ If Not addedHandler Then
+ AddHandler My.Application.Shutdown, AddressOf AutoSaveSettings
+ addedHandler = True
+ End If
+ End SyncLock
+ End If
+#End If
+ Return defaultInstance
+ End Get
+ End Property
+ End Class
+End Namespace
+
+Namespace My
+
+ _
+ Friend Module MySettingsProperty
+
+ _
+ Friend ReadOnly Property Settings() As Global.Pilz.UI.My.MySettings
+ Get
+ Return Global.Pilz.UI.My.MySettings.Default
+ End Get
+ End Property
+ End Module
+End Namespace
diff --git a/Pilz.UI/My Project/Settings.settings b/Pilz.UI/My Project/Settings.settings
new file mode 100644
index 0000000..85b890b
--- /dev/null
+++ b/Pilz.UI/My Project/Settings.settings
@@ -0,0 +1,7 @@
+
+
+
+
+
+
+
diff --git a/Pilz.UI/PaintingControl/DefaultDrawMethodes.vb b/Pilz.UI/PaintingControl/DefaultDrawMethodes.vb
new file mode 100644
index 0000000..09bb875
--- /dev/null
+++ b/Pilz.UI/PaintingControl/DefaultDrawMethodes.vb
@@ -0,0 +1,220 @@
+Imports System.Drawing
+Imports System.Drawing.Drawing2D
+Imports System.Windows.Forms
+Imports Pilz.Drawing
+
+'''
+''' Contains static methods that are used for the standart PaintingObject Types.
+'''
+Public Class DefaultDrawMethodes
+
+ Public Shared Sub DrawText(e As PaintingObjectPaintEventArgs)
+ Dim obj As PaintingObject = e.PaintingObject
+ Dim b As New SolidBrush(obj.TextColor)
+ Dim p As New PointF
+ Dim rect As New Rectangle(e.X, e.Y, obj.Width, obj.Height)
+
+ Dim f As StringFormat = StringFormat.GenericDefault
+ f.Alignment = obj.HorizontalTextAlignment
+ f.LineAlignment = obj.VerticalTextAlignment
+
+ Dim zoomFactor As Single
+ If obj.Parent Is Nothing Then
+ zoomFactor = 1.0!
+ Else
+ zoomFactor = obj.Parent.ZoomFactor.Width
+ End If
+
+ e.Graphics.DrawString(obj.Text, New Font(obj.TextFont.FontFamily, obj.TextFont.Size * zoomFactor, obj.TextFont.Style), b, rect, f)
+ End Sub
+
+ Public Shared Sub DrawPicture(e As PaintingObjectPaintEventArgs)
+ Dim obj As PaintingObject = e.PaintingObject
+ Dim objImg As Image
+ Dim result As RectangleF
+ Dim image As Bitmap
+
+ SyncLock e.PaintingObject.Parent
+ If obj?.Image Is Nothing Then Return
+ objImg = obj.Image
+ End SyncLock
+
+ image = obj.BufferedImage
+ result = CalculateImageResolution(obj, objImg.Size)
+
+ If obj.ImageProperties.Rotate = 90 OrElse obj.ImageProperties.Rotate = 270 Then
+ result = CalculateImageResolution(obj, New SizeF(objImg.Size.Height, objImg.Size.Width))
+ Else
+ result = result
+ End If
+
+ If image Is Nothing Then
+ Dim needRescaleImageBecauseRot As Boolean = False
+
+ image = DrawToNewImage(objImg, result.Size)
+
+ Select Case obj.ImageProperties.Rotate
+ Case 90
+ image.RotateFlip(RotateFlipType.Rotate90FlipNone)
+ needRescaleImageBecauseRot = True
+ Case 180
+ image.RotateFlip(RotateFlipType.Rotate180FlipNone)
+ Case 270
+ image.RotateFlip(RotateFlipType.Rotate270FlipNone)
+ needRescaleImageBecauseRot = True
+ End Select
+ If obj.ImageProperties.FlipX Then
+ image.RotateFlip(RotateFlipType.RotateNoneFlipX)
+ End If
+ If obj.ImageProperties.FlipY Then
+ image.RotateFlip(RotateFlipType.RotateNoneFlipY)
+ End If
+
+ If needRescaleImageBecauseRot Then
+ result = CalculateImageResolution(obj, New SizeF(objImg.Size.Height, objImg.Size.Width))
+ image = DrawToNewImage(image, result.Size)
+ End If
+
+ obj.BufferedImage = image
+ End If
+
+ If image IsNot Nothing Then
+ e.Graphics.DrawImageUnscaled(image, New Rectangle(New Point(obj.Location.X + result.Location.X - e.Offset.X, obj.Location.Y + result.Location.Y - e.Offset.Y), result.Size.ToSize))
+ End If
+ End Sub
+
+ Private Shared Function DrawToNewImage(image As Bitmap, newSize As SizeF) As Bitmap
+ Dim bmp As New Bitmap(CInt(newSize.Width), CInt(newSize.Height))
+ Dim gimage As Graphics = Graphics.FromImage(bmp)
+ gimage.SmoothingMode = SmoothingMode.HighQuality
+ gimage.PixelOffsetMode = PixelOffsetMode.HighQuality
+ gimage.PageUnit = GraphicsUnit.Pixel
+ gimage.InterpolationMode = InterpolationMode.HighQualityBicubic
+ gimage.DrawImage(image, New RectangleF(PointF.Empty, newSize))
+ gimage.Dispose()
+ Return bmp
+ End Function
+
+ Public Shared Sub DrawLine(e As PaintingObjectPaintEventArgs)
+ Dim obj As PaintingObject = e.PaintingObject
+ Dim p2 As New Pen(obj.OutlineColor, obj.OutlineThicknes) With {.DashStyle = obj.OutlineDashStyle}
+ p2.Alignment = PenAlignment.Center
+ Dim no As PointF = New PointF(e.X, e.Y)
+ e.Graphics.DrawLine(p2, no, no + obj.Size)
+ End Sub
+
+ Private Shared Function CalculateImageResolution(obj As PaintingObject, imageSize As SizeF) As RectangleF
+ Dim result As New RectangleF
+ Dim objrect As New RectangleF(obj.Location, obj.Size)
+ Dim size As SizeF = imageSize
+ Dim clientRectangle As RectangleF = objrect
+ Dim val As Single = clientRectangle.Width / size.Width
+
+ clientRectangle = objrect
+ Dim num As Single = Math.Min(val, clientRectangle.Height / size.Height)
+
+ result.Width = CInt(Math.Truncate(size.Width * num))
+ result.Height = CInt(Math.Truncate(size.Height * num))
+
+ clientRectangle = objrect
+ result.X = (clientRectangle.Width - result.Width) \ 2
+
+ clientRectangle = objrect
+ result.Y = (clientRectangle.Height - result.Height) \ 2
+
+ Return result
+ End Function
+
+ Public Shared Sub DrawTriangle(e As PaintingObjectPaintEventArgs)
+ Dim obj As PaintingObject = e.PaintingObject
+
+ If obj.EnableFill Then
+ Dim b As New SolidBrush(obj.FillColor)
+ Dim p1 As New Point(obj.Size.Width / 2 + e.X, e.Y)
+ Dim p2 As New Point(e.X, e.Y + obj.Size.Height)
+ Dim p3 As New Point(e.X + obj.Size.Width, e.Y + obj.Size.Height)
+ e.Graphics.FillPolygon(b, {p1, p2, p3})
+ End If
+
+ If obj.EnableOutline Then
+ Dim lw As Single = obj.OutlineThicknes
+ Dim p As New Pen(obj.OutlineColor, obj.OutlineThicknes) With {.DashStyle = obj.OutlineDashStyle, .Alignment = PenAlignment.Inset}
+ Dim p1 As New Point(obj.Size.Width / 2 + e.X, e.Y)
+ Dim p2 As New Point(e.X, e.Y + obj.Size.Height)
+ Dim p3 As New Point(e.X + obj.Size.Width, e.Y + obj.Size.Height)
+ e.Graphics.DrawPolygon(p, {p1, p2, p3})
+ End If
+ End Sub
+
+ Public Shared Sub DrawRectangle(e As PaintingObjectPaintEventArgs)
+ Dim obj As PaintingObject = e.PaintingObject
+ Dim hol As Single = obj.OutlineThicknes / 2
+
+ If obj.EnableFill Then
+ Dim b As New SolidBrush(obj.FillColor)
+ Dim rect As Rectangle = If(obj.EnableOutline,
+ New Rectangle(e.X + hol, e.Y + hol, obj.Size.Width - hol * 2, obj.Size.Height - hol * 2),
+ New Rectangle(e.X, e.Y, obj.Size.Width, obj.Size.Height))
+ e.Graphics.FillRectangle(b, rect)
+ End If
+
+ If obj.EnableOutline Then
+ Dim p As New Pen(obj.OutlineColor, obj.OutlineThicknes) With {.DashStyle = obj.OutlineDashStyle, .Alignment = PenAlignment.Inset}
+ Dim rect As New Rectangle(e.X, e.Y, obj.Size.Width, obj.Size.Height)
+ e.Graphics.DrawRectangle(p, rect)
+ End If
+ End Sub
+
+ Public Shared Sub DrawEllipse(e As PaintingObjectPaintEventArgs)
+ Dim obj As PaintingObject = e.PaintingObject
+
+ If obj.EnableFill Then
+ Dim b As New SolidBrush(obj.FillColor)
+ Dim rect As Rectangle = New Rectangle(e.X, e.Y, obj.Size.Width, obj.Size.Height)
+ e.Graphics.FillEllipse(b, rect)
+ End If
+
+ If obj.EnableOutline Then
+ Dim p As New Pen(obj.OutlineColor, obj.OutlineThicknes) With {.DashStyle = obj.OutlineDashStyle, .Alignment = PenAlignment.Inset}
+ Dim rect As New Rectangle(e.X, e.Y, obj.Size.Width, obj.Size.Height)
+ e.Graphics.DrawEllipse(p, rect)
+ End If
+ End Sub
+
+ Public Shared Sub DrawSelection(e As PaintingObjectPaintEventArgs)
+ Dim obj As PaintingObject = e.PaintingObject
+ Dim lw As Single = 2.5!
+ Dim hlw As Single = lw / 2
+ Dim hlwphol As Single = hlw '+ hol
+ Dim hlwpholm2 As Single = hlwphol * 2
+
+ Dim p As New Pen(Color.CornflowerBlue, lw) With {.DashStyle = obj.SelectionDashStyle, .Alignment = PenAlignment.Outset}
+ Dim rect As New Rectangle(e.X - hlwphol, e.Y - hlwphol, obj.Size.Width + hlwpholm2, obj.Size.Height + hlwpholm2)
+ e.Graphics.DrawRectangle(p, rect)
+ End Sub
+
+ Public Shared Sub DrawGrid(e As PaintEventArgs, pc As PaintingControl, offset As PointF)
+ Dim p As New Pen(pc.GridColor, 0.5)
+
+ Dim curX As Integer = pc.GridChunkSize.Width * pc.ZoomFactor.Width - offset.X
+ Do While curX < pc.Width
+ e.Graphics.DrawLine(p, curX, -offset.Y, curX, pc.Height)
+ curX += (pc.GridChunkSize.Width * pc.ZoomFactor.Width)
+ Loop
+
+ Dim curY As Integer = pc.GridChunkSize.Height * pc.ZoomFactor.Height - offset.Y
+ Do While curY < pc.Height
+ e.Graphics.DrawLine(p, -offset.X, curY, pc.Width, curY)
+ curY += (pc.GridChunkSize.Height * pc.ZoomFactor.Height)
+ Loop
+ End Sub
+
+ Public Shared Sub DrawAreaSelection(e As PaintEventArgs, pc As PaintingControl, startMousePos As PointF, lastMousePos As PointF)
+ Dim p As New Pen(pc.AreaSelectionColor)
+ p.DashStyle = DashStyle.DashDot
+ p.Width = 3
+ Dim rectToDraw As RectangleF = HelpfulDrawingFunctions.GetRectangle(startMousePos, lastMousePos)
+ e.Graphics.DrawRectangle(p, rectToDraw.X, rectToDraw.Y, rectToDraw.Width, rectToDraw.Height)
+ End Sub
+
+End Class
diff --git a/Pilz.UI/PaintingControl/EventArgs/PaintingObjectEventArgs.vb b/Pilz.UI/PaintingControl/EventArgs/PaintingObjectEventArgs.vb
new file mode 100644
index 0000000..ef5c14b
--- /dev/null
+++ b/Pilz.UI/PaintingControl/EventArgs/PaintingObjectEventArgs.vb
@@ -0,0 +1,16 @@
+Imports System.Drawing
+Imports System.IO
+Imports System.Windows.Forms
+Imports Newtonsoft.Json
+Imports Newtonsoft.Json.Linq
+
+Public Class PaintingObjectEventArgs
+ Inherits EventArgs
+
+ Public ReadOnly Property PaintingObjects As PaintingObject() = Nothing
+
+ Friend Sub New(paintingObjects As PaintingObject())
+ _PaintingObjects = paintingObjects
+ End Sub
+
+End Class
diff --git a/Pilz.UI/PaintingControl/EventArgs/PaintingObjectPaintEventArgs.vb b/Pilz.UI/PaintingControl/EventArgs/PaintingObjectPaintEventArgs.vb
new file mode 100644
index 0000000..aaca912
--- /dev/null
+++ b/Pilz.UI/PaintingControl/EventArgs/PaintingObjectPaintEventArgs.vb
@@ -0,0 +1,78 @@
+Imports System.Drawing
+Imports System.IO
+Imports System.Windows.Forms
+Imports Newtonsoft.Json
+Imports Newtonsoft.Json.Linq
+
+Public Class PaintingObjectPaintEventArgs
+ Inherits EventArgs
+
+ '''
+ ''' The Painting Object to draw.
+ '''
+ '''
+ Public ReadOnly Property PaintingObject As PaintingObject
+
+ '''
+ ''' The current offset of the page on the screen.
+ '''
+ '''
+ Public ReadOnly Property Offset As PointF
+
+ '''
+ ''' The Grpahics from the parent PaintingControl.
+ '''
+ '''
+ Public ReadOnly Property Graphics As Graphics
+
+ '''
+ ''' The position of the PaintingObject on Screen.
+ '''
+ '''
+ Public ReadOnly Property Location As PointF
+ Get
+ Return New PointF(X, Y)
+ End Get
+ End Property
+
+ '''
+ ''' The X position of the PaintingObject on Screen.
+ '''
+ '''
+ Public ReadOnly Property X As Single
+ Get
+ Return PaintingObject.X - Offset.X
+ End Get
+ End Property
+
+ '''
+ ''' The Y position of the PaintingObject on Screen.
+ '''
+ '''
+ Public ReadOnly Property Y As Single
+ Get
+ Return PaintingObject.Y - Offset.Y
+ End Get
+ End Property
+
+ '''
+ ''' The rectangle of the PaintingObject on Screen.
+ '''
+ '''
+ Public ReadOnly Property Rectangle As RectangleF
+ Get
+ Return New RectangleF(X, Y, PaintingObject.Width, PaintingObject.Height)
+ End Get
+ End Property
+
+ Friend Sub New(obj As PaintingObject, g As Graphics)
+ Me.New(obj, g, obj.Parent.Offset)
+ End Sub
+
+ Friend Sub New(obj As PaintingObject, g As Graphics, offset As PointF)
+ PaintingObject = obj
+ Me.Offset = offset
+ Graphics = g
+ End Sub
+
+End Class
diff --git a/Pilz.UI/PaintingControl/IPaintingObjectContainer.vb b/Pilz.UI/PaintingControl/IPaintingObjectContainer.vb
new file mode 100644
index 0000000..6909c7d
--- /dev/null
+++ b/Pilz.UI/PaintingControl/IPaintingObjectContainer.vb
@@ -0,0 +1,5 @@
+Imports System.Drawing
+
+Public Interface IPaintingObjectContainer
+
+End Interface
diff --git a/Pilz.UI/PaintingControl/ImageProperties.vb b/Pilz.UI/PaintingControl/ImageProperties.vb
new file mode 100644
index 0000000..b572234
--- /dev/null
+++ b/Pilz.UI/PaintingControl/ImageProperties.vb
@@ -0,0 +1,5 @@
+Public Class PaintingObjectImageProperties
+ Public Property FlipY As Boolean = False
+ Public Property FlipX As Boolean = False
+ Public Property Rotate As UShort = 0
+End Class
diff --git a/Pilz.UI/PaintingControl/PaintingControl.resx b/Pilz.UI/PaintingControl/PaintingControl.resx
new file mode 100644
index 0000000..1af7de1
--- /dev/null
+++ b/Pilz.UI/PaintingControl/PaintingControl.resx
@@ -0,0 +1,120 @@
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ text/microsoft-resx
+
+
+ 2.0
+
+
+ System.Resources.ResXResourceReader, System.Windows.Forms, Version=4.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089
+
+
+ System.Resources.ResXResourceWriter, System.Windows.Forms, Version=4.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089
+
+
\ No newline at end of file
diff --git a/Pilz.UI/PaintingControl/PaintingControl.vb b/Pilz.UI/PaintingControl/PaintingControl.vb
new file mode 100644
index 0000000..5143f04
--- /dev/null
+++ b/Pilz.UI/PaintingControl/PaintingControl.vb
@@ -0,0 +1,660 @@
+Imports System.Drawing
+Imports System.Drawing.Drawing2D
+Imports System.Runtime.CompilerServices
+Imports System.Windows.Forms
+Imports Pilz.Drawing
+
+Public Class PaintingControl
+ Inherits UserControl
+ Implements IPaintingObjectContainer
+
+ Private curObjMouseDown As PaintingObject = Nothing
+ Private bgColor As Color = Color.White
+ Private startMousePos As Point = Nothing
+ Private lastMousePos As Point = Nothing
+ Private lastHashCode As Integer = 0
+ Private calcOffset_MouseOnTab As Point = Point.Empty
+ Private calcOffset_IsActive As Boolean = False
+ Private calcOffset_LastOffset As PointF = PointF.Empty
+
+ Private Overloads Property ForeColor As Color
+ Private Overloads Property Font As Font
+ Private Overloads Property Text As String
+
+ Public Property Offset As PointF = PointF.Empty
+ Public ReadOnly Property PaintingObjects As New PaintingObjectList(Me)
+ Public Property AutoAreaSelection As Boolean = True
+ Public Property AutoSingleSelection As Boolean = True
+ Public Property AutoMultiselection As Boolean = True
+ Public Property AutoRemoveSelection As Boolean = True
+ Public Property AreaSelectionDashStyle As DashStyle = DashStyle.DashDot
+ Public Property AreaSelectionColor As Color = Color.CornflowerBlue
+ Public Property AutoMoveObjects As Boolean = True
+ Private _IsAreaSelecting As Boolean = False
+ Public ReadOnly Property IsMovingObjects As Boolean = False
+ Public Property GridEnabled As Boolean = True
+ Public Property GridVisible As Boolean = False
+ Public Property GridChunkSize As New Size(20, 20)
+ Public Property GridColor As Color = Color.LightGray
+ Public Property DrawGridMethode As DelegateDrawPaintingControlGridMethode = AddressOf DefaultDrawMethodes.DrawGrid
+ Public Property DrawAreaSelectionMethode As DelegateDrawPaintingControlAreaSelectionMethode = AddressOf DefaultDrawMethodes.DrawAreaSelection
+ Private _ZoomFactor As New SizeF(1, 1)
+
+ Private _stopDrawing As Integer = -1
+ Private bufferedImg As Image = Nothing
+
+ Private pressedShift As Boolean = False
+ Private pressedControl As Boolean = False
+ Private pressedAlt As Boolean = False
+
+ 'Friend WithEvents HScrollBarAdv1 As DevComponents.DotNetBar.ScrollBar.HScrollBarAdv
+ 'Friend WithEvents VScrollBarAdv1 As DevComponents.DotNetBar.VScrollBarAdv
+
+ Private savedPos As New Dictionary(Of PaintingObject, PointF)
+
+ Public Event SelectionChanged(sender As Object, e As PaintingObjectEventArgs)
+ Public Event PaintingObjectAdded(sender As Object, e As PaintingObjectEventArgs)
+ Public Event PaintingObjectRemoved(sender As Object, e As PaintingObjectEventArgs)
+ Public Event AfterScrollingDone(sender As Object, e As EventArgs)
+ Public Event ZoomFactorChanged(sender As Object, e As EventArgs)
+
+ Public ReadOnly Property SelectedObjects As PaintingObject()
+ Get
+ Dim objs As New List(Of PaintingObject)
+
+ For Each obj As PaintingObject In PaintingObjects
+ If obj.Selected Then
+ objs.Add(obj)
+ End If
+ Next
+
+ Return objs.ToArray
+ End Get
+ End Property
+
+ Public ReadOnly Property IsLayoutSuspended As Boolean
+ Get
+ Return Me.GetType.GetField("layoutSuspendCount", Reflection.BindingFlags.Instance Or Reflection.BindingFlags.NonPublic).GetValue(Me) <> 0
+ End Get
+ End Property
+
+ Public ReadOnly Property StopDrawing As Boolean
+ Get
+ Return _stopDrawing > -1
+ End Get
+ End Property
+
+ Public Overrides Property BackColor As Color
+ Get
+ Return bgColor
+ End Get
+ Set(value As Color)
+ bgColor = value
+ If value <> Color.Transparent Then
+ MyBase.BackColor = value
+ End If
+ End Set
+ End Property
+ Public ReadOnly Property IsAreaSelecting As Boolean
+ Get
+ Return _IsAreaSelecting AndAlso startMousePos <> lastMousePos
+ End Get
+ End Property
+ Public Property ZoomFactor As SizeF
+ Get
+ Return _ZoomFactor
+ End Get
+ Set
+ If _ZoomFactor <> Value Then
+ _ZoomFactor = Value
+ RaiseEvent ZoomFactorChanged(Me, New EventArgs)
+ End If
+ End Set
+ End Property
+
+ Public Sub New()
+ DoubleBuffered = True
+ End Sub
+
+ Private Sub CheckKeyDown(sender As Object, e As KeyEventArgs) Handles Me.KeyDown, Me.KeyUp
+ pressedShift = e.Shift
+ pressedControl = e.Control
+ pressedAlt = e.Alt
+ End Sub
+
+ Friend ReadOnly Property AreaSelectionRectangle As RectangleF
+ Get
+ Return HelpfulDrawingFunctions.GetRectangle(startMousePos, lastMousePos)
+ End Get
+ End Property
+
+ Private Sub CheckMouseClick(sender As Object, e As MouseEventArgs) Handles Me.MouseClick
+ For Each obj As PaintingObject In GetObjects(New Point(e.X + Offset.X, e.Y + Offset.Y))
+ If Not obj.MouseTransparency Then
+ obj.RaiseMouseClick(GetMouseEventArgs(e, obj))
+ End If
+ Next
+ End Sub
+
+ Private Sub CheckMouseDown(sender As Object, e As MouseEventArgs) Handles Me.MouseDown
+ lastMousePos = New Point(e.X + Offset.X, e.Y + Offset.Y)
+
+ curObjMouseDown = GetObjects(lastMousePos).Where(Function(n) Not n.MouseTransparency).LastOrDefault
+ curObjMouseDown?.RaiseMouseDown(GetMouseEventArgs(e, curObjMouseDown))
+
+ If Not GetSelectedObjects.Contains(curObjMouseDown) Then
+ Dim hasMovedObjects As Boolean = False
+ If _IsMovingObjects Then
+ For Each obj As PaintingObject In GetSelectedObjects()
+ If HelpfulDrawingFunctions.IsPointInRectangle(lastMousePos, obj.Rectangle) Then
+ hasMovedObjects = True
+ Exit For
+ End If
+ Next
+ End If
+
+ If (Not hasMovedObjects) AndAlso (Not _IsAreaSelecting) Then
+ Dim selChanged As New List(Of PaintingObject)
+
+ If AutoRemoveSelection AndAlso Not pressedShift Then
+ For Each obj As PaintingObject In PaintingObjects
+ If obj.Selected Then
+ obj.SelectedDirect = False
+ If Not selChanged.Contains(obj) Then
+ selChanged.Add(obj)
+ End If
+ End If
+ Next
+ End If
+ If AutoSingleSelection Then
+ Dim objtosel As PaintingObject = curObjMouseDown
+ If objtosel?.EnableSelection Then
+ objtosel.SelectedDirect = Not objtosel.Selected
+ If Not selChanged.Contains(objtosel) Then
+ selChanged.Add(objtosel)
+ Else
+ selChanged.Remove(objtosel)
+ End If
+ End If
+ End If
+
+ RaiseEvent SelectionChanged(Me, New PaintingObjectEventArgs(selChanged.ToArray))
+ End If
+ End If
+
+ If pressedControl Then
+
+ calcOffset_MouseOnTab = New Point(e.X, e.Y)
+ calcOffset_LastOffset = Offset
+ calcOffset_IsActive = True
+ Cursor = Cursors.Arrow
+
+ Else
+
+ Select Case e.Button
+ Case MouseButtons.Left
+ savedPos.Clear()
+ If AutoMoveObjects Then
+ SaveObjectPositions(e, GetSelectedObjects)
+ End If
+ If savedPos.Count > 0 Then
+ _IsMovingObjects = True
+ ElseIf AutoAreaSelection Then
+ startMousePos = New Point(e.X + Offset.X, e.Y + Offset.Y)
+ lastMousePos = startMousePos 'New Point(e.X - Offset.X, e.Y - Offset.Y)
+ _IsAreaSelecting = True
+ End If
+ End Select
+
+ End If
+ End Sub
+ Public Sub RaiseSelectionChanged()
+ RaiseEvent SelectionChanged(Me, New PaintingObjectEventArgs(SelectedObjects))
+ End Sub
+ Private Sub CheckMouseUp(sender As Object, e As MouseEventArgs) Handles Me.MouseUp
+ If _IsAreaSelecting Then
+ _IsAreaSelecting = False
+ End If
+
+ If _IsMovingObjects Then
+ _IsMovingObjects = False
+ AutoArrangeToGrid()
+ 'CalculateScrollValues()
+ End If
+
+ If curObjMouseDown IsNot Nothing Then
+ If Not curObjMouseDown.MouseTransparency Then
+ curObjMouseDown.RaiseMouseUp(GetMouseEventArgs(e, curObjMouseDown))
+ End If
+ curObjMouseDown = Nothing
+ End If
+
+ If calcOffset_IsActive Then
+ calcOffset_IsActive = False
+ Cursor = Cursors.Default
+ CalcNewOffset(e.Location)
+ RaiseEvent AfterScrollingDone(Me, New EventArgs)
+ End If
+ End Sub
+ Private Sub CheckMouseMove(sender As Object, e As MouseEventArgs) Handles Me.MouseMove
+ If _IsAreaSelecting OrElse _IsMovingObjects Then
+ lastMousePos = New Point(e.X + Offset.X, e.Y + Offset.Y)
+ End If
+
+ If _IsAreaSelecting Then
+ SelectControlsInArea()
+ End If
+
+ If _IsMovingObjects Then
+ UpdateObjectPositions(e)
+ End If
+
+ For Each obj As PaintingObject In GetObjects(New Point(e.X + Offset.X, e.Y + Offset.Y))
+ If Not obj.MouseTransparency Then
+ obj.RaiseMouseMove(GetMouseEventArgs(e, obj))
+ End If
+ Next
+
+ Dim topObj As PaintingObject = GetObject(New Point(e.X + Offset.X, e.Y + Offset.Y), True)
+ If topObj IsNot Nothing Then
+ Cursor = topObj.Cursor
+ ElseIf calcOffset_IsActive Then
+ Cursor = Cursors.Arrow
+ Else
+ Cursor = Cursors.Default
+ End If
+
+ If calcOffset_IsActive Then
+ If pressedControl Then
+ CalcNewOffset(e.Location)
+ Else
+ calcOffset_IsActive = False
+ End If
+ End If
+
+ Refresh()
+ End Sub
+
+ Private Sub CalcNewOffset(newMousePos As Point)
+ Offset = New PointF(calcOffset_LastOffset.X - (newMousePos.X - calcOffset_MouseOnTab.X),
+ calcOffset_LastOffset.Y - (newMousePos.Y - calcOffset_MouseOnTab.Y))
+ If Offset.X < 0 Then
+ Offset = New PointF(0, Offset.Y)
+ End If
+ If Offset.Y < 0 Then
+ Offset = New PointF(Offset.X, 0)
+ End If
+ End Sub
+
+ Private Function GetSelectedObjects() As PaintingObject()
+ Dim objs As New List(Of PaintingObject)
+
+ For Each obj As PaintingObject In PaintingObjects
+ If obj.Selected Then objs.Add(obj)
+ Next
+
+ Return objs.ToArray
+ End Function
+
+ Private Sub SaveObjectPositions(e As MouseEventArgs, objs As IList)
+ For Each obj As PaintingObject In objs
+ If Not savedPos.ContainsKey(obj) Then
+ savedPos.Add(obj, New PointF(e.X - obj.Location.X + Offset.X, e.Y - obj.Location.Y + Offset.Y))
+ SaveObjectPositions(e, obj.PinnedObjects)
+ End If
+ Next
+ End Sub
+ Private Sub UpdateObjectPositions(e As MouseEventArgs)
+ UpdateObjectPositions(e, GetSelectedObjects)
+ End Sub
+ Private Sub UpdateObjectPositions(e As MouseEventArgs, objs As IList(Of PaintingObject), Optional movedObjs As List(Of PaintingObject) = Nothing)
+ If IsResizingObjs(objs) Then Return
+ If movedObjs Is Nothing Then movedObjs = New List(Of PaintingObject)
+ Dim updateprocesses As New List(Of Task)
+
+ SuspendDrawing()
+
+ For Each obj As PaintingObject In objs
+ updateprocesses.Add(Task.Run(
+ Sub()
+ Dim sp As PointF = savedPos(obj)
+
+ If Not movedObjs.Contains(obj) Then
+ UpdateObjectPosition(e, obj, sp)
+ movedObjs.Add(obj)
+ End If
+
+ If obj.PinnedObjects.Count > 0 Then
+ UpdateObjectPositions(e, obj.PinnedObjects, movedObjs)
+ movedObjs.AddRange(obj.PinnedObjects.ToArray)
+ End If
+ End Sub))
+ Next
+
+ For Each a In updateprocesses
+ Do Until a.IsCompleted
+ Loop
+ Next
+
+ ResumeDrawing(False)
+ End Sub
+ Private Sub UpdateObjectPosition(e As MouseEventArgs, obj As PaintingObject, sp As PointF)
+ obj.Location = New Point(e.X - sp.X + Offset.X,
+ e.Y - sp.Y + Offset.Y)
+ End Sub
+
+ Private Function IsResizingObjs(objs As IList(Of PaintingObject)) As Boolean
+ For Each obj As PaintingObject In objs
+ If obj.IsResizing Then Return True
+ Next
+ Return False
+ End Function
+
+ Private Function GetMouseEventArgs(e As MouseEventArgs, obj As PaintingObject) As MouseEventArgs
+ Return New MouseEventArgs(e.Button, e.Clicks, e.X - obj.X + Offset.X, e.Y - obj.Y + Offset.Y, e.Delta)
+ End Function
+
+ Public Function GetObject(p As PointF, Optional UseExtRect As Boolean = False) As PaintingObject
+ For Each obj As PaintingObject In PaintingObjects
+ If UseExtRect Then
+ If HelpfulDrawingFunctions.IsPointInRectangle(p, obj.RectangleExtended) Then
+ Return obj
+ End If
+ Else
+ If HelpfulDrawingFunctions.IsPointInRectangle(p, obj.Rectangle) Then
+ Return obj
+ End If
+ End If
+ Next
+
+ Return Nothing
+ End Function
+
+ Public Function GetObjects(p As Point) As PaintingObject()
+ Dim objs As New List(Of PaintingObject)
+
+ For Each obj As PaintingObject In PaintingObjects
+ If HelpfulDrawingFunctions.IsPointInRectangle(p, obj.RectangleExtended) Then
+ objs.Add(obj)
+ End If
+ Next
+
+ Return objs.ToArray
+ End Function
+
+ Public Function GetObjects(startPoint As Point, endPoint As Point) As PaintingObject()
+ Return GetObjects(New Rectangle(startPoint, CType(endPoint - startPoint, Size)))
+ End Function
+
+ Public Function GetObjects(rect As Rectangle) As PaintingObject()
+ Dim objs As New List(Of PaintingObject)
+
+ For Each obj As PaintingObject In PaintingObjects
+ Dim objRect As RectangleF = obj.Rectangle
+ If HelpfulDrawingFunctions.IsPointInRectangle(objRect.Location, rect) OrElse
+ HelpfulDrawingFunctions.IsPointInRectangle(objRect.Location + objRect.Size, rect) OrElse
+ HelpfulDrawingFunctions.IsPointInRectangle(New PointF(objRect.Left, objRect.Bottom), rect) OrElse
+ HelpfulDrawingFunctions.IsPointInRectangle(New PointF(objRect.Right, objRect.Top), rect) Then
+ objs.Add(obj)
+ End If
+ Next
+
+ Return objs.ToArray
+ End Function
+
+ Protected Overrides ReadOnly Property CreateParams As CreateParams
+ Get
+ Dim cp = MyBase.CreateParams
+
+ 'If EnableFullTransparentBackground Then
+ ' cp.ExStyle = cp.ExStyle Or &H20 'WS_EX_TRANSPARENT
+ 'End If
+
+ Return cp
+ End Get
+ End Property
+
+ '''
+ ''' Sorg dafür, dass Events durch dieses Control durchdringen zum Parnet-Control.
+ '''
+ '''
+ Protected Overrides Sub WndProc(ByRef m As Message)
+ Dim WM_NCHITTEST As Integer = &H84
+ Dim HTTRANSPARENT As Integer = -1
+
+ 'If m.Msg = WM_NCHITTEST Then
+ ' m.Result = CType(HTTRANSPARENT, IntPtr)
+ 'Else
+ ' MyBase.WndProc(m)
+ 'End If
+
+ MyBase.WndProc(m)
+ End Sub
+
+ Protected Overrides Sub OnPaintBackground(e As PaintEventArgs)
+ 'Stop Drawing directly to the parent
+ Me.SuspendLayout()
+
+ 'Draw Background
+ MyBase.OnPaintBackground(e)
+ End Sub
+
+ Private Function GetCurrentHashValue() As Integer
+ Dim hashes As New List(Of Integer)
+
+ hashes.AddRange({Offset.X,
+ Offset.Y,
+ Size.Width,
+ Size.Height})
+
+ For Each p As PaintingObject In PaintingObjects
+ hashes.AddRange({p.Location.X,
+ p.Location.Y,
+ p.Size.Width,
+ p.Size.Height,
+ p.DrawMethodes.Count,
+ p.FillColor.ToArgb,
+ p.OutlineColor.ToArgb,
+ p.SelectionColor.ToArgb,
+ p.TextColor.ToArgb,
+ p.Type,
+ p.Text.GetHashCode / p.Text.Length,
+ p.Visible,
+ p.VerticalTextAlignment,
+ p.HorizontalTextAlignment})
+ Next
+
+ Dim hash As Integer = 0
+
+ For Each h As Integer In hashes
+ Try
+ hash += h
+ Catch ex As Exception
+ If h <> 0 AndAlso h <> 1 Then
+ hash /= h
+ End If
+ End Try
+ Next
+
+ Return hash
+ End Function
+
+ Protected Overrides Sub OnPaint(e As PaintEventArgs)
+ 'Do default Drawing Methode
+ MyBase.OnPaint(e)
+
+ If StopDrawing Then
+ e.Graphics.DrawImage(bufferedImg, Point.Empty)
+ Else
+ With e.Graphics
+ .SmoothingMode = SmoothingMode.HighQuality
+ .PixelOffsetMode = PixelOffsetMode.HighQuality
+ .PageUnit = GraphicsUnit.Pixel
+ .InterpolationMode = InterpolationMode.HighQualityBicubic
+ End With
+
+ If GridVisible Then
+ DrawGridMethode?.Invoke(e, Me, Offset)
+ End If
+
+ Dim baserect As RectangleF = New RectangleF(Offset, Size)
+
+ For Each obj As PaintingObject In PaintingObjects
+ If obj.Visible AndAlso HelpfulDrawingFunctions.OverlapsTwoRectangles(obj.Rectangle, baserect) Then
+ obj.Draw(e, Offset)
+ End If
+ Next
+
+ If _IsAreaSelecting Then
+ DrawAreaSelectionMethode?.Invoke(e, Me, New PointF(startMousePos.X - Offset.X, startMousePos.Y - Offset.Y), New PointF(lastMousePos.X - Offset.X, lastMousePos.Y - Offset.Y))
+ End If
+ End If
+
+ 'Start Drawing directly to the Form
+ ResumeLayout(False)
+ End Sub
+
+ Public Overloads Function CreateGraphics() As Graphics
+ Return MyBase.CreateGraphics
+ End Function
+
+ Public Sub PaintFullView(g As Graphics)
+ For Each obj As PaintingObject In PaintingObjects
+ If obj.Visible Then
+ obj.Draw(g, PointF.Empty)
+ End If
+ Next
+ End Sub
+
+ Private Function CalcTextSize(obj As PaintingObject) As SizeF
+ Return CalcTextSize(obj, Parent.CreateGraphics)
+ End Function
+ Private Function CalcTextSize(obj As PaintingObject, g As Graphics) As SizeF
+ Return g.MeasureString(obj.Text, obj.TextFont, obj.Width)
+ End Function
+
+ Private Sub SelectControlsInArea()
+ Dim rect As RectangleF = HelpfulDrawingFunctions.GetRectangle(startMousePos, lastMousePos)
+ For Each obj As PaintingObject In PaintingObjects
+ obj.Selected = HelpfulDrawingFunctions.OverlapsTwoRectangles(obj.Rectangle, rect)
+ Next
+ End Sub
+
+ Public Sub ArrangeToGrid(obj As PaintingObject)
+ Dim zoomedGridChunkSize As New SizeF(GridChunkSize.Width * ZoomFactor.Width, Me.GridChunkSize.Height * ZoomFactor.Height)
+
+ Dim modTop As Integer = obj.Y Mod zoomedGridChunkSize.Height
+ Dim modLeft As Integer = obj.X Mod zoomedGridChunkSize.Width
+
+ Dim halfHeight As Integer = zoomedGridChunkSize.Height / 2
+ Dim halfWidth As Integer = zoomedGridChunkSize.Width / 2
+
+ If modTop > halfHeight Then
+ obj.Y += (zoomedGridChunkSize.Height - modTop)
+ Else
+ obj.Y -= modTop
+ End If
+
+ If modLeft > halfWidth Then
+ obj.X += (zoomedGridChunkSize.Width - modLeft)
+ Else
+ obj.X -= modLeft
+ End If
+
+ If obj.EnableResize AndAlso Not obj.HardcodedSize Then
+ Dim modH As Integer = obj.Height Mod zoomedGridChunkSize.Height
+ Dim modW As Integer = obj.Width Mod zoomedGridChunkSize.Width
+
+ If modH > halfHeight Then
+ obj.Height += (zoomedGridChunkSize.Height - modH)
+ Else
+ obj.Height -= modH
+ End If
+
+ If modW > halfWidth Then
+ obj.Width += (zoomedGridChunkSize.Width - modW)
+ Else
+ obj.Width -= modW
+ End If
+ End If
+ End Sub
+
+ Public Sub AutoArrangeToGrid()
+ If GridEnabled Then
+ For Each obj As PaintingObject In GetSelectedObjects()
+ If obj.AutoAlignToGrid Then
+ ArrangeToGrid(obj)
+ End If
+ Next
+ If Not StopDrawing Then Refresh()
+ End If
+ End Sub
+
+ Public Function GetFullSize() As SizeF
+ Return GetFullSize(PaintingObjects)
+ End Function
+
+ Public Shared Function GetFullSize(objects As IEnumerable(Of PaintingObject)) As SizeF
+ Dim curX As Single = 0
+ Dim curY As Single = 0
+
+ For Each po As PaintingObject In objects
+ Dim myX As Single = po.X + po.Width
+ If curX < myX Then
+ curX = myX
+ End If
+ Dim myY As Single = po.Y + po.Height
+ If curY < myY Then
+ curY = myY
+ End If
+ Next
+
+ Return New SizeF(curX + 20, curY + 20)
+ End Function
+
+ Friend Sub RaisePaintingObjectAdded(args As PaintingObjectEventArgs)
+ RaiseEvent PaintingObjectAdded(Me, args)
+ End Sub
+ Friend Sub RaisePaintingObjectRemoved(args As PaintingObjectEventArgs)
+ RaiseEvent PaintingObjectRemoved(Me, args)
+ End Sub
+
+ Private Sub PaintingControl_PaintingObjectAdded(sender As Object, e As PaintingObjectEventArgs) Handles Me.PaintingObjectAdded, Me.PaintingObjectRemoved
+ 'CalculateScrollValues()
+ End Sub
+
+ Private Sub CheckMouseWheel(sender As Object, e As MouseEventArgs) Handles Me.MouseWheel
+ If pressedControl Then
+ Dim val As Single = e.Delta / 120 / 10
+ ZoomFactor = New SizeF(Math.Max(ZoomFactor.Width + val, 0.25), Math.Max(ZoomFactor.Height + val, 0.25))
+ Refresh()
+ End If
+ End Sub
+
+ Public Sub SuspendDrawing()
+ If _stopDrawing < 0 Then
+ 'bufferedImg = New Bitmap(Width, Height)
+ 'DrawToBitmap(bufferedImg, New Rectangle(0, 0, bufferedImg.Width, bufferedImg.Height))
+ Utils.SuspendDrawing(Me)
+ End If
+ _stopDrawing += 1
+ End Sub
+
+ Public Sub ResumeDrawing()
+ ResumeDrawing(True)
+ End Sub
+
+ Public Sub ResumeDrawing(executeRefresh As Boolean)
+ If _stopDrawing >= 0 Then
+ _stopDrawing -= 1
+ End If
+
+ If _stopDrawing = -1 Then
+ 'bufferedImg.Dispose()
+ 'bufferedImg = Nothing
+ 'If executeRefresh Then Refresh()
+ Utils.ResumeDrawing(Me, executeRefresh)
+ End If
+ End Sub
+
+End Class
diff --git a/Pilz.UI/PaintingControl/PaintingControlDelegates.vb b/Pilz.UI/PaintingControl/PaintingControlDelegates.vb
new file mode 100644
index 0000000..6516ca2
--- /dev/null
+++ b/Pilz.UI/PaintingControl/PaintingControlDelegates.vb
@@ -0,0 +1,6 @@
+Imports System.Drawing
+Imports System.Windows.Forms
+
+Public Delegate Sub DelegateDrawPaintingObjectMethode(e As PaintingObjectPaintEventArgs)
+Public Delegate Sub DelegateDrawPaintingControlGridMethode(e As PaintEventArgs, pc As PaintingControl, offset As PointF)
+Public Delegate Sub DelegateDrawPaintingControlAreaSelectionMethode(e As PaintEventArgs, pc As PaintingControl, startMousePos As PointF, lastMousePos As PointF)
diff --git a/Pilz.UI/PaintingControl/PaintingObject.vb b/Pilz.UI/PaintingControl/PaintingObject.vb
new file mode 100644
index 0000000..5ceaa73
--- /dev/null
+++ b/Pilz.UI/PaintingControl/PaintingObject.vb
@@ -0,0 +1,586 @@
+Imports System.Drawing
+Imports System.Drawing.Drawing2D
+Imports System.Reflection
+Imports System.Runtime.CompilerServices
+Imports System.Runtime.InteropServices
+Imports System.Runtime.Serialization
+Imports System.Windows.Forms
+Imports Newtonsoft.Json
+
+ Public Class PaintingObject
+ Implements ICloneable, IPaintingObjectContainer
+
+ Private resizeEngine As PaintingObjectResizing = Nothing
+ Private _Selected As Boolean = False
+
+ Private _Parent As PaintingControl = Nothing
+ Public Property FillColor As Color = Color.Blue
+ Public Property OutlineColor As Color = Color.DarkBlue
+ Public Property OutlineThicknes As Single = 1
+ Public Property OutlineDashStyle As DashStyle = DashStyle.Solid
+ Private _Text As String = ""
+ Public Property TextPosition As TextPosition = TextPosition.FullCenter
+ Public Property VerticalTextAlignment As StringAlignment = StringAlignment.Center
+ Public Property HorizontalTextAlignment As StringAlignment = StringAlignment.Center
+ Public Property TextFont As New Font(FontFamily.GenericSansSerif, 8.25)
+ Public Property TextColor As Color = Color.Black
+ Private _Location As New PointF(50, 50)
+ Private _Size As New SizeF(50, 80)
+ Public Property EnableFill As Boolean = True
+ Public Property EnableOutline As Boolean = True
+ Public Property SelectionColor As Color = Color.CornflowerBlue
+ Public Property SelectionDashStyle As DashStyle = DashStyle.Dot
+ Private _EnableSelection As Boolean = True
+ Public Property Image As Image = Nothing
+ Public Property BufferedImage As Image = Nothing
+ Public Property ImageSizeMode As ImageSizeMode
+ Public Property ImageProperties As New PaintingObjectImageProperties
+ Public Property Tag As String = Nothing
+ Public Property Name As String = ""
+ Public ReadOnly Property PinnedObjects As New List(Of PaintingObject)
+ Public ReadOnly Property DrawMethodes As New List(Of DelegateDrawPaintingObjectMethode)
+ Public ReadOnly Property DrawSelectionMethode As DelegateDrawPaintingObjectMethode = AddressOf DefaultDrawMethodes.DrawSelection
+ Public Property Cursor As Cursor = Cursors.Default
+ Public Property HardcodedSize As Boolean = False
+ Private _Visible As Boolean = True
+ Private _AutoAlignToGrid As Boolean = False
+ Public Property MouseTransparency As Boolean = False
+ Public ReadOnly Property Layering As New PaintingObjectLayering(Me)
+ Public ReadOnly Property PaintingObjects As New PaintingObjectList(_Parent) With {.EnableRaisingEvents = False}
+
+ Public Event MouseClick(sender As PaintingObject, e As MouseEventArgs)
+ Public Event MouseDown(sender As PaintingObject, e As MouseEventArgs)
+ Public Event MouseUp(sender As PaintingObject, e As MouseEventArgs)
+ Public Event MouseMove(sender As PaintingObject, e As MouseEventArgs)
+ Public Event SelectedChanged(sender As PaintingObject, e As EventArgs)
+ Public Event Paint(sender As PaintingObject, e As PaintEventArgs)
+ Public Event ParentChanged(sender As PaintingObject, e As EventArgs)
+ Public Event VisibleChanged(sender As PaintingObject, e As EventArgs)
+
+ Public Sub New()
+ End Sub
+
+ Public Sub New(type As PaintingObjectType)
+ Me.Type = type
+ End Sub
+
+ Public Sub New(type As PaintingObjectType, drawMethodes As DelegateDrawPaintingObjectMethode())
+ Me.New(type)
+ Me.DrawMethodes.AddRange(drawMethodes)
+ End Sub
+
+ Public Sub RaiseMouseClick(e As MouseEventArgs)
+ RaiseEvent MouseClick(Me, e)
+ End Sub
+ Public Sub RaiseMouseDown(e As MouseEventArgs)
+ RaiseEvent MouseDown(Me, e)
+ End Sub
+ Public Sub RaiseMouseUp(e As MouseEventArgs)
+ RaiseEvent MouseUp(Me, e)
+ End Sub
+ Public Sub RaiseMouseMove(e As MouseEventArgs)
+ RaiseEvent MouseMove(Me, e)
+ End Sub
+ Private Sub RaisePaint(e As PaintEventArgs)
+ RaiseEvent Paint(Me, e)
+ End Sub
+
+ Public Property Type As PaintingObjectType
+ Get
+ Dim tt As PaintingObjectType = PaintingObjectType.Custom
+
+ For Each d As DelegateDrawPaintingObjectMethode In DrawMethodes
+ If d.Method.DeclaringType Is GetType(DefaultDrawMethodes) Then
+ Select Case d.Method.Name
+ Case "DrawPicture"
+ tt = tt Or PaintingObjectType.Picture
+ Case "DrawText"
+ tt = tt Or PaintingObjectType.Text
+ Case "DrawRectangle"
+ tt = tt Or PaintingObjectType.Rectangle
+ Case "DrawEllipse"
+ tt = tt Or PaintingObjectType.Elipse
+ Case "DrawTriangle"
+ tt = tt Or PaintingObjectType.Triangle
+ Case "DrawLine"
+ tt = tt Or PaintingObjectType.Line
+ End Select
+ End If
+ Next
+
+ Return tt
+ End Get
+ Set(value As PaintingObjectType)
+ DrawMethodes.Clear()
+
+ If (value And PaintingObjectType.Picture) = PaintingObjectType.Picture Then
+ DrawMethodes.Add(AddressOf DefaultDrawMethodes.DrawPicture)
+ End If
+
+ If (value And PaintingObjectType.Rectangle) = PaintingObjectType.Rectangle Then
+ DrawMethodes.Add(AddressOf DefaultDrawMethodes.DrawRectangle)
+ End If
+
+ If (value And PaintingObjectType.Elipse) = PaintingObjectType.Elipse Then
+ DrawMethodes.Add(AddressOf DefaultDrawMethodes.DrawEllipse)
+ End If
+
+ If (value And PaintingObjectType.Triangle) = PaintingObjectType.Triangle Then
+ DrawMethodes.Add(AddressOf DefaultDrawMethodes.DrawTriangle)
+ End If
+
+ If (value And PaintingObjectType.Line) = PaintingObjectType.Line Then
+ DrawMethodes.Add(AddressOf DefaultDrawMethodes.DrawLine)
+ End If
+
+ If (value And PaintingObjectType.Text) = PaintingObjectType.Text Then
+ DrawMethodes.Add(AddressOf DefaultDrawMethodes.DrawText)
+ End If
+ End Set
+ End Property
+
+ Public Property Location As PointF
+ Get
+ If Parent IsNot Nothing Then
+ Return New PointF(_Location.X * Parent.ZoomFactor.Width,
+ _Location.Y * Parent.ZoomFactor.Height)
+ Else
+ Return _Location
+ End If
+ End Get
+ Set(value As PointF)
+ If Parent IsNot Nothing Then
+ _Location = New PointF(value.X / Parent.ZoomFactor.Width,
+ value.Y / Parent.ZoomFactor.Height)
+ Else
+ _Location = value
+ End If
+ End Set
+ End Property
+
+ Public Property Size As SizeF
+ Get
+ If Parent IsNot Nothing Then
+ Return New SizeF(_Size.Width * Parent.ZoomFactor.Width,
+ _Size.Height * Parent.ZoomFactor.Height)
+ Else
+ Return _Size
+ End If
+ End Get
+ Set(value As SizeF)
+ If Parent IsNot Nothing Then
+ _Size = New SizeF(value.Width / Parent.ZoomFactor.Width,
+ value.Height / Parent.ZoomFactor.Height)
+ Else
+ _Size = value
+ End If
+ ResetImageBuffer()
+ End Set
+ End Property
+
+ Public Property SizeDirect As SizeF
+ Get
+ Return _Size
+ End Get
+ Set(value As SizeF)
+ _Size = value
+ ResetImageBuffer()
+ End Set
+ End Property
+
+ Public Property AutoAlignToGrid As Boolean
+ Get
+ Return _AutoAlignToGrid
+ End Get
+ Set(value As Boolean)
+ _AutoAlignToGrid = value
+ If value Then ArrangeToGrid()
+ End Set
+ End Property
+
+ Public ReadOnly Property IsResizing As Boolean
+ Get
+ If resizeEngine Is Nothing Then
+ Return False
+ Else
+ Return resizeEngine?.IsResizing
+ End If
+ End Get
+ End Property
+
+ Public Property Parent As PaintingControl
+ Get
+ Return _Parent
+ End Get
+ Set(value As PaintingControl)
+ Dim re As Boolean = value IsNot _Parent
+ _Parent = value
+ If re Then RaiseEvent ParentChanged(Me, New EventArgs)
+ End Set
+ End Property
+
+ Public Property Visible As Boolean
+ Get
+ Return _Visible
+ End Get
+ Set(value As Boolean)
+ If value <> _Visible Then
+ _Visible = value
+ If Not value AndAlso Not _EnableSelection Then EnableResize = False
+ RaiseEvent VisibleChanged(Me, New EventArgs)
+ End If
+ End Set
+ End Property
+
+ Public Property Selected As Boolean
+ Get
+ Return _Selected
+ End Get
+ Set(value As Boolean)
+ SetSelection(value, True)
+ End Set
+ End Property
+
+ Public Property SelectedDirect As Boolean
+ Get
+ Return Selected
+ End Get
+ Set(value As Boolean)
+ SetSelection(value, False)
+ End Set
+ End Property
+
+ Private Sub SetSelection(value As Boolean, raiseEventOnParent As Boolean)
+ If EnableSelection Then
+ If _Selected <> value Then
+ _Selected = value
+ RaiseEvent SelectedChanged(Me, New EventArgs)
+ If raiseEventOnParent Then
+ Parent.RaiseSelectionChanged()
+ End If
+ End If
+ Else
+ _Selected = False
+ End If
+ End Sub
+
+ Public Property Width As Single
+ Get
+ Return Size.Width
+ End Get
+ Set(value As Single)
+ Size = New SizeF(value, Size.Height)
+ End Set
+ End Property
+ Public Property Height As Single
+ Get
+ Return Size.Height
+ End Get
+ Set(value As Single)
+ Size = New SizeF(Size.Width, value)
+ End Set
+ End Property
+
+ Public Property X As Single
+ Get
+ Return Location.X
+ End Get
+ Set(value As Single)
+ Location = New PointF(value, Location.Y)
+ End Set
+ End Property
+ Public Property Y As Single
+ Get
+ Return Location.Y
+ End Get
+ Set(value As Single)
+ Location = New PointF(Location.X, value)
+ End Set
+ End Property
+
+ Public Property Text As String
+ Get
+ Return _Text
+ End Get
+ Set(value As String)
+ _Text = value
+ End Set
+ End Property
+
+ Public Property Rectangle As RectangleF
+ Get
+ Return New RectangleF(Location, Size)
+ End Get
+ Set(value As RectangleF)
+ Location = value.Location
+ Size = value.Size
+ End Set
+ End Property
+
+ Public Property EnableSelection As Boolean
+ Get
+ Return _EnableSelection
+ End Get
+ Set(value As Boolean)
+ _EnableSelection = value
+ If Not value AndAlso Not _Visible Then EnableResize = False
+ If Not value Then Selected = False
+ End Set
+ End Property
+
+ Public Property RectangleExtended As Rectangle
+ Get
+ Return New Rectangle(X - 12,
+ Y - 12,
+ Width + 12 + 12,
+ Height + 12 + 12)
+ End Get
+ Set(value As Rectangle)
+ X = value.X + 12
+ Y = value.Y + 12
+ Width = value.Width - 12 - 12
+ Height = value.Height - 12 - 12
+ End Set
+ End Property
+
+ Public Sub FitSizeToText()
+ If Parent Is Nothing Then
+ Throw New Exception("You have to put that PaintingObject to a PaintingControl before.")
+ End If
+
+ Dim g As Graphics = Parent.CreateGraphics()
+ Dim newSize As SizeF = g.MeasureString(Text, TextFont)
+ SizeDirect = newSize + New SizeF(1, 0)
+ End Sub
+
+ Public Sub SetBounds(x As Integer, y As Integer, width As Integer, height As Integer)
+ Location = New Point(x, y)
+ Size = New Size(width, height)
+ End Sub
+
+ Public Property Left As Integer
+ Get
+ Return X
+ End Get
+ Set(value As Integer)
+ X = value
+ End Set
+ End Property
+
+ Public Property Top() As Integer
+ Get
+ Return Y
+ End Get
+ Set(value As Integer)
+ Y = value
+ End Set
+ End Property
+
+ Public ReadOnly Property Right As Integer
+ Get
+ Return X + Width
+ End Get
+ End Property
+
+ Public ReadOnly Property Bottom() As Integer
+ Get
+ Return Y + Height
+ End Get
+ End Property
+
+ Public Property EnableResize As Boolean
+ Get
+ If resizeEngine Is Nothing Then
+ Return False
+ Else
+ Return resizeEngine.Enabled
+ End If
+ End Get
+ Set(value As Boolean)
+ If resizeEngine Is Nothing AndAlso value Then
+ resizeEngine = New PaintingObjectResizing(Me)
+ ElseIf resizeEngine IsNot Nothing Then
+ resizeEngine.Enabled = value
+ End If
+ End Set
+ End Property
+
+ Public Sub Remove()
+ Parent?.PaintingObjects.Remove(Me)
+ End Sub
+
+ Public Sub AutoArrangeToGrid()
+ If Parent?.GridEnabled AndAlso AutoAlignToGrid Then
+ ArrangeToGrid()
+ End If
+ End Sub
+
+ Public Sub ArrangeToGrid()
+ If Parent IsNot Nothing Then
+ Parent.ArrangeToGrid(Me)
+ If Not Parent.StopDrawing Then Parent.Refresh()
+ End If
+ End Sub
+
+ Public Sub Draw(e As PaintEventArgs)
+ Draw(e, PointF.Empty)
+ End Sub
+
+ Public Sub Draw(e As PaintEventArgs, offset As PointF)
+ Draw(e.Graphics, offset)
+
+ If Visible Then
+ RaisePaint(e)
+ End If
+ End Sub
+
+ Public Sub Draw(g As Graphics, offset As PointF)
+ If Visible Then
+ Dim poevargs As New PaintingObjectPaintEventArgs(Me, g, offset)
+
+ For Each dm As DelegateDrawPaintingObjectMethode In DrawMethodes
+ dm?.Invoke(poevargs)
+ Next
+
+ If Selected AndAlso DrawSelectionMethode IsNot Nothing Then
+ DrawSelectionMethode?.Invoke(poevargs)
+ End If
+ End If
+ End Sub
+
+ Public Function Clone() As Object Implements ICloneable.Clone
+ Return Clone(True)
+ End Function
+
+ Public Function Clone(includePinnedObject As Boolean) As Object
+ Dim obj As New PaintingObject
+ Dim t As Type = Me.GetType
+ Dim blackField As New List(Of String) From {
+ NameOf(_PinnedObjects),
+ NameOf(resizeEngine),
+ NameOf(_Parent),
+ NameOf(BufferedImage)
+ }
+
+ Dim fields As FieldInfo() = t.GetFields(BindingFlags.Public Or BindingFlags.NonPublic Or BindingFlags.IgnoreCase Or BindingFlags.Instance)
+ For Each field As FieldInfo In fields
+ If Not blackField.Contains(field.Name) Then
+ field.SetValue(obj, field.GetValue(Me))
+ End If
+ Next
+
+ If includePinnedObject Then
+ obj.PinnedObjects.AddRange(PinnedObjects)
+ End If
+
+ obj.EnableResize = EnableResize
+
+ Return obj
+ End Function
+
+
+ Public Sub BringToFront()
+ Layering.BringToTop()
+ End Sub
+
+
+ Public Sub SendToBack()
+ Layering.SendToBack()
+ End Sub
+
+ Public Sub ResetImageBuffer()
+ BufferedImage = Nothing
+ End Sub
+
+End Class
+
+Public Class PaintingObjectList
+ Inherits List(Of PaintingObject)
+
+ Friend ReadOnly Property MyParent As PaintingControl
+ Friend Property EnableRaisingEvents As Boolean = True
+ Public ReadOnly Property Layering As New PaintingObjectListLayering(Me)
+
+ Public Sub New()
+ Me.New(Nothing)
+ End Sub
+
+ Public Sub New(parent As PaintingControl)
+ MyParent = parent
+ End Sub
+
+ Public Overloads Sub Add(item As PaintingObject)
+ item.Parent = myParent
+ MyBase.Add(item)
+ item.AutoArrangeToGrid()
+ If EnableRaisingEvents Then
+ MyParent?.RaisePaintingObjectAdded(New PaintingObjectEventArgs({item}))
+ End If
+ End Sub
+
+ Public Overloads Sub AddRange(items As PaintingObject())
+ For Each item As PaintingObject In items
+ item.Parent = myParent
+ Next
+ MyBase.AddRange(items)
+ For Each item As PaintingObject In items
+ item.AutoArrangeToGrid()
+ Next
+ If EnableRaisingEvents Then
+ MyParent?.RaisePaintingObjectAdded(New PaintingObjectEventArgs(items))
+ End If
+ End Sub
+
+ Public Overloads Sub Insert(index As Integer, item As PaintingObject)
+ item.Parent = myParent
+ MyBase.Insert(index, item)
+ myParent?.AutoArrangeToGrid()
+ If EnableRaisingEvents Then
+ MyParent?.RaisePaintingObjectAdded(New PaintingObjectEventArgs({item}))
+ End If
+ End Sub
+
+ Public Overloads Sub Remove(item As PaintingObject)
+ item.Parent = Nothing
+ MyBase.Remove(item)
+ If EnableRaisingEvents Then
+ MyParent?.RaisePaintingObjectRemoved(New PaintingObjectEventArgs({item}))
+ End If
+ End Sub
+
+ Public Overloads Sub RemoveAt(index As Integer)
+ Me(index).Parent = Nothing
+ Dim item As PaintingObject = Me(index)
+ MyBase.RemoveAt(index)
+ If EnableRaisingEvents Then
+ MyParent?.RaisePaintingObjectRemoved(New PaintingObjectEventArgs({item}))
+ End If
+ End Sub
+
+End Class
+
+Public Enum PaintingObjectType
+ Custom = 0
+ Text = 1
+ Picture = 2
+ Line = 4
+ Triangle = 8
+ Rectangle = 16
+ Elipse = 32
+End Enum
+
+Public Enum ImageSizeMode
+ Fit
+ Zoom
+ Original
+End Enum
+
+Public Enum TextPosition
+ HLeft = &H1
+ HRight = &H2
+ HCenter = &H4
+ VUp = &H10
+ VDown = &H20
+ VCenter = &H40
+ FullCenter = HCenter Or VCenter
+End Enum
diff --git a/Pilz.UI/PaintingControl/PaintingObjectLayering.vb b/Pilz.UI/PaintingControl/PaintingObjectLayering.vb
new file mode 100644
index 0000000..f56e4ac
--- /dev/null
+++ b/Pilz.UI/PaintingControl/PaintingObjectLayering.vb
@@ -0,0 +1,85 @@
+Public Class PaintingObjectLayering
+
+ Public ReadOnly Property PaintingObject As PaintingObject
+
+ '''
+ ''' Get the current object list from the painting object.
+ '''
+ ''' Returns the current object list from the painting object.
+ Public ReadOnly Property ObjectList As PaintingObjectList
+ Get
+ Return PaintingObject.Parent.PaintingObjects
+ End Get
+ End Property
+
+ '''
+ ''' Create a new instance of object layer managing.
+ '''
+ '''
+ Public Sub New(obj As PaintingObject)
+ PaintingObject = obj
+ End Sub
+
+ '''
+ ''' Moves the object by the given number of indicies.
+ '''
+ ''' The number how many objects it should be moved.
+ Public Sub MoveObject(count As Integer)
+ Dim oldIndex As Integer = ObjectList.IndexOf(PaintingObject)
+ Dim newIndex As Integer = oldIndex + count
+ MoveObjectTo(newIndex)
+ End Sub
+
+ '''
+ ''' Moves the object to the new index.
+ '''
+ '''
+ Public Sub MoveObjectTo(newIndex As Integer)
+ Dim list As PaintingObjectList = ObjectList
+
+ 'Check & make index valid
+ If newIndex >= ObjectList.Count Then
+ newIndex = ObjectList.Count - 1
+ ElseIf newIndex < 0 Then
+ newIndex = 0
+ End If
+
+ 'Remove object
+ list.Remove(PaintingObject)
+
+ 'Insert object at new index
+ list.Insert(newIndex, PaintingObject)
+
+ 'Order all objects again
+ list.Layering.OrderAll()
+ End Sub
+
+ '''
+ ''' Moves the object to the front.
+ '''
+ Public Sub BringToTop()
+ MoveObjectTo(ObjectList.Count - 1)
+ End Sub
+
+ '''
+ ''' Moves the object to the back.
+ '''
+ Public Sub SendToBack()
+ MoveObjectTo(0)
+ End Sub
+
+ '''
+ ''' Moves the object fordward by one
+ '''
+ Public Sub OneToTop()
+ MoveObject(+1)
+ End Sub
+
+ '''
+ ''' Moves the object backward by one
+ '''
+ Public Sub OneToBack()
+ MoveObject(-1)
+ End Sub
+
+End Class
diff --git a/Pilz.UI/PaintingControl/PaintingObjectListLayering.vb b/Pilz.UI/PaintingControl/PaintingObjectListLayering.vb
new file mode 100644
index 0000000..64100ec
--- /dev/null
+++ b/Pilz.UI/PaintingControl/PaintingObjectListLayering.vb
@@ -0,0 +1,73 @@
+Public Class PaintingObjectListLayering
+
+
+ Public ReadOnly Property ObjectList As PaintingObjectList
+ Public ReadOnly Property Conditions As New Dictionary(Of Integer, Func(Of PaintingObject, Boolean))
+
+ '''
+ ''' Get the order function will checkout the conditions.
+ '''
+ ''' Returns true, if conditions are aviable, otherwise false.
+ Public ReadOnly Property EnableConditions As Boolean
+ Get
+ Return Conditions.Any
+ End Get
+ End Property
+
+ '''
+ ''' Create a new instance of object list layer managing.
+ '''
+ '''
+ Public Sub New(list As PaintingObjectList)
+ ObjectList = list
+ End Sub
+
+ '''
+ ''' Order all objects using the conditions. If no conditions are setted, this method will do nothing.
+ '''
+ Public Sub OrderAll()
+ If EnableConditions Then
+ OrderAllPrivate()
+ End If
+ End Sub
+
+ Private Sub OrderAllPrivate()
+ Dim list As PaintingObjectList = ObjectList
+ Dim listOld As List(Of PaintingObject) = list.ToList
+ Dim toRemove As New List(Of PaintingObject)
+
+ 'Disable raising events
+ ObjectList.EnableRaisingEvents = False
+
+ 'Clear list
+ list.Clear()
+
+ 'Add ordered
+ For Each kvp In Conditions.OrderBy(Function(n) n.Key)
+ Dim func = kvp.Value
+
+ For Each obj As PaintingObject In listOld
+ If func(obj) Then
+ 'Add to list
+ list.Add(obj)
+
+ 'Add to remove
+ toRemove.Add(obj)
+ End If
+ Next
+
+ 'Remove remembered objects
+ For Each obj As PaintingObject In toRemove
+ listOld.Remove(obj)
+ Next
+ toRemove.Clear()
+ Next
+
+ 'Enable raising events
+ ObjectList.EnableRaisingEvents = True
+
+ 'Refresh
+ ObjectList.MyParent?.Refresh()
+ End Sub
+
+End Class
diff --git a/Pilz.UI/PaintingControl/PaintingObjectResizing.vb b/Pilz.UI/PaintingControl/PaintingObjectResizing.vb
new file mode 100644
index 0000000..002e303
--- /dev/null
+++ b/Pilz.UI/PaintingControl/PaintingObjectResizing.vb
@@ -0,0 +1,171 @@
+Imports System.Drawing
+Imports System.Windows.Forms
+Imports Newtonsoft.Json
+Imports Pilz.Drawing
+
+ Friend Class PaintingObjectResizing
+
+ Private WithEvents mObj As PaintingObject
+ Private WithEvents mObjParent As Control = Nothing
+ Private WithEvents mObjControl As Control = Nothing
+ Private mMouseDown As Boolean = False
+ Private mEdge As EdgeEnum = EdgeEnum.None
+ Private mWidth As Integer = 4
+ Private qWidth As Integer = 4 * 4
+ Private rect As New Rectangle
+
+ Public Property Enabled As Boolean = True
+ Public Property MinimumSize As New SizeF(15, 15)
+
+ Private Enum EdgeEnum
+ None
+ Right
+ Left
+ Top
+ Bottom
+ TopLeft
+ TopRight
+ BottomLeft
+ BottomRight
+ End Enum
+
+ Public ReadOnly Property IsResizing As Boolean
+ Get
+ Return mMouseDown AndAlso mEdge <> EdgeEnum.None
+ End Get
+ End Property
+
+ Public Sub New(obj As PaintingObject)
+ mObj = obj
+ mObjControl = mObj.Parent
+ End Sub
+
+ Shared Function ApplyToControl(obj As PaintingObject) As PaintingObjectResizing
+ Return New PaintingObjectResizing(obj)
+ End Function
+
+ Private Sub mControl_MouseDown(sender As Object, e As MouseEventArgs) Handles mObj.MouseDown
+ If e.Button = System.Windows.Forms.MouseButtons.Left Then
+ mMouseDown = True
+ End If
+ End Sub
+
+ Private Sub mControl_MouseUp(sender As Object, e As MouseEventArgs) Handles mObj.MouseUp
+ mMouseDown = False
+
+ If mObj.Selected Then
+ mObj.AutoArrangeToGrid()
+ End If
+ End Sub
+
+ Private Sub KeepInRange(ByRef size As SizeF)
+ If size.Height < MinimumSize.Height OrElse size.Width < MinimumSize.Width Then
+ size = New SizeF(Math.Max(size.Width, MinimumSize.Width),
+ Math.Max(size.Height, MinimumSize.Height))
+ End If
+ End Sub
+
+ Private Sub mControl_MouseMove(sender As Object, e As MouseEventArgs) Handles mObjControl.MouseMove
+
+ If mMouseDown AndAlso mEdge <> EdgeEnum.None Then
+
+ Dim eX As Integer = e.X + mObj.Parent.Offset.X
+ Dim eY As Integer = e.Y + mObj.Parent.Offset.Y
+
+ Select Case mEdge
+ Case EdgeEnum.TopLeft
+ mObj.SetBounds(eX, eY, mObj.Width + (mObj.Left - eX), mObj.Height + (mObj.Top - eY))
+ Case EdgeEnum.TopRight
+ mObj.SetBounds(mObj.Left, eY, eX - mObj.Left, mObj.Height + (mObj.Top - eY))
+ Case EdgeEnum.BottomRight
+ mObj.SetBounds(mObj.Left, mObj.Top, eX - mObj.Left, eY - mObj.Top)
+ Case EdgeEnum.BottomLeft
+ mObj.SetBounds(eX, mObj.Top, mObj.Width + (mObj.Left - eX), eY - mObj.Top)
+ Case EdgeEnum.Left
+ mObj.SetBounds(eX, mObj.Top, mObj.Width + (mObj.Left - eX), mObj.Height)
+ Case EdgeEnum.Right
+ mObj.SetBounds(mObj.Left, mObj.Top, eX - mObj.Left, mObj.Height)
+ Case EdgeEnum.Top
+ mObj.SetBounds(mObj.Left, eY, mObj.Width, mObj.Height + (mObj.Top - eY))
+ Case EdgeEnum.Bottom
+ mObj.SetBounds(mObj.Left, mObj.Top, mObj.Width, eY - mObj.Top)
+ End Select
+
+ KeepInRange(mObj.Size)
+
+ ElseIf Not mMouseDown Then
+
+ Dim eX As Integer = e.X - mObj.X + mObj.Parent.Offset.X
+ Dim eY As Integer = e.Y - mObj.Y + mObj.Parent.Offset.Y
+ Dim eLocation As New Point(eX, eY)
+ Dim extRect As RectangleF = mObj.RectangleExtended
+ Dim oldRect As RectangleF = mObj.Rectangle
+
+ Dim newRect As New RectangleF
+ newRect.X = extRect.X - oldRect.X
+ newRect.Y = extRect.Y - oldRect.Y
+ newRect.Width = (extRect.Width - oldRect.Width) / 2
+ newRect.Height = (extRect.Height - oldRect.Height) / 2
+
+ Dim setToNone As Boolean = False
+
+ If Enabled Then
+ Select Case True
+ Case HelpfulDrawingFunctions.IsPointInRectangle(eLocation, New Rectangle(newRect.X, newRect.Y, newRect.Width, newRect.Height))
+ mObj.Cursor = Cursors.SizeNWSE
+ mEdge = EdgeEnum.TopLeft
+ Case HelpfulDrawingFunctions.IsPointInRectangle(eLocation, New Rectangle(mObj.Width, newRect.Y, newRect.Width, newRect.Height))
+ mObj.Cursor = Cursors.SizeNESW
+ mEdge = EdgeEnum.TopRight
+ Case HelpfulDrawingFunctions.IsPointInRectangle(eLocation, New Rectangle(mObj.Width, mObj.Height, newRect.Width, newRect.Height))
+ mObj.Cursor = Cursors.SizeNWSE
+ mEdge = EdgeEnum.BottomRight
+ Case HelpfulDrawingFunctions.IsPointInRectangle(eLocation, New Rectangle(newRect.X, mObj.Height, newRect.Width, newRect.Height))
+ mObj.Cursor = Cursors.SizeNESW
+ mEdge = EdgeEnum.BottomLeft
+ Case HelpfulDrawingFunctions.IsPointInRectangle(eLocation, New Rectangle(-newRect.Width, 0, newRect.Width, mObj.Height))
+ mObj.Cursor = Cursors.SizeWE
+ mEdge = EdgeEnum.Left
+ Case HelpfulDrawingFunctions.IsPointInRectangle(eLocation, New Rectangle(mObj.Width, 0, newRect.Width, mObj.Height))
+ mObj.Cursor = Cursors.SizeWE
+ mEdge = EdgeEnum.Right
+ Case HelpfulDrawingFunctions.IsPointInRectangle(eLocation, New Rectangle(0, -newRect.Height, mObj.Width, newRect.Height))
+ mObj.Cursor = Cursors.SizeNS
+ mEdge = EdgeEnum.Top
+ Case HelpfulDrawingFunctions.IsPointInRectangle(eLocation, New Rectangle(0, mObj.Height, mObj.Width, newRect.Height))
+ mObj.Cursor = Cursors.SizeNS
+ mEdge = EdgeEnum.Bottom
+ Case Else
+ setToNone = True
+ End Select
+ Else
+ setToNone = True
+ End If
+
+ If setToNone Then
+ mObj.Cursor = Cursors.Default
+ mEdge = EdgeEnum.None
+ End If
+ End If
+ End Sub
+
+ Private Sub mControl_Paint(sender As PaintingObject, e As PaintEventArgs) Handles mObj.Paint
+ 'e.Graphics.FillRectangle(brush, rect)
+ End Sub
+
+ Private Sub mControl_MouseLeave(ByVal sender As PaintingObject, ByVal e As EventArgs) Handles mObj.SelectedChanged
+ If Not sender.Selected Then
+ mEdge = EdgeEnum.None
+ End If
+ End Sub
+
+ Private Sub mObjParent_ParentChanged(sender As Object, e As EventArgs) Handles mObjControl.ParentChanged
+ mObjParent = mObjControl.Parent
+ End Sub
+
+ Private Sub mObj_ParentChanged(sender As PaintingObject, e As EventArgs) Handles mObj.ParentChanged
+ mObjControl = mObj.Parent
+ mObjParent = mObjControl?.Parent
+ End Sub
+
+End Class
diff --git a/Pilz.UI/Pilz.UI-NuGet/PaintingControls.nuspec b/Pilz.UI/Pilz.UI-NuGet/PaintingControls.nuspec
new file mode 100644
index 0000000..dba8132
--- /dev/null
+++ b/Pilz.UI/Pilz.UI-NuGet/PaintingControls.nuspec
@@ -0,0 +1,27 @@
+
+
+
+ PaintingControls
+ 1.0.0.0
+ PaintingControls
+ Pilzinsel64
+ Pilzinsel64
+ https://github.com/dotnet/corefx/blob/master/LICENSE.TXT
+ https://www.nuget.org/packages/PaintingControls/
+ false
+ Create an PaintingControl and add several PaintingObjects containing visual objects.
+The PaintingControl has some user actions that can be enabled/disabled.
+Also you can completly customize the drawing process of an PaintingObject.
+It is very simple to use.
+
+ Copyright © Pilzinsel64 2018
+ control object paint visual
+
+
+
+ PaintingControls is a simple way to paint and control visual objects.
+
+
+
+
+
\ No newline at end of file
diff --git a/Pilz.UI/Pilz.UI-NuGet/lib/net45/PaintingControls.dll b/Pilz.UI/Pilz.UI-NuGet/lib/net45/PaintingControls.dll
new file mode 100644
index 0000000..c199143
Binary files /dev/null and b/Pilz.UI/Pilz.UI-NuGet/lib/net45/PaintingControls.dll differ
diff --git a/Pilz.UI/Pilz.UI-NuGet/lib/net45/PaintingControls.xml b/Pilz.UI/Pilz.UI-NuGet/lib/net45/PaintingControls.xml
new file mode 100644
index 0000000..9225e96
--- /dev/null
+++ b/Pilz.UI/Pilz.UI-NuGet/lib/net45/PaintingControls.xml
@@ -0,0 +1,32 @@
+
+
+
+
+PaintingControls
+
+
+
+
+
+ A strongly-typed resource class, for looking up localized strings, etc.
+
+
+
+
+ Returns the cached ResourceManager instance used by this class.
+
+
+
+
+ Overrides the current thread's CurrentUICulture property for all
+ resource lookups using this strongly typed resource class.
+
+
+
+
+ Sorg dafür, dass Events durch dieses Control durchdringen zum Parnet-Control.
+
+
+
+
+
diff --git a/Pilz.UI/Pilz.UI-NuGet/lib/net451/PaintingControls.dll b/Pilz.UI/Pilz.UI-NuGet/lib/net451/PaintingControls.dll
new file mode 100644
index 0000000..e32f7bf
Binary files /dev/null and b/Pilz.UI/Pilz.UI-NuGet/lib/net451/PaintingControls.dll differ
diff --git a/Pilz.UI/Pilz.UI-NuGet/lib/net451/PaintingControls.xml b/Pilz.UI/Pilz.UI-NuGet/lib/net451/PaintingControls.xml
new file mode 100644
index 0000000..f75d8c2
--- /dev/null
+++ b/Pilz.UI/Pilz.UI-NuGet/lib/net451/PaintingControls.xml
@@ -0,0 +1,32 @@
+
+
+
+
+PaintingControls
+
+
+
+
+
+ Eine stark typisierte Ressourcenklasse zum Suchen von lokalisierten Zeichenfolgen usw.
+
+
+
+
+ Gibt die zwischengespeicherte ResourceManager-Instanz zurück, die von dieser Klasse verwendet wird.
+
+
+
+
+ Überschreibt die CurrentUICulture-Eigenschaft des aktuellen Threads für alle
+ Ressourcenzuordnungen, die diese stark typisierte Ressourcenklasse verwenden.
+
+
+
+
+ Sorg dafür, dass Events durch dieses Control durchdringen zum Parnet-Control.
+
+
+
+
+
diff --git a/Pilz.UI/Pilz.UI-NuGet/lib/net452/PaintingControls.dll b/Pilz.UI/Pilz.UI-NuGet/lib/net452/PaintingControls.dll
new file mode 100644
index 0000000..80ddf7f
Binary files /dev/null and b/Pilz.UI/Pilz.UI-NuGet/lib/net452/PaintingControls.dll differ
diff --git a/Pilz.UI/Pilz.UI-NuGet/lib/net452/PaintingControls.xml b/Pilz.UI/Pilz.UI-NuGet/lib/net452/PaintingControls.xml
new file mode 100644
index 0000000..f75d8c2
--- /dev/null
+++ b/Pilz.UI/Pilz.UI-NuGet/lib/net452/PaintingControls.xml
@@ -0,0 +1,32 @@
+
+
+
+
+PaintingControls
+
+
+
+
+
+ Eine stark typisierte Ressourcenklasse zum Suchen von lokalisierten Zeichenfolgen usw.
+
+
+
+
+ Gibt die zwischengespeicherte ResourceManager-Instanz zurück, die von dieser Klasse verwendet wird.
+
+
+
+
+ Überschreibt die CurrentUICulture-Eigenschaft des aktuellen Threads für alle
+ Ressourcenzuordnungen, die diese stark typisierte Ressourcenklasse verwenden.
+
+
+
+
+ Sorg dafür, dass Events durch dieses Control durchdringen zum Parnet-Control.
+
+
+
+
+
diff --git a/Pilz.UI/Pilz.UI-NuGet/lib/net46/PaintingControls.dll b/Pilz.UI/Pilz.UI-NuGet/lib/net46/PaintingControls.dll
new file mode 100644
index 0000000..0ec52d9
Binary files /dev/null and b/Pilz.UI/Pilz.UI-NuGet/lib/net46/PaintingControls.dll differ
diff --git a/Pilz.UI/Pilz.UI-NuGet/lib/net46/PaintingControls.xml b/Pilz.UI/Pilz.UI-NuGet/lib/net46/PaintingControls.xml
new file mode 100644
index 0000000..f75d8c2
--- /dev/null
+++ b/Pilz.UI/Pilz.UI-NuGet/lib/net46/PaintingControls.xml
@@ -0,0 +1,32 @@
+
+
+
+
+PaintingControls
+
+
+
+
+
+ Eine stark typisierte Ressourcenklasse zum Suchen von lokalisierten Zeichenfolgen usw.
+
+
+
+
+ Gibt die zwischengespeicherte ResourceManager-Instanz zurück, die von dieser Klasse verwendet wird.
+
+
+
+
+ Überschreibt die CurrentUICulture-Eigenschaft des aktuellen Threads für alle
+ Ressourcenzuordnungen, die diese stark typisierte Ressourcenklasse verwenden.
+
+
+
+
+ Sorg dafür, dass Events durch dieses Control durchdringen zum Parnet-Control.
+
+
+
+
+
diff --git a/Pilz.UI/Pilz.UI-NuGet/lib/net461/PaintingControls.dll b/Pilz.UI/Pilz.UI-NuGet/lib/net461/PaintingControls.dll
new file mode 100644
index 0000000..561517b
Binary files /dev/null and b/Pilz.UI/Pilz.UI-NuGet/lib/net461/PaintingControls.dll differ
diff --git a/Pilz.UI/Pilz.UI-NuGet/lib/net461/PaintingControls.xml b/Pilz.UI/Pilz.UI-NuGet/lib/net461/PaintingControls.xml
new file mode 100644
index 0000000..f75d8c2
--- /dev/null
+++ b/Pilz.UI/Pilz.UI-NuGet/lib/net461/PaintingControls.xml
@@ -0,0 +1,32 @@
+
+
+
+
+PaintingControls
+
+
+
+
+
+ Eine stark typisierte Ressourcenklasse zum Suchen von lokalisierten Zeichenfolgen usw.
+
+
+
+
+ Gibt die zwischengespeicherte ResourceManager-Instanz zurück, die von dieser Klasse verwendet wird.
+
+
+
+
+ Überschreibt die CurrentUICulture-Eigenschaft des aktuellen Threads für alle
+ Ressourcenzuordnungen, die diese stark typisierte Ressourcenklasse verwenden.
+
+
+
+
+ Sorg dafür, dass Events durch dieses Control durchdringen zum Parnet-Control.
+
+
+
+
+
diff --git a/Pilz.UI/Pilz.UI-NuGet/lib/net471/PaintingControls.dll b/Pilz.UI/Pilz.UI-NuGet/lib/net471/PaintingControls.dll
new file mode 100644
index 0000000..16c5c19
Binary files /dev/null and b/Pilz.UI/Pilz.UI-NuGet/lib/net471/PaintingControls.dll differ
diff --git a/Pilz.UI/Pilz.UI-NuGet/lib/net471/PaintingControls.xml b/Pilz.UI/Pilz.UI-NuGet/lib/net471/PaintingControls.xml
new file mode 100644
index 0000000..f75d8c2
--- /dev/null
+++ b/Pilz.UI/Pilz.UI-NuGet/lib/net471/PaintingControls.xml
@@ -0,0 +1,32 @@
+
+
+
+
+PaintingControls
+
+
+
+
+
+ Eine stark typisierte Ressourcenklasse zum Suchen von lokalisierten Zeichenfolgen usw.
+
+
+
+
+ Gibt die zwischengespeicherte ResourceManager-Instanz zurück, die von dieser Klasse verwendet wird.
+
+
+
+
+ Überschreibt die CurrentUICulture-Eigenschaft des aktuellen Threads für alle
+ Ressourcenzuordnungen, die diese stark typisierte Ressourcenklasse verwenden.
+
+
+
+
+ Sorg dafür, dass Events durch dieses Control durchdringen zum Parnet-Control.
+
+
+
+
+
diff --git a/Pilz.UI/Pilz.UI-NuGet/nuget.exe b/Pilz.UI/Pilz.UI-NuGet/nuget.exe
new file mode 100644
index 0000000..0cc4088
Binary files /dev/null and b/Pilz.UI/Pilz.UI-NuGet/nuget.exe differ
diff --git a/Pilz.UI/Pilz.UI.vbproj b/Pilz.UI/Pilz.UI.vbproj
new file mode 100644
index 0000000..772d1bb
--- /dev/null
+++ b/Pilz.UI/Pilz.UI.vbproj
@@ -0,0 +1,156 @@
+
+
+
+
+ Debug
+ AnyCPU
+ {827C60BF-4D92-4D39-92F0-4285923266A1}
+ Library
+ Pilz.UI
+ Pilz.UI
+ 512
+ Windows
+ v4.5
+
+
+
+ true
+ full
+ true
+ true
+ bin\Debug\
+ Pilz.UI.xml
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+
+
+ none
+ false
+ true
+ true
+ bin\Release\
+ Pilz.UI.xml
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+ true
+
+
+ On
+
+
+ Binary
+
+
+ Off
+
+
+ On
+
+
+ true
+ true
+ true
+ bin\x86\Debug\
+ Pilz.UI.xml
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+ full
+ x86
+ MinimumRecommendedRules.ruleset
+ true
+
+
+ true
+ bin\x86\Release\
+ true
+ Pilz.UI.xml
+ true
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+ x86
+ MinimumRecommendedRules.ruleset
+
+
+
+ ..\packages\Newtonsoft.Json.12.0.1\lib\net45\Newtonsoft.Json.dll
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ UserControl
+
+
+
+ True
+ Application.myapp
+
+
+ True
+ True
+ Resources.resx
+
+
+ True
+ Settings.settings
+ True
+
+
+
+
+
+
+
+
+ VbMyResourcesResXFileCodeGenerator
+ Resources.Designer.vb
+ My.Resources
+ Designer
+
+
+ PaintingControl.vb
+
+
+
+
+ MyApplicationCodeGenerator
+ Application.Designer.vb
+
+
+ SettingsSingleFileGenerator
+ My
+ Settings.Designer.vb
+
+
+
+
+
+ {1a0b8106-2449-4908-b5e1-a00d8e9cf8f6}
+ Pilz.Drawing
+
+
+
+
\ No newline at end of file
diff --git a/Pilz.UI/Utilities/DrawingControl.vb b/Pilz.UI/Utilities/DrawingControl.vb
new file mode 100644
index 0000000..02b44a8
--- /dev/null
+++ b/Pilz.UI/Utilities/DrawingControl.vb
@@ -0,0 +1,28 @@
+Imports System.Runtime.CompilerServices
+Imports System.Windows.Forms
+
+Namespace Utils
+
+ Public Module DrawingControl
+
+ Private Const WM_SETREDRAW = 11
+
+
+ Public Sub SuspendDrawing(control As Control)
+ SendMessage(control.Handle, WM_SETREDRAW, False, 0)
+ End Sub
+
+
+ Public Sub ResumeDrawing(control As Control)
+ ResumeDrawing(control, True)
+ End Sub
+
+
+ Public Sub ResumeDrawing(control As Control, redraw As Boolean)
+ SendMessage(control.Handle, WM_SETREDRAW, True, 0)
+ If redraw Then control.Refresh()
+ End Sub
+
+ End Module
+
+End Namespace
diff --git a/Pilz.UI/Utilities/User32Bridge.vb b/Pilz.UI/Utilities/User32Bridge.vb
new file mode 100644
index 0000000..be8d6b6
--- /dev/null
+++ b/Pilz.UI/Utilities/User32Bridge.vb
@@ -0,0 +1,5 @@
+Public Module User32Bridge
+
+ Friend Declare Auto Function SendMessage Lib "user32.dll" (hWnd As IntPtr, Msg As Integer, wParam As Boolean, lParam As Integer) As Integer
+
+End Module
diff --git a/Pilz.UI/packages.config b/Pilz.UI/packages.config
new file mode 100644
index 0000000..7f83af3
--- /dev/null
+++ b/Pilz.UI/packages.config
@@ -0,0 +1,4 @@
+
+
+
+
\ No newline at end of file
diff --git a/Pilz.Win32/Mapped/FileInfo.vb b/Pilz.Win32/Mapped/FileInfo.vb
new file mode 100644
index 0000000..fe3bce4
--- /dev/null
+++ b/Pilz.Win32/Mapped/FileInfo.vb
@@ -0,0 +1,22 @@
+Imports System.Drawing
+Imports Pilz.Win32.Native
+
+Namespace Mapped
+
+ Public Class FileInfo
+
+ Public ReadOnly Property Icon As Icon
+ Public ReadOnly Property SystemIconIndex As Integer
+ Public ReadOnly Property Displayname As String
+ Public ReadOnly Property Typename As String
+
+ Friend Sub New(info As SHFILEINFO)
+ Icon = Icon.FromHandle(info.hIcon)
+ SystemIconIndex = info.iIcon
+ Displayname = info.szDisplayName
+ Typename = info.szTypeName
+ End Sub
+
+ End Class
+
+End Namespace
diff --git a/Pilz.Win32/My Project/Application.Designer.vb b/Pilz.Win32/My Project/Application.Designer.vb
new file mode 100644
index 0000000..8ab460b
--- /dev/null
+++ b/Pilz.Win32/My Project/Application.Designer.vb
@@ -0,0 +1,13 @@
+'------------------------------------------------------------------------------
+'
+' Dieser Code wurde von einem Tool generiert.
+' Laufzeitversion:4.0.30319.42000
+'
+' Änderungen an dieser Datei können falsches Verhalten verursachen und gehen verloren, wenn
+' der Code erneut generiert wird.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
diff --git a/Pilz.Win32/My Project/Application.myapp b/Pilz.Win32/My Project/Application.myapp
new file mode 100644
index 0000000..758895d
--- /dev/null
+++ b/Pilz.Win32/My Project/Application.myapp
@@ -0,0 +1,10 @@
+
+
+ false
+ false
+ 0
+ true
+ 0
+ 1
+ true
+
diff --git a/Pilz.Win32/My Project/AssemblyInfo.vb b/Pilz.Win32/My Project/AssemblyInfo.vb
new file mode 100644
index 0000000..7215404
--- /dev/null
+++ b/Pilz.Win32/My Project/AssemblyInfo.vb
@@ -0,0 +1,35 @@
+Imports System
+Imports System.Reflection
+Imports System.Runtime.InteropServices
+
+' Allgemeine Informationen über eine Assembly werden über die folgenden
+' Attribute gesteuert. Ändern Sie diese Attributwerte, um die Informationen zu ändern,
+' die einer Assembly zugeordnet sind.
+
+' Werte der Assemblyattribute überprüfen
+
+
+
+
+
+
+
+
+
+
+'Die folgende GUID bestimmt die ID der Typbibliothek, wenn dieses Projekt für COM verfügbar gemacht wird.
+
+
+' Versionsinformationen für eine Assembly bestehen aus den folgenden vier Werten:
+'
+' Hauptversion
+' Nebenversion
+' Buildnummer
+' Revision
+'
+' Sie können alle Werte angeben oder Standardwerte für die Build- und Revisionsnummern verwenden,
+' übernehmen, indem Sie "*" eingeben:
+'
+
+
+
diff --git a/Pilz.Win32/My Project/Resources.Designer.vb b/Pilz.Win32/My Project/Resources.Designer.vb
new file mode 100644
index 0000000..75efaf8
--- /dev/null
+++ b/Pilz.Win32/My Project/Resources.Designer.vb
@@ -0,0 +1,63 @@
+'------------------------------------------------------------------------------
+'
+' Dieser Code wurde von einem Tool generiert.
+' Laufzeitversion:4.0.30319.42000
+'
+' Änderungen an dieser Datei können falsches Verhalten verursachen und gehen verloren, wenn
+' der Code erneut generiert wird.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
+Imports System
+
+Namespace My.Resources
+
+ 'Diese Klasse wurde von der StronglyTypedResourceBuilder automatisch generiert
+ '-Klasse über ein Tool wie ResGen oder Visual Studio automatisch generiert.
+ 'Um einen Member hinzuzufügen oder zu entfernen, bearbeiten Sie die .ResX-Datei und führen dann ResGen
+ 'mit der /str-Option erneut aus, oder Sie erstellen Ihr VS-Projekt neu.
+ '''
+ ''' Eine stark typisierte Ressourcenklasse zum Suchen von lokalisierten Zeichenfolgen usw.
+ '''
+ _
+ Friend Module Resources
+
+ Private resourceMan As Global.System.Resources.ResourceManager
+
+ Private resourceCulture As Global.System.Globalization.CultureInfo
+
+ '''
+ ''' Gibt die zwischengespeicherte ResourceManager-Instanz zurück, die von dieser Klasse verwendet wird.
+ '''
+ _
+ Friend ReadOnly Property ResourceManager() As Global.System.Resources.ResourceManager
+ Get
+ If Object.ReferenceEquals(resourceMan, Nothing) Then
+ Dim temp As Global.System.Resources.ResourceManager = New Global.System.Resources.ResourceManager("Pilz.Win32.Resources", GetType(Resources).Assembly)
+ resourceMan = temp
+ End If
+ Return resourceMan
+ End Get
+ End Property
+
+ '''
+ ''' Überschreibt die CurrentUICulture-Eigenschaft des aktuellen Threads für alle
+ ''' Ressourcenzuordnungen, die diese stark typisierte Ressourcenklasse verwenden.
+ '''
+ _
+ Friend Property Culture() As Global.System.Globalization.CultureInfo
+ Get
+ Return resourceCulture
+ End Get
+ Set
+ resourceCulture = value
+ End Set
+ End Property
+ End Module
+End Namespace
diff --git a/Pilz.Win32/My Project/Resources.resx b/Pilz.Win32/My Project/Resources.resx
new file mode 100644
index 0000000..af7dbeb
--- /dev/null
+++ b/Pilz.Win32/My Project/Resources.resx
@@ -0,0 +1,117 @@
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ text/microsoft-resx
+
+
+ 2.0
+
+
+ System.Resources.ResXResourceReader, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089
+
+
+ System.Resources.ResXResourceWriter, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089
+
+
\ No newline at end of file
diff --git a/Pilz.Win32/My Project/Settings.Designer.vb b/Pilz.Win32/My Project/Settings.Designer.vb
new file mode 100644
index 0000000..0cc5b4a
--- /dev/null
+++ b/Pilz.Win32/My Project/Settings.Designer.vb
@@ -0,0 +1,73 @@
+'------------------------------------------------------------------------------
+'
+' Dieser Code wurde von einem Tool generiert.
+' Laufzeitversion:4.0.30319.42000
+'
+' Änderungen an dieser Datei können falsches Verhalten verursachen und gehen verloren, wenn
+' der Code erneut generiert wird.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
+
+Namespace My
+
+ _
+ Partial Friend NotInheritable Class MySettings
+ Inherits Global.System.Configuration.ApplicationSettingsBase
+
+ Private Shared defaultInstance As MySettings = CType(Global.System.Configuration.ApplicationSettingsBase.Synchronized(New MySettings()),MySettings)
+
+#Region "Automatische My.Settings-Speicherfunktion"
+#If _MyType = "WindowsForms" Then
+ Private Shared addedHandler As Boolean
+
+ Private Shared addedHandlerLockObject As New Object
+
+ _
+ Private Shared Sub AutoSaveSettings(sender As Global.System.Object, e As Global.System.EventArgs)
+ If My.Application.SaveMySettingsOnExit Then
+ My.Settings.Save()
+ End If
+ End Sub
+#End If
+#End Region
+
+ Public Shared ReadOnly Property [Default]() As MySettings
+ Get
+
+#If _MyType = "WindowsForms" Then
+ If Not addedHandler Then
+ SyncLock addedHandlerLockObject
+ If Not addedHandler Then
+ AddHandler My.Application.Shutdown, AddressOf AutoSaveSettings
+ addedHandler = True
+ End If
+ End SyncLock
+ End If
+#End If
+ Return defaultInstance
+ End Get
+ End Property
+ End Class
+End Namespace
+
+Namespace My
+
+ _
+ Friend Module MySettingsProperty
+
+ _
+ Friend ReadOnly Property Settings() As Global.Pilz.Win32.My.MySettings
+ Get
+ Return Global.Pilz.Win32.My.MySettings.Default
+ End Get
+ End Property
+ End Module
+End Namespace
diff --git a/Pilz.Win32/My Project/Settings.settings b/Pilz.Win32/My Project/Settings.settings
new file mode 100644
index 0000000..85b890b
--- /dev/null
+++ b/Pilz.Win32/My Project/Settings.settings
@@ -0,0 +1,7 @@
+
+
+
+
+
+
+
diff --git a/Pilz.Win32/Native/SHFILEINFO.vb b/Pilz.Win32/Native/SHFILEINFO.vb
new file mode 100644
index 0000000..96242b8
--- /dev/null
+++ b/Pilz.Win32/Native/SHFILEINFO.vb
@@ -0,0 +1,15 @@
+Imports System.Runtime.InteropServices
+
+Namespace Native
+
+ Friend Structure SHFILEINFO
+ Public hIcon As IntPtr
+ Public iIcon As Integer
+ Public dwAttributes As UInteger
+
+ Public szDisplayName As String
+
+ Public szTypeName As String
+ End Structure
+
+End Namespace
diff --git a/Pilz.Win32/Pilz.Win32.vbproj b/Pilz.Win32/Pilz.Win32.vbproj
new file mode 100644
index 0000000..2de4aac
--- /dev/null
+++ b/Pilz.Win32/Pilz.Win32.vbproj
@@ -0,0 +1,107 @@
+
+
+
+
+ Debug
+ AnyCPU
+ {0BE0428D-AC97-4812-ADFC-6D7D00AEE497}
+ Library
+ Pilz.Win32
+ Pilz.Win32
+ 512
+ Windows
+ v4.5
+ true
+
+
+ true
+ full
+ true
+ true
+ bin\Debug\
+ Pilz.Win32.xml
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+
+
+ pdbonly
+ false
+ true
+ true
+ bin\Release\
+ Pilz.Win32.xml
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+
+
+ On
+
+
+ Binary
+
+
+ Off
+
+
+ On
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ True
+ Application.myapp
+
+
+ True
+ True
+ Resources.resx
+
+
+ True
+ Settings.settings
+ True
+
+
+
+
+
+ VbMyResourcesResXFileCodeGenerator
+ Resources.Designer.vb
+ My.Resources
+ Designer
+
+
+
+
+ MyApplicationCodeGenerator
+ Application.Designer.vb
+
+
+ SettingsSingleFileGenerator
+ My
+ Settings.Designer.vb
+
+
+
+
+
\ No newline at end of file
diff --git a/Pilz.sln b/Pilz.sln
new file mode 100644
index 0000000..f366730
--- /dev/null
+++ b/Pilz.sln
@@ -0,0 +1,121 @@
+
+Microsoft Visual Studio Solution File, Format Version 12.00
+# Visual Studio 15
+VisualStudioVersion = 15.0.28307.329
+MinimumVisualStudioVersion = 10.0.40219.1
+Project("{F184B08F-C81C-45F6-A57F-5ABD9991F28F}") = "Pilz", "Pilz\Pilz.vbproj", "{277D2B83-7613-4C49-9CAB-E080195A6E0C}"
+EndProject
+Project("{F184B08F-C81C-45F6-A57F-5ABD9991F28F}") = "Pilz.Drawing", "Pilz.Drawing\Pilz.Drawing.vbproj", "{1A0B8106-2449-4908-B5E1-A00D8E9CF8F6}"
+EndProject
+Project("{F184B08F-C81C-45F6-A57F-5ABD9991F28F}") = "Pilz.UI", "Pilz.UI\Pilz.UI.vbproj", "{827C60BF-4D92-4D39-92F0-4285923266A1}"
+EndProject
+Project("{F184B08F-C81C-45F6-A57F-5ABD9991F28F}") = "Pilz.Collections", "Pilz.Collections\Pilz.Collections.vbproj", "{E4B2D294-8479-4014-942D-0B460E453DEA}"
+EndProject
+Project("{F184B08F-C81C-45F6-A57F-5ABD9991F28F}") = "Pilz.Threading", "Pilz.Threading\Pilz.Threading.vbproj", "{D9C8655E-4F1C-4348-A51C-AB00FD9A14BB}"
+EndProject
+Project("{F184B08F-C81C-45F6-A57F-5ABD9991F28F}") = "Pilz.IO", "Pilz.IO\Pilz.IO.vbproj", "{35591965-8339-41A2-8CD3-962ED54670AC}"
+EndProject
+Project("{F184B08F-C81C-45F6-A57F-5ABD9991F28F}") = "Pilz.Cryptography", "Pilz.Cryptography\Pilz.Cryptography.vbproj", "{DF980F5D-820C-4CD3-A865-C40791BF7CE4}"
+EndProject
+Project("{F184B08F-C81C-45F6-A57F-5ABD9991F28F}") = "Pilz.Win32", "Pilz.Win32\Pilz.Win32.vbproj", "{0BE0428D-AC97-4812-ADFC-6D7D00AEE497}"
+EndProject
+Project("{F184B08F-C81C-45F6-A57F-5ABD9991F28F}") = "Pilz.Configuration", "Pilz.Configuration\Pilz.Configuration.vbproj", "{A56C6153-C61F-4B10-BE06-35EB0448CFDC}"
+EndProject
+Project("{F184B08F-C81C-45F6-A57F-5ABD9991F28F}") = "Pilz.Reflection.PluginSystem", "Pilz.Reflection.PluginSystem\Pilz.Reflection.PluginSystem.vbproj", "{F7975470-4CA3-4FAB-BB6A-A3AF3978ABB7}"
+EndProject
+Global
+ GlobalSection(SolutionConfigurationPlatforms) = preSolution
+ Debug|Any CPU = Debug|Any CPU
+ Debug|x86 = Debug|x86
+ Release|Any CPU = Release|Any CPU
+ Release|x86 = Release|x86
+ EndGlobalSection
+ GlobalSection(ProjectConfigurationPlatforms) = postSolution
+ {277D2B83-7613-4C49-9CAB-E080195A6E0C}.Debug|Any CPU.ActiveCfg = Debug|Any CPU
+ {277D2B83-7613-4C49-9CAB-E080195A6E0C}.Debug|Any CPU.Build.0 = Debug|Any CPU
+ {277D2B83-7613-4C49-9CAB-E080195A6E0C}.Debug|x86.ActiveCfg = Debug|Any CPU
+ {277D2B83-7613-4C49-9CAB-E080195A6E0C}.Debug|x86.Build.0 = Debug|Any CPU
+ {277D2B83-7613-4C49-9CAB-E080195A6E0C}.Release|Any CPU.ActiveCfg = Release|Any CPU
+ {277D2B83-7613-4C49-9CAB-E080195A6E0C}.Release|Any CPU.Build.0 = Release|Any CPU
+ {277D2B83-7613-4C49-9CAB-E080195A6E0C}.Release|x86.ActiveCfg = Release|Any CPU
+ {277D2B83-7613-4C49-9CAB-E080195A6E0C}.Release|x86.Build.0 = Release|Any CPU
+ {1A0B8106-2449-4908-B5E1-A00D8E9CF8F6}.Debug|Any CPU.ActiveCfg = Debug|Any CPU
+ {1A0B8106-2449-4908-B5E1-A00D8E9CF8F6}.Debug|Any CPU.Build.0 = Debug|Any CPU
+ {1A0B8106-2449-4908-B5E1-A00D8E9CF8F6}.Debug|x86.ActiveCfg = Debug|Any CPU
+ {1A0B8106-2449-4908-B5E1-A00D8E9CF8F6}.Debug|x86.Build.0 = Debug|Any CPU
+ {1A0B8106-2449-4908-B5E1-A00D8E9CF8F6}.Release|Any CPU.ActiveCfg = Release|Any CPU
+ {1A0B8106-2449-4908-B5E1-A00D8E9CF8F6}.Release|Any CPU.Build.0 = Release|Any CPU
+ {1A0B8106-2449-4908-B5E1-A00D8E9CF8F6}.Release|x86.ActiveCfg = Release|Any CPU
+ {1A0B8106-2449-4908-B5E1-A00D8E9CF8F6}.Release|x86.Build.0 = Release|Any CPU
+ {827C60BF-4D92-4D39-92F0-4285923266A1}.Debug|Any CPU.ActiveCfg = Debug|Any CPU
+ {827C60BF-4D92-4D39-92F0-4285923266A1}.Debug|Any CPU.Build.0 = Debug|Any CPU
+ {827C60BF-4D92-4D39-92F0-4285923266A1}.Debug|x86.ActiveCfg = Debug|x86
+ {827C60BF-4D92-4D39-92F0-4285923266A1}.Debug|x86.Build.0 = Debug|x86
+ {827C60BF-4D92-4D39-92F0-4285923266A1}.Release|Any CPU.ActiveCfg = Release|Any CPU
+ {827C60BF-4D92-4D39-92F0-4285923266A1}.Release|Any CPU.Build.0 = Release|Any CPU
+ {827C60BF-4D92-4D39-92F0-4285923266A1}.Release|x86.ActiveCfg = Release|x86
+ {827C60BF-4D92-4D39-92F0-4285923266A1}.Release|x86.Build.0 = Release|x86
+ {E4B2D294-8479-4014-942D-0B460E453DEA}.Debug|Any CPU.ActiveCfg = Debug|Any CPU
+ {E4B2D294-8479-4014-942D-0B460E453DEA}.Debug|Any CPU.Build.0 = Debug|Any CPU
+ {E4B2D294-8479-4014-942D-0B460E453DEA}.Debug|x86.ActiveCfg = Debug|x86
+ {E4B2D294-8479-4014-942D-0B460E453DEA}.Debug|x86.Build.0 = Debug|x86
+ {E4B2D294-8479-4014-942D-0B460E453DEA}.Release|Any CPU.ActiveCfg = Release|Any CPU
+ {E4B2D294-8479-4014-942D-0B460E453DEA}.Release|Any CPU.Build.0 = Release|Any CPU
+ {E4B2D294-8479-4014-942D-0B460E453DEA}.Release|x86.ActiveCfg = Release|x86
+ {E4B2D294-8479-4014-942D-0B460E453DEA}.Release|x86.Build.0 = Release|x86
+ {D9C8655E-4F1C-4348-A51C-AB00FD9A14BB}.Debug|Any CPU.ActiveCfg = Debug|Any CPU
+ {D9C8655E-4F1C-4348-A51C-AB00FD9A14BB}.Debug|Any CPU.Build.0 = Debug|Any CPU
+ {D9C8655E-4F1C-4348-A51C-AB00FD9A14BB}.Debug|x86.ActiveCfg = Debug|x86
+ {D9C8655E-4F1C-4348-A51C-AB00FD9A14BB}.Debug|x86.Build.0 = Debug|x86
+ {D9C8655E-4F1C-4348-A51C-AB00FD9A14BB}.Release|Any CPU.ActiveCfg = Release|Any CPU
+ {D9C8655E-4F1C-4348-A51C-AB00FD9A14BB}.Release|Any CPU.Build.0 = Release|Any CPU
+ {D9C8655E-4F1C-4348-A51C-AB00FD9A14BB}.Release|x86.ActiveCfg = Release|x86
+ {D9C8655E-4F1C-4348-A51C-AB00FD9A14BB}.Release|x86.Build.0 = Release|x86
+ {35591965-8339-41A2-8CD3-962ED54670AC}.Debug|Any CPU.ActiveCfg = Debug|Any CPU
+ {35591965-8339-41A2-8CD3-962ED54670AC}.Debug|Any CPU.Build.0 = Debug|Any CPU
+ {35591965-8339-41A2-8CD3-962ED54670AC}.Debug|x86.ActiveCfg = Debug|x86
+ {35591965-8339-41A2-8CD3-962ED54670AC}.Debug|x86.Build.0 = Debug|x86
+ {35591965-8339-41A2-8CD3-962ED54670AC}.Release|Any CPU.ActiveCfg = Release|Any CPU
+ {35591965-8339-41A2-8CD3-962ED54670AC}.Release|Any CPU.Build.0 = Release|Any CPU
+ {35591965-8339-41A2-8CD3-962ED54670AC}.Release|x86.ActiveCfg = Release|x86
+ {35591965-8339-41A2-8CD3-962ED54670AC}.Release|x86.Build.0 = Release|x86
+ {DF980F5D-820C-4CD3-A865-C40791BF7CE4}.Debug|Any CPU.ActiveCfg = Debug|Any CPU
+ {DF980F5D-820C-4CD3-A865-C40791BF7CE4}.Debug|Any CPU.Build.0 = Debug|Any CPU
+ {DF980F5D-820C-4CD3-A865-C40791BF7CE4}.Debug|x86.ActiveCfg = Debug|Any CPU
+ {DF980F5D-820C-4CD3-A865-C40791BF7CE4}.Debug|x86.Build.0 = Debug|Any CPU
+ {DF980F5D-820C-4CD3-A865-C40791BF7CE4}.Release|Any CPU.ActiveCfg = Release|Any CPU
+ {DF980F5D-820C-4CD3-A865-C40791BF7CE4}.Release|Any CPU.Build.0 = Release|Any CPU
+ {DF980F5D-820C-4CD3-A865-C40791BF7CE4}.Release|x86.ActiveCfg = Release|Any CPU
+ {DF980F5D-820C-4CD3-A865-C40791BF7CE4}.Release|x86.Build.0 = Release|Any CPU
+ {0BE0428D-AC97-4812-ADFC-6D7D00AEE497}.Debug|Any CPU.ActiveCfg = Debug|Any CPU
+ {0BE0428D-AC97-4812-ADFC-6D7D00AEE497}.Debug|Any CPU.Build.0 = Debug|Any CPU
+ {0BE0428D-AC97-4812-ADFC-6D7D00AEE497}.Debug|x86.ActiveCfg = Debug|Any CPU
+ {0BE0428D-AC97-4812-ADFC-6D7D00AEE497}.Debug|x86.Build.0 = Debug|Any CPU
+ {0BE0428D-AC97-4812-ADFC-6D7D00AEE497}.Release|Any CPU.ActiveCfg = Release|Any CPU
+ {0BE0428D-AC97-4812-ADFC-6D7D00AEE497}.Release|Any CPU.Build.0 = Release|Any CPU
+ {0BE0428D-AC97-4812-ADFC-6D7D00AEE497}.Release|x86.ActiveCfg = Release|Any CPU
+ {0BE0428D-AC97-4812-ADFC-6D7D00AEE497}.Release|x86.Build.0 = Release|Any CPU
+ {A56C6153-C61F-4B10-BE06-35EB0448CFDC}.Debug|Any CPU.ActiveCfg = Debug|Any CPU
+ {A56C6153-C61F-4B10-BE06-35EB0448CFDC}.Debug|Any CPU.Build.0 = Debug|Any CPU
+ {A56C6153-C61F-4B10-BE06-35EB0448CFDC}.Debug|x86.ActiveCfg = Debug|Any CPU
+ {A56C6153-C61F-4B10-BE06-35EB0448CFDC}.Debug|x86.Build.0 = Debug|Any CPU
+ {A56C6153-C61F-4B10-BE06-35EB0448CFDC}.Release|Any CPU.ActiveCfg = Release|Any CPU
+ {A56C6153-C61F-4B10-BE06-35EB0448CFDC}.Release|Any CPU.Build.0 = Release|Any CPU
+ {A56C6153-C61F-4B10-BE06-35EB0448CFDC}.Release|x86.ActiveCfg = Release|Any CPU
+ {A56C6153-C61F-4B10-BE06-35EB0448CFDC}.Release|x86.Build.0 = Release|Any CPU
+ {F7975470-4CA3-4FAB-BB6A-A3AF3978ABB7}.Debug|Any CPU.ActiveCfg = Debug|Any CPU
+ {F7975470-4CA3-4FAB-BB6A-A3AF3978ABB7}.Debug|Any CPU.Build.0 = Debug|Any CPU
+ {F7975470-4CA3-4FAB-BB6A-A3AF3978ABB7}.Debug|x86.ActiveCfg = Debug|Any CPU
+ {F7975470-4CA3-4FAB-BB6A-A3AF3978ABB7}.Debug|x86.Build.0 = Debug|Any CPU
+ {F7975470-4CA3-4FAB-BB6A-A3AF3978ABB7}.Release|Any CPU.ActiveCfg = Release|Any CPU
+ {F7975470-4CA3-4FAB-BB6A-A3AF3978ABB7}.Release|Any CPU.Build.0 = Release|Any CPU
+ {F7975470-4CA3-4FAB-BB6A-A3AF3978ABB7}.Release|x86.ActiveCfg = Release|Any CPU
+ {F7975470-4CA3-4FAB-BB6A-A3AF3978ABB7}.Release|x86.Build.0 = Release|Any CPU
+ EndGlobalSection
+ GlobalSection(SolutionProperties) = preSolution
+ HideSolutionNode = FALSE
+ EndGlobalSection
+ GlobalSection(ExtensibilityGlobals) = postSolution
+ SolutionGuid = {728F13B2-34E5-46C6-BB39-3203EE238C2A}
+ EndGlobalSection
+EndGlobal
diff --git a/Pilz/My Project/Application.Designer.vb b/Pilz/My Project/Application.Designer.vb
new file mode 100644
index 0000000..88dd01c
--- /dev/null
+++ b/Pilz/My Project/Application.Designer.vb
@@ -0,0 +1,13 @@
+'------------------------------------------------------------------------------
+'
+' This code was generated by a tool.
+' Runtime Version:4.0.30319.42000
+'
+' Changes to this file may cause incorrect behavior and will be lost if
+' the code is regenerated.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
diff --git a/Pilz/My Project/Application.myapp b/Pilz/My Project/Application.myapp
new file mode 100644
index 0000000..758895d
--- /dev/null
+++ b/Pilz/My Project/Application.myapp
@@ -0,0 +1,10 @@
+
+
+ false
+ false
+ 0
+ true
+ 0
+ 1
+ true
+
diff --git a/Pilz/My Project/AssemblyInfo.vb b/Pilz/My Project/AssemblyInfo.vb
new file mode 100644
index 0000000..900251e
--- /dev/null
+++ b/Pilz/My Project/AssemblyInfo.vb
@@ -0,0 +1,35 @@
+Imports System
+Imports System.Reflection
+Imports System.Runtime.InteropServices
+
+' Allgemeine Informationen über eine Assembly werden über die folgenden
+' Attribute gesteuert. Ändern Sie diese Attributwerte, um die Informationen zu ändern,
+' die einer Assembly zugeordnet sind.
+
+' Werte der Assemblyattribute überprüfen
+
+
+
+
+
+
+
+
+
+
+'Die folgende GUID bestimmt die ID der Typbibliothek, wenn dieses Projekt für COM verfügbar gemacht wird.
+
+
+' Versionsinformationen für eine Assembly bestehen aus den folgenden vier Werten:
+'
+' Hauptversion
+' Nebenversion
+' Buildnummer
+' Revision
+'
+' Sie können alle Werte angeben oder Standardwerte für die Build- und Revisionsnummern verwenden,
+' übernehmen, indem Sie "*" eingeben:
+'
+
+
+
diff --git a/Pilz/My Project/Resources.Designer.vb b/Pilz/My Project/Resources.Designer.vb
new file mode 100644
index 0000000..a205072
--- /dev/null
+++ b/Pilz/My Project/Resources.Designer.vb
@@ -0,0 +1,62 @@
+'------------------------------------------------------------------------------
+'
+' This code was generated by a tool.
+' Runtime Version:4.0.30319.42000
+'
+' Changes to this file may cause incorrect behavior and will be lost if
+' the code is regenerated.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
+
+Namespace My.Resources
+
+ 'This class was auto-generated by the StronglyTypedResourceBuilder
+ 'class via a tool like ResGen or Visual Studio.
+ 'To add or remove a member, edit your .ResX file then rerun ResGen
+ 'with the /str option, or rebuild your VS project.
+ '''
+ ''' A strongly-typed resource class, for looking up localized strings, etc.
+ '''
+ _
+ Friend Module Resources
+
+ Private resourceMan As Global.System.Resources.ResourceManager
+
+ Private resourceCulture As Global.System.Globalization.CultureInfo
+
+ '''
+ ''' Returns the cached ResourceManager instance used by this class.
+ '''
+ _
+ Friend ReadOnly Property ResourceManager() As Global.System.Resources.ResourceManager
+ Get
+ If Object.ReferenceEquals(resourceMan, Nothing) Then
+ Dim temp As Global.System.Resources.ResourceManager = New Global.System.Resources.ResourceManager("Pilz.Resources", GetType(Resources).Assembly)
+ resourceMan = temp
+ End If
+ Return resourceMan
+ End Get
+ End Property
+
+ '''
+ ''' Overrides the current thread's CurrentUICulture property for all
+ ''' resource lookups using this strongly typed resource class.
+ '''
+ _
+ Friend Property Culture() As Global.System.Globalization.CultureInfo
+ Get
+ Return resourceCulture
+ End Get
+ Set(ByVal value As Global.System.Globalization.CultureInfo)
+ resourceCulture = value
+ End Set
+ End Property
+ End Module
+End Namespace
diff --git a/Pilz/My Project/Resources.resx b/Pilz/My Project/Resources.resx
new file mode 100644
index 0000000..af7dbeb
--- /dev/null
+++ b/Pilz/My Project/Resources.resx
@@ -0,0 +1,117 @@
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ text/microsoft-resx
+
+
+ 2.0
+
+
+ System.Resources.ResXResourceReader, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089
+
+
+ System.Resources.ResXResourceWriter, System.Windows.Forms, Version=2.0.0.0, Culture=neutral, PublicKeyToken=b77a5c561934e089
+
+
\ No newline at end of file
diff --git a/Pilz/My Project/Settings.Designer.vb b/Pilz/My Project/Settings.Designer.vb
new file mode 100644
index 0000000..e6de5b2
--- /dev/null
+++ b/Pilz/My Project/Settings.Designer.vb
@@ -0,0 +1,73 @@
+'------------------------------------------------------------------------------
+'
+' This code was generated by a tool.
+' Runtime Version:4.0.30319.42000
+'
+' Changes to this file may cause incorrect behavior and will be lost if
+' the code is regenerated.
+'
+'------------------------------------------------------------------------------
+
+Option Strict On
+Option Explicit On
+
+
+Namespace My
+
+ _
+ Partial Friend NotInheritable Class MySettings
+ Inherits Global.System.Configuration.ApplicationSettingsBase
+
+ Private Shared defaultInstance As MySettings = CType(Global.System.Configuration.ApplicationSettingsBase.Synchronized(New MySettings), MySettings)
+
+#Region "My.Settings Auto-Save Functionality"
+#If _MyType = "WindowsForms" Then
+ Private Shared addedHandler As Boolean
+
+ Private Shared addedHandlerLockObject As New Object
+
+ _
+ Private Shared Sub AutoSaveSettings(ByVal sender As Global.System.Object, ByVal e As Global.System.EventArgs)
+ If My.Application.SaveMySettingsOnExit Then
+ My.Settings.Save()
+ End If
+ End Sub
+#End If
+#End Region
+
+ Public Shared ReadOnly Property [Default]() As MySettings
+ Get
+
+#If _MyType = "WindowsForms" Then
+ If Not addedHandler Then
+ SyncLock addedHandlerLockObject
+ If Not addedHandler Then
+ AddHandler My.Application.Shutdown, AddressOf AutoSaveSettings
+ addedHandler = True
+ End If
+ End SyncLock
+ End If
+#End If
+ Return defaultInstance
+ End Get
+ End Property
+ End Class
+End Namespace
+
+Namespace My
+
+ _
+ Friend Module MySettingsProperty
+
+ _
+ Friend ReadOnly Property Settings() As Global.Pilz.My.MySettings
+ Get
+ Return Global.Pilz.My.MySettings.Default
+ End Get
+ End Property
+ End Module
+End Namespace
diff --git a/Pilz/My Project/Settings.settings b/Pilz/My Project/Settings.settings
new file mode 100644
index 0000000..85b890b
--- /dev/null
+++ b/Pilz/My Project/Settings.settings
@@ -0,0 +1,7 @@
+
+
+
+
+
+
+
diff --git a/Pilz/Pilz.vbproj b/Pilz/Pilz.vbproj
new file mode 100644
index 0000000..d0f8cda
--- /dev/null
+++ b/Pilz/Pilz.vbproj
@@ -0,0 +1,103 @@
+
+
+
+
+ Debug
+ AnyCPU
+ {277D2B83-7613-4C49-9CAB-E080195A6E0C}
+ Library
+ Pilz
+ Pilz
+ 512
+ Windows
+ v4.5
+ true
+
+
+ true
+ full
+ true
+ true
+ bin\Debug\
+ Pilz.xml
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+
+
+ pdbonly
+ false
+ true
+ true
+ bin\Release\
+ Pilz.xml
+ 42016,41999,42017,42018,42019,42032,42036,42020,42021,42022
+
+
+ On
+
+
+ Binary
+
+
+ Off
+
+
+ On
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+ True
+ Application.myapp
+
+
+ True
+ True
+ Resources.resx
+
+
+ True
+ Settings.settings
+ True
+
+
+
+
+ VbMyResourcesResXFileCodeGenerator
+ Resources.Designer.vb
+ My.Resources
+ Designer
+
+
+
+
+ MyApplicationCodeGenerator
+ Application.Designer.vb
+
+
+ SettingsSingleFileGenerator
+ My
+ Settings.Designer.vb
+
+
+
+
\ No newline at end of file